3,3',4,4'-tetrachlorobiphenyl - Ontology Report - Rat Genome Database

Submit Data | Help | Video Tutorials | News | Publications | Download | REST API | Citing RGD | Contact

CHEBI ONTOLOGY - ANNOTATIONS

{{ watchLinkText }}

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:	3,3',4,4'-tetrachlorobiphenyl	go back to main search page
Accession:	CHEBI:1367	browse the term
Definition:	A tetrachlorobiphenyl that is biphenyl in which the hydrogens at position 3 and 4 on each phenyl group are replaced by chlorines.
Synonyms:	exact_synonym:	3,3',4,4'-tetrachloro-1,1'-biphenyl
	related_synonym:	3,4,3',4'-Tetra coplanar polychlorinated biphenyl; Formula=C12H6Cl4; InChI=1S/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H; InChIKey=UQMGJOKDKOLIDP-UHFFFAOYSA-N; PCB 77; SMILES=Clc1ccc(cc1Cl)-c1ccc(Cl)c(Cl)c1
	xref:	Beilstein:2051251; CAS:32598-13-3; KEGG:C11057
	xref_mesh:	MESH:C028451

show annotations for term's descendants Sort by:
Rat (448) Mouse (460) Human (448) Chinchilla (0) Bonobo (0) Dog (0) Squirrel (0) Pig (10) Green Monkey (0) Naked Mole-rat (0) All
Genes (448)

3,3',4,4'-tetrachlorobiphenyl

term browser

Symbol

Object Name

Qualifiers

Evidence

Notes

Source

PubMed Reference(s)

RGD Reference(s)

Position

G

ATP binding cassette subfamily B member 1A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ABCB1A mRNA]

NCBI chr 4:25,357,467...25,529,941
Ensembl chr 4:25,158,362...25,442,709

G

ATP binding cassette subfamily D member 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ABCD4 mRNA]

NCBI chr 6:104,246,459...104,260,965
Ensembl chr 6:104,246,468...104,280,276

G

abhydrolase domain containing 13

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ABHD13 mRNA]

NCBI chr16:79,501,879...79,516,712
Ensembl chr16:79,501,727...79,516,748

G

abhydrolase domain containing 6, acylglycerol lipase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ABHD6 mRNA]

NCBI chr15:16,859,740...16,907,094
Ensembl chr15:16,859,738...16,906,985

G

acetyl-CoA acyltransferase 1A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACAA1A mRNA]

NCBI chr 8:119,079,401...119,088,626
Ensembl chr 8:119,079,775...119,088,624

G

acyl-CoA dehydrogenase family, member 11

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACAD11 mRNA]

NCBI chr 8:104,681,346...104,746,559
Ensembl chr 8:104,681,396...104,746,560

G

acyl-CoA dehydrogenase, long chain

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACADL mRNA]

NCBI chr 9:68,333,981...68,372,149
Ensembl chr 9:68,333,980...68,372,220

G

acyl-CoA dehydrogenase medium chain

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACADM mRNA]

NCBI chr 2:242,858,865...242,883,036
Ensembl chr 2:242,858,865...242,883,147

G

acyl-CoA thioesterase 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACOT3 mRNA]

NCBI chr 6:103,682,518...103,688,735
Ensembl chr 6:103,682,596...103,688,427
Ensembl chr 6:103,682,596...103,688,427

G

acyl-CoA synthetase long-chain family member 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACSL1 mRNA]

NCBI chr16:45,755,246...45,821,541
Ensembl chr16:45,755,254...45,821,541

G

acyl-CoA synthetase medium-chain family member 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACSM3 mRNA]

NCBI chr 1:174,133,260...174,159,966
Ensembl chr 1:174,133,288...174,160,184

G

acyl-CoA synthetase medium-chain family member 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ACSM5 mRNA]

NCBI chr 1:173,870,873...173,896,838
Ensembl chr 1:173,863,041...173,898,588

G

actin alpha 2, smooth muscle

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of ACTA2 mRNA

NCBI chr 1:231,746,527...231,759,307
Ensembl chr 1:231,746,548...231,759,554

G

ArfGAP with dual PH domains 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ADAP2 mRNA]

NCBI chr10:65,138,006...65,166,147
Ensembl chr10:65,138,020...65,165,604

G

adenylate cyclase 6

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ADCY6 mRNA]

NCBI chr 7:129,742,827...129,763,922
Ensembl chr 7:129,742,838...129,763,754

G

adhesion G protein-coupled receptor G2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ADGRG2 mRNA]

NCBI chr X:34,297,402...34,422,590
Ensembl chr X:34,297,402...34,422,609

G

adiponectin, C1Q and collagen domain containing

decreases expression

3,4,3',4'-tetrachlorobiphenyl results in decreased expression of ADIPOQ mRNA

NCBI chr11:77,721,912...77,735,644
Ensembl chr11:77,721,912...77,735,564

G

adenylosuccinate synthase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ADSS1 mRNA]

NCBI chr 6:131,679,795...131,702,012
Ensembl chr 6:131,679,701...131,701,998

G

AFG3 like matrix AAA peptidase subunit 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AFG3L2 mRNA]

NCBI chr18:60,954,268...60,999,110
Ensembl chr18:60,954,268...60,999,110

G

angiotensinogen

increases expression
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased expression of AGT mRNA
3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AGT mRNA]

PMID:19467301 PMID:21925196

NCBI chr19:52,529,139...52,549,618
Ensembl chr19:52,529,185...52,540,977

G

angiotensin II receptor, type 1a

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of AGTR1 mRNA

NCBI chr17:34,173,446...34,226,892
Ensembl chr17:34,174,429...34,226,946

G

aryl hydrocarbon receptor

affects binding
increases activity
multiple interactions
affects response to substance

3,4,3',4'-tetrachlorobiphenyl binds to AHR protein
3,4,3',4'-tetrachlorobiphenyl results in increased activity of AHR protein
3,4,3',4'-tetrachlorobiphenyl binds to and affects the localization of AHR protein; 3,4,3',4'-tetrachlorobiphenyl binds to and results in increased activity of AHR protein; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [AHR protein results in increased expression of CYP1A2]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [CAV1 protein binds to AHR protein]; [3,4,3',4'-tetrachlorobiphenyl binds to and affects the localization of AHR protein] which results in increased expression of CYP1A1 mRNA; [3,4,3',4'-tetrachlorobiphenyl co-treated with 3,4,5,3',4'-pentachlorobiphenyl co-treated with 3,4,5,3',4',5'-hexachlorobiphenyl co-treated with 2,3,3',4,4'-pentachlorobiphenyl co-treated with 2,3',4,4',5-pentachlorobiphenyl co-treated with 2,2',3',4,4',5-hexachlorobiphenyl co-treated with 2,4,5,2',4',5'-hexachlorobiphenyl co-treated with PCB 180] promotes the reaction [AHR protein results in increased expression of CYP1A2 mRNA]; [AHR protein co-treated with CYP1A2 protein] affects the susceptibility to [3,4,3',4'-tetrachlorobiphenyl co-treated with 3,4,5,3',4'-pentachlorobiphenyl co-treated with 3,4,5,3',4',5'-hexachlorobiphenyl co-treated with 2,3,3',4,4'-pentachlorobiphenyl co-treated with 2,3',4,4',5-pentachlorobiphenyl co-treated with 2,2',3',4,4',5-hexachlorobiphenyl co-treated with 2,4,5,2',4',5'-hexachlorobiphenyl co-treated with PCB 180]; AHR protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 mRNA]; AHR protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of TNF mRNA]
3,4,3',4'-tetrachlorobiphenyl binds to and results in increased activity of AHR protein; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [AHR protein binds to CYP1A1 promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [AHR protein results in increased expression of CYP1A1 mRNA]; 3,4,3',4'-tetrachlorobiphenyl results in increased activity of [AHR protein binds to ARNT protein]; AHR protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [INS protein results in decreased abundance of Blood Glucose]]; resveratrol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]]
AHR affects the susceptibility to 3,4,3',4'-tetrachlorobiphenyl; AHR mRNA affects the susceptibility to 3,4,3',4'-tetrachlorobiphenyl
2-methyl-2H-pyrazole-3-carboxylic acid (2-methyl-4-o-tolylazophenyl)amide inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl binds to and results in increased activity of AHR protein]; 3,4,3',4'-tetrachlorobiphenyl binds to and results in increased activity of AHR protein; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [Tetrachlorodibenzodioxin results in increased activity of AHR protein]; Resveratrol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]]

PMID:10448124 PMID:11294989 PMID:11339718 PMID:12117779 PMID:12628580 More...

NCBI chr 6:52,234,089...52,271,568
Ensembl chr 6:52,234,089...52,271,568

G

apoptosis inducing factor, mitochondria associated 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AIFM2 mRNA]

NCBI chr20:29,654,283...29,679,239
Ensembl chr20:29,652,927...29,679,236

G

adenylate kinase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AK2 mRNA]

NCBI chr 5:141,308,650...141,364,633
Ensembl chr 5:141,346,063...141,364,632

G

adenylate kinase 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AK4 mRNA]

NCBI chr 5:116,039,222...116,099,064
Ensembl chr 5:116,039,616...116,098,618

G

A-kinase anchoring protein 13

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of AKAP13 mRNA

NCBI chr 1:129,313,183...129,619,647
Ensembl chr 1:129,314,402...129,619,646

G

A-kinase anchoring protein 8

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AKAP8 mRNA]

NCBI chr 7:11,316,224...11,332,523
Ensembl chr 7:11,316,228...11,332,399

G

aldo-keto reductase family 1, member C1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AKR1C6 mRNA]

NCBI chr17:65,810,474...65,837,385
Ensembl chr17:65,810,475...65,837,326

G

5'-aminolevulinate synthase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ALAS1 mRNA]

NCBI chr 8:106,876,514...106,889,917
Ensembl chr 8:106,876,514...106,889,917

G

aldehyde dehydrogenase 3 family, member A2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ALDH3A2 mRNA]

NCBI chr10:45,928,313...45,949,366
Ensembl chr10:45,908,524...45,949,281

G

antagonist of mitotic exit network 1 homolog

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AMN1 mRNA]

NCBI chr 4:182,155,140...182,182,085
Ensembl chr 4:182,155,142...182,182,016

G

ankyrin repeat domain 12

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ANKRD12 mRNA]

NCBI chr 9:105,583,273...105,687,957
Ensembl chr 9:105,584,065...105,687,911

G

ankyrin repeat domain 17

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ANKRD17 mRNA]

NCBI chr14:17,723,239...17,861,841
Ensembl chr14:17,721,932...17,862,617

G

ankyrin repeat domain 28

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ANKRD28 mRNA]

NCBI chr16:6,918,487...7,050,244
Ensembl chr16:6,914,336...7,050,249

G

alanyl aminopeptidase, membrane

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ANPEP mRNA]

NCBI chr 1:133,767,332...133,810,137
Ensembl chr 1:133,767,332...133,785,789

G

apolipoprotein A5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of APOA5 mRNA]

NCBI chr 8:46,561,180...46,563,818
Ensembl chr 8:46,561,229...46,563,816

G

apolipoprotein L 7a like 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of APOL7A mRNA]

NCBI chr 7:109,118,559...109,149,798
Ensembl chr 7:109,131,064...109,147,649

G

aprataxin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of APTX mRNA]

NCBI chr 5:55,798,896...55,822,963
Ensembl chr 5:55,800,248...55,822,855

G

aquaporin 11

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AQP11 mRNA]

