Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:ginkgolide B
go back to main search page
Accession:CHEBI:5356 term browser browse the term
Definition:A ginkgolide in which the pro-R hydrogens at positions 6, 12, and 17 of the 8-tert-butyl-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.0(1,11).0(3,7).0(7,11).0(13,17)]nonadecane-5,15,18-trione ginkgolide skeleton have been replaced by hydroxy groups.
Synonyms:exact_synonym: (1R,3R,6R,8S,10R,12R,13S,16S,17R)-8-tert-butyl-6,12,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.0(1,11).0(3,7).0(7,11).0(13,17)]nonadecane-5,15,18-trione
 related_synonym: Formula=C20H24O10;   InChI=1S/C20H24O10/c1-6-12(23)28-11-9(21)18-8-5-7(16(2,3)4)17(18)10(22)13(24)29-15(17)30-20(18,14(25)27-8)19(6,11)26/h6-11,15,21-22,26H,5H2,1-4H3/t6-,7+,8-,9+,10+,11+,15+,17?,18?,19-,20-/m1/s1;   InChIKey=SQOJOAFXDQDRGF-NNGCZKEZSA-N;   SMILES=C123[C@]4([C@]5([C@@H](C(=O)O[C@]5([C@@H]1O)[H])C)O)O[C@H]6C2([C@](C(C)(C)C)(C[C@]3(OC4=O)[H])[H])[C@H](C(=O)O6)O
 xref: CAS:15291-77-7;   DrugBank:DB06744;   HMDB:HMDB0036861;   KEGG:C07602;   KNApSAcK:C00035830;   LIPID_MAPS_instance:LMPR0104540002
 xref_mesh: MESH:C045856
 xref: PMID:15910800;   PMID:23695070;   PMID:25749575;   PMID:25755731;   PMID:25869596;   PMID:25887229;   PMID:26059355;   PMID:26064244;   PMID:26246869;   PMID:26382046;   PMID:26768586;   PMID:26775663;   PMID:26983247;   PMID:27182682;   PMID:27261579;   PMID:27306494;   PMID:27323179;   PMID:27744452;   PMID:27973574;   PMID:28234255;   PMID:28416372;   PMID:28689387;   PMID:28712049;   Reaxys:4727611;   Reaxys:8173450


show annotations for term's descendants           Sort by:
 
ginkgolide B term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Abcb1a ATP binding cassette subfamily B member 1A increases expression
multiple interactions
ISO ginkgolide B results in increased expression of ABCB1 mRNA
NR1I2 protein affects the reaction [ginkgolide B results in increased expression of ABCB1 mRNA]; sulforafan inhibits the reaction [ginkgolide B results in increased expression of ABCB1 mRNA]
CTD PMID:19034627 PMID:26775663 NCBI chr 4:22,339,829...22,517,642
Ensembl chr 4:22,133,521...22,425,515
JBrowse link
G Abcc2 ATP binding cassette subfamily C member 2 increases expression ISO ginkgolide B results in increased expression of ABCC2 mRNA CTD PMID:19034627 NCBI chr 1:263,554,426...263,612,556
Ensembl chr 1:263,554,453...263,613,252
JBrowse link
G Akt1 AKT serine/threonine kinase 1 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of AKT1 protein] CTD PMID:19464278 NCBI chr 6:137,218,398...137,239,970
Ensembl chr 6:137,218,376...137,236,258
JBrowse link
G App amyloid beta precursor protein multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased abundance of Reactive Oxygen Species]; ginkgolide B inhibits the reaction [APP protein results in increased cleavage of and results in increased activity of CASP3 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of AKT1 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK1 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK3 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK8 protein] CTD PMID:19464278 NCBI chr11:24,425,013...24,641,872
Ensembl chr11:24,425,005...24,641,858
JBrowse link
G Casp3 caspase 3 multiple interactions ISO
EXP
ginkgolide B inhibits the reaction [APP protein results in increased cleavage of and results in increased activity of CASP3 protein]; ginkgolide B inhibits the reaction [Doxorubicin results in increased cleavage of CASP3 protein]; ginkgolide B inhibits the reaction [Staurosporine results in increased cleavage of CASP3 protein]
ginkgolide B inhibits the reaction [Ethanol results in increased activity of CASP3 protein]
CTD PMID:19464278 PMID:21704112 PMID:26775663 NCBI chr16:48,845,011...48,863,249
Ensembl chr16:48,845,012...48,863,204
JBrowse link
G Cybb cytochrome b-245 beta chain multiple interactions EXP ginkgolide B inhibits the reaction [Ethanol results in increased expression of NOX2 protein] CTD PMID:21704112 NCBI chr  X:14,578,330...14,610,049
Ensembl chr  X:14,578,264...14,612,547
JBrowse link
G Cyp1a1 cytochrome P450, family 1, subfamily a, polypeptide 1 multiple interactions ISO [Quercetin co-treated with kaempferol co-treated with 3-methylquercetin co-treated with ginkgolide A co-treated with ginkgolide B co-treated with ginkgolide C co-treated with ginkgolide J co-treated with bilobalide] affects the activity of CYP1A1 protein; [Quercetin co-treated with kaempferol co-treated with 3-methylquercetin co-treated with ginkgolide A co-treated with ginkgolide B co-treated with ginkgolide C co-treated with ginkgolide J co-treated with bilobalide] inhibits the reaction [Benzo(a)pyrene results in increased activity of CYP1A1 protein]; [Quercetin co-treated with kaempferol co-treated with 3-methylquercetin co-treated with ginkgolide A co-treated with ginkgolide B co-treated with ginkgolide C co-treated with ginkgolide J co-treated with bilobalide] inhibits the reaction [Tetrachlorodibenzodioxin results in increased activity of CYP1A1 protein] CTD PMID:21329749 NCBI chr 8:62,472,087...62,478,122
Ensembl chr 8:62,472,095...62,478,147
JBrowse link
G Cyp1a2 cytochrome P450, family 1, subfamily a, polypeptide 2 multiple interactions
increases expression
EXP ginkgolide B results in increased expression of and results in increased activity of CYP1A2 protein
ginkgolide B results in increased expression of CYP1A2 mRNA
CTD PMID:18421621 NCBI chr 8:62,451,360...62,458,244
