Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:spiperone
go back to main search page
Accession:CHEBI:9233 term browser browse the term
Definition:An azaspiro compound that is 1,3,8-triazaspiro[4.5]decane which is substituted at positions 1, 4, and 8 by phenyl, oxo, and 4-(p-fluorophenyl)-4-oxobutyl groups, respectively.
Synonyms:exact_synonym: 8-[4-(4-fluorophenyl)-4-oxobutyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one
 related_synonym: 1-[2-[4-[5-chloro-1-(4-fluorophenyl)-indol-3-yl]-1-piperidyl]ethyl]imidazolidin-2-one;   8-(3-(p-fluorobenzoyl)propyl)-1-phenyl-1,3,8-triazaspiro(4.5)decan-4-one;   8-(3-p-fluorobenzoyl-1-propyl)-4-oxo-1-phenyl-1,3,8-triazaspiro(4,5)decane;   Formula=C23H26FN3O2;   InChI=1S/C23H26FN3O2/c24-19-10-8-18(9-11-19)21(28)7-4-14-26-15-12-23(13-16-26)22(29)25-17-27(23)20-5-2-1-3-6-20/h1-3,5-6,8-11H,4,7,12-17H2,(H,25,29);   InChIKey=DKGZKTPJOSAWFA-UHFFFAOYSA-N;   SMILES=Fc1ccc(cc1)C(=O)CCCN1CCC2(CC1)N(CNC2=O)c1ccccc1;   Spiropitan;   espiperona;   spiperonum
 xref: Beilstein:632204;   CAS:749-02-0;   Drug_Central:2470;   KEGG:D01051;   LINCS:LSM-3235
 xref_mesh: MESH:D013134
 xref: PMID:18987251;   PMID:19948059;   PMID:6106952;   PMID:6149442;   Patent:US3155669;   Patent:US3155670;   Patent:US3161644;   Reaxys:632204;   Wikipedia:Spiperone


show annotations for term's descendants           Sort by:
 
spiperone term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Abcb1a ATP binding cassette subfamily B member 1A multiple interactions EXP Spiperone inhibits the reaction [Bromocriptine results in increased expression of ABCB1 protein]; Spiperone inhibits the reaction [N-n-propylnorapomorphine results in increased expression of ABCB1 protein]; Spiperone inhibits the reaction [Quinpirole results in increased expression of ABCB1 protein] CTD PMID:9111066 NCBI chr 4:25,357,467...25,529,941
Ensembl chr 4:25,158,362...25,442,709
JBrowse link
G Abcb1b ATP-binding cassette, subfamily B (MDR/TAP), member 1B multiple interactions EXP Spiperone inhibits the reaction [Bromocriptine results in increased activity of ABCB1B promoter]; Spiperone inhibits the reaction [N-n-propylnorapomorphine results in increased activity of ABCB1B promoter]; Spiperone inhibits the reaction [Quinpirole results in increased activity of ABCB1B promoter] CTD PMID:9111066 NCBI chr 4:25,242,761...25,325,194
Ensembl chr 4:25,242,798...25,325,199
JBrowse link
G Adra1a adrenoceptor alpha 1A multiple interactions EXP Spiperone inhibits the reaction [Norepinephrine results in increased activity of ADRA1A protein] CTD PMID:10416824 NCBI chr15:40,830,125...40,935,902
Ensembl chr15:40,832,534...40,927,500
JBrowse link
G Drd1 dopamine receptor D1 multiple interactions EXP Spiperone inhibits the reaction [A 86929 promotes the reaction [DRD1 protein results in increased chemical synthesis of Cyclic AMP]] CTD PMID:8558425 NCBI chr17:10,540,440...10,544,971
Ensembl chr17:10,540,558...10,545,002
JBrowse link
G Drd2 dopamine receptor D2 multiple interactions
affects binding
ISO
EXP
amitraz inhibits the reaction [Spiperone binds to DRD2 protein]; demethylchlordimeform inhibits the reaction [Spiperone binds to DRD2 protein]; NR3C1 protein promotes the reaction [Spiperone binds to DRD2 protein]
Melitten inhibits the reaction [Spiperone binds to DRD2 protein]
8-fluoro-12-(4-methylpiperazin-1-yl)-6H-(1)benzothieno(2,3-b)(1,5)benzodiazepine inhibits the reaction [Spiperone binds to DRD2 protein]; Amphetamine inhibits the reaction [Spiperone binds to DRD2 protein]; Caffeine inhibits the reaction [N-Methyl-3,4-methylenedioxyamphetamine promotes the reaction [Spiperone binds to DRD2 protein]]; Cocaine affects the reaction [Spiperone binds to DRD2 protein]; Haloperidol inhibits the reaction [Spiperone binds to DRD2 protein]; manganese chloride inhibits the reaction [DRD2 protein binds to Spiperone]; N-Methyl-3,4-methylenedioxyamphetamine promotes the reaction [Spiperone binds to DRD2 protein]; perospirone inhibits the reaction [Spiperone binds to DRD2 protein]; Pilocarpine inhibits the reaction [Spiperone binds to DRD2 protein]; Pilocarpine promotes the reaction [Spiperone binds to DRD2 protein]; Remoxipride inhibits the reaction [Spiperone binds to DRD2 protein]; Spiperone inhibits the reaction [Cocaine promotes the reaction [[DRD2 protein results in increased phosphorylation of TH protein] which results in increased abundance of Dopamine]]