NCBI chr 1:152,046,515...152,056,675
Ensembl chr 1:152,046,517...152,056,725

G

aquaporin 3 (Gill blood group)

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of AQP3 mRNA

NCBI chr 5:56,239,200...56,244,718
Ensembl chr 5:56,239,201...56,244,720

G

aquaporin 4

multiple interactions
affects expression

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of AQP4 mRNA]
3,4,3',4'-tetrachlorobiphenyl affects the expression of AQP4 mRNA

PMID:19467301 PMID:20638727

NCBI chr18:6,507,903...6,524,558
Ensembl chr18:6,507,903...6,524,856

G

androgen receptor

multiple interactions

[aroclor 1260 co-treated with Chlorodiphenyl (54% Chlorine) co-treated with 2,4,4'-trichlorobiphenyl co-treated with 2,4,2',4'-tetrachlorobiphenyl co-treated with 3,4,5,3',4'-pentachlorobiphenyl co-treated with 3,4,3',4'-tetrachlorobiphenyl] inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]

NCBI chr X:63,104,771...63,273,934
Ensembl chr X:63,104,771...63,273,925

G

Rho GTPase activating protein 21

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ARHGAP21 mRNA]

NCBI chr17:83,348,673...83,472,202
Ensembl chr17:83,348,673...83,472,444

G

ariadne RBR E3 ubiquitin protein ligase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ARIH2 mRNA]

NCBI chr 8:109,296,738...109,355,909
Ensembl chr 8:109,296,738...109,355,852

G

aryl hydrocarbon receptor nuclear translocator

multiple interactions

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ARNT protein binds to CYP1A1 promoter]; 3,4,3',4'-tetrachlorobiphenyl results in increased activity of [AHR protein binds to ARNT protein]; resveratrol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]]
3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]; resveratrol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]]

PMID:11294989 PMID:16972788 PMID:18708364

NCBI chr 2:182,997,731...183,056,584
Ensembl chr 2:182,997,736...183,056,580

G

arylsulfatase A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ARSA mRNA]

NCBI chr 7:120,542,788...120,547,577
Ensembl chr 7:120,543,362...120,548,783

G

argininosuccinate lyase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ASL mRNA]

NCBI chr12:26,659,664...26,677,136
Ensembl chr12:26,659,565...26,679,662

G

asparagine synthetase (glutamine-hydrolyzing)

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of ASNS mRNA

NCBI chr 4:35,784,995...35,803,474
Ensembl chr 4:35,785,237...35,803,423

G

autophagy related 16-like 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ATG16L1 mRNA]

NCBI chr 9:88,420,737...88,457,530
Ensembl chr 9:88,422,038...88,457,529

G

atlastin GTPase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ATL2 mRNA]

NCBI chr 6:15,139,071...15,180,421
Ensembl chr 6:15,139,044...15,180,421

G

ATPase phospholipid transporting 11C

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ATP11C mRNA]

NCBI chr X:138,564,459...138,752,116
Ensembl chr X:138,565,836...138,751,204

G

ATPase H+ transporting V1 subunit E1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ATP6V1E1 mRNA]

NCBI chr 4:154,022,358...154,044,486
Ensembl chr 4:154,022,358...154,044,584

G

ataxin 10

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ATXN10 mRNA]

NCBI chr 7:116,441,768...116,565,093
Ensembl chr 7:116,441,613...116,565,087

G

BCL2 associated X, apoptosis regulator

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of BAX protein

NCBI chr 1:95,940,001...95,945,407
Ensembl chr 1:95,938,808...95,945,368

G

gamma-butyrobetaine hydroxylase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of BBOX1 mRNA]

NCBI chr 3:96,822,654...96,871,786
Ensembl chr 3:96,822,655...96,871,458

G

3-hydroxybutyrate dehydrogenase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of BDH1 mRNA]

NCBI chr11:69,302,534...69,343,173
Ensembl chr11:69,302,534...69,337,671

G

brain expressed X-linked 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of BEX2 mRNA

NCBI chr X:99,219,014...99,220,518
Ensembl chr X:99,219,014...99,220,958

G

BCL2 interacting protein 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of BNIP3 mRNA]

NCBI chr 1:193,708,164...193,725,348
Ensembl chr 1:193,708,167...193,725,359

G

BCL2 interacting protein 3 like

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of BNIP3L mRNA

NCBI chr15:41,174,594...41,197,730
Ensembl chr15:41,174,594...41,197,803

G

BRCA1/BRCA2-containing complex subunit 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of BRCC3 mRNA]

NCBI chr 9:1,986,942...1,989,484
Ensembl chr 9:1,986,575...1,991,080

G

basic transcription factor 3-like 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of BTF3L4 mRNA]

NCBI chr 5:123,567,902...123,587,527
Ensembl chr 5:123,567,907...123,586,866

G

complement C5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HC mRNA]

NCBI chr 3:18,270,696...18,361,994
Ensembl chr 3:18,270,696...18,361,994

G

complement C5a receptor 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of C5AR1 mRNA

NCBI chr 1:76,948,622...76,959,826

G

complement C8 alpha chain

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of C8A mRNA]

NCBI chr 5:119,583,168...119,637,675
Ensembl chr 5:119,583,174...119,637,754

G

calcium/calmodulin-dependent protein kinase II inhibitor 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CAMK2N1 mRNA]

NCBI chr 5:150,674,819...150,676,600
Ensembl chr 5:150,673,507...150,676,600

G

carbonic anhydrase 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CAR3 mRNA]

NCBI chr 2:86,770,418...86,780,011
Ensembl chr 2:86,770,420...86,784,280

G

carbonic anhydrase 5A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CAR5A mRNA]

NCBI chr19:49,973,092...50,002,948
Ensembl chr19:49,973,107...50,002,906

G

carbonic anhydrase 8

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CAR8 mRNA]

NCBI chr 5:21,302,940...21,402,395
Ensembl chr 5:21,305,383...21,402,374

G

caspase 3

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of CASP3 protein

NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648

G

caveolin 1

multiple interactions
increases expression

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [CAV1 protein binds to AHR protein]; CAV1 mutant form inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of VCAM1 protein]; CAV1 mutant form inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased phosphorylation of and results in increased activity of MAPK1 protein]; CAV1 mutant form inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased phosphorylation of and results in increased activity of MAPK3 protein]; CAV1 protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 protein]
3,4,3',4'-tetrachlorobiphenyl results in increased expression of CAV1 protein

PMID:18786521 PMID:20406653

NCBI chr 4:45,640,624...45,673,708
Ensembl chr 4:45,634,918...45,673,705

G

C-C motif chemokine ligand 2

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of CCL2 mRNA

NCBI chr10:67,005,424...67,007,222
Ensembl chr10:67,005,424...67,007,226

G

cyclin B2

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of CCNB2 mRNA

NCBI chr 8:71,087,594...71,100,794
Ensembl chr 8:71,087,595...71,100,874

G

cyclin E1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CCNE1 mRNA]

NCBI chr 1:90,781,947...90,791,188
Ensembl chr 1:90,781,949...90,791,101

G

C-C motif chemokine receptor 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of CCR1 mRNA

NCBI chr 8:123,556,286...123,561,841

G

CD36 molecule

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of CD36 mRNA

NCBI chr 4:17,317,343...17,410,084
Ensembl chr 4:17,354,466...17,513,903

G

CD44 molecule

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of CD44 mRNA

NCBI chr 3:89,155,850...89,244,615
Ensembl chr 3:89,157,058...89,244,620

G

centromere protein A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CENPA mRNA]

NCBI chr 6:25,700,142...25,711,767
Ensembl chr 6:25,700,142...25,711,675

G

centrosomal protein 63

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CEP63 mRNA]

NCBI chr 8:103,162,639...103,214,177
Ensembl chr 8:103,162,700...103,214,177

G

carboxylesterase 3a

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CES3 mRNA]

NCBI chr19:32,992,386...33,000,562

G

complement factor H-related 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CFHR1 mRNA]

NCBI chr13:51,395,583...51,410,571
Ensembl chr13:51,369,211...51,410,592

G

coiled-coil-helix-coiled-coil-helix domain containing 10

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CHCHD10 mRNA]

NCBI chr20:12,725,839...12,727,638
Ensembl chr20:12,725,842...12,732,763

G

chimerin 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CHN2 mRNA]

NCBI chr 4:83,148,616...83,407,711
Ensembl chr 4:83,147,983...83,407,709

G

CAP-GLY domain containing linker protein 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CLIP1 mRNA]

NCBI chr12:32,910,932...33,017,891
Ensembl chr12:32,910,977...33,017,884

G

calmin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CLMN mRNA]

NCBI chr 6:123,707,710...123,807,283
Ensembl chr 6:123,713,507...123,807,272

G

CLN8, transmembrane ER and ERGIC protein

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CLN8 mRNA]

NCBI chr16:74,749,662...74,759,553
Ensembl chr16:74,749,662...74,759,774

G

clusterin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CLU mRNA]

NCBI chr15:40,161,068...40,200,315
Ensembl chr15:40,174,617...40,200,315

G

chondromodulin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CNMD mRNA]

NCBI chr15:55,041,548...55,066,297
Ensembl chr15:55,041,561...55,066,297

G

calponin 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CNN3 mRNA]

NCBI chr 2:209,518,948...209,550,107
Ensembl chr 2:209,518,948...209,550,104

G

cordon-bleu WH2 repeat protein-like 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of COBLL1 mRNA]

NCBI chr 3:49,753,260...49,915,168
Ensembl chr 3:49,753,262...49,915,194

G

collagen type III alpha 1 chain

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of COL3A1 mRNA

NCBI chr 9:47,374,611...47,410,547
Ensembl chr 9:47,374,593...47,410,547

G

coenzyme Q10B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of COQ10B mRNA]

NCBI chr 9:56,553,751...56,573,671
Ensembl chr 9:56,553,758...56,573,663

G

carnitine palmitoyltransferase 1A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CPT1A mRNA]

NCBI chr 1:200,564,634...200,627,059
Ensembl chr 1:200,565,613...200,627,055

G

C-reactive protein

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of CRP mRNA
3,4,3',4'-tetrachlorobiphenyl results in increased expression of CRP protein

PMID:26519613 PMID:30935970

NCBI chr13:85,135,384...85,175,178
Ensembl chr13:85,124,977...85,175,178

G

cryptochrome circadian regulator 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CRY2 mRNA]

NCBI chr 3:78,374,995...78,405,001
Ensembl chr 3:78,374,995...78,404,965

G

cysteine and glycine-rich protein 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CSRP2 mRNA]

NCBI chr 7:46,349,109...46,367,743
Ensembl chr 7:46,348,686...46,367,745

G

cathepsin H

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CTSH mRNA]

NCBI chr 8:90,608,941...90,627,824
Ensembl chr 8:90,608,941...90,627,824

G

cytochrome P450, family 11, subfamily b, polypeptide 2

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP11B1 mRNA

NCBI chr 7:106,838,590...106,845,004
Ensembl chr 7:106,838,590...106,845,004

G

cytochrome P450, family 11, subfamily b, polypeptide 3

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP11B2 mRNA

NCBI chr 7:106,808,559...106,814,048
Ensembl chr 7:106,808,559...106,814,048

G

cytochrome P450, family 1, subfamily a, polypeptide 1

multiple interactions
increases expression
affects expression
increases activity

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [AHR protein binds to CYP1A1 promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [AHR protein results in increased expression of CYP1A1 mRNA]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ARNT protein binds to CYP1A1 promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to CYP1A1 promoter]
3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 mRNA; 3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 protein
2,4,5,2',4',5'-hexachlorobiphenyl inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 mRNA]; [3,4,3',4'-tetrachlorobiphenyl binds to and affects the localization of AHR protein] which results in increased expression of CYP1A1 mRNA; AHR protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 mRNA]; alpha-naphthoflavone inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 mRNA]; CAV1 protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 protein]
3,4,3',4'-tetrachlorobiphenyl affects the expression of CYP1A1 mRNA
2,4,5,2',4',5'-hexachlorobiphenyl inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 protein]; 7-ketocholesterol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A1 protein]; [Tetrachlorodibenzodioxin co-treated with 3,4,3',4'-tetrachlorobiphenyl] results in increased expression of CYP1A1 protein
3,4,3',4'-tetrachlorobiphenyl results in increased activity of CYP1A1 protein

PMID:11339718 PMID:12117779 PMID:12505372 PMID:12628580 PMID:15352264 More...

