Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

Ontology Browser

17beta-estradiol 3-benzoate (CHEBI:77006)
Annotations: Rat: (186) Mouse: (180) Human: (182) Chinchilla: (0) Bonobo: (0) Dog: (0) Squirrel: (0) Pig: (2)
Parent Terms Term With Siblings Child Terms
(3alpha,5alpha,17beta)-17-hydroxyandrostan-3-yl sulfate 
(3Z)-hex-3-en-1-yl benzoate 
1,3-benzodioxole-5-carboxylic acid [2-[[[(3-fluorophenyl)-oxomethyl]hydrazinylidene]methyl]phenyl] ester 
1-(3,4-dihydroxybenzoyl)-beta-D-glucopyranose +  
1-(tert-butylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-yl benzoate +   
15-acetoxyorbiculin G 
16beta-hydroxyestradiol +  
17-epiestriol +  
17alpha-ethynylestradiol +   
17alpha-ethynylestradiol 3-sulfate 
17beta-estradiol +   
17beta-estradiol 17-glucosiduronic acid  
17beta-estradiol 3-benzoate  
A benzoate ester resulting from the formal condensation of benzoic acid with the phenolic hydroxy group of 17beta-estradiol.
17beta-estradiol 3-glucosiduronic acid  
17beta-estradiol 3-O-carboxymethyl ether 
17beta-estradiol 3-sulfate 
17beta-estradiol 3-sulfate 17-(beta-D-glucosiduronic acid) 
17beta-estradiol 6-O-(carboxymethyl)oxime 
17beta-hydroxy-5alpha-androstan-3-one +   
17beta-hydroxyandrostan-3-one +   
1beta-hydroxymaprounic acid 3-p-hydroxybenzoate 
2,4-dichlorobenzoic acid 1,2,4-triazol-1-ylmethyl ester 
2,4-difluorobenzoic acid [2-(cyclopropylamino)-2-oxoethyl] ester 
2,6-difluorobenzoic acid 2,3-dihydro-1,4-benzodioxin-3-ylmethyl ester 
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid thiophen-2-ylmethyl ester 
2-(2-furanylmethylamino)benzoic acid [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] ester 
2-(2-furanylmethylamino)benzoic acid [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] ester 
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoic acid 
2-(butylamino)benzoic acid [2-oxo-2-(4-sulfamoylanilino)ethyl] ester 
2-(thiophen-2-ylsulfonylamino)benzoic acid [2-(cyclohexylamino)-2-oxoethyl] ester 
2-[(4-acetyloxy-3-ethoxyphenyl)methylidene]-7-methyl-3-oxo-5-(2-phenylethenyl)-5H-thiazolo[3,2-a]pyrimidine-6-carboxylic acid ethyl ester 
2-[(4-acetyloxyphenyl)methylidene]-7-methyl-3-oxo-5-(2-phenylethenyl)-5H-thiazolo[3,2-a]pyrimidine-6-carboxylic acid ethyl ester 
2-[(benzoylamino)methyl]-3,4,6-trichlorophenyl 4-nitrobenzoate 
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid (4-chlorophenyl) ester 
2-[3-(trifluoromethyl)anilino]benzoic acid 2-(2-hydroxyethoxy)ethyl ester 
2-[3-[(4-ethoxycarbonylphenyl)hydrazinylidene]-6-oxo-1-cyclohexa-1,4-dienyl]acetic acid 
2-[4-(difluoromethylthio)anilino]benzoic acid [2-(cyclopropylamino)-2-oxoethyl] ester 
2-[4-(difluoromethylthio)anilino]benzoic acid [2-(dimethylamino)-2-oxoethyl] ester 
2-[5-[(5-amino-1-tetrazolyl)iminomethyl]-2-furanyl]-5-bromobenzoic acid methyl ester 
2-[[(1,3-benzodioxol-5-ylamino)-oxomethyl]amino]benzoic acid methyl ester 
