(R)-adrenaline - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	(R)-adrenaline	go back to main search page
Accession:	CHEBI:28918	browse the term
Definition:	The R-enantiomer of adrenaline.
Synonyms:	exact_synonym:	4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol
	related_synonym:	(-)-(R)-epinephrine; (-)-3,4-dihydroxy-alpha-((methylamino)methyl)benzyl alcohol; (R)-(-)-Adnephrine; (R)-(-)-Epirenamine; 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol; Adrenalin; C9H13NO3; CNC[C@H](O)c1ccc(O)c(O)c1; Epinephrin; Epipen; Epipen JR; InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1; InChIKey=UCTWMZQNUQWSLP-VIFPVBQESA-N; L-Adrenaline; Primatene; adrenaline; epinefrina; epinephrine; epinephrinum; levoepinephrine
	alt_id:	CHEBI:1942; CHEBI:23928
	xref_casrn:	51-43-4
	xref:	Beilstein:2368277 "Beilstein Registry Number"; ChEMBL:128976 "ChEMBL COMPOUND"; ChemIDplus:51-43-4 "CAS Registry Number"; CiteXplore:18325983 "PubMed citation"; CiteXplore:21963816 "PubMed citation"; CiteXplore:22115931 "PubMed citation"; CiteXplore:22405854 "PubMed citation"; CiteXplore:22425731 "PubMed citation"; CiteXplore:22429969 "PubMed citation"; CiteXplore:22569014 "PubMed citation"; CiteXplore:22623754 "PubMed citation"; CiteXplore:22826982 "PubMed citation"; CiteXplore:22895980 "PubMed citation"; CiteXplore:22898765 "PubMed citation"; CiteXplore:22905594 "PubMed citation"; CiteXplore:22940899 "PubMed citation"; CiteXplore:23066296 "PubMed citation"; CiteXplore:23130169 "PubMed citation"; CiteXplore:23164182 "PubMed citation"; CiteXplore:23185846 "PubMed citation"; DrugBank:DB00668 "DrugBank"; HMDB:HMDB00068 "HMDB"; KEGG COMPOUND:51-43-4 "CAS Registry Number"; KEGG COMPOUND:C00788 "KEGG COMPOUND"; KEGG DRUG:D00095 "KEGG DRUG"
	xref_mesh:	MESH:D004837
	xref:	MetaCyc:L-EPINEPHRINE "MetaCyc"; NIST Chemistry WebBook:51-43-4 "CAS Registry Number"; Reaxys:2368277 "Reaxys Registry Number"; Wikipedia:Epinephrine "Wikipedia"
	cyclic_relationship:	is_conjugate_base_of CHEBI:71406; is_enantiomer_of CHEBI:40751

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

(R)-adrenaline
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Abcc1	ATP-binding cassette, subfamily C (CFTR/MRP), member 1		multiple interactions	EXP	10	452,239	575,705	RGD:6480464	CTD
G	Abcc1	ATP-binding cassette, subfamily C (CFTR/MRP), member 1		increases export	EXP	10	452,239	575,705	RGD:6480464	CTD
G	Abp1	amiloride binding protein 1 (amine oxidase, copper-containing)		multiple interactions	EXP	4	76,957,477	76,977,643	RGD:6480464	CTD
G	Abp1	amiloride binding protein 1 (amine oxidase, copper-containing)		increases activity	EXP	4	76,957,477	76,977,643	RGD:6480464	CTD
G	Aco2	aconitase 2, mitochondrial		increases expression	EXP	7	120,223,788	120,266,944	RGD:6480464	CTD
G	Actn1	actinin, alpha 1		increases expression	EXP	6	103,188,593	103,282,873	RGD:6480464	CTD
G	Adra1a	adrenoceptor alpha 1A		multiple interactions	EXP	15	46,173,429	46,263,198	RGD:6480464	CTD
G	Adra1a	adrenoceptor alpha 1A		affects binding	ISO	15	46,173,429	46,263,198	RGD:6480464	CTD
G	Adra1a	adrenoceptor alpha 1A		multiple interactions	ISO	15	46,173,429	46,263,198	RGD:6480464	CTD
G	Adra1a	adrenoceptor alpha 1A		increases activity	ISO	15	46,173,429	46,263,198	RGD:6480464	CTD
G	Adra1a	adrenoceptor alpha 1A		multiple interactions	ISO	15	46,173,429	46,263,198	RGD:6480464	CTD
G	Adra1b	adrenoceptor alpha 1B		multiple interactions	ISO	10	28,889,092	28,946,889	RGD:6480464	CTD
G	Adra1b	adrenoceptor alpha 1B		increases activity	ISO	10	28,889,092	28,946,889	RGD:6480464	CTD
G	Adra1b	adrenoceptor alpha 1B		multiple interactions	ISO	10	28,889,092	28,946,889	RGD:6480464	CTD
G	Adra1d	adrenoceptor alpha 1D		affects binding	ISO	3	119,279,974	119,295,985	RGD:6480464	CTD
G	Adra1d	adrenoceptor alpha 1D		multiple interactions	ISO	3	119,279,974	119,295,985	RGD:6480464	CTD
G	Adra1d	adrenoceptor alpha 1D		increases activity	ISO	3	119,279,974	119,295,985	RGD:6480464	CTD
G	Adra1d	adrenoceptor alpha 1D		multiple interactions	ISO	3	119,279,974	119,295,985	RGD:6480464	CTD
G	Adra2a	adrenoceptor alpha 2A		increases activity	EXP				RGD:6480464	CTD
G	Adra2a	adrenoceptor alpha 2A		multiple interactions	ISO				RGD:6480464	CTD
G	Adra2b	adrenoceptor alpha 2B		multiple interactions	ISO	3	114,867,357	114,869,680	RGD:6480464	CTD