NCBI chr 8:58,096,021...58,102,130
Ensembl chr 8:58,096,077...58,102,125

G

cytochrome P450, family 1, subfamily a, polypeptide 2

multiple interactions
increases expression
decreases response to substance

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [AHR protein results in increased expression of CYP1A2]; [3,4,3',4'-tetrachlorobiphenyl co-treated with 3,4,5,3',4'-pentachlorobiphenyl co-treated with 3,4,5,3',4',5'-hexachlorobiphenyl co-treated with 2,3,3',4,4'-pentachlorobiphenyl co-treated with 2,3',4,4',5-pentachlorobiphenyl co-treated with 2,2',3',4,4',5-hexachlorobiphenyl co-treated with 2,4,5,2',4',5'-hexachlorobiphenyl co-treated with PCB 180] promotes the reaction [AHR protein results in increased expression of CYP1A2 mRNA]; [AHR protein co-treated with CYP1A2 protein] affects the susceptibility to [3,4,3',4'-tetrachlorobiphenyl co-treated with 3,4,5,3',4'-pentachlorobiphenyl co-treated with 3,4,5,3',4',5'-hexachlorobiphenyl co-treated with 2,3,3',4,4'-pentachlorobiphenyl co-treated with 2,3',4,4',5-pentachlorobiphenyl co-treated with 2,2',3',4,4',5-hexachlorobiphenyl co-treated with 2,4,5,2',4',5'-hexachlorobiphenyl co-treated with PCB 180]
3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A2 protein
3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [CYP1A2 protein results in decreased methylation of 7-methoxyresorufin]
3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1A2 mRNA
CYP1A2 results in decreased susceptibility to 3,4,3',4'-tetrachlorobiphenyl

PMID:12117779 PMID:12635099 PMID:19467301 PMID:20961953 PMID:21571617 More...

NCBI chr 8:58,075,367...58,082,255
Ensembl chr 8:58,075,367...58,082,312

G

cytochrome P450, family 1, subfamily b, polypeptide 1

increases expression
increases response to substance

3,4,3',4'-tetrachlorobiphenyl results in increased expression of CYP1B1 mRNA
CYP1B1 protein results in increased susceptibility to 3,4,3',4'-tetrachlorobiphenyl

PMID:12117779 PMID:25654323 PMID:29738842 PMID:31733235

NCBI chr 6:15,342,312...15,350,886
Ensembl chr 6:15,342,344...15,350,917

G

cytochrome P450, family 27, subfamily a, polypeptide 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CYP27A1 mRNA]

NCBI chr 9:76,264,655...76,294,551
Ensembl chr 9:76,264,860...76,294,551

G

cytochrome P450 family 7 subfamily A member 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of CYP7A1 mRNA]

NCBI chr 5:19,376,979...19,386,676
Ensembl chr 5:19,376,974...19,386,688

G

D-box binding PAR bZIP transcription factor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DBP mRNA]

NCBI chr 1:96,175,796...96,180,745
Ensembl chr 1:96,175,440...96,180,745

G

DDB1 and CUL4 associated factor 11

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DCAF11 mRNA]

NCBI chr15:29,046,744...29,057,450
Ensembl chr15:29,046,826...29,057,669

G

doublecortin domain containing 2

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of DCDC2 mRNA

NCBI chr17:39,845,952...40,031,781
Ensembl chr17:39,845,952...40,030,743

G

defective in cullin neddylation 1 domain containing 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DCUN1D3 mRNA]

NCBI chr 1:174,243,001...174,285,647
Ensembl chr 1:66,494,848...66,496,343
Ensembl chr 1:66,494,848...66,496,343

G

DEAD-box helicase 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DDX5 mRNA]

NCBI chr10:91,723,508...91,732,210
Ensembl chr10:91,723,508...91,732,283

G

diacylglycerol O-acyltransferase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DGAT2 mRNA]

NCBI chr 1:153,454,078...153,484,432
Ensembl chr 1:153,454,080...153,484,428

G

dihydrofolate reductase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DHFR mRNA]

NCBI chr 2:23,585,876...23,611,199
Ensembl chr 2:23,586,031...23,613,713

G

dehydrogenase/reductase 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DHRS4 mRNA]

NCBI chr15:28,966,544...28,978,135
Ensembl chr15:28,966,553...28,978,127

G

distal-less homeobox 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DLX4 mRNA]

NCBI chr10:80,085,037...80,090,434
Ensembl chr10:80,085,465...80,090,456

G

dynein, axonemal, heavy chain 3

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of DNAH3 mRNA

NCBI chr 1:174,305,929...174,479,490
Ensembl chr 1:174,306,644...174,479,474

G

DnaJ heat shock protein family (Hsp40) member A2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DNAJA2 mRNA]

NCBI chr19:21,497,792...21,516,904
Ensembl chr19:21,497,729...21,516,901

G

DnaJ heat shock protein family (Hsp40) member B6

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DNAJB6 mRNA]

NCBI chr 4:5,452,683...5,556,679
Ensembl chr 4:5,452,683...5,556,659

G

DnaJ heat shock protein family (Hsp40) member B9

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of DNAJB9 mRNA

NCBI chr 6:61,270,385...61,276,795
Ensembl chr 6:61,269,913...61,275,063

G

DnaJ heat shock protein family (Hsp40) member C12

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of DNAJC12 mRNA

NCBI chr20:25,246,744...25,267,508
Ensembl chr20:25,223,144...25,267,521

G

deoxyribonuclease 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DNASE1 mRNA]

NCBI chr10:11,498,930...11,505,151
Ensembl chr10:11,498,931...11,501,869

G

dedicator of cytokinesis 9

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DOCK9 mRNA]

NCBI chr15:98,611,518...98,883,306
Ensembl chr15:98,618,084...98,883,153

G

dihydropyrimidinase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DPYS mRNA]

NCBI chr 7:70,822,648...70,929,255
Ensembl chr 7:70,835,789...70,929,231

G

desmocollin 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DSC2 mRNA]

NCBI chr18:11,450,392...11,482,476
Ensembl chr18:11,450,390...11,482,392

G

desmoglein 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of DSG2 mRNA]

NCBI chr18:11,846,207...11,904,630
Ensembl chr18:11,846,183...11,904,156

G

enoyl-CoA hydratase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ECH1 mRNA]

NCBI chr 1:84,114,494...84,120,788
Ensembl chr 1:84,112,751...84,120,795

G

estrogen-induced osteoclastogenesis regulator 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of EEIG1 mRNA]

NCBI chr 3:15,822,441...15,854,651
Ensembl chr 3:15,823,144...15,854,643

G

EF-hand domain family, member D2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of EFHD2 mRNA]

NCBI chr 5:154,160,945...154,176,980
Ensembl chr 5:154,160,946...154,176,980

G

eukaryotic translation initiation factor 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of EIF1 mRNA]

NCBI chr10:85,246,751...85,248,842
Ensembl chr10:85,246,764...85,427,327

G

eukaryotic translation initiation factor 1A, X-linked

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of EIF1AY mRNA]

NCBI chr X:35,498,698...35,513,402
Ensembl chr X:35,498,517...35,513,335

G

eukaryotic translation initiation factor 4E binding protein 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of EIF4EBP2 mRNA]

NCBI chr20:29,379,444...29,400,110
Ensembl chr20:29,382,668...29,399,946

G

elongation factor for RNA polymerase II 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ELL2 mRNA]

NCBI chr 2:5,189,375...5,258,781
Ensembl chr 2:5,189,971...5,258,781

G

energy homeostasis associated

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ENHO mRNA]

NCBI chr 5:56,800,980...56,802,777
Ensembl chr 5:56,800,980...56,802,777

G

ectonucleotide pyrophosphatase/phosphodiesterase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ENPP2 mRNA]

NCBI chr 7:86,202,345...86,325,050
Ensembl chr 7:86,202,350...86,324,827

G

endosomal transmembrane epsin interactor 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ENTREP1 mRNA]

NCBI chr 1:221,592,500...221,646,603
Ensembl chr 1:221,592,503...221,646,758

G

erythrocyte membrane protein band 4.1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of EPB41 mRNA]

NCBI chr 5:144,110,010...144,264,037
Ensembl chr 5:144,111,906...144,237,821

G

epoxide hydrolase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of EPHX2 mRNA]

NCBI chr15:40,289,901...40,327,632
Ensembl chr15:40,289,902...40,327,615

G

ELKS/RAB6-interacting/CAST family member 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ERC1 mRNA]

NCBI chr 4:152,763,664...153,055,724
Ensembl chr 4:152,767,419...153,055,639

G

estrogen receptor 1

multiple interactions
increases expression
affects binding

3,4,3',4'-tetrachlorobiphenyl binds to and results in increased activity of ESR1 protein; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to CYP1A1 promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to KDM4B intron]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to RELA promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to TFF1 promoter]; ESR1 protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of KDM4B mRNA]
3,4,3',4'-tetrachlorobiphenyl results in increased expression of ESR1 mRNA
3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ESR1 mRNA]
3,4,3',4'-tetrachlorobiphenyl binds to ESR1 protein

PMID:16293362 PMID:16972788 PMID:19467301 PMID:26519613

NCBI chr 1:41,106,335...41,499,104
Ensembl chr 1:41,210,475...41,495,002

G

coagulation factor V

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of F5 mRNA]

NCBI chr13:76,513,509...76,583,106
Ensembl chr13:76,513,255...76,582,317

G

family with sequence similarity 107, member A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FAM107A mRNA]

NCBI chr15:16,608,362...16,630,398
Ensembl chr15:16,607,205...16,630,396

G

family with sequence similarity 107, member B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FAM107B mRNA]

NCBI chr17:74,478,608...74,685,027
Ensembl chr17:74,478,608...74,684,989

G

FA complementation group E

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FANCE mRNA]

NCBI chr20:6,369,416...6,386,631
Ensembl chr20:6,375,573...6,386,631

G

fatty acid synthase

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of FASN mRNA

NCBI chr10:106,072,093...106,090,259
Ensembl chr10:106,072,091...106,090,261

G

F-box and leucine-rich repeat protein 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FBXL4 mRNA]

NCBI chr 5:35,955,801...36,029,446
Ensembl chr 5:35,955,812...36,029,443

G

Fc gamma binding protein

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of FCGBP mRNA

NCBI chr 1:83,374,979...83,413,082
Ensembl chr 1:83,372,127...83,413,083

G

Fc gamma receptor and transporter

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FCGRT mRNA]