2-[[(4-methyl-1-piperidinyl)-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
2-[[(4-methyl-1-pyrazolyl)-oxomethyl]amino]benzoic acid methyl ester 
2-[[2-(6-oxo-1-cyclohexa-2,4-dienylidene)-3H-1,3,4-oxadiazol-5-yl]thio]acetic acid (2,6-dimethylphenyl) ester 
2-[[2-(6-oxo-1-cyclohexa-2,4-dienylidene)-3H-1,3,4-oxadiazol-5-yl]thio]acetic acid (4-phenylmethoxyphenyl) ester 
2-[[2-[(2-hydroxyphenyl)-oxomethoxy]-1-oxoethyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylic acid methyl ester 
2-[[3-(methylthio)-1,2,4-thiadiazol-5-yl]thio]acetic acid (4-acetamidophenyl) ester 
2-[[[(1-ethyl-3,5-dimethyl-4-pyrazolyl)methylamino]-oxomethyl]amino]benzoic acid methyl ester 
2-[[[(5-chloro-2-pyridinyl)amino]-oxomethyl]amino]benzoic acid methyl ester 
2-[[[2-(2-methoxyphenyl)ethylamino]-oxomethyl]amino]benzoic acid methyl ester 
2-amino-4-chlorobenzoic acid [2-oxo-2-(3,3,5-trimethyl-7-azabicyclo[3.2.1]octan-7-yl)ethyl] ester 
2-aminosulfonyl-benzoic acid methyl ester 
2-benzoylbenzene-1,4-diyl bis(4-bromo-3-nitrobenzoate) 
2-chloro-5-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]-2-furanyl]benzoic acid ethyl ester 
2-ethoxy-3-pyridinecarboxylic acid (4-methoxycarbonylphenyl)methyl ester 
2-furancarboxylic acid [3-[[[1,3-benzodioxol-5-yl(oxo)methyl]hydrazinylidene]methyl]phenyl] ester 
2-furancarboxylic acid [3-[[[4-anilino-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] ester 
2-furancarboxylic acid [4-[(2,4-dioxo-5-thiazolidinylidene)methyl]-2-methoxyphenyl] ester 
2-furancarboxylic acid [4-[(3-methyl-4-oxo-2-sulfanylidene-5-thiazolidinylidene)methyl]phenyl] ester 
2-furancarboxylic acid [4-[[[(2-methylpropan-2-yl)oxy-oxomethyl]hydrazinylidene]methyl]phenyl] ester 
2-furancarboxylic acid [4-[[[oxo(2-pyridinyl)methyl]hydrazinylidene]methyl]phenyl] ester 
2-hydroxy-17beta-estradiol +   
2-hydroxy-17beta-estradiol 2-O-(beta-D-glucuronide) 
2-hydroxy-17beta-estradiol 3-O-(beta-D-glucuronide) 
2-hydroxy-17beta-estradiol 3-sulfate 
2-hydroxy-3-methylbenzoic acid (3-cyano-4-imino-2-oxopentyl) ester 
2-hydroxy-4-methylbenzoic acid [2-(2-chloroanilino)-2-oxoethyl] ester 
2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid [2-[1-(3-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] ester 
2-hydroxybenzoic acid (3,3,5-trimethylcyclohexyl) ester  
2-hydroxybenzoic acid [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] ester 
2-hydroxybenzoic acid [2-[[(1-methyl-2-pyrrolyl)-oxomethyl]amino]-2-oxoethyl] ester 
2-hydroxyestradiol 3-methyl ether 
2-hydroxytestosterone +  
2-methoxy-17beta-estradiol +   
2-methoxy-17beta-estradiol 3-O-(beta-D-glucuronide) 
2-methoxy-17beta-estradiol 3-sulfate 
2-thiophenecarboxylic acid (4-acetamidophenyl) ester 
2-thiophenecarboxylic acid [2-ethoxy-4-[(3-methyl-5-oxo-1-phenyl-4-pyrazolylidene)methyl]phenyl] ester 