G	Adra2c	adrenoceptor alpha 2C		multiple interactions	ISO	14	81,107,907	81,109,610	RGD:6480464	CTD
G	Adrb1	adrenoceptor beta 1		multiple interactions	ISO	1	263,025,655	263,027,055	RGD:6480464	CTD
G	Adrb1	adrenoceptor beta 1		multiple interactions	ISO	1	263,025,655	263,027,055	RGD:6480464	CTD
G	Adrb1	adrenoceptor beta 1		multiple interactions	EXP	1	263,025,655	263,027,055	RGD:6480464	CTD
G	Adrb1	adrenoceptor beta 1		multiple interactions	ISO	1	263,025,655	263,027,055	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		increases activity	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		increases activity	EXP	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		affects response to substance	EXP	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	EXP	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb3	adrenoceptor beta 3		multiple interactions	ISO	16	69,163,620	69,166,384	RGD:6480464	CTD
G	Adrb3	adrenoceptor beta 3		multiple interactions	EXP	16	69,163,620	69,166,384	RGD:6480464	CTD
G	Adrb3	adrenoceptor beta 3		multiple interactions	ISO	16	69,163,620	69,166,384	RGD:6480464	CTD
G	Adrb3	adrenoceptor beta 3		multiple interactions	ISO	16	69,163,620	69,166,384	RGD:6480464	CTD
G	Adrb3	adrenoceptor beta 3		multiple interactions	ISO	16	69,163,620	69,166,384	RGD:6480464	CTD
G	Adrbk1	adrenergic, beta, receptor kinase 1		multiple interactions	ISO	1	206,873,002	206,892,868	RGD:6480464	CTD
G	Ak2	adenylate kinase 2		decreases expression	EXP	5	148,156,751	148,176,195	RGD:6480464	CTD
G	Ak2	adenylate kinase 2		multiple interactions	EXP	5	148,156,751	148,176,195	RGD:6480464	CTD
G	Aqp7	aquaporin 7		affects localization	ISO	5	58,433,731	58,447,853	RGD:6480464	CTD
G	Aqp7	aquaporin 7		increases expression	ISO	5	58,433,731	58,447,853	RGD:6480464	CTD
G	Aqp7	aquaporin 7		multiple interactions	ISO	5	58,433,731	58,447,853	RGD:6480464	CTD
G	Atp5a1	ATP synthase, H+ transporting, mitochondrial F1 complex, alpha subunit 1, cardiac muscle		increases expression	EXP	18	74,735,267	74,743,088	RGD:6480464	CTD
G	C1qbp	complement component 1, q subcomponent binding protein		multiple interactions	EXP	10	57,881,783	57,886,434	RGD:6480464	CTD
G	C1qbp	complement component 1, q subcomponent binding protein		increases expression	EXP	10	57,881,783	57,886,434	RGD:6480464	CTD
G	Ca2	carbonic anhydrase 2		increases expression	ISO	2	88,077,095	88,092,223	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases abundance	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Chrna7	cholinergic receptor, nicotinic, alpha 7 (neuronal)		multiple interactions	ISO	1	117,587,580	117,716,267	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		increases methylation	ISO	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		multiple interactions	ISO	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		increases methylation	EXP	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		multiple interactions	EXP	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		multiple interactions	EXP	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		multiple interactions	EXP	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Crh	corticotropin releasing hormone		multiple interactions	EXP	2	104,764,023	104,765,887	RGD:6480464	CTD
G	Crh	corticotropin releasing hormone		increases abundance	EXP	2	104,764,023	104,765,887	RGD:6480464	CTD
G	Csk	c-src tyrosine kinase		multiple interactions	ISO	8	61,381,336	61,386,013	RGD:6480464	CTD
G	Ctsk	cathepsin K		increases expression	ISO	2	190,394,854	190,405,668	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		multiple interactions	EXP	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		increases expression	EXP	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Dbh	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		affects abundance	ISO	3	6,052,706	6,069,826	RGD:6480464	CTD
G	Des	desmin		multiple interactions	EXP	9	74,637,783	74,645,499	RGD:6480464	CTD
G	Des	desmin		decreases expression	EXP	9	74,637,783	74,645,499	RGD:6480464	CTD
G	Dlat	dihydrolipoamide S-acetyltransferase		multiple interactions	EXP	8	53,989,491	54,014,779	RGD:6480464	CTD
G	Echs1	enoyl CoA hydratase, short chain, 1, mitochondrial		multiple interactions	EXP	1	199,901,585	199,910,412	RGD:6480464	CTD
