Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:spiperone
go back to main search page
Accession:CHEBI:9233 term browser browse the term
Definition:An azaspiro compound that is 1,3,8-triazaspiro[4.5]decane which is substituted at positions 1, 4, and 8 by phenyl, oxo, and 4-(p-fluorophenyl)-4-oxobutyl groups, respectively.
Synonyms:exact_synonym: 8-[4-(4-fluorophenyl)-4-oxobutyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one
 related_synonym: 1-[2-[4-[5-chloro-1-(4-fluorophenyl)-indol-3-yl]-1-piperidyl]ethyl]imidazolidin-2-one;   8-(3-(p-fluorobenzoyl)propyl)-1-phenyl-1,3,8-triazaspiro(4.5)decan-4-one;   8-(3-p-fluorobenzoyl-1-propyl)-4-oxo-1-phenyl-1,3,8-triazaspiro(4,5)decane;   Formula=C23H26FN3O2;   InChI=1S/C23H26FN3O2/c24-19-10-8-18(9-11-19)21(28)7-4-14-26-15-12-23(13-16-26)22(29)25-17-27(23)20-5-2-1-3-6-20/h1-3,5-6,8-11H,4,7,12-17H2,(H,25,29);   InChIKey=DKGZKTPJOSAWFA-UHFFFAOYSA-N;   SMILES=Fc1ccc(cc1)C(=O)CCCN1CCC2(CC1)N(CNC2=O)c1ccccc1;   Spiropitan;   espiperona;   spiperonum
 xref: Beilstein:632204;   CAS:749-02-0;   Drug_Central:2470;   KEGG:D01051;   LINCS:LSM-3235
 xref_mesh: MESH:D013134
 xref: PMID:18987251;   PMID:19948059;   PMID:6106952;   PMID:6149442;   Patent:US3155669;   Patent:US3155670;   Patent:US3161644;   Reaxys:632204;   Wikipedia:Spiperone


show annotations for term's descendants           Sort by:
 
spiperone term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Abcb1a ATP binding cassette subfamily B member 1A multiple interactions EXP Spiperone inhibits the reaction [Bromocriptine results in increased expression of ABCB1 protein]; Spiperone inhibits the reaction [N-n-propylnorapomorphine results in increased expression of ABCB1 protein]; Spiperone inhibits the reaction [Quinpirole results in increased expression of ABCB1 protein] CTD PMID:9111066 NCBI chr 4:22,339,829...22,517,642
Ensembl chr 4:22,133,521...22,425,515
JBrowse link
G Abcb1b ATP-binding cassette, subfamily B (MDR/TAP), member 1B multiple interactions EXP Spiperone inhibits the reaction [Bromocriptine results in increased activity of ABCB1B promoter]; Spiperone inhibits the reaction [N-n-propylnorapomorphine results in increased activity of ABCB1B promoter]; Spiperone inhibits the reaction [Quinpirole results in increased activity of ABCB1B promoter] CTD PMID:9111066 NCBI chr 4:22,225,123...22,307,577
Ensembl chr 4:22,133,521...22,425,515
JBrowse link
G Adra1a adrenoceptor alpha 1A multiple interactions EXP Spiperone inhibits the reaction [Norepinephrine results in increased activity of ADRA1A protein] CTD PMID:10416824 NCBI chr15:43,296,997...43,398,314
Ensembl chr15:43,298,794...43,392,451
JBrowse link
G Drd1 dopamine receptor D1 multiple interactions EXP Spiperone inhibits the reaction [A 86929 promotes the reaction [DRD1 protein results in increased chemical synthesis of Cyclic AMP]] CTD PMID:8558425 NCBI chr17:11,099,736...11,104,352
Ensembl chr17:11,101,306...11,103,541
JBrowse link
G Drd2 dopamine receptor D2 multiple interactions
affects binding
ISO
EXP
amitraz inhibits the reaction [Spiperone binds to DRD2 protein]; demethylchlordimeform inhibits the reaction [Spiperone binds to DRD2 protein]; NR3C1 protein promotes the reaction [Spiperone binds to DRD2 protein]
Melitten inhibits the reaction [Spiperone binds to DRD2 protein]
8-fluoro-12-(4-methylpiperazin-1-yl)-6H-(1)benzothieno(2,3-b)(1,5)benzodiazepine inhibits the reaction [Spiperone binds to DRD2 protein]; Amphetamine inhibits the reaction [Spiperone binds to DRD2 protein]; Caffeine inhibits the reaction [N-Methyl-3,4-methylenedioxyamphetamine promotes the reaction [Spiperone binds to DRD2 protein]]; Cocaine affects the reaction [Spiperone binds to DRD2 protein]; Haloperidol inhibits the reaction [Spiperone binds to DRD2 protein]; manganese chloride inhibits the reaction [DRD2 protein binds to Spiperone]; N-Methyl-3,4-methylenedioxyamphetamine promotes the reaction [Spiperone binds to DRD2 protein]; perospirone inhibits the reaction [Spiperone binds to DRD2 protein]; Pilocarpine inhibits the reaction [Spiperone binds to DRD2 protein]; Pilocarpine promotes the reaction [Spiperone binds to DRD2 protein]; Remoxipride inhibits the reaction [Spiperone binds to DRD2 protein]; Spiperone inhibits the reaction [Cocaine promotes the reaction [[DRD2 protein results in increased phosphorylation of TH protein] which results in increased abundance of Dopamine]]