Ensembl chr 8:62,451,329...62,458,301
JBrowse link
G Cyp2b3 cytochrome P450, family 2, subfamily b, polypeptide 3 increases expression ISO ginkgolide B results in increased expression of CYP2B6 mRNA CTD PMID:19034627 NCBI chr 1:83,163,103...83,236,615
Ensembl chr 1:83,163,079...83,236,615
JBrowse link
G Fcer1g Fc fragment of IgE receptor Ig decreases expression EXP ginkgolide B results in decreased expression of FCER1G protein CTD PMID:1834581 NCBI chr13:89,601,894...89,606,326
Ensembl chr13:89,601,896...89,606,326
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK1 protein] CTD PMID:19464278 NCBI chr11:88,203,863...88,273,301
Ensembl chr11:88,211,599...88,273,254
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK3 protein] CTD PMID:19464278 NCBI chr 1:198,192,773...198,198,975
Ensembl chr 1:198,192,773...198,198,975
JBrowse link
G Mapk8 mitogen-activated protein kinase 8 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK8 protein] CTD PMID:19464278 NCBI chr16:9,620,854...9,709,342
Ensembl chr16:9,625,177...9,709,347
JBrowse link
G Ncf1 neutrophil cytosolic factor 1 multiple interactions EXP ginkgolide B inhibits the reaction [Ethanol results in increased expression of NCF1 protein] CTD PMID:21704112 NCBI chr12:25,497,104...25,506,300
Ensembl chr12:25,497,104...25,506,300
JBrowse link
G Nos2 nitric oxide synthase 2 multiple interactions EXP ginkgolide B inhibits the reaction [Cyclophosphamide results in increased activity of NOS2 protein] CTD PMID:9006340 NCBI chr10:66,188,290...66,221,621
Ensembl chr10:66,189,786...66,313,190
JBrowse link
G Nox4 NADPH oxidase 4 multiple interactions ISO ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 protein]; MIR214 mRNA affects the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]] CTD PMID:26768586 NCBI chr 1:150,796,359...150,976,186
Ensembl chr 1:150,797,084...150,976,194
JBrowse link
G Nr1i2 nuclear receptor subfamily 1, group I, member 2 increases activity
multiple interactions
affects localization
ISO ginkgolide B results in increased activity of NR1I2 protein
NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]]; NR1I2 protein affects the reaction [ginkgolide B results in increased expression of ABCB1 mRNA]; NR1I2 protein affects the reaction [ginkgolide B results in increased expression of CYP3A4 mRNA]
ginkgolide B affects the localization of NR1I2 protein
CTD PMID:19034627 PMID:26775663 NCBI chr11:65,022,100...65,058,546
Ensembl chr11:65,022,100...65,058,545
JBrowse link
G Sele selectin E multiple interactions ISO ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]] CTD PMID:26775663 NCBI chr13:82,355,234...82,365,323
Ensembl chr13:82,355,471...82,365,341
JBrowse link
G Shc1 SHC adaptor protein 1 multiple interactions ISO ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 protein]; MIR214 mRNA affects the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]] CTD PMID:26768586 NCBI chr 2:188,745,503...188,757,066
Ensembl chr 2:188,745,503...188,757,066
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]] CTD PMID:26775663 NCBI chr20:5,189,382...5,192,000
Ensembl chr20:5,189,390...5,192,000
JBrowse link
G Tp53 tumor protein p53 multiple interactions ISO ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]; ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of TRP53 mRNA]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of TRP53 protein]; MIR214 mRNA affects the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of TRP53 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]] CTD PMID:26768586 NCBI chr10:56,186,299...56,198,449
Ensembl chr10:56,187,020...56,198,449
JBrowse link
G Ugt1a1 UDP glucuronosyltransferase family 1 member A1 increases expression ISO ginkgolide B results in increased expression of UGT1A1 mRNA CTD PMID:19034627 NCBI chr 9:95,295,701...95,302,822
Ensembl chr 9:95,161,157...95,302,822
JBrowse link
G Vcam1 vascular cell adhesion molecule 1 multiple interactions ISO ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]] CTD PMID:26775663 NCBI chr 2:219,071,193...219,090,931
Ensembl chr 2:219,071,193...219,097,619
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19810
    role 19758
      biological role 19758
        pharmacological role 18821
          antagonist 16219
            platelet-activating factor receptor antagonist 23
              ginkgolide B 23
Path 2
Term Annotations click to browse term
  CHEBI ontology 19810
    subatomic particle 19808
      composite particle 19808
        hadron 19808
          baryon 19808
            nucleon 19808
              atomic nucleus 19808
                atom 19808
                  main group element atom 19696
                    p-block element atom 19696
                      carbon group element atom 19599
                        carbon atom 19588
                          organic molecular entity 19588
                            organic group 18527
                              organic divalent group 18520
                                organodiyl group 18520
                                  carbonyl group 18427
                                    carbonyl compound 18427
                                      carboxylic ester 14367
                                        lactone 5988
                                          terpene lactone 1771
                                            diterpene lactone 226
                                              ginkgolide 24
                                                ginkgolide B 23
paths to the root