Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

Ontology Browser

N-[(7,8-dihydropterin-6-yl)methyl]-4-(beta-D-ribofuranosyl)aniline 5'-phosphate (CHEBI:73084)
Annotations: Rat: (0) Mouse: (0) Human: (0) Chinchilla: (0) Bonobo: (0) Dog: (0) Squirrel: (0) Pig: (0)
Parent Terms Term With Siblings Child Terms
tetrahydropterin +     
(2S)-2-[(\{4-[(1S)-2-(2-amino-4-hydroxyquinazolin-6-yl)-1-(\{[2-(\{5-O-phosphonoribofuranosyl\}amino)-2-oxoethyl]amino\}methyl)-1-hydroxyethyl]phenyl\}carbonyl)amino]pentanedioic acid 
(7,8-dihydropterin-6-yl)methyl diphosphate 
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate 
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate(2-) 
2,6-anhydro-3-deoxy-7-O-phosphono-D-manno-heptonic acid 
2-[(2R,5R,6R)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6R)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2R,5R,6R)-5-amino-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6R)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6R)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6R)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6R)-6-(hydroxymethyl)-5-[(4-methylphenyl)sulfonylamino]-2-oxanyl]acetic acid 
2-[(2R,5R,6R)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6S)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2R,5R,6S)-5-amino-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6S)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6S)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6S)-6-(hydroxymethyl)-5-(pyridine-4-carbonylamino)oxan-2-yl]acetic acid 
2-[(2R,5R,6S)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2R,5R,6S)-6-(hydroxymethyl)-5-[(4-methylphenyl)sulfonylamino]-2-oxanyl]acetic acid 
2-[(2R,5R,6S)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6R)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6R)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2R,5S,6R)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6R)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6R)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6R)-6-(hydroxymethyl)-5-[(4-methylphenyl)sulfonylamino]-2-oxanyl]acetic acid 
2-[(2R,5S,6R)-6-(hydroxymethyl)-5-[[oxo(pyridin-4-yl)methyl]amino]-2-oxanyl]acetic acid 
2-[(2R,5S,6R)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6S)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2R,5S,6S)-5-amino-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6S)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6S)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6S)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2R,5S,6S)-6-(hydroxymethyl)-5-[(4-methylphenyl)sulfonylamino]-2-oxanyl]acetic acid 
2-[(2R,5S,6S)-6-(hydroxymethyl)-5-[[oxo(pyridin-4-yl)methyl]amino]-2-oxanyl]acetic acid 
2-[(2R,5S,6S)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6R)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6R)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2S,5R,6R)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6R)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6R)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6R)-6-(hydroxymethyl)-5-[(4-methylphenyl)sulfonylamino]-2-oxanyl]acetic acid 
2-[(2S,5R,6R)-6-(hydroxymethyl)-5-[[oxo(pyridin-4-yl)methyl]amino]-2-oxanyl]acetic acid 
2-[(2S,5R,6R)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6S)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6S)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2S,5R,6S)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6S)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6S)-6-(hydroxymethyl)-5-(pyridine-4-carbonylamino)oxan-2-yl]acetic acid 