2-thiophenecarboxylic acid [3-[[1-(3-chloro-4-fluorophenyl)-3,5-dioxo-4-pyrazolidinylidene]methyl]phenyl] ester 
2-thiophenecarboxylic acid [4-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]phenyl] ester 
2alpha-hydroxymaprounic acid 2,3-bis-p-hydroxybenzoate 
3,4-bis(methoxycarbonyl)benzoic acid 
3,4-diethoxybenzoic acid [2-[(5-methyl-3-isoxazolyl)amino]-2-oxoethyl] ester 
3,4-dimethylbenzoic acid (6-methyl-3-pyridinyl) ester 
3,5-Bis(1,1-dimethylethyl)-4-hydroxy-benzoic acid ethyl ester 
3,5-dichlorobenzoic acid (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) ester 
3,5-dimethyl-4-oxo-6-thieno[2,3-d]pyrimidinecarboxylic acid (4-methylphenyl) ester 
3,5-dimethylbenzoic acid (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) ester 
3-(2-furanyl)-2-propenoic acid (3-formylphenyl) ester 
3-(2-methylpiperidin-1-yl)propyl 3,4-dichlorobenzoate +  
3-(diethylsulfamoyl)benzoic acid [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] ester 
3-(dimethylamino)propyl benzoate 
3-(methanesulfonamido)benzoic acid methyl ester 
3-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoic acid [2-(1H-indol-3-yl)-2-oxoethyl] ester 
3-[(3,4-difluorophenyl)sulfonylamino]benzoic acid [2-[[(2-methylpropylamino)-oxomethyl]amino]-2-oxoethyl] ester 
3-[(4-methylphenyl)sulfamoyl]benzoic acid [2-(2-furanylmethylamino)-2-oxoethyl] ester 
3-[2-(2,6-dichlorophenyl)-6-quinolyl]-1-hydroxy-1-methoxypropan-2-yl 2,6-dichlorobenzoate 
3-[5-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]-2-furanyl]benzoic acid methyl ester 
3-[[oxo-[3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methoxy]methyl]benzoic acid ethyl ester 
3-amino-4-chlorobenzoic acid [2-oxo-2-(1-pyrrolidinyl)ethyl] ester 
3-Hexenyl salicylic acid 
3-hydroxybenzoic acid [2-(1H-indol-3-yl)-2-oxoethyl] ester 
3-hydroxybenzyl benzoate 
3-pyridinecarboxylic acid [4-[heptoxy(oxo)methyl]phenyl] ester 
4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid [2-(cyclopropylamino)-2-oxoethyl] ester 
4-(4-methoxycarbonylphenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylic acid dimethyl ester 
4-(5-formyl-2-furanyl)benzoic acid propyl ester 
4-(\{4-[(2,3,3-Trichloroacryloyl)oxy]phenyl\}sulfonyl)phenyl 2,3,3-trichloroacrylate 
4-(carbamoylamino)benzoic acid [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] ester 
4-(diethylsulfamoyl)benzoic acid 1,3-benzodioxol-5-yl ester 
4-(diethylsulfamoyl)benzoic acid [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] ester 
4-(dimethylamino)benzoic acid (3,5-dimethyl-4-isoxazolyl)methyl ester 
4-(dimethylamino)benzoic acid (phenylmethyl) ester 
4-(dimethylamino)benzoic acid [2-(cycloheptylamino)-2-oxoethyl] ester 
4-(dimethylsulfamoyl)benzoic acid [2-(2-furanylmethylamino)-2-oxoethyl] ester 
4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]benzoic acid methyl ester 
4-[(2-methoxyphenyl)-methylsulfamoyl]benzoic acid [2-[(5-methyl-3-isoxazolyl)amino]-2-oxoethyl] ester 