G	Etfb	electron-transfer-flavoprotein, beta polypeptide		multiple interactions	EXP	1	93,820,124	93,834,288	RGD:6480464	CTD
G	Fabp3	fatty acid binding protein 3, muscle and heart		affects expression	EXP	5	149,340,525	149,347,268	RGD:6480464	CTD
G	Fabp3	fatty acid binding protein 3, muscle and heart		multiple interactions	EXP	5	149,340,525	149,347,268	RGD:6480464	CTD
G	Fas	Fas cell surface death receptor		multiple interactions	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas cell surface death receptor		increases expression	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		multiple interactions	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		increases expression	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Fh	fumarate hydratase		increases expression	EXP	13	91,329,837	91,355,722	RGD:6480464	CTD
G	Grk5	G protein-coupled receptor kinase 5		multiple interactions	ISO	1	267,495,534	267,693,144	RGD:6480464	CTD
G	Hadh	hydroxyacyl-CoA dehydrogenase		multiple interactions	EXP	2	228,698,545	228,751,691	RGD:6480464	CTD
G	Hsf1	heat shock transcription factor 1		multiple interactions	EXP	7	114,524,211	114,551,166	RGD:6480464	CTD
G	Hsf1	heat shock transcription factor 1		affects localization	EXP	7	114,524,211	114,551,166	RGD:6480464	CTD
G	Hsp90ab1	heat shock protein 90 alpha (cytosolic), class B member 1		multiple interactions	EXP	9	11,033,496	11,038,868	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		multiple interactions	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa8	heat shock 70kDa protein 8		increases expression	EXP	8	43,784,035	43,787,760	RGD:6480464	CTD
G	Hspa9	heat shock protein 9		multiple interactions	EXP	18	27,419,614	27,437,031	RGD:6480464	CTD
G	Hspb6	heat shock protein, alpha-crystallin-related, B6		decreases expression	EXP	1	85,599,075	85,601,214	RGD:6480464	CTD
G	Hspb6	heat shock protein, alpha-crystallin-related, B6		multiple interactions	EXP	1	85,599,075	85,601,214	RGD:6480464	CTD
G	Idh2	isocitrate dehydrogenase 2 (NADP+), mitochondrial		decreases expression	EXP	1	135,876,052	135,895,373	RGD:6480464	CTD
G	Idh2	isocitrate dehydrogenase 2 (NADP+), mitochondrial		multiple interactions	EXP	1	135,876,052	135,895,373	RGD:6480464	CTD
G	Il10	interleukin 10		multiple interactions	ISO	13	43,953,900	43,957,766	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	ISO	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Ins2	insulin 2		decreases expression	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Ins2	insulin 2		decreases expression	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Itga2	integrin, alpha 2		multiple interactions	ISO	2	46,967,681	47,080,909	RGD:6480464	CTD
G	Itgav	integrin, alpha V		increases expression	ISO	3	66,953,403	67,029,774	RGD:6480464	CTD
G	Itgb1	integrin, beta 1		increases response to substance	EXP	19	58,600,095	58,647,531	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		multiple interactions	ISO	1	80,663,791	80,682,480	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		increases activity	ISO	1	80,663,791	80,682,480	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		affects localization	EXP	1	80,663,791	80,682,480	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		increases expression	ISO	1	80,663,791	80,682,480	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		affects activity	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases activity	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		affects activity	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases activity	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Myl2	myosin, light chain 2, regulatory, cardiac, slow		multiple interactions	EXP	12	35,653,745	35,664,700	RGD:6480464	CTD
G	Myl2	myosin, light chain 2, regulatory, cardiac, slow		affects expression	EXP	12	35,653,745	35,664,700	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	EXP	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		increases expression	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Ntf3	neurotrophin 3		increases expression	EXP	4	162,435,781	162,506,961	RGD:6480464	CTD
G	P2rx7	purinergic receptor P2X, ligand-gated ion channel, 7		decreases activity	ISO	12	35,074,025	35,117,152	RGD:6480464	CTD