NCBI chr 1:95,574,436...95,584,171
Ensembl chr 1:95,567,175...95,584,084

G

ferrochelatase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FECH mRNA]

NCBI chr18:57,945,123...57,978,327
Ensembl chr18:57,945,122...57,979,348

G

fibroblast growth factor 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FGF1 mRNA]

NCBI chr18:30,686,555...30,772,667
Ensembl chr18:30,686,581...30,772,357

G

FKBP prolyl isomerase 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FKBP5 mRNA]

NCBI chr20:6,457,207...6,575,404
Ensembl chr20:6,457,216...6,541,674

G

flavin containing dimethylaniline monoxygenase 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FMO5 mRNA]

NCBI chr 2:185,197,184...185,249,699
Ensembl chr 2:185,222,204...185,249,693

G

fructosamine 3 kinase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FN3K mRNA]

NCBI chr10:106,700,670...106,715,903
Ensembl chr10:106,700,670...106,715,895

G

folliculin interacting protein 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FNIP1 mRNA]

NCBI chr10:38,567,728...38,650,824
Ensembl chr10:38,567,729...38,650,824

G

forkhead box A3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FOXA3 mRNA]

NCBI chr 1:78,662,067...78,672,321
Ensembl chr 1:78,662,431...78,672,155

G

forkhead box O1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FOXO1 mRNA]

NCBI chr 2:136,312,168...136,390,603
Ensembl chr 2:136,312,168...136,387,790

G

forkhead box P2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of FOXP2 mRNA]

NCBI chr 4:43,133,827...43,712,442
Ensembl chr 4:43,133,912...43,711,683

G

GA binding protein transcription factor subunit alpha

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GABPA mRNA]

NCBI chr11:23,888,586...23,917,612
Ensembl chr11:23,888,815...23,917,605

G

glucosylceramidase beta 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GBA2 mRNA]

NCBI chr 5:57,822,389...57,834,522
Ensembl chr 5:57,822,389...57,834,072

G

guanine deaminase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GDA mRNA]

NCBI chr 1:218,903,045...218,982,360
Ensembl chr 1:218,906,815...218,982,416

G

growth differentiation factor 15

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of GDF15 mRNA

NCBI chr16:18,804,457...18,808,043
Ensembl chr16:18,805,239...18,808,055

G

GDP-L-fucose synthase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GFUS mRNA]

NCBI chr 7:107,612,087...107,617,005
Ensembl chr 7:107,612,094...107,616,948

G

GLI family zinc finger 2

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of GLI2 mRNA

NCBI chr13:29,946,882...30,163,589
Ensembl chr13:29,946,809...30,163,574

G

glutaredoxin

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of GLRX mRNA

NCBI chr 2:5,341,873...5,351,686
Ensembl chr 2:5,341,885...5,351,680

G

G protein subunit alpha 12

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GNA12 mRNA]

NCBI chr12:13,805,580...13,886,255
Ensembl chr12:13,805,698...13,886,255

G

glucosamine (UDP-N-acetyl)-2-epimerase/N-acetylmannosamine kinase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GNE mRNA]

NCBI chr 5:58,267,189...58,307,396
Ensembl chr 5:58,267,210...58,307,499

G

glycerol-3-phosphate acyltransferase 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GPAT4 mRNA]

NCBI chr16:68,819,031...68,852,903
Ensembl chr16:68,819,079...68,852,901

G

glycerol-3-phosphate dehydrogenase 1 like

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GPD1L mRNA]

NCBI chr 8:114,591,103...114,620,771
Ensembl chr 8:114,588,487...114,620,723

G

G protein-coupled receptor 155

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GPR155 mRNA]

NCBI chr 3:58,216,422...58,270,350
Ensembl chr 3:58,216,423...58,270,275

G

G protein-coupled receptor 61

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GPR61 mRNA]

NCBI chr 2:195,781,931...195,789,798
Ensembl chr 2:195,782,752...195,789,621

G

G-protein coupled receptor 65

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of GPR65 mRNA

NCBI chr 6:117,515,786...117,536,514
Ensembl chr 6:117,515,648...117,536,512

G

glutamic--pyruvic transaminase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GPT2 mRNA]

NCBI chr19:21,526,800...21,561,314
Ensembl chr19:21,517,621...21,560,610

G

glutathione peroxidase 1

decreases expression

3,4,3',4'-tetrachlorobiphenyl results in decreased expression of GPX1 mRNA

NCBI chr 8:109,026,905...109,028,031
Ensembl chr 8:109,026,905...109,028,024

G

general transcription factor IIH subunit 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GTF2H1 mRNA]

NCBI chr 1:97,321,417...97,349,455
Ensembl chr 1:97,321,394...97,349,455

G

guanylate kinase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of GUK1 mRNA]

NCBI chr10:43,971,514...43,988,658
Ensembl chr10:43,971,509...43,980,107

G

H2A.X variant histone

increases expression
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased expression of H2AX protein
2,4,3',5'-tetramethoxystilbene inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of H2AX protein]

NCBI chr 8:44,671,907...44,673,262
Ensembl chr 8:44,671,786...44,673,239

G

hydroxyacyl-CoA dehydrogenase trifunctional multienzyme complex subunit alpha

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HADHA mRNA]

NCBI chr 6:26,187,969...26,227,605
Ensembl chr 6:26,187,956...26,227,869

G

hydroxyacyl-CoA dehydrogenase trifunctional multienzyme complex subunit beta

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HADHB mRNA]

NCBI chr 6:26,153,572...26,187,668
Ensembl chr 6:26,153,578...26,184,869

G

hydroxyacyl glutathione hydrolase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HAGH mRNA]

NCBI chr10:13,874,883...13,889,527
Ensembl chr10:13,875,241...13,889,504

G

homocysteine inducible ER protein with ubiquitin like domain 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HERPUD1 mRNA]

NCBI chr19:10,598,411...10,609,002
Ensembl chr19:10,598,417...10,618,424

G

HLF transcription factor, PAR bZIP family member

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HLF mRNA]

NCBI chr10:75,154,244...75,211,884
Ensembl chr10:75,154,507...75,211,935

G

heterogeneous nuclear ribonucleoprotein K

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HNRNPK mRNA]

NCBI chr17:6,262,936...6,275,001
Ensembl chr17:6,262,998...6,274,997

G

homer scaffold protein 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HOMER2 mRNA]

NCBI chr 1:135,558,977...135,659,780
Ensembl chr 1:135,567,414...135,659,772

G

hepsin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HPN mRNA]

NCBI chr 1:86,337,085...86,352,785
Ensembl chr 1:86,337,087...86,352,811

G

heparan sulfate 6-O-sulfotransferase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HS6ST1 mRNA]

NCBI chr 9:38,283,502...38,322,684
Ensembl chr 9:38,282,395...38,322,683

G

hydroxysteroid 11-beta dehydrogenase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HSD11B1 mRNA]

NCBI chr13:104,728,539...104,798,884
Ensembl chr13:104,728,539...104,788,687

G

hydroxysteroid (17-beta) dehydrogenase 11

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HSD17B11 mRNA]

NCBI chr14:5,693,304...5,743,157
Ensembl chr14:5,711,964...5,743,161

G

heat shock protein family A (Hsp70) member 9

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HSPA9 mRNA]

NCBI chr18:26,536,131...26,554,294
Ensembl chr18:26,535,798...26,554,292

G

HECT, UBA and WWE domain containing E3 ubiquitin protein ligase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of HUWE1 mRNA]

NCBI chr X:20,873,795...21,001,378
Ensembl chr X:20,873,795...21,001,262

G

intercellular adhesion molecule 1

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of ICAM1 mRNA

NCBI chr 8:19,553,063...19,565,438
Ensembl chr 8:19,553,645...19,565,438

G

isocitrate dehydrogenase (NAD(+)) 3 catalytic subunit alpha

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IDH3A mRNA]

NCBI chr 8:54,971,694...54,991,085
Ensembl chr 8:54,971,740...54,991,084

G

intraflagellar transport 88

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of IFT88 mRNA

NCBI chr15:31,573,325...31,666,068
Ensembl chr15:31,573,376...31,672,147

G

insulin-like growth factor binding protein, acid labile subunit

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IGFALS mRNA]

NCBI chr10:13,897,468...13,903,920
Ensembl chr10:13,898,395...13,902,677

G

insulin-like growth factor binding protein 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IGFBP2 mRNA]

NCBI chr 9:74,415,574...74,442,945
Ensembl chr 9:74,415,546...74,442,937

G

insulin-like growth factor binding protein 3

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of IGFBP3 mRNA

NCBI chr14:82,056,347...82,064,083
Ensembl chr14:82,056,347...82,064,083

G

insulin-like growth factor binding protein 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IGFBP4 mRNA]

NCBI chr10:83,995,253...84,007,272
Ensembl chr10:83,989,591...84,007,225

G

interleukin 12 receptor subunit beta 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IL12RB1 mRNA]

NCBI chr16:18,620,228...18,633,207
Ensembl chr16:18,620,770...18,632,769

G

interleukin 1 alpha

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of IL1A mRNA

NCBI chr 3:116,526,601...116,537,055
Ensembl chr 3:116,526,604...116,536,822

G

interleukin 1 beta

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of IL1B mRNA

PMID:21925196 PMID:26519613

NCBI chr 3:116,577,005...116,583,386
Ensembl chr 3:116,577,010...116,583,415

G

interleukin 1 receptor accessory protein

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IL1RAP mRNA]

NCBI chr11:74,062,999...74,199,530
Ensembl chr11:74,070,304...74,199,530

G

interleukin 6

increases expression
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased expression of IL6 mRNA; 3,4,3',4'-tetrachlorobiphenyl results in increased expression of IL6 protein
KDM4B protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of IL6 mRNA]

PMID:23099484 PMID:26519613 PMID:30935970

NCBI chr 4:5,214,602...5,219,178
Ensembl chr 4:5,213,394...5,219,178

G

interleukin 6 receptor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IL6RA mRNA]

NCBI chr 2:175,289,157...175,347,719
Ensembl chr 2:175,298,686...175,347,536

G

immunoglobulin-like domain containing receptor 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ILDR2 mRNA]

NCBI chr13:78,518,770...78,580,627
Ensembl chr13:78,518,802...78,576,924

G

inverted formin 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of INF2 mRNA]

NCBI chr 6:131,649,162...131,675,944
Ensembl chr 6:131,649,211...131,675,941

G

insulin 2

multiple interactions
decreases response to substance

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [INS protein results in decreased abundance of Blood Glucose]; AHR protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [INS protein results in decreased abundance of Blood Glucose]]
3,4,3',4'-tetrachlorobiphenyl results in decreased susceptibility to INS protein
3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [INS protein results in increased uptake of Glucose]; resveratrol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [INS protein results in increased uptake of Glucose]]; resveratrol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in decreased susceptibility to INS protein]

PMID:24231106 PMID:25734695

NCBI chr 1:197,843,277...197,992,522
Ensembl chr 1:197,843,281...197,864,775

G

insulin receptor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of INSR mRNA]

NCBI chr12:1,193,193...1,330,976
Ensembl chr12:1,197,100...1,330,883

G

inositol polyphosphate multikinase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IPMK mRNA]

NCBI chr20:17,216,988...17,251,675
Ensembl chr20:17,218,037...17,251,705

G

importin 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IPO5 mRNA]

NCBI chr15:97,990,755...98,041,074
Ensembl chr15:98,005,299...98,041,126

G

IQ motif containing GTPase activating protein 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IQGAP2 mRNA]