4-[2-(4-methoxycarbonylphenyl)iminohydrazinyl]benzoic acid methyl ester 
4-[2-(cyclohexylamino)-2-oxo-1-[(1-oxo-2-thiophen-2-ylethyl)-(phenylmethyl)amino]ethyl]benzoic acid methyl ester 
4-[3-(2-furanyl)-4-(3-nitrophenyl)-6-oxo-2,4-dihydropyrrolo[3,4-c]pyrazol-5-yl]benzoic acid ethyl ester 
4-[3-methyl-5-(4-methylphenyl)-6-oxo-2,4-dihydropyrrolo[3,4-c]pyrazol-4-yl]benzoic acid methyl ester 
4-[5-(2-phenylethyl)-2-sulfanylidene-1,3,5-triazinan-1-yl]benzoic acid ethyl ester 
4-[5-[[(2-hydroxy-2-phenylethyl)amino]methyl]-2-furanyl]benzoic acid methyl ester 
4-[5-[[[(5-bromo-3-pyridinyl)-oxomethyl]hydrazinylidene]methyl]-2-furanyl]benzoic acid ethyl ester 
4-[5-[[[2-(2-methyl-1,3-dioxan-2-yl)-1-oxoethyl]hydrazinylidene]methyl]-2-furanyl]benzoic acid methyl ester 
4-[5-[[[ethylamino(sulfanylidene)methyl]hydrazinylidene]methyl]-2-furanyl]benzoic acid butyl ester 
4-[5-[oxo-(3-pyridinylamino)methyl]-2-furanyl]benzoic acid ethyl ester 
4-[6-(diaminomethylideneamino)-1-oxohexoxy]benzoic acid ethyl ester  
4-[[(2,3-dihydro-1H-inden-1-ylamino)-sulfanylidenemethyl]amino]benzoic acid methyl ester 
4-[[(3,4-dimethoxyanilino)-oxomethyl]amino]benzoic acid butyl ester 
4-[[(4-hydroxy-1-piperidinyl)-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[(4-methoxyanilino)-oxomethyl]amino]benzoic acid methyl ester 
4-[[(4-oxo-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)thio]methyl]benzoic acid methyl ester 
4-[[(cyclohexylamino)-oxomethyl]amino]benzoic acid methyl ester 
4-[[1-azepanyl(oxo)methyl]amino]benzoic acid ethyl ester 
4-[[4-[[[(2-methoxyethylamino)-sulfanylidenemethyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid methyl ester 
4-[[4-cyclohexyl-3-(2-hydroxyethyl)-1-piperazinyl]methyl]benzoic acid methyl ester 
4-[[6-methyl-2-(6-oxo-1-cyclohexa-2,4-dienylidene)-1H-pyrimidin-4-yl]amino]benzoic acid methyl ester 
4-[[[(2-methoxy-1-oxoethyl)hydrazo]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[(2-methoxyphenyl)methylamino]-oxomethyl]amino]benzoic acid ethyl ester 
4-[[[2-(1-azepanyl)ethyl-(2-furanylmethyl)amino]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[2-(3-methylphenyl)ethylamino]-sulfanylidenemethyl]amino]benzoic acid methyl ester 
4-[[[2-(4-fluorophenyl)ethylamino]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[2-(4-methoxyphenyl)-3-thiazolidinyl]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[[2-(3-pyridinyl)-1-piperidinyl]amino]-sulfanylidenemethyl]amino]benzoic acid methyl ester 
4-[[[[8-[(1-tert-butyl-5-tetrazolyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-oxomethyl]amino]benzoic acid ethyl ester 
4-[[diethylamino(oxo)methyl]amino]benzoic acid ethyl ester 
4-aminobenzoic acid 3-(dibutylamino)propyl ester 
4-chloro-3-(1-piperidinylsulfonyl)benzoic acid [2-(4-amino-1,3-dimethyl-2,6-dioxo-5-pyrimidinyl)-2-oxoethyl] ester 
4-chloro-3-(1-pyrrolidinylsulfonyl)benzoic acid [2-(butylamino)-2-oxoethyl] ester 