CTD PMID:1975278, PMID:2018630, PMID:2833825, PMID:6149133, PMID:8804920, PMID:8829135, PMID:11226678, PMID:11927170, PMID:14559291, PMID:16137708, PMID:16889759, PMID:17161392, PMID:18457824, PMID:20729865, PMID:20969853, PMID:21484877, PMID:21999579, PMID:25522657 NCBI chr 8:53,678,777...53,743,643
Ensembl chr 8:53,678,777...53,743,642
JBrowse link
G Drd3 dopamine receptor D3 affects binding
multiple interactions
ISO Spiperone binds to DRD3 protein
N-Methyl-3,4-methylenedioxyamphetamine inhibits the reaction [Spiperone binds to DRD3 protein]
CTD PMID:21999579, PMID:29458138 NCBI chr11:61,819,102...61,883,223
Ensembl chr11:61,822,077...61,874,327
JBrowse link
G Drd4 dopamine receptor D4 affects binding
multiple interactions
ISO Spiperone binds to DRD4 protein
N-Methyl-3,4-methylenedioxyamphetamine inhibits the reaction [Spiperone binds to DRD4 protein]
CTD PMID:21999579, PMID:29458138 NCBI chr 1:214,278,296...214,282,818
Ensembl chr 1:214,278,296...214,281,483
JBrowse link
G Htr1a 5-hydroxytryptamine receptor 1A multiple interactions EXP
ISO
Spiperone binds to and results in decreased activity of HTR1A protein CTD PMID:2207497, PMID:15482641 NCBI chr 2:36,246,628...36,247,896
Ensembl chr 2:36,246,628...36,247,896
JBrowse link
G Htr2a 5-hydroxytryptamine receptor 2A multiple interactions ISO Spiperone inhibits the reaction [Ketanserin binds to HTR2A protein] CTD PMID:2891550 NCBI chr15:56,666,152...56,732,469
Ensembl chr15:56,666,012...56,735,382
JBrowse link
G Htr7 5-hydroxytryptamine receptor 7 multiple interactions ISO [Spiperone binds to and results in decreased activity of HTR7 protein] inhibits the reaction [5-carboxamidotryptamine results in increased abundance of Cyclic AMP] CTD PMID:14578406 NCBI chr 1:254,547,964...254,671,811
Ensembl chr 1:254,547,620...254,671,778
JBrowse link
G Nr3c1 nuclear receptor subfamily 3, group C, member 1 multiple interactions ISO NR3C1 protein promotes the reaction [Spiperone binds to DRD2 protein] CTD PMID:11226678 NCBI chr18:31,728,373...32,704,022
Ensembl chr18:31,728,373...31,749,647
JBrowse link
G Slc22a2 solute carrier family 22 member 2 multiple interactions ISO Spiperone inhibits the reaction [SLC22A2 protein results in increased uptake of 4-(4-dimethylaminostyryl)-1-methylpyridinium] CTD PMID:21599003 NCBI chr 1:48,318,025...48,360,219
Ensembl chr 1:48,317,995...48,360,261
JBrowse link
G Th tyrosine hydroxylase multiple interactions EXP Spiperone inhibits the reaction [Cocaine promotes the reaction [[DRD2 protein results in increased phosphorylation of TH protein] which results in increased abundance of Dopamine]] CTD PMID:20729865 NCBI chr 1:216,073,034...216,080,287
Ensembl chr 1:216,073,031...216,080,287
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19816
    role 19764
      application 19426
        pharmaceutical 19301
          drug 19301
            central nervous system drug 16449
              psychotropic drug 15058
                spiperone 13
Path 2
Term Annotations click to browse term
  CHEBI ontology 19816
    subatomic particle 19814
      composite particle 19814
        hadron 19814
          baryon 19814
            nucleon 19814
              atomic nucleus 19814
                atom 19814
                  main group element atom 19702
                    main group molecular entity 19702
                      s-block molecular entity 19461
                        hydrogen molecular entity 19452
                          hydrides 18707
                            inorganic hydride 17430
                              pnictogen hydride 17402
                                nitrogen hydride 17243
                                  azane 16960
                                    ammonia 16959
                                      organic amino compound 16958
                                        tertiary amino compound 8643
                                          spiperone 13
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.