NCBI chr 2:26,894,836...27,170,270
Ensembl chr 2:26,894,825...27,170,279

G

ISY1 splicing factor homolog

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ISY1 mRNA]

NCBI chr 4:120,276,535...120,297,227
Ensembl chr 4:120,276,292...120,297,188

G

integrin subunit alpha 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ITGA4 mRNA]

NCBI chr 3:64,162,764...64,235,010
Ensembl chr 3:64,163,085...64,233,715

G

integrin subunit beta 8

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of ITGB8 mRNA

NCBI chr 6:140,125,002...140,208,261
Ensembl chr 6:140,127,203...140,208,476

G

inter-alpha-trypsin inhibitor heavy chain 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ITIH4 mRNA]

NCBI chr16:6,080,539...6,095,710
Ensembl chr16:6,080,539...6,095,708

G

ITPRIP like 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ITPRIPL1 mRNA]

NCBI chr 3:114,403,123...114,407,917
Ensembl chr 3:114,402,270...114,414,497

G

influenza virus NS1A binding protein

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of IVNS1ABP mRNA]

NCBI chr13:63,427,040...63,446,701
Ensembl chr13:63,427,041...63,446,701

G

junctional adhesion molecule 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of JAM3 mRNA]

NCBI chr 8:25,508,461...25,569,306
Ensembl chr 8:25,507,057...25,569,355

G

potassium two pore domain channel subfamily K member 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of KCNK5 mRNA]

NCBI chr15:4,122,442...4,164,718
Ensembl chr15:4,122,442...4,164,718

G

potassium calcium-activated channel subfamily N member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of KCNN2 mRNA]

NCBI chr18:37,817,966...38,258,347
Ensembl chr18:37,817,957...38,258,347

G

lysine demethylase 4B

multiple interactions
increases expression

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to KDM4B intron]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [KDM4B protein binds to RELA promoter]; ESR1 protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of KDM4B mRNA]; KDM4B protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of IL6 mRNA]; KDM4B protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of RELA mRNA]

NCBI chr 9:1,158,737...1,237,233
Ensembl chr 9:1,158,752...1,236,543

G

KLF transcription factor 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of KLF1 mRNA]

NCBI chr19:23,250,627...23,253,802
Ensembl chr19:23,250,631...23,253,758

G

KLF transcription factor 13

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of KLF13 mRNA]

NCBI chr 1:117,505,857...117,536,626
Ensembl chr 1:117,503,602...117,551,227

G

kelch-like family member 11

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of KLHL11 mRNA]

NCBI chr10:85,398,487...85,409,049
Ensembl chr10:85,398,487...85,409,049

G

kelch-like family member 24

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of KLHL24 mRNA

NCBI chr11:80,843,621...80,877,649
Ensembl chr11:80,846,755...80,877,636

G

kininogen 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of KNG1 mRNA]

NCBI chr11:77,812,757...77,835,555
Ensembl chr11:77,812,752...77,835,555

G

keratin 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of KRT5 mRNA]

NCBI chr 7:132,846,132...132,851,861
Ensembl chr 7:132,846,136...132,851,850

G

leukocyte cell-derived chemotaxin 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of LECT2 mRNA]

NCBI chr17:8,044,759...8,050,983
Ensembl chr17:8,044,759...8,050,983

G

LIM domain and actin binding 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of LIMA1 mRNA]

NCBI chr 7:130,901,717...131,001,512
Ensembl chr 7:130,901,717...131,001,473

G

LIM domain kinase 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of LIMK1 mRNA

NCBI chr12:22,026,697...22,060,605
Ensembl chr12:22,026,672...22,060,606

G

lin-7 homolog A, crumbs cell polarity complex component

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of LIN7A mRNA]

NCBI chr 7:42,586,704...42,742,609
Ensembl chr 7:42,586,719...42,730,550

G

lipase G, endothelial type

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of LIPG mRNA]

NCBI chr18:68,514,923...68,536,105
Ensembl chr18:68,514,923...68,536,260

G

LMBR1 domain containing 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of LMBRD1 mRNA]

NCBI chr 9:27,096,387...27,178,095
Ensembl chr 9:27,096,297...27,178,090

G

leucine-rich repeat, Ig-like and transmembrane domains 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of LRIT2 mRNA]

NCBI chr16:12,834,996...12,840,028
Ensembl chr16:12,835,051...12,839,482

G

macoilin 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MACO1 mRNA]

NCBI chr 5:147,012,416...147,075,265
Ensembl chr 5:147,012,867...147,075,001

G

mannosidase, alpha, class 2A, member 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MAN2A1 mRNA]

NCBI chr 9:104,252,001...104,408,349
Ensembl chr 9:104,252,001...104,408,349

G

monoamine oxidase B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MAOB mRNA]

NCBI chr X:5,907,327...6,010,996
Ensembl chr X:5,907,266...6,011,003

G

mitogen activated protein kinase kinase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MAP2K2 mRNA]

NCBI chr 7:8,590,729...8,610,279
Ensembl chr 7:8,580,905...8,610,243

G

mitogen-activated protein kinase kinase 6

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MAP2K6 mRNA]

NCBI chr10:95,373,304...95,490,406
Ensembl chr10:95,373,204...95,488,293

G

mitogen activated protein kinase 1

increases phosphorylation
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased phosphorylation of MAPK1 protein
CAV1 mutant form inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased phosphorylation of and results in increased activity of MAPK1 protein]

NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616

G

mitogen activated protein kinase 14

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MAPK14 mRNA]

NCBI chr20:6,749,646...6,810,590
Ensembl chr20:6,749,670...6,810,589

G

mitogen activated protein kinase 3

increases phosphorylation
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased phosphorylation of MAPK3 protein
CAV1 mutant form inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased phosphorylation of and results in increased activity of MAPK3 protein]

NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863

G

membrane associated ring-CH-type finger 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MARCHF2 mRNA]

NCBI chr 7:14,480,605...14,507,821
Ensembl chr 7:14,481,761...14,507,794

G

membrane associated ring-CH-type finger 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MARCHF5 mRNA]

NCBI chr 1:234,931,137...234,953,849
Ensembl chr 1:234,931,271...234,952,632

G

MARVEL domain containing 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MARVELD1 mRNA]

NCBI chr 1:240,954,050...240,958,101
Ensembl chr 1:240,954,452...240,958,384

G

MBL associated serine protease 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MASP1 mRNA]

NCBI chr11:77,334,794...77,405,271
Ensembl chr11:77,334,859...77,402,974

G

methionine adenosyltransferase 1A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MAT1A mRNA]

NCBI chr16:16,983,084...17,001,284
Ensembl chr16:16,983,022...17,001,274

G

mannose binding lectin 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MBL2 mRNA]

NCBI chr 1:228,016,439...228,024,736

G

minichromosome maintenance 9 homologous recombination repair factor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MCM9 mRNA]

NCBI chr20:32,818,219...32,929,577
Ensembl chr20:32,844,951...32,929,600

G

MFSD2 lysolipid transporter A, lysophospholipid

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MFSD2 mRNA]

NCBI chr 5:135,225,801...135,240,744
Ensembl chr 5:135,225,816...135,240,690

G

MIA SH3 domain ER export factor 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MIA2 mRNA]

NCBI chr 6:76,787,508...76,885,246
Ensembl chr 6:76,787,508...76,885,211

G

MIA SH3 domain ER export factor 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MIA3 mRNA]

NCBI chr13:94,970,421...95,012,071
Ensembl chr13:94,970,424...95,011,972

G

monocyte to macrophage differentiation-associated

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MMD mRNA]

NCBI chr10:75,073,278...75,101,528
Ensembl chr10:75,073,365...75,101,528

G

MORC family CW-type zinc finger 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MORC3 mRNA]

NCBI chr11:33,151,906...33,194,650
Ensembl chr11:33,152,025...33,194,646

G

mitochondrial pyruvate carrier 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MPC1 mRNA]

NCBI chr 1:52,437,745...52,449,399
Ensembl chr 1:52,437,741...52,449,400

G

mitochondrial pyruvate carrier 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MPC2 mRNA]

NCBI chr13:77,728,176...77,747,664
Ensembl chr13:77,728,250...77,747,664

G

myelin protein zero-like 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MPZL2 mRNA]

NCBI chr 8:45,348,285...45,359,298
Ensembl chr 8:45,348,285...45,359,298

G

mitochondrial ribosomal protein L19

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MRPL19 mRNA]

NCBI chr 4:114,521,824...114,526,053
Ensembl chr 4:114,521,824...114,526,053

G

mitochondrial ribosomal protein L55

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MRPL55 mRNA]

NCBI chr10:43,988,676...43,991,841
Ensembl chr10:43,988,683...43,991,841

G

methionine sulfoxide reductase B1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of MSRB1 mRNA]

NCBI chr10:13,764,883...13,770,609
Ensembl chr10:13,764,883...13,770,609

G

NEDD4 binding protein 2-like 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of N4BP2L1 mRNA]

NCBI chr12:102,572...128,352
Ensembl chr12:102,573...127,257

G

nicotinamide phosphoribosyltransferase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NAMPT mRNA]

NCBI chr 6:49,425,316...49,462,109
Ensembl chr 6:49,424,332...49,462,100

G

N-acetylneuraminic acid phosphatase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NANP mRNA]

NCBI chr 3:139,826,549...139,841,655
Ensembl chr 3:139,826,549...139,841,648

G

nuclear prelamin A recognition factor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NARF mRNA]

NCBI chr10:106,519,508...106,537,494
Ensembl chr10:106,519,444...106,537,486

G

N-acetyltransferase 8 (GCN5-related) family member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NAT8F2 mRNA]

NCBI chr 4:118,319,984...118,323,159
Ensembl chr 4:118,319,988...118,324,395

G

Nedd4 family interacting protein 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NDFIP1 mRNA]

NCBI chr18:30,265,808...30,316,068
Ensembl chr18:30,250,613...30,322,311

G

N-myc downstream regulated 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of NDRG1 mRNA

NCBI chr 7:98,684,487...98,725,869
Ensembl chr 7:98,684,487...98,725,880

G

NADH:ubiquinone oxidoreductase subunit A7

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NDUFA7 mRNA]

NCBI chr 7:14,609,283...14,622,064
Ensembl chr 7:14,609,146...14,631,976

G

NFE2 like bZIP transcription factor 2

multiple interactions

[resveratrol co-treated with 3,4,3',4'-tetrachlorobiphenyl] results in increased expression of NFE2L2 mRNA

NCBI chr 3:60,594,239...60,621,712
Ensembl chr 3:60,594,242...60,621,737

G

nuclear factor I X

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NFIX mRNA]

NCBI chr19:23,355,388...23,450,360
Ensembl chr19:23,355,498...23,448,265

G

neuronal guanine nucleotide exchange factor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NGEF mRNA]

NCBI chr 9:88,146,956...88,244,454
Ensembl chr 9:88,146,956...88,244,914

G

NHERF family PDZ scaffold protein 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NHERF1 mRNA]

NCBI chr10:100,403,189...100,420,290
Ensembl chr10:100,403,069...100,420,598

G

NHL repeat containing 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NHLRC2 mRNA]

NCBI chr 1:255,589,743...255,648,904
Ensembl chr 1:255,589,742...255,651,408

G

neurolysin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NLN mRNA]

NCBI chr 2:35,133,634...35,232,927
Ensembl chr 2:35,134,145...35,232,914

G

NMD3 ribosome export adaptor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NMD3 mRNA]