4-chlorobenzoic acid (5-methyl-2-pyridin-4-yl-4-thiazolyl) ester 
4-cyanobenzoic acid [4-oxo-6-[(2-pyrimidinylthio)methyl]-3-pyranyl] ester 
4-cyanobenzoic acid [6-[[(4-methyl-2-pyrimidinyl)thio]methyl]-4-oxo-3-pyranyl] ester 
4-ethylbenzoic acid [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] ester 
4-fluorobenzoic acid 4-[(5-phenyl-1,3,4-oxadiazol-2-yl)thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-furanyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-hydroxy-17beta-estradiol +   
4-hydroxy-17beta-estradiol 3-O-(beta-D-glucuronide) 
4-hydroxy-17beta-estradiol 4-O-(beta-D-glucuronide) 
4-hydroxybenzoate ester +   
4-methoxy-17beta-estradiol +   
4-methoxy-17beta-estradiol 3-O-(beta-D-glucuronide) 
4-methyl-3-(4-morpholinylsulfonyl)benzoic acid [3-(1H-benzimidazol-2-yl)-3-cyano-2-oxopropyl] ester 
4-methylbenzoic acid [2-(1H-indol-3-yl)-2-oxoethyl] ester 
4-methylbenzoic acid [6-[[[5-[[cyclopropyl(oxo)methyl]amino]-1,3,4-thiadiazol-2-yl]thio]methyl]-4-oxo-3-pyranyl] ester 
4-octylphenol +   
5-(4-acetyloxy-3-methoxyphenyl)-2,7-dimethyl-3-oxo-5H-thiazolo[3,2-a]pyrimidine-6-carboxylic acid ethyl ester 
5-(diethylsulfamoyl)-2-hydroxybenzoic acid [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] ester 
5-[(carbamimidoylthio)methyl]-2-(3-methylbutoxy)benzoic acid methyl ester 
5alpha-androstane-3beta,17beta-diol +  
6-dehydrotestosterone +  
6beta-hydroxytestosterone +   
7alpha -hydroxytestosterone 
9-acetoxy-8,10-dehydrothymol 3-O-tiglate 
9-acetoxy-8,10-epoxythymol 3-O-tiglate 
acetic acid [2-(4-acetamido-6-phenyl-1,3,5-triazin-2-yl)phenyl] ester 
acetic acid [2-[2-acetyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl] ester 
acetic acid [3-[3-(dimethylamino)-1-oxopropyl]-5-benzofuranyl] ester 
acetic acid [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] ester 
acetic acid [4-[(1-oxo-2-phenylethyl)amino]phenyl] ester 
acetic acid [4-[oxo-(2-phenylethylamino)methyl]phenyl] ester 
albibrissinoside A 
albiflorin +   
amburoside A 
Amyl salicylate 
ananolignan K 
androstane-3alpha,17beta-diol +  
aspirin-based probe AP 
avilamycin A 
avilamycin A precursor 
baccatin III +   
benzoic acid (2-oxo-2-thiophen-2-ylethyl) ester 
benzoic acid 2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl ester  
benzoic acid [2-(2-furanylmethylamino)-2-oxoethyl] ester 
benzoic acid [2-methyl-2-(propylamino)propyl] ester 
benzoic acid [4-(6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)-2-methoxyphenyl] ester 
benzoic acid [5-amino-1-(4-methoxyphenyl)sulfonyl-3-pyrazolyl] ester 
benzyl 2,5-dihydroxybenzoate 
benzyl benzoate  
Benzyl parahydroxybenzoate  
Benzyl salicylate  
bisphenol A +   
bisphenol F +   
bolandiol +  
Bopindolol malonate 
brasilicardin A 
butamben +   
butyl anthranilate 
butyl benzoate 
cangorinine E-1 
chloroprocaine +  
cholesta-5,7-dien-3beta-ol benzoate 
