Term: | oviedomycin |
|
Accession: | CHEBI:156291
|
browse the term
|
Definition: | A member of the class of tetraphenes that is 1,4,7,12-tetrahydrotetraphene substituted by oxo groups at positions 1, 4, 7, and 12, by hydroxy groups at positions 2, 6 and 8, and by a methyl group at position 3. It is a natural product found in Streptomyces antibioticus ATCC 11891 which exhibits cytotoxicity against A549 human lung cancer cells, HepG2 liver cancer cells, and MCF-7 breast cancer cells. |
Synonyms: | exact_synonym: | 2,6,8-trihydroxy-3-methyltetraphene-1,4,7,12-tetrone |
| related_synonym: | 2,6,8-trihydroxy-3-methyl-1,4,7,12-tetrahydrotetraphene-1,4,7,12-tetrone; 2,6,8-trihydroxy-3-methyl-benz[a]anthracene-1,4,7,12-tetrone; 3-methyl-2,6,8-trihydroxybenzo[a]anthracene-1,4,7,12-tetrone; Formula=C19H10O7; InChI=1S/C19H10O7/c1-6-15(22)8-5-10(21)13-14(12(8)19(26)16(6)23)17(24)7-3-2-4-9(20)11(7)18(13)25/h2-5,20-21,23H,1H3; InChIKey=LRVJUCBWMNTDLP-UHFFFAOYSA-N; SMILES=CC1=C(O)C(=O)C2=C(C=C(O)C3=C2C(=O)C2=CC=CC(O)=C2C3=O)C1=O |
| xref: | CAS:439127-45-4; KNApSAcK:C00046255; MetaCyc:CPD-12942; PMID:12027768; PMID:15368568; PMID:18988223; PMID:25303210; PMID:28972184 |
|
|