NCBI chr 2:154,012,973...154,038,466
Ensembl chr 2:154,013,020...154,039,259

G

nicotinamide riboside kinase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NMRK1 mRNA]

NCBI chr 1:216,049,350...216,076,792
Ensembl chr 1:216,049,437...216,076,791

G

NADPH oxidase 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NOX4 mRNA]

NCBI chr 1:140,900,886...141,078,844
Ensembl chr 1:140,901,097...141,077,406

G

natriuretic peptide receptor 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NPR2 mRNA]

NCBI chr 5:57,883,171...57,901,590
Ensembl chr 5:57,883,171...57,901,580

G

NAD(P)H quinone dehydrogenase 1

affects expression
multiple interactions

3,4,3',4'-tetrachlorobiphenyl affects the expression of NQO1 mRNA
[resveratrol co-treated with 3,4,3',4'-tetrachlorobiphenyl] results in increased expression of NQO1 mRNA

PMID:20638727 PMID:24231106

NCBI chr19:35,295,633...35,310,528
Ensembl chr19:35,295,573...35,310,557

G

nuclear receptor subfamily 1, group D, member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NR1D2 mRNA]

NCBI chr15:7,524,257...7,550,553
Ensembl chr15:7,524,257...7,550,553

G

nuclear receptor subfamily 1, group H, member 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NR1H4 mRNA]

NCBI chr 7:23,846,122...23,942,085
Ensembl chr 7:23,846,122...23,942,047

G

nuclear receptor subfamily 1, group I, member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NR1I2 mRNA]

NCBI chr11:62,460,213...62,496,665
Ensembl chr11:62,460,213...62,496,658

G

neuronal regeneration related protein

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NREP mRNA]

NCBI chr18:25,017,069...25,046,593
Ensembl chr18:25,017,083...25,046,591

G

neuregulin 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of NRG4 mRNA]

NCBI chr 8:55,586,253...55,677,829
Ensembl chr 8:55,592,893...55,677,483

G

oxysterol binding protein-like 1A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of OSBPL1A mRNA]; 3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of OSBPL2 mRNA]

NCBI chr18:3,904,006...4,094,635
Ensembl chr18:3,904,006...4,094,585

G

purinergic receptor P2Y1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of P2RY1 mRNA]

NCBI chr 2:145,241,975...145,248,186
Ensembl chr 2:145,241,849...145,248,457

G

proliferation-associated 2G4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PA2G4 mRNA]

NCBI chr 7:984,795...992,264
Ensembl chr 7:983,971...992,331

G

phenylalanine hydroxylase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PAH mRNA]

NCBI chr 7:21,933,179...21,998,134
Ensembl chr 7:21,933,179...21,998,130

G

progestin and adipoQ receptor family member 7

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PAQR7 mRNA]

NCBI chr 5:146,709,159...146,720,577
Ensembl chr 5:146,708,900...146,720,673

G

poly (ADP-ribose) polymerase 1

increases activity
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased activity of PARP1 protein
[3,4,3',4'-tetrachlorobiphenyl results in increased activity of PARP1 protein] which results in decreased abundance of NAD

NCBI chr13:92,307,593...92,339,406
Ensembl chr13:92,307,586...92,339,404

G

poly (ADP-ribose) polymerase family, member 16

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PARP16 mRNA]

NCBI chr 8:65,731,152...65,749,438
Ensembl chr 8:65,727,706...65,749,433

G

phosphoenolpyruvate carboxykinase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PCK1 mRNA]

NCBI chr 3:161,930,256...161,936,205
Ensembl chr 3:161,930,256...161,936,191

G

proprotein convertase subtilisin/kexin type 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PCSK4 mRNA]

NCBI chr 7:9,381,366...9,389,589
Ensembl chr 7:9,381,361...9,389,585

G

phosphodiesterase 4D interacting protein

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PDE4DIP mRNA]

NCBI chr 2:185,293,236...185,490,100
Ensembl chr 2:185,293,214...185,468,379

G

period circadian regulator 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PER2 mRNA]

NCBI chr 9:92,007,289...92,049,551
Ensembl chr 9:92,007,296...92,049,459

G

period circadian regulator 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PER3 mRNA]

NCBI chr 5:161,460,228...161,495,404
Ensembl chr 5:161,459,533...161,495,607

G

peroxisomal biogenesis factor 11 alpha

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PEX11A mRNA]

NCBI chr 1:133,680,091...133,687,172
Ensembl chr 1:133,680,091...133,687,172

G

peroxisomal biogenesis factor 26

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PEX26 mRNA]

NCBI chr 4:154,414,332...154,426,954
Ensembl chr 4:154,414,849...154,426,952

G

peroxisomal biogenesis factor 6

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PEX6 mRNA]

NCBI chr 9:14,258,145...14,270,335
Ensembl chr 9:14,258,145...14,270,303

G

PHD finger protein 14

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PHF14 mRNA]

NCBI chr 4:40,009,691...40,195,877
Ensembl chr 4:40,009,264...40,195,885

G

phytanoyl-CoA 2-hydroxylase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PHYH mRNA]

NCBI chr17:73,329,461...73,346,359
Ensembl chr17:73,329,082...73,346,409

G

polymeric immunoglobulin receptor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PIGR mRNA]

NCBI chr13:42,298,905...42,326,877
Ensembl chr13:42,298,914...42,326,875

G

phosphoinositide-3-kinase regulatory subunit 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PIK3R1 mRNA]

NCBI chr 2:32,878,942...32,963,668
Ensembl chr 2:32,882,032...32,963,631

G

phosphatidylinositol transfer protein, cytoplasmic 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PITPNC1 mRNA]

NCBI chr10:92,163,558...92,428,971
Ensembl chr10:92,167,196...92,429,297

G

peptidase, mitochondrial processing subunit beta

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PMPCB mRNA]

NCBI chr 4:13,297,583...13,310,363
Ensembl chr 4:13,297,559...13,310,367

G

patatin-like phospholipase domain containing 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PNPLA2 mRNA]

NCBI chr 1:196,552,723...196,557,805
Ensembl chr 1:196,552,723...196,557,805

G

POC1 centriolar protein A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of POC1A mRNA]

NCBI chr 8:106,922,058...106,991,678
Ensembl chr 8:106,922,978...106,991,089

G

RNA polymerase II subunit B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of POLR2B mRNA]

NCBI chr14:30,797,228...30,834,916
Ensembl chr14:30,797,228...30,834,916

G

cytochrome p450 oxidoreductase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of POR mRNA]

NCBI chr12:20,951,058...20,999,198
Ensembl chr12:20,951,058...20,999,245

G

peroxisome proliferator activated receptor alpha

multiple interactions
decreases expression

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PPARA mRNA]
3,4,3',4'-tetrachlorobiphenyl results in decreased expression of PPARA mRNA

NCBI chr 7:116,832,405...116,900,878
Ensembl chr 7:116,832,756...116,895,346

G

peroxisome proliferator-activated receptor gamma

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of PPARG mRNA

NCBI chr 4:148,423,102...148,548,471
Ensembl chr 4:148,423,194...148,548,468

G

protein phosphatase 1, regulatory subunit 12B

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of PPP1R12B mRNA

NCBI chr13:46,199,418...46,397,108
Ensembl chr13:46,201,251...46,397,108

G

protein phosphatase 2 regulatory subunit B', epsilon

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PPP2R5E mRNA]

NCBI chr 6:94,168,846...94,317,872
Ensembl chr 6:94,168,846...94,317,872

G

protein kinase C, alpha

increases activity
increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased activity of PRKCA protein
3,4,3',4'-tetrachlorobiphenyl results in increased expression of PRKCA protein

NCBI chr10:92,889,390...93,288,013
Ensembl chr10:92,894,012...93,288,012

G

prolactin receptor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PRLR mRNA]

NCBI chr 2:59,134,147...59,324,719
Ensembl chr 2:59,134,588...59,324,718

G

proline dehydrogenase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PRODH2 mRNA]

NCBI chr 1:85,753,558...85,767,165
Ensembl chr 1:85,753,644...85,767,162

G

pre-mRNA processing factor 8

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PRPF8 mRNA]

NCBI chr10:60,331,494...60,354,606
Ensembl chr10:60,331,494...60,354,606

G

presenilin enhancer gamma secretase subunit

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PSENEN mRNA]

NCBI chr 1:85,814,905...85,816,654
Ensembl chr 1:85,814,905...85,816,192

G

proteasome activator subunit 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PSME4 mRNA]

NCBI chr14:104,505,716...104,609,410
Ensembl chr14:104,505,716...104,609,408

G

phosphatidylserine synthase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PTDSS1 mRNA]

NCBI chr 7:63,845,017...63,906,791
Ensembl chr 7:63,844,268...63,906,791

G

phosphatidylserine synthase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PTDSS2 mRNA]

NCBI chr 1:196,241,439...196,267,632
Ensembl chr 1:196,241,494...196,267,685

G

protein tyrosine phosphatase 4A1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of PTP4A1 mRNA]

NCBI chr 9:33,214,201...33,245,046
Ensembl chr 9:33,214,208...33,221,964

G

glutaminyl-tRNA synthetase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of QARS1 mRNA]

NCBI chr 8:109,207,705...109,215,738
Ensembl chr 8:109,207,705...109,215,739

G

QKI, KH domain containing RNA binding

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of QKI mRNA]

NCBI chr 1:50,387,716...50,501,568
Ensembl chr 1:50,387,698...50,498,831

G

glutaminyl-peptide cyclotransferase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of QPCT mRNA]

NCBI chr 6:15,964,656...15,996,730
Ensembl chr 6:15,964,657...15,996,711

G

RAB43, member RAS oncogene family

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RAB43 mRNA]

NCBI chr 4:120,249,650...120,269,174
Ensembl chr 4:120,249,879...120,269,174

G

RAB GTPase activating protein 1-like

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RABGAP1L mRNA]

NCBI chr13:72,464,114...73,059,845
Ensembl chr13:72,468,110...73,059,984

G

Raf-1 proto-oncogene, serine/threonine kinase

multiple interactions
increases expression

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]; resveratrol inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl promotes the reaction [[AHR protein binds to ARNT protein] which binds to RAF1 promoter]]
3,4,3',4'-tetrachlorobiphenyl results in increased expression of RAF1 protein

NCBI chr 4:148,679,534...148,740,265
Ensembl chr 4:148,679,530...148,740,317

G

retinol dehydrogenase 13

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RDH13 mRNA]

NCBI chr 1:69,373,014...69,401,454
Ensembl chr 1:69,373,113...69,400,908

G

retinol dehydrogenase 9

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RDH9 mRNA]

NCBI chr 7:63,642,305...63,645,149

G

RELA proto-oncogene, NF-kB subunit

multiple interactions
increases expression

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to RELA promoter]; 3,4,3',4'-tetrachlorobiphenyl promotes the reaction [KDM4B protein binds to RELA promoter]; 3,4,3',4'-tetrachlorobiphenyl results in increased expression of and affects the localization of RELA protein; KDM4B protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of RELA mRNA]

NCBI chr 1:202,925,001...202,935,484
Ensembl chr 1:202,924,945...202,935,484

G

riboflavin kinase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RFK mRNA]

NCBI chr 1:214,799,880...214,807,440
Ensembl chr 1:214,799,825...214,807,438
Ensembl chr X:214,799,825...214,807,438

G

regulator of G-protein signaling 16

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RGS16 mRNA]