G	P2ry12	purinergic receptor P2Y, G-protein coupled, 12		multiple interactions	ISO	2	148,611,035	148,613,985	RGD:6480464	CTD
G	Phb	prohibitin		increases expression	EXP				RGD:6480464	CTD
G	Phb	prohibitin		multiple interactions	EXP				RGD:6480464	CTD
G	Phgdh	phosphoglycerate dehydrogenase		increases expression	EXP	2	193,147,943	193,177,137	RGD:6480464	CTD
G	Pkm	pyruvate kinase, muscle		multiple interactions	EXP	8	63,486,492	63,508,016	RGD:6480464	CTD
G	Ppp2r1a	protein phosphatase 2, regulatory subunit A, alpha		decreases expression	EXP	1	58,442,220	58,461,462	RGD:6480464	CTD
G	Ppp2r1a	protein phosphatase 2, regulatory subunit A, alpha		multiple interactions	EXP	1	58,442,220	58,461,462	RGD:6480464	CTD
G	Prdx6	peroxiredoxin 6		multiple interactions	EXP	13	76,824,968	76,835,517	RGD:6480464	CTD
G	Prdx6	peroxiredoxin 6		decreases expression	EXP	13	76,824,968	76,835,517	RGD:6480464	CTD
G	Prkce	protein kinase C, epsilon		affects response to substance	ISO	6	9,631,234	10,097,311	RGD:6480464	CTD
G	Prkce	protein kinase C, epsilon		affects response to substance	EXP	6	9,631,234	10,097,311	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	EXP	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Ren	renin		increases activity	ISO	13	46,262,936	46,275,213	RGD:6480464	CTD
G	Ren	renin		multiple interactions	ISO	13	46,262,936	46,275,213	RGD:6480464	CTD
G	Ren	renin		increases activity	ISO	13	46,262,936	46,275,213	RGD:6480464	CTD
G	Sct	secretin		multiple interactions	EXP	1	201,472,250	201,472,944	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		increases expression	ISO	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Slc22a3	solute carrier family 22 (extraneuronal monoamine transporter), member 3		multiple interactions	EXP	1	42,690,158	42,781,895	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	ISO	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		increases expression	ISO	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		increases activity	ISO	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		increases expression	EXP	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	EXP	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		increases activity	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		increases expression	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		increases expression	EXP	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	EXP	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Suclg2	succinate-CoA ligase, GDP-forming, beta subunit		increases expression	EXP	4	129,995,856	130,276,182	RGD:6480464	CTD
G	Th	tyrosine hydroxylase		increases chemical synthesis	ISO	1	203,164,253	203,171,506	RGD:6480464	CTD
G	Th	tyrosine hydroxylase		multiple interactions	EXP	1	203,164,253	203,171,506	RGD:6480464	CTD
G	Thy1	Thy-1 cell surface antigen		multiple interactions	ISO	8	47,027,721	47,031,857	RGD:6480464	CTD
G	Thy1	Thy-1 cell surface antigen		decreases expression	ISO	8	47,027,721	47,031,857	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases secretion	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Vdac1	voltage-dependent anion channel 1		increases expression	EXP	10	37,795,721	37,823,253	RGD:6480464	CTD
G	Vdac1	voltage-dependent anion channel 1		multiple interactions	EXP	10	37,795,721	37,823,253	RGD:6480464	CTD
G	Xdh	xanthine dehydrogenase		multiple interactions	EXP	6	21,417,685	21,590,015	RGD:6480464	CTD
G	Xdh	xanthine dehydrogenase		multiple interactions	EXP	6	21,417,685	21,590,015	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	501881
role	491510
biological role	489686
molecular messenger	58825
hormone	42571
(R)-adrenaline	166
(R)-adrenaline hydrochloride	0
Path 2
Term	Annotations
CHEBI ontology	501881
subatomic particle	500845
composite particle	500845
hadron	500845
baryon	500845
nucleon	500845
atomic nucleus	500845
atom	500845
main group element atom	470301
main group molecular entity	465185
s-block molecular entity	315220
hydrogen molecular entity	312457
hydrides	195649
inorganic hydride	83087
pnictogen hydride	81304
nitrogen hydride	81299
azane	75531
ammonia	75343
organic amino compound	75282
aralkylamino compound	1842
monoamine	1110
monoamine molecular messenger	1110
catecholamine	957
adrenaline	166
(R)-adrenaline	166
(R)-adrenaline hydrochloride	0