Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:cudraflavone B
go back to main search page
Accession:CHEBI:67850 term browser browse the term
Definition:An extended flavonoid that consists of a pyranochromane skeleton that is 2H,6H-pyrano[3,2-g]chromen-6-one substituted by geminal methyl groups at position 2, a 2,4-dihydroxyphenyl group at position 8, a hydroxy group at position 5 and a prenyl group at position 7. Isolated from Morus alba and Morus species it exhibits anti-inflammatory activity.
Synonyms:exact_synonym: 8-(2,4-dihydroxyphenyl)-5-hydroxy-2,2-dimethyl-7-(3-methylbut-2-en-1-yl)-2H,6H-pyrano[3,2-g]chromen-6-one
 related_synonym: Formula=C25H24O6;   InChI=1S/C25H24O6/c1-13(2)5-7-17-23(29)21-20(30-24(17)15-8-6-14(26)11-18(15)27)12-19-16(22(21)28)9-10-25(3,4)31-19/h5-6,8-12,26-28H,7H2,1-4H3;   InChIKey=XIWCDUHPYMOFIL-UHFFFAOYSA-N;   SMILES=CC(C)=CCc1c(oc2cc3OC(C)(C)C=Cc3c(O)c2c1=O)-c1ccc(O)cc1O
 alt_id: MESH:C542041
 xref_mesh: MESH:C542041
 xref: PMID:21319773;   Reaxys:1442331



show annotations for term's descendants           Sort by:
cudraflavone B term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Bax BCL2 associated X, apoptosis regulator increases expression
multiple interactions
ISO cudraflavone B results in increased expression of BAX protein
resveratrol inhibits the reaction [cudraflavone B results in increased expression of BAX protein]; sirtinol promotes the reaction [cudraflavone B results in increased expression of BAX protein]
CTD PMID:23881456 NCBI chr 1:95,940,001...95,945,407
Ensembl chr 1:95,938,808...95,945,368
JBrowse link
G Bcl2 BCL2, apoptosis regulator multiple interactions
decreases expression
ISO resveratrol inhibits the reaction [cudraflavone B results in decreased expression of BCL2 protein]; sirtinol promotes the reaction [cudraflavone B results in decreased expression of BCL2 protein] CTD PMID:23881456 NCBI chr13:22,689,783...22,853,920
Ensembl chr13:22,684,989...22,853,743
Ensembl chr13:22,684,989...22,853,743
JBrowse link
G Casp3 caspase 3 increases activity
multiple interactions
ISO cudraflavone B results in increased activity of CASP3 protein
resveratrol inhibits the reaction [cudraflavone B results in increased activity of CASP3 protein]; sirtinol promotes the reaction [cudraflavone B results in increased activity of CASP3 protein]
CTD PMID:23881456 NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648
JBrowse link
G Cdkn1a cyclin-dependent kinase inhibitor 1A increases expression
multiple interactions
ISO cudraflavone B results in increased expression of CDKN1A protein
resveratrol inhibits the reaction [cudraflavone B results in increased expression of CDKN1A protein]; sirtinol promotes the reaction [cudraflavone B results in increased expression of CDKN1A protein]
CTD PMID:23881456 NCBI chr20:7,149,177...7,159,727
Ensembl chr20:7,149,217...7,159,585
JBrowse link
G Cdkn1b cyclin-dependent kinase inhibitor 1B multiple interactions
increases expression
ISO resveratrol inhibits the reaction [cudraflavone B results in increased expression of CDKN1B protein]; sirtinol promotes the reaction [cudraflavone B results in increased expression of CDKN1B protein] CTD PMID:23881456 NCBI chr 4:167,760,067...167,765,177
Ensembl chr 4:167,760,181...167,764,982
JBrowse link
G Mapk1 mitogen activated protein kinase 1 increases activity ISO cudraflavone B results in increased activity of MAPK1 protein CTD PMID:23881456 NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616
JBrowse link
G Mapk3 mitogen activated protein kinase 3 increases activity ISO cudraflavone B results in increased activity of MAPK3 protein CTD PMID:23881456 NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
JBrowse link
G Nfkbia NFKB inhibitor alpha multiple interactions ISO cudraflavone B results in increased phosphorylation of and results in increased degradation of NFKBIA protein CTD PMID:23881456 NCBI chr 6:72,858,713...72,861,941
Ensembl chr 6:72,858,712...72,861,941
JBrowse link
G Rb1 RB transcriptional corepressor 1 multiple interactions
decreases phosphorylation
ISO resveratrol inhibits the reaction [cudraflavone B results in decreased phosphorylation of RB1 protein]; sirtinol promotes the reaction [cudraflavone B results in decreased phosphorylation of RB1 protein] CTD PMID:23881456 NCBI chr15:48,371,295...48,502,473
Ensembl chr15:48,371,296...48,502,302
JBrowse link
G Rela RELA proto-oncogene, NF-kB subunit affects localization ISO cudraflavone B affects the localization of RELA protein CTD PMID:23881456 NCBI chr 1:202,925,001...202,935,484
Ensembl chr 1:202,924,945...202,935,484
JBrowse link
G Sirt1 sirtuin 1 increases expression
multiple interactions
ISO cudraflavone B results in increased expression of SIRT1 mRNA; cudraflavone B results in increased expression of SIRT1 protein
resveratrol promotes the reaction [cudraflavone B results in increased expression of SIRT1 mRNA]; resveratrol promotes the reaction [cudraflavone B results in increased expression of SIRT1 protein]; sirtinol inhibits the reaction [cudraflavone B results in increased expression of SIRT1 mRNA]; sirtinol inhibits the reaction [cudraflavone B results in increased expression of SIRT1 protein]
CTD PMID:23881456 NCBI chr20:25,307,225...25,329,273
Ensembl chr20:25,306,917...25,329,260
JBrowse link
G Tp53 tumor protein p53 increases expression
multiple interactions
ISO cudraflavone B results in increased expression of TP53 protein
resveratrol inhibits the reaction [cudraflavone B results in increased expression of TP53 protein]; sirtinol promotes the reaction [cudraflavone B results in increased expression of TP53 protein]
CTD PMID:23881456 NCBI chr10:54,300,070...54,311,525
Ensembl chr10:54,300,048...54,311,524
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19890
    role 19839
      application 19703
        anti-inflammatory agent 16700
          cudraflavone B 12
Path 2
Term Annotations click to browse term
  CHEBI ontology 19890
    subatomic particle 19867
      composite particle 19888
        hadron 19888
          baryon 19888
            nucleon 19867
              atomic nucleus 19888
                atom 19888
                  main group element atom 19806
                    p-block element atom 19806
                      carbon group element atom 19746
                        carbon atom 19743
                          organic molecular entity 19743
                            organic molecule 19714
                              organic cyclic compound 19485
                                organic heterocyclic compound 18881
                                  oxacycle 17917
                                    benzopyran 11984
                                      1-benzopyran 11737
                                        flavonoid 7229
                                          anthoxanthin 4587
                                            flavones 4587
                                              hydroxyflavone 4561
                                                trihydroxyflavone 453
                                                  cudraflavone B 12
paths to the root