Cinnamyl anthranilate  
cis-3-Hexenyl salicylate 
comazaphilone A 
comazaphilone B 
comazaphilone C 
comazaphilone D 
comazaphilone E 
comazaphilone F 
coniferyl benzoate 
crassicauline A 
curtisian A 
cylindol A 
cytonic acid A 
cytonic acid B 
D-glucosyl salicylate +  
dehydrodiconiferyl dibenzoate 
diethylstilbestrol +   
digallic acid  
Diloxanide furoate 
Dinoseb acetate 
ecgonine benzoate  
emarginatine B 
emarginatine F 
estramustine +   
estriol +   
estriol 16-O-(beta-D-glucuronide)  
estriol 3-O-(beta-D-glucuronide)  
ethyl 4-\{2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy\}benzoate 
ethyl 4-\{3-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]propoxy\}benzoate 
ethyl 4-\{4-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]butoxy\}benzoate 
ethyl 4-hydroxybenzoate sulfate 
ethyl 4-tert-butylbenzoate 
ethyl benzoate 
ethyl piperidinoacetylaminobenzoate 
Ethyl-N-ethylanthranilic acid 
Ethylhexyl salicylate 
ethynodiol +   
Euphorbia diterpenoid 1 
Euphorbia diterpenoid 3 
Euphorbiaproliferin B, (rel)- 
Euphorbiaproliferin D 
Euphorbiaproliferin E 
Euphorbiaproliferin F 
Euphorbiaproliferin H 
euphornin L 
Euphorprolitherin B 
Euphorprolitherin C 
G a G b G 
G b G AcO 
G b S 
gabexate methanesulfonate  
gallate ester +   
geranyl benzoate 
globosumone A 
globosumone B 
globosumone C 
glochierioside A 
glochierioside B 
Guaiacol acetate 
H b G AcO 
Heptyl p-hydroxybenzoate 
hexadecyl benzoate 
hexan-2-yl benzoate 
hexan-3-yl benzoate 
Hexyl benzoate 
Hexyl salicylic acid 
hokbusine A 
Hydroxyphenylethanol diacetate 
hypoglaunine C 
hyponine D 
Ingenol 3,20-dibenzoate  
integracin A 
integracin B 
integracin C 
interiotherin A 
Ioxynil octanoate 
isobutyl benzoate 
isopropyl salicylate +   
Kansuinine B 
kweichowenol B 
lignin cw compound-116 
lignin cw compound-138 
lignin cw compound-195 
lignin cw compound-202 
lignin cw compound-214 
lignin cw compound-218 
lignin cw compound-251 
lignin cw compound-254 
lignin cw compound-255 
lignin cw compound-280 
lignin cw compound-294 
lignin cw compound-3010 
lignin cw compound-3035 
lignin cw compound-3037 
lignin cw compound-3039 
lignin cw compound-3041 
lignin cw compound-99 
locoracemoside B 
Medinoterb acetate 
menthyl salicylate 
Meprylcaine hydrochloride 
metholone +  
Methyl 2-[(methylsulfonyl)amino]benzoate 
methyl 2-\{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl\}benzoate 
methyl 2-\{[5-(\{3-chloro-4-[(5S)-1,1-dioxido-3-oxo-1,2-thiazolidin-5-yl]-N-(phenylsulfonyl)-L-phenylalanyl\}amino)pentyl]oxy\}-6-hydroxybenzoate 
methyl 3,4-dihydroxy-5-(3'-methyl-2'-butenyl)benzoate 
Methyl 3-hydroxybenzoate 
methyl 4-\{[(\{[(2R,5S)-5-\{[(2S)-2-(aminomethyl)pyrrolidin-1-yl]carbonyl\}pyrrolidin-2-yl]methyl\}amino)carbonyl]amino\}benzoate 
methyl 4-acetoxy-3-methoxybenzoate 
methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate 
