Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:ginkgolide B
go back to main search page
Accession:CHEBI:5356 term browser browse the term
Definition:A ginkgolide in which the pro-R hydrogens at positions 6, 12, and 17 of the 8-tert-butyl-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.0(1,11).0(3,7).0(7,11).0(13,17)]nonadecane-5,15,18-trione ginkgolide skeleton have been replaced by hydroxy groups.
Synonyms:exact_synonym: (1R,3R,6R,8S,10R,12R,13S,16S,17R)-8-tert-butyl-6,12,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.0(1,11).0(3,7).0(7,11).0(13,17)]nonadecane-5,15,18-trione
 related_synonym: Formula=C20H24O10;   InChI=1S/C20H24O10/c1-6-12(23)28-11-9(21)18-8-5-7(16(2,3)4)17(18)10(22)13(24)29-15(17)30-20(18,14(25)27-8)19(6,11)26/h6-11,15,21-22,26H,5H2,1-4H3/t6-,7+,8-,9+,10+,11+,15+,17?,18?,19-,20-/m1/s1;   InChIKey=SQOJOAFXDQDRGF-NNGCZKEZSA-N;   SMILES=C123[C@]4([C@]5([C@@H](C(=O)O[C@]5([C@@H]1O)[H])C)O)O[C@H]6C2([C@](C(C)(C)C)(C[C@]3(OC4=O)[H])[H])[C@H](C(=O)O6)O
 xref: CAS:15291-77-7;   DrugBank:DB06744;   HMDB:HMDB0036861;   KEGG:C07602;   KNApSAcK:C00035830;   LIPID_MAPS_instance:LMPR0104540002
 xref_mesh: MESH:C045856
 xref: PMID:15910800;   PMID:23695070;   PMID:25749575;   PMID:25755731;   PMID:25869596;   PMID:25887229;   PMID:26059355;   PMID:26064244;   PMID:26246869;   PMID:26382046;   PMID:26768586;   PMID:26775663;   PMID:26983247;   PMID:27182682;   PMID:27261579;   PMID:27306494;   PMID:27323179;   PMID:27744452;   PMID:27973574;   PMID:28234255;   PMID:28416372;   PMID:28689387;   PMID:28712049;   Reaxys:4727611;   Reaxys:8173450


show annotations for term's descendants           Sort by:
 
ginkgolide B term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Abcb1a ATP binding cassette subfamily B member 1A increases expression
multiple interactions
ISO ginkgolide B results in increased expression of ABCB1 mRNA
NR1I2 protein affects the reaction [ginkgolide B results in increased expression of ABCB1 mRNA]; sulforaphane inhibits the reaction [ginkgolide B results in increased expression of ABCB1 mRNA]
CTD PMID:19034627 PMID:26775663 NCBI chr 4:25,357,467...25,529,941
Ensembl chr 4:25,158,362...25,442,709
JBrowse link
G Abcc2 ATP binding cassette subfamily C member 2 increases expression ISO ginkgolide B results in increased expression of ABCC2 mRNA CTD PMID:19034627 NCBI chr 1:242,664,657...242,723,239
Ensembl chr 1:242,664,657...242,723,238
JBrowse link
G Akt1 AKT serine/threonine kinase 1 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of AKT1 protein] CTD PMID:19464278 NCBI chr 6:131,713,716...131,735,319
Ensembl chr 6:131,713,720...131,733,921
JBrowse link
G Apoe apolipoprotein E multiple interactions ISO ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the activity of GPT protein]; ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of FTH1 protein]; ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of GPX4 protein]; ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of HMOX1 protein]; ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of NFE2L2 protein]; ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of TFRC protein] CTD PMID:32976958 NCBI chr 1:79,353,924...79,357,852
Ensembl chr 1:79,353,916...79,357,932
JBrowse link
G App amyloid beta precursor protein multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased abundance of Reactive Oxygen Species]; ginkgolide B inhibits the reaction [APP protein results in increased cleavage of and results in increased activity of CASP3 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of AKT1 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK1 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK3 protein]; ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK8 protein] CTD PMID:19464278 NCBI chr11:24,019,774...24,236,584
Ensembl chr11:24,019,778...24,236,561
JBrowse link
G Casp3 caspase 3 multiple interactions ISO
EXP
ginkgolide B inhibits the reaction [APP protein results in increased cleavage of and results in increased activity of CASP3 protein]; ginkgolide B inhibits the reaction [Doxorubicin results in increased cleavage of CASP3 protein]; ginkgolide B inhibits the reaction [Staurosporine results in increased cleavage of CASP3 protein]
ginkgolide B inhibits the reaction [Ethanol results in increased activity of CASP3 protein]
CTD PMID:19464278 PMID:21704112 PMID:26775663 NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648
JBrowse link
G Cybb cytochrome b-245 beta chain multiple interactions EXP ginkgolide B inhibits the reaction [Ethanol results in increased expression of NOX2 protein] CTD PMID:21704112 NCBI chr  X:13,360,583...13,392,517
Ensembl chr  X:13,359,430...13,392,586
JBrowse link