NCBI chr13:65,887,668...65,892,862
Ensembl chr13:65,887,530...65,892,857

G

rhomboid like 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RHBDL1 mRNA]

NCBI chr10:14,854,514...14,858,848
Ensembl chr10:14,854,514...14,857,430

G

ras homolog family member B

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of RHOB mRNA

NCBI chr 6:31,363,752...31,365,926
Ensembl chr 6:31,363,548...31,366,108

G

Rho-related BTB domain containing 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RHOBTB1 mRNA]

NCBI chr20:19,327,142...19,456,121
Ensembl chr20:19,327,155...19,403,012

G

ras homolog family member D

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of RHOD mRNA

NCBI chr 1:201,708,699...201,724,405
Ensembl chr 1:201,708,699...201,722,632

G

RIO kinase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RIOK2 mRNA]

NCBI chr 1:58,103,132...58,119,397
Ensembl chr 1:58,103,084...58,120,512

G

ribonuclease A family member 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RNASE4 mRNA]

NCBI chr15:24,312,765...24,330,112
Ensembl chr15:24,312,464...24,330,117

G

ribosomal protein L35A

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of RPL35A mRNA

NCBI chr11:67,726,031...67,729,953
Ensembl chr11:67,726,032...67,729,942
Ensembl chr 5:67,726,032...67,729,942

G

regulator of telomere elongation helicase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RTEL1 mRNA]

NCBI chr 3:168,427,247...168,465,349
Ensembl chr 3:168,419,579...168,465,348

G

retinoid X receptor alpha

decreases expression
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in decreased expression of RXRA mRNA
3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of RXRA mRNA]

NCBI chr 3:10,989,832...11,076,366
Ensembl chr 3:10,989,832...11,073,712

G

sphingosine-1-phosphate receptor 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of S1PR5 mRNA]

NCBI chr 8:19,786,676...19,791,862
Ensembl chr 8:19,786,663...19,791,795

G

sarcosine dehydrogenase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SARDH mRNA]

NCBI chr 3:10,510,553...10,575,342
Ensembl chr 3:10,510,553...10,573,874

G

SET binding factor 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SBF2 mRNA]

NCBI chr 1:164,352,892...164,719,883
Ensembl chr 1:164,353,444...164,719,807

G

secretory carrier membrane protein 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SCAMP1 mRNA]

NCBI chr 2:25,433,958...25,516,734
Ensembl chr 2:25,433,959...25,516,673

G

scavenger receptor class B, member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SCARB2 mRNA]

NCBI chr14:15,558,271...15,609,813
Ensembl chr14:15,558,236...15,609,813

G

stearoyl-CoA desaturase

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of SCD1 mRNA

NCBI chr 1:243,269,745...243,282,878
Ensembl chr 1:243,269,747...243,282,562

G

SEC14-like lipid binding 4

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of SEC14L4 mRNA

NCBI chr14:78,912,750...78,928,799
Ensembl chr14:78,912,750...78,956,099

G

SEC62 homolog, preprotein translocation factor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SEC62 mRNA]

NCBI chr 2:112,570,810...112,598,198
Ensembl chr 2:112,570,819...112,601,814

G

serpin family D member 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SERPIND1 mRNA]

NCBI chr11:83,664,517...83,675,593
Ensembl chr11:83,664,518...83,675,519

G

serpin family G member 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SERPING1 mRNA]

NCBI chr 3:69,842,726...69,852,583
Ensembl chr 3:69,842,739...69,852,034

G

SET domain containing 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SETD4 mRNA]

NCBI chr11:32,829,509...32,859,162
Ensembl chr11:32,838,063...32,858,243

G

SH2 domain containing adaptor protein B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SHB mRNA]

NCBI chr 5:59,678,066...59,785,443
Ensembl chr 5:59,678,216...59,785,538

G

solute carrier family 12, member 6

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC12A6 mRNA]

NCBI chr 3:99,071,577...99,170,266
Ensembl chr 3:99,071,391...99,170,258

G

solute carrier family 16 member 10

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC16A10 mRNA]

NCBI chr20:43,454,819...43,567,839
Ensembl chr20:43,459,709...43,567,839

G

solute carrier family 16, member 12

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC16A12 mRNA]

NCBI chr 1:232,184,004...232,262,170
Ensembl chr 1:232,185,907...232,262,141

G

solute carrier family 17, member 2

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of SLC17A2 mRNA

NCBI chr17:41,318,312...41,339,012
Ensembl chr17:41,319,701...41,336,325

G

solute carrier family 1 member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC1A2 mRNA]

NCBI chr 3:89,005,129...89,135,469
Ensembl chr 3:89,005,129...89,126,498

G

solute carrier family 22 member 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC22A5 mRNA]

NCBI chr10:38,008,303...38,035,474
Ensembl chr10:38,008,311...38,035,309

G

solute carrier family 25 member 13

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC25A13 mRNA]

NCBI chr 4:34,179,224...34,361,912
Ensembl chr 4:34,179,224...34,361,902

G

solute carrier family 25 member 20

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC25A20 mRNA]

NCBI chr 8:109,365,056...109,386,512
Ensembl chr 8:109,365,002...109,386,512

G

solute carrier family 25 member 32

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC25A32 mRNA]

NCBI chr 7:70,142,958...70,160,726
Ensembl chr 7:70,142,964...70,160,770

G

solute carrier family 25, member 47

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC25A47 mRNA]

NCBI chr 6:127,767,365...127,773,000
Ensembl chr 6:127,767,305...127,773,005

G

solute carrier family 25, member 51

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC25A51 mRNA]

NCBI chr 5:59,649,980...59,663,454
Ensembl chr 5:59,649,744...59,663,581

G

solute carrier family 27 member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC27A2 mRNA]

NCBI chr 3:113,804,728...113,842,208
Ensembl chr 3:113,804,728...113,842,208

G

solute carrier family 27 member 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC27A5 mRNA]

NCBI chr 1:73,616,556...73,627,149
Ensembl chr 1:73,616,564...73,627,172

G

solute carrier family 2 member 9

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC2A9 mRNA]

NCBI chr14:72,328,334...72,461,981
Ensembl chr14:72,328,320...72,461,981

G

solute carrier family 31 member 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC31A1 mRNA]

NCBI chr 5:75,814,744...75,844,241
Ensembl chr 5:75,814,743...75,844,228

G

solute carrier family 38, member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC38A2 mRNA]

NCBI chr 7:127,851,267...127,863,482
Ensembl chr 7:127,851,267...127,863,436

G

solute carrier family 38, member 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC38A3 mRNA]

NCBI chr 8:108,323,889...108,339,959
Ensembl chr 8:108,323,894...108,339,988

G

solute carrier family 38, member 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC38A4 mRNA]

NCBI chr 7:128,142,866...128,203,000
Ensembl chr 7:128,144,807...128,202,995

G

solute carrier family 39 member 14

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC39A14 mRNA]

NCBI chr15:45,376,806...45,423,549
Ensembl chr15:45,376,917...45,423,524

G

solute carrier family 39 member 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC39A3 mRNA]

NCBI chr 7:8,676,845...8,682,846
Ensembl chr 7:8,676,759...8,685,149

G

solute carrier family 5 member 6

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC5A6 mRNA]

NCBI chr 6:25,319,187...25,331,713
Ensembl chr 6:25,320,442...25,331,712

G

solute carrier family 6 member 9

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC6A9 mRNA]

NCBI chr 5:131,374,562...131,408,733
Ensembl chr 5:131,374,542...131,408,728

G

solute carrier family 7 member 11

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of SLC7A11 mRNA

NCBI chr 2:134,382,002...134,517,622
Ensembl chr 2:133,963,107...134,517,536

G

solute carrier family 7 member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLC7A2 mRNA]

NCBI chr16:51,417,478...51,470,784
Ensembl chr16:51,417,493...51,470,784

G

solute carrier organic anion transporter family member 1B2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SLCO1B2 mRNA]

NCBI chr 4:174,551,463...174,619,988
Ensembl chr 4:174,551,480...174,619,981

G

SMAD family member 9

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SMAD9 mRNA]

NCBI chr 2:138,956,326...139,006,315
Ensembl chr 2:138,986,471...139,006,307

G

SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SMARCA2 mRNA]

NCBI chr 1:224,191,125...224,358,640
Ensembl chr 1:224,191,125...224,358,684

G

sphingomyelin phosphodiesterase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SMPD2 mRNA]

NCBI chr20:44,986,229...44,989,343
Ensembl chr20:44,986,231...44,989,441

G

sorbitol dehydrogenase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SORD mRNA]

NCBI chr 3:109,184,697...109,216,133
Ensembl chr 3:109,184,676...109,216,133

G

SOS Ras/Rac guanine nucleotide exchange factor 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of SOS1 mRNA

NCBI chr 6:14,533,870...14,613,348
Ensembl chr 6:14,533,360...14,611,107

G

sprouty RTK signaling antagonist 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SPRY4 mRNA]

NCBI chr18:30,436,513...30,451,426
Ensembl chr18:30,436,443...30,453,004

G

ST3 beta-galactoside alpha-2,3-sialyltransferase 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ST3GAL5 mRNA]

NCBI chr 4:104,134,613...104,192,558
Ensembl chr 4:104,134,613...104,192,558

G

StAR-related lipid transfer domain containing 5

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of STARD5 mRNA]

NCBI chr 1:137,606,151...137,616,017
Ensembl chr 1:137,606,177...137,616,469

G

stromal interaction molecule 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of STIM2 mRNA]

NCBI chr14:56,878,428...57,004,405
Ensembl chr14:56,878,645...57,004,179

G

succinate-CoA ligase GDP/ADP-forming subunit alpha

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SUCLG1 mRNA]

NCBI chr 4:105,308,236...105,337,595
Ensembl chr 4:105,308,039...105,337,600

G

sulfatase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SULF2 mRNA]

NCBI chr 3:154,822,079...154,904,566
Ensembl chr 3:154,822,085...154,904,415

G

SURF1, cytochrome c oxidase assembly factor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SURF1 mRNA]

NCBI chr 3:10,241,793...10,244,686
Ensembl chr 3:10,241,837...10,263,315

G

synaptonemal complex protein 3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SYCP3 mRNA]

NCBI chr 7:22,874,055...22,888,512
Ensembl chr 7:22,874,055...22,888,511

G

synapse defective Rho GTPase homolog 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SYDE2 mRNA]

NCBI chr 2:234,897,975...234,930,994
Ensembl chr 2:234,897,717...234,930,994

G

spleen associated tyrosine kinase

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of SYK mRNA

NCBI chr17:12,604,615...12,678,437
Ensembl chr17:12,604,619...12,661,410

G

synaptogyrin 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of SYNGR2 mRNA]

NCBI chr10:103,029,903...103,034,473
Ensembl chr10:103,029,917...103,034,473

G

trafficking regulator and scaffold protein tamalin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TAMALIN mRNA]

NCBI chr 7:132,338,900...132,359,519
Ensembl chr 7:132,338,900...132,346,666

G

tubulin folding cofactor A

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of TBCA mRNA

NCBI chr 2:26,011,714...26,065,909
Ensembl chr 2:26,011,795...26,065,907

G

TEF transcription factor, PAR bZIP family member

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TEF mRNA]

NCBI chr 7:113,317,191...113,341,783
Ensembl chr 7:113,317,283...113,341,783

G

testis expressed 261

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TEX261 mRNA]