methyl anthranilate 
methyl benzoate 
methyl N-methylanthranilate 
methyl p-anisate 
methyl salicylate  
methyl syringate 
methyl vanillate +  
methyl-4-hydroxybenzoate O-sulfate 
metronidazole benzoate 
metsulfuron methyl  
Mono-carboxy isononyl phthalate 
Mono-carboxy isooctyl phthalate 
monobenzyl phthalate  
nafamostat methanesulfonate 
nandrolone +   
norethisterone +   
O-benzoylecgonine 5-carboxypentyl ester 
o-orsellinate depside 
octyl benzoate 
onosmin B 
orbiculin A 
orbiculin E 
orbiculin F 
orbiculin G +  
otophylloside B 
oxybuprocaine +   
oxymetholone +   
oxyphenisatine acetate 
Padimate A 
Padimate O  
paeoniflorin sulfonate 
Paeonilactone C 
phenethyl benzoate 
phenyl benzoate  
phenyl salicylate  
platensimycin A2 methyl ester 
platensimycin A3 methyl ester 
platensimycin A4 methyl ester 
platensimycin A5 methyl ester 
platensimycin B4 methyl ester 
platensimycin methyl ester 
Proliferin A 
Proliferin B 
Proliferin C 
propyl 4-hydroxybenzoate sulfate 
propyl benzoate 
pterolinus F 
purpurquinone A 
purpurquinone B 
purpurquinone C 
quercetin 3-(6''-p-hydroxybenzoylgalactoside) 
rediocide C 
rediocide F 
rediocide G 
resolvin D2  
resorcinol monobenzoate 
RU 58668  
S a S b S 
S b S AcO 
scoparic acid A 
scutebarbatine C 
scutebarbatine D 
scutebarbatine E 
Sinapyl alcohol diacetate 
sulfometuron methyl 
taiwankadsurin B 
tasumatrol E 
tasumatrol F 
Tasumatrol I(rel) 
Tasumatrol J(rel) 
tert-butyl 4-hydroxy-3-methoxybenzoate 
tert-butyl benzoate 
testosterone +   
Tetracaine hydrochloride 
trigoheterin E, (rel)- 
triptofordin C 2 
tropanyl 3,5-dimethylbenzoate 
vaccihein A 
Vanillin a G b CA 
vinyl benzoate 
wilfordinine C 
wilfornine A 

Exact Synonyms: (17beta)-17-hydroxyestra-1(10),2,4-trien-3-yl benzoate
Related Synonyms: 17-beta-Estradiol 3-benzoate ;   17beta-estradiol monobenzoate ;   Agofollin Depot ;   Benovocylin ;   Benzo-Gynoestryl ;   Benztrone ;   Estrogin ;   Folone ;   Formula=C25H28O3 ;   InChI=1S/C25H28O3/c1-25-14-13-20-19-10-8-18(28-24(27)16-5-3-2-4-6-16)15-17(19)7-9-21(20)22(25)11-12-23(25)26/h2-6,8,10,15,20-23,26H,7,9,11-14H2,1H3/t20-,21-,22+,23+,25+/m1/s1 ;   InChIKey=UYIFTLBWAOGQBI-BZDYCCQFSA-N ;   Mesalin ;   Ovahormon ;   Ovasterol-B ;   Primogyn B ;   Progynon B ;   Progynon benzoate ;   SMILES=C[C@]12CC[C@H]3[C@@H](CCc4cc(OC(=O)c5ccccc5)ccc34)[C@@H]1CC[C@@H]2O ;   benzoate d'estradiol ;   benzoato de estradiol ;   beta-estradiol 3-benzoate ;   estra-1,3,5(10)-triene-3,17beta-diol 3-benzoate ;   estradiol benzoate ;   estradiol monobenzoate ;   estradioli benzoas ;   oestradiol 3-benzoate ;   oestradiol benzoate ;   oestradiol monobenzoate
Xrefs: CAS:50-50-0 ;   DrugBank:DB00783 ;   Drug_Central:1058 ;   KEGG:C13444 ;   KEGG:D01953 ;   LINCS:LSM-26352
Xref Mesh: MESH:C074283
Xrefs: PMID:18356042 ;   PMID:19090709 ;   Reaxys:3107526 ;   Wikipedia:Estradiol_benzoate

paths to the root