G Cyp1a1 cytochrome P450, family 1, subfamily a, polypeptide 1 multiple interactions ISO [Quercetin co-treated with kaempferol co-treated with 3-methylquercetin co-treated with ginkgolide A co-treated with ginkgolide B co-treated with ginkgolide C co-treated with ginkgolide J co-treated with bilobalide] affects the activity of CYP1A1 protein; [Quercetin co-treated with kaempferol co-treated with 3-methylquercetin co-treated with ginkgolide A co-treated with ginkgolide B co-treated with ginkgolide C co-treated with ginkgolide J co-treated with bilobalide] inhibits the reaction [Benzo(a)pyrene results in increased activity of CYP1A1 protein]; [Quercetin co-treated with kaempferol co-treated with 3-methylquercetin co-treated with ginkgolide A co-treated with ginkgolide B co-treated with ginkgolide C co-treated with ginkgolide J co-treated with bilobalide] inhibits the reaction [Tetrachlorodibenzodioxin results in increased activity of CYP1A1 protein] CTD PMID:21329749 NCBI chr 8:58,096,021...58,102,130
Ensembl chr 8:58,096,077...58,102,125
JBrowse link
G Cyp1a2 cytochrome P450, family 1, subfamily a, polypeptide 2 multiple interactions
increases expression
EXP ginkgolide B results in increased expression of and results in increased activity of CYP1A2 protein
ginkgolide B results in increased expression of CYP1A2 mRNA
CTD PMID:18421621 NCBI chr 8:58,075,367...58,082,255
Ensembl chr 8:58,075,367...58,082,312
JBrowse link
G Cyp2b3 cytochrome P450, family 2, subfamily b, polypeptide 3 increases expression ISO ginkgolide B results in increased expression of CYP2B6 mRNA CTD PMID:19034627 NCBI chr 1:81,652,762...81,732,153
Ensembl chr 1:81,652,787...81,732,143
JBrowse link
G Cyp3a2 cytochrome P450, family 3, subfamily a, polypeptide 2 multiple interactions
increases expression
ISO NR1I2 protein affects the reaction [ginkgolide B results in increased expression of CYP3A4 mRNA]; sulforaphane inhibits the reaction [ginkgolide B results in increased expression of CYP3A4 mRNA] CTD PMID:19034627 PMID:26775663 NCBI chr12:9,207,986...9,230,038
Ensembl chr12:9,015,383...9,285,008
JBrowse link
G Fcer1g Fc fragment of IgE receptor Ig decreases expression EXP ginkgolide B results in decreased expression of FCER1G protein CTD PMID:1834581 NCBI chr13:83,649,447...83,654,215
Ensembl chr13:83,649,449...83,671,443
JBrowse link
G Fth1 ferritin heavy chain 1 multiple interactions ISO ginkgolide B inhibits the reaction [[Palmitic Acid co-treated with Oleic Acid] results in decreased expression of FTH1 protein]
ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of FTH1 protein]
CTD PMID:32976958 NCBI chr 1:206,627,142...206,629,430
Ensembl chr 1:206,627,103...206,725,424
JBrowse link
G Gpt glutamic--pyruvic transaminase multiple interactions ISO ginkgolide B inhibits the reaction [[Palmitic Acid co-treated with Oleic Acid] results in increased activity of GPT protein]
ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the activity of GPT protein]
CTD PMID:32976958 NCBI chr 7:108,416,646...108,419,495
Ensembl chr 7:108,416,642...108,419,494
JBrowse link
G Gpx4 glutathione peroxidase 4 multiple interactions ISO ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of GPX4 protein]
ginkgolide B inhibits the reaction [[Palmitic Acid co-treated with Oleic Acid] results in decreased expression of GPX4 protein]
CTD PMID:32976958 NCBI chr 7:9,650,186...9,652,982
Ensembl chr 7:9,650,185...9,652,982
JBrowse link
G Hmox1 heme oxygenase 1 multiple interactions ISO ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of HMOX1 protein]
ginkgolide B inhibits the reaction [[Palmitic Acid co-treated with Oleic Acid] results in decreased expression of HMOX1 protein]
CTD PMID:32976958 NCBI chr19:13,466,287...13,474,082
Ensembl chr19:13,467,244...13,474,079
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK1 protein] CTD PMID:19464278 NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK3 protein] CTD PMID:19464278 NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
JBrowse link
G Mapk8 mitogen-activated protein kinase 8 multiple interactions ISO ginkgolide B inhibits the reaction [APP protein results in increased phosphorylation of and results in increased activity of MAPK8 protein] CTD PMID:19464278 NCBI chr16:8,638,897...8,721,960
Ensembl chr16:8,638,924...8,721,981
JBrowse link
G Ncf1 neutrophil cytosolic factor 1 multiple interactions EXP ginkgolide B inhibits the reaction [Ethanol results in increased expression of NCF1 protein] CTD PMID:21704112 NCBI chr12:22,485,382...22,494,647
Ensembl chr12:22,485,451...22,494,646
JBrowse link
G Nfe2l2 nuclear factor, erythroid 2-like 2 multiple interactions ISO ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of NFE2L2 protein]
ginkgolide B inhibits the reaction [[Palmitic Acid co-treated with Oleic Acid] results in decreased expression of and affects the localization of NFE2L2 protein]
CTD PMID:32976958 NCBI chr 3:60,594,239...60,621,785
Ensembl chr 3:60,594,242...60,621,737
JBrowse link
G Nos2 nitric oxide synthase 2 multiple interactions EXP ginkgolide B inhibits the reaction [Cyclophosphamide results in increased activity of NOS2 protein] CTD PMID:9006340 NCBI chr10:63,815,308...63,851,208
Ensembl chr10:63,815,308...63,851,210