CTD PMID:1975278 PMID:2018630 PMID:2833825 PMID:6149133 PMID:8804920 More... NCBI chr 8:49,708,903...49,772,888
Ensembl chr 8:49,708,927...49,772,875
JBrowse link
G Drd3 dopamine receptor D3 affects binding
multiple interactions
ISO Spiperone binds to DRD3 protein
N-Methyl-3,4-methylenedioxyamphetamine inhibits the reaction [Spiperone binds to DRD3 protein]
CTD PMID:21999579 PMID:29458138 NCBI chr11:56,879,689...56,931,901
Ensembl chr11:56,879,689...56,940,596
JBrowse link
G Drd4 dopamine receptor D4 affects binding
multiple interactions
ISO
EXP
Spiperone binds to DRD4 protein
Spiperone binds to Drd4 protein
N-Methyl-3,4-methylenedioxyamphetamine inhibits the reaction [Spiperone binds to DRD4 protein]
CTD PMID:21999579 PMID:29458138 PMID:8078498 RGD:7248459 NCBI chr 1:196,396,366...196,400,824
Ensembl chr 1:196,396,366...196,399,553
JBrowse link
G Htr1a 5-hydroxytryptamine receptor 1A multiple interactions EXP
ISO
Spiperone binds to and results in decreased activity of HTR1A protein CTD PMID:2207497 PMID:15482641 NCBI chr 2:36,694,174...36,695,442
Ensembl chr 2:36,694,174...36,695,442
JBrowse link
G Htr2a 5-hydroxytryptamine receptor 2A multiple interactions ISO Spiperone inhibits the reaction [Ketanserin binds to HTR2A protein] CTD PMID:2891550 NCBI chr15:49,950,035...50,022,188
Ensembl chr15:49,950,804...50,020,928
JBrowse link
G Htr7 5-hydroxytryptamine receptor 7 multiple interactions ISO [Spiperone binds to and results in decreased activity of HTR7 protein] inhibits the reaction [5-carboxamidotryptamine results in increased abundance of Cyclic AMP] CTD PMID:14578406 NCBI chr 1:233,636,442...233,761,063
Ensembl chr 1:233,636,452...233,760,626
JBrowse link
G Nr3c1 nuclear receptor subfamily 3, group C, member 1 multiple interactions ISO NR3C1 protein promotes the reaction [Spiperone binds to DRD2 protein] CTD PMID:11226678 NCBI chr18:31,271,681...31,393,320
Ensembl chr18:31,271,681...31,393,375
JBrowse link
G Slc22a2 solute carrier family 22 member 2 multiple interactions ISO Spiperone inhibits the reaction [SLC22A2 protein results in increased uptake of 4-(4-dimethylaminostyryl)-1-methylpyridinium] CTD PMID:21599003 NCBI chr 1:48,121,061...48,163,268
Ensembl chr 1:48,121,061...48,163,268
JBrowse link
G Th tyrosine hydroxylase multiple interactions EXP Spiperone inhibits the reaction [Cocaine promotes the reaction [[DRD2 protein results in increased phosphorylation of TH protein] which results in increased abundance of Dopamine]] CTD PMID:20729865 NCBI chr 1:198,071,500...198,078,832
Ensembl chr 1:198,071,503...198,109,767
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19821
    role 19769
      application 19481
        pharmaceutical 19329
          drug 19329
            central nervous system drug 16522
              psychotropic drug 15171
                spiperone 13
Path 2
Term Annotations click to browse term
  CHEBI ontology 19821
    subatomic particle 19819
      composite particle 19819
        hadron 19819
          baryon 19819
            nucleon 19819
              atomic nucleus 19819
                atom 19819
                  main group element atom 19716
                    main group molecular entity 19716
                      s-block molecular entity 19502
                        hydrogen molecular entity 19498
                          hydrides 18852
                            inorganic hydride 17691
                              pnictogen hydride 17672
                                nitrogen hydride 17545
                                  azane 17279
                                    ammonia 17278
                                      organic amino compound 17278
                                        tertiary amino compound 8679
                                          spiperone 13
paths to the root