NCBI chr 4:116,253,547...116,260,730
Ensembl chr 4:116,244,600...116,260,253

G

trefoil factor 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl promotes the reaction [ESR1 protein binds to TFF1 promoter]

NCBI chr20:9,235,736...9,239,597
Ensembl chr20:9,235,736...9,239,597

G

transforming growth factor, beta 1

increases expression

3,4,3',4'-tetrachlorobiphenyl results in increased expression of TGFB1 mRNA

NCBI chr 1:81,196,532...81,212,848
Ensembl chr 1:81,196,532...81,212,847

G

thymocyte selection associated

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of THEMIS mRNA]

NCBI chr 1:16,433,906...16,623,889
Ensembl chr 1:16,432,631...16,664,329

G

thymidine kinase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TK1 mRNA]

NCBI chr10:103,034,755...103,046,125
Ensembl chr10:103,031,521...103,046,920

G

transmembrane 9 superfamily member 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TM9SF2 mRNA]

NCBI chr15:99,201,556...99,254,054
Ensembl chr15:99,201,489...99,254,049

G

transmembrane channel-like 7

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMC7 mRNA]

NCBI chr 1:172,853,531...172,905,796
Ensembl chr 1:172,854,658...172,905,824

G

transmembrane p24 trafficking protein 7

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMED7 mRNA]

NCBI chr18:39,318,564...39,325,640
Ensembl chr18:39,297,351...39,325,640

G

transmembrane protein 106B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMEM106B mRNA]

NCBI chr 4:41,328,125...41,347,315
Ensembl chr 4:41,327,994...41,345,619

G

transmembrane protein 134

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMEM134 mRNA]

NCBI chr 1:201,419,225...201,424,778
Ensembl chr 1:201,419,264...201,431,411

G

transmembrane protein 183A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMEM183A mRNA]

NCBI chr13:45,803,641...45,820,409
Ensembl chr13:45,803,639...45,820,375

G

transmembrane protein 63B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMEM63B mRNA]

NCBI chr 9:15,313,867...15,340,722
Ensembl chr 9:15,320,432...15,340,720

G

transmembrane serine protease 6

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMPRSS6 mRNA]

NCBI chr 7:109,991,008...110,021,626
Ensembl chr 7:109,985,931...110,021,624

G

transmembrane O-mannosyltransferase targeting cadherins 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TMTC2 mRNA]

NCBI chr 7:40,392,377...40,806,685
Ensembl chr 7:40,394,220...40,807,298

G

tumor necrosis factor

increases expression
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased expression of TNF mRNA; 3,4,3',4'-tetrachlorobiphenyl results in increased expression of TNF protein
AHR protein promotes the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of TNF mRNA]; alpha-naphthoflavone inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of TNF mRNA]

PMID:21925196 PMID:23099484 PMID:25734695 PMID:30935970

NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629

G

tankyrase 1 binding protein 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TNKS1BP1 mRNA]

NCBI chr 3:70,135,335...70,160,071
Ensembl chr 3:70,137,837...70,160,038

G

transition protein 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of TNP1 mRNA

NCBI chr 9:74,594,463...74,595,072
Ensembl chr 9:74,594,466...74,595,274

G

torsin family 1, member A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TOR1A mRNA]

NCBI chr 3:14,250,667...14,257,704
Ensembl chr 3:14,250,676...14,257,691

G

torsin family 1, member B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TOR1B mRNA]

NCBI chr 3:14,243,181...14,249,279
Ensembl chr 3:14,243,243...14,249,272

G

TOX high mobility group box family member 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TOX4 mRNA]

NCBI chr15:24,989,246...25,002,833
Ensembl chr15:24,988,853...25,002,833

G

tumor protein p53 inducible protein 11

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of TP53I11 mRNA

NCBI chr 3:79,144,824...79,160,056
Ensembl chr 3:79,144,895...79,160,050

G

tumor protein p53 inducible protein 13

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TRP53I13 mRNA]

NCBI chr10:62,356,722...62,363,122
Ensembl chr10:62,356,722...62,361,343

G

trafficking kinesin protein 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TRAK1 mRNA]

NCBI chr 8:120,984,445...121,139,357
Ensembl chr 8:120,984,431...121,139,367

G

tripartite motif-containing 24

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TRIM24 mRNA]

NCBI chr 4:66,567,342...66,692,029
Ensembl chr 4:66,566,686...66,717,241

G

transient receptor potential cation channel, subfamily M, member 7

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TRPM7 mRNA]

NCBI chr 3:114,046,258...114,134,799
Ensembl chr 3:114,046,258...114,135,190

G

tsukushi, small leucine rich proteoglycan

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TSKU mRNA]

NCBI chr 1:152,660,259...152,671,682
Ensembl chr 1:152,656,693...152,672,588

G

tetraspanin 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TSPAN4 mRNA]

NCBI chr 1:196,571,307...196,593,842
Ensembl chr 1:196,572,228...196,617,448

G

tetratricopeptide repeat domain 39B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TTC39B mRNA]

NCBI chr 5:97,603,329...97,708,103
Ensembl chr 5:97,609,392...97,736,270

G

tetratricopeptide repeat domain 7A

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TTC7 mRNA]

NCBI chr 6:7,159,285...7,261,826
Ensembl chr 6:7,159,061...7,261,892

G

twist family bHLH transcription factor 2

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of TWIST2 mRNA

NCBI chr 9:92,374,740...92,419,222
Ensembl chr 9:92,374,574...92,419,222

G

thioredoxin interacting protein

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of TXNIP mRNA]

NCBI chr 2:184,093,079...184,096,882
Ensembl chr 2:184,092,991...184,096,886

G

UBA domain containing 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UBAC1 mRNA]

NCBI chr 3:8,825,444...8,848,055
Ensembl chr 3:8,825,447...8,848,028

G

ubiquitin-conjugating enzyme E2, J2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UBE2J2 mRNA]

NCBI chr 5:166,533,374...166,547,811
Ensembl chr 5:166,533,418...166,547,804

G

ubiquitin-conjugating enzyme E2R 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UBE2R2 mRNA]

NCBI chr 5:56,286,604...56,345,160
Ensembl chr 5:56,286,725...56,345,513

G

upstream binding transcription factor

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UBTF mRNA]

NCBI chr10:87,258,217...87,274,291
Ensembl chr10:87,258,217...87,272,969

G

UDP glucuronosyltransferase family 2 member A3

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UGT2A3 mRNA]

NCBI chr14:20,572,793...20,590,795
Ensembl chr14:20,572,808...20,590,729

G

UDP glycosyltransferase family 3 member A1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UGT3A1 mRNA]

NCBI chr 2:58,327,058...58,350,186
Ensembl chr 2:58,334,603...58,350,186

G

uromodulin

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UMOD mRNA]

NCBI chr 1:173,816,341...173,829,681
Ensembl chr 1:173,816,339...173,830,302

G

uracil-DNA glycosylase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UNG mRNA]

NCBI chr12:42,485,276...42,494,217
Ensembl chr12:42,485,276...42,494,206

G

ubiquinol-cytochrome c reductase complex assembly factor 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of UQCC1 mRNA]

NCBI chr 3:144,353,276...144,445,810
Ensembl chr 3:144,353,287...144,445,711

G

URI1, prefoldin-like chaperone

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of URI1 mRNA]

NCBI chr 1:90,646,392...90,704,811
Ensembl chr 1:90,646,393...90,709,026

G

upstream transcription factor 2, c-fos interacting

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of USF2 mRNA]

NCBI chr 1:86,174,703...86,185,942
Ensembl chr 1:86,174,703...86,185,617

G

ubiquitin specific peptidase 2

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of USP2 mRNA]

NCBI chr 8:44,411,457...44,439,668
Ensembl chr 8:44,411,607...44,438,331

G

ubiquitin specific peptidase 4

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of USP4 mRNA]

NCBI chr 8:109,035,402...109,079,382
Ensembl chr 8:109,036,099...109,080,427

G

vascular cell adhesion molecule 1

increases expression
multiple interactions

3,4,3',4'-tetrachlorobiphenyl results in increased expression of VCAM1 protein
3,4,3',4'-tetrachlorobiphenyl results in increased expression of VCAM1 mRNA
CAV1 mutant form inhibits the reaction [3,4,3',4'-tetrachlorobiphenyl results in increased expression of VCAM1 protein]

PMID:20406653 PMID:26519613

NCBI chr 2:204,038,120...204,057,852
Ensembl chr 2:204,038,114...204,057,958

G

vanin 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of VNN1 mRNA]

NCBI chr 1:21,537,084...21,547,395
Ensembl chr 1:21,537,094...21,547,395

G

vacuolar protein sorting 13 homolog D

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of VPS13D mRNA]

NCBI chr 5:156,830,509...157,055,895
Ensembl chr 5:156,830,512...157,055,891

G

WEE1 G2 checkpoint kinase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of WEE1 mRNA]

NCBI chr 1:164,173,681...164,197,688
Ensembl chr 1:164,174,779...164,197,688

G

WW domain containing E3 ubiquitin protein ligase 1

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of WWP1 mRNA]

NCBI chr 5:33,092,379...33,185,887
Ensembl chr 5:33,098,494...33,186,046

G

YME1-like 1 ATPase

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of YME1L1 mRNA]

NCBI chr17:85,287,607...85,326,068
Ensembl chr17:85,287,554...85,326,335

G

zeta chain of T cell receptor associated protein kinase 70

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ZAP70 mRNA]

NCBI chr 9:38,989,750...39,011,701
Ensembl chr 9:38,989,750...39,011,700

G

zinc finger and BTB domain containing 44

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ZBTB44 mRNA]

NCBI chr 8:29,466,055...29,524,027
Ensembl chr 8:29,466,352...29,518,163

G

zinc finger AN1-type containing 2B

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ZFAND2B mRNA]

NCBI chr 9:76,665,466...76,668,447
Ensembl chr 9:76,665,546...76,668,445

G

zinc finger protein 36, C3H type-like 1

affects expression

3,4,3',4'-tetrachlorobiphenyl affects the expression of ZFP36L1 mRNA

NCBI chr 6:98,930,705...98,935,748
Ensembl chr 6:98,930,718...98,935,748

G

zinc finger protein 622

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ZFP622 mRNA]

NCBI chr 2:76,479,605...76,494,405
Ensembl chr 2:76,335,609...76,493,898

G

zyg-11 family member B, cell cycle regulator

multiple interactions

3,4,3',4'-tetrachlorobiphenyl inhibits the reaction [Dietary Fats results in increased expression of ZYG11B mRNA]

NCBI chr 5:122,985,548...123,042,735
Ensembl chr 5:122,992,147...123,042,736

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	19844
role	19820
chemical role	19457
environmental contaminant	18828
persistent organic pollutant	16701
polychlorobiphenyl	6020
tetrachlorobiphenyl	2422
3,3',4,4'-tetrachlorobiphenyl	448
Path 2
Term	Annotations
CHEBI ontology	19844
subatomic particle	19842
composite particle	19842
hadron	19842
baryon	19842
nucleon	19809
atomic nucleus	19842
atom	19842
main group element atom	19792
main group molecular entity	19792
s-block molecular entity	19626
hydrogen molecular entity	19613
hydrides	19115
organic hydride	18691
organic fundamental parent	18691
hydrocarbon	18435
halohydrocarbon	15713
haloarene	6410
chloroarene	6022
chlorobiphenyl	6022
polychlorobiphenyl	6020
tetrachlorobiphenyl	2422
3,3',4,4'-tetrachlorobiphenyl	448

paths to the root