JBrowse link
G Nox4 NADPH oxidase 4 multiple interactions ISO ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 protein]; MIR214 mRNA affects the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]] CTD PMID:26768586 NCBI chr 1:140,900,886...141,078,844
Ensembl chr 1:140,901,097...141,077,406
JBrowse link
G Nr1i2 nuclear receptor subfamily 1, group I, member 2 increases activity
multiple interactions
affects localization
ISO ginkgolide B results in increased activity of NR1I2 protein
NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]]; NR1I2 protein affects the reaction [ginkgolide B results in increased expression of ABCB1 mRNA]; NR1I2 protein affects the reaction [ginkgolide B results in increased expression of CYP3A4 mRNA]
ginkgolide B affects the localization of NR1I2 protein
CTD PMID:19034627 PMID:26775663 NCBI chr11:62,460,213...62,496,665
Ensembl chr11:62,460,213...62,496,658
JBrowse link
G Sele selectin E multiple interactions ISO ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]] CTD PMID:26775663 NCBI chr13:76,402,841...76,412,741
Ensembl chr13:76,403,304...76,412,741
JBrowse link
G Shc1 SHC adaptor protein 1 multiple interactions ISO ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 protein]; MIR214 mRNA affects the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]] CTD PMID:26768586 NCBI chr 2:174,837,937...174,849,538
Ensembl chr 2:174,837,930...174,849,536
JBrowse link
G Tfrc transferrin receptor multiple interactions ISO ginkgolide B inhibits the reaction [[APOE protein affects the susceptibility to Dietary Fats] which affects the expression of TFRC protein]
ginkgolide B inhibits the reaction [[Palmitic Acid co-treated with Oleic Acid] results in increased expression of TFRC protein]
CTD PMID:32976958 NCBI chr11:68,163,413...68,185,257
Ensembl chr11:68,163,413...68,185,257
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of SELE protein]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]] CTD PMID:26775663 NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629
JBrowse link
G Tp53 tumor protein p53 multiple interactions ISO ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]; ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of TRP53 mRNA]; ginkgolide B inhibits the reaction [Cisplatin results in increased expression of TRP53 protein]; MIR214 mRNA affects the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of TRP53 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to NOX4 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin promotes the reaction [TRP53 protein binds to SHC1 promoter]]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of NOX4 mRNA]]; TRP53 protein inhibits the reaction [ginkgolide B inhibits the reaction [Cisplatin results in increased expression of SHC1 mRNA]] CTD PMID:26768586 NCBI chr10:54,300,070...54,311,525
Ensembl chr10:54,300,048...54,311,524
JBrowse link
G Ugt1a1 UDP glucuronosyltransferase family 1 member A1 increases expression ISO ginkgolide B results in increased expression of UGT1A1 mRNA CTD PMID:19034627 NCBI chr 9:88,801,344...88,808,465 JBrowse link
G Vcam1 vascular cell adhesion molecule 1 multiple interactions ISO ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]; ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 mRNA]]; NR1I2 protein affects the reaction [ginkgolide B inhibits the reaction [TNF protein results in increased expression of VCAM1 protein]] CTD PMID:26775663 NCBI chr 2:204,038,120...204,057,852
Ensembl chr 2:204,038,114...204,057,958
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19812
    role 19761
      biological role 19761
        pharmacological role 18842
          antagonist 16278
            platelet-activating factor receptor antagonist 31
              ginkgolide B 31
Path 2
Term Annotations click to browse term
  CHEBI ontology 19812
    subatomic particle 19811
      composite particle 19811
        hadron 19811
          baryon 19811
            nucleon 19811
              atomic nucleus 19811
                atom 19811
                  main group element atom 19708
                    p-block element atom 19708
                      carbon group element atom 19630
                        carbon atom 19620
                          organic molecular entity 19620
                            organic group 18728
                              organic divalent group 18719
                                organodiyl group 18719
                                  carbonyl group 18667
                                    carbonyl compound 18667
                                      carboxylic ester 15889
                                        lactone 11245
                                          terpene lactone 1786
                                            diterpene lactone 230
                                              ginkgolide 32
                                                ginkgolide B 31
paths to the root