2-[(2S,5R,6S)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5R,6S)-6-(hydroxymethyl)-5-[(4-methylphenyl)sulfonylamino]-2-oxanyl]acetic acid 
2-[(2S,5R,6S)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6R)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2S,5S,6R)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6R)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6R)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6R)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6S)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6S)-5-[[anilino(oxo)methyl]amino]-6-(hydroxymethyl)-2-oxanyl]acetic acid 
2-[(2S,5S,6S)-5-benzamido-6-(hydroxymethyl)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6S)-6-(hydroxymethyl)-5-(1-oxopropylamino)-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6S)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfonylamino]-2-oxanyl]acetic acid methyl ester 
2-[(2S,5S,6S)-6-(hydroxymethyl)-5-[(4-methylphenyl)sulfonylamino]-2-oxanyl]acetic acid 
2-[(2S,5S,6S)-6-(hydroxymethyl)-5-[[oxo(pyridin-4-yl)methyl]amino]-2-oxanyl]acetic acid 
2-[(2S,5S,6S)-6-(hydroxymethyl)-5-[[oxo-[4-(trifluoromethyl)anilino]methyl]amino]-2-oxanyl]acetic acid methyl ester 
2-amino-5-formylamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate 
2-amino-5-formylamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate(2-) 
4-(beta-D-ribofuranosyl)aminobenzene 5'-phosphate 
4a-hydroxytetrahydrobiopterin +  
5,6,7,8-tetrahydrobiopterin +   
5,6,7,8-tetrahydropterin-6-carboxylic acid 
5-phospho-D-ribosylamine +  
6-lactoyl-5,6,7,8-tetrahydropterin +  
6-methylformycin A 
7-(5-O-phosphono-beta-D-ribofuranosyl)-1,7-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4(3H)-one 2,2-dioxide 
7-O-methylvitexin 2''-O-alpha-L-rhamnoside 
7-O-methylvitexin 2''-O-beta-L-rhamnoside 
[1-(5-phosphoribosyl)imidazol-4-yl]acetic acid 
ADP-D-ribose 1'',2''-cyclic phosphate 
ADP-D-ribose 1''-phosphate 
Aloe C-glucosylchromone 
aloin A +  
aloin B +  
alpha-C-GalCer +  
alpha-D-ribose 1-methylphosphonate 5-phosphate 
alpha-ribazole 5'-phosphate 
alvaradoin E 
alvaradoin F 
alvaradoin G 
alvaradoin H 
alvaradoin I 
alvaradoin J 
alvaradoin K 
alvaradoin L 
alvaradoin M 
alvaradoin N 
ardimerin digallate 
C-2'-decoumaroyl-aloeresin G 
C-glycoside antibiotic 
C-glycosylphytoceramide +  
C-glycosylpyridine +  
C-nucleoside +   
C-pentosyl-apigenin O-feruloylhexoside 
canagliflozin +   
carminic acid 
chrysoeriol C-glucoside 
chrysoeriol C-hexoside-C-pentoside 
D-ribose 1-phosphate +  
D-ribose 5-phosphate +   
dapagliflozin +  
dyspropterin +  
empagliflozin +  
flavone C-glycoside +   
formycin +  
formycin 3',5'-cyclic phosphate 
formycin A 5'-monophosphate 
genistein 8-C-glucoside 
hydroxysafflor yellow A  
isoorientin 7-O-glucoside 
isoscoparin +  
isoscutellarein glycoside 
Isotan B 
isovitexin +  
isovitexin 2''-O-arabinoside 
isovitexin 2''-O-beta-D-glucoside 
isovitexin 7-O-[feruloyl]-glucoside 
isovitexin 7-O-[isoferuloyl]-glucoside 
isovitexin 8-C-beta-glucoside 
methyl 2-[(2R,5R,6S)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)oxan-2-yl]acetate 
methyl 2-[(2R,5S,6S)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)oxan-2-yl]acetate 
methyl 2-[(2S,5S,6R)-5-[(2-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)oxan-2-yl]acetate 
moromycin A 
moromycin B 
N(7)-methylformycin A 
N-(5-phospho-beta-D-ribosyl)anthranilic acid 
N-[(7,8-dihydropterin-6-yl)methyl]-4-(beta-D-ribofuranosyl)aniline 5'-phosphate 
A C-glycosyl compound that is N-[(7,8-dihydropterin-6-yl)methyl]-4-(beta-D-ribofuranosyl)aniline carrying a single monophospate substituent at position 5'.
N-\{3-[4-(3-aminopropyl)piperazin-1-yl]propyl\}-3-nitro-5-(D-galactopyranosyl)benzamide +  
orientin +   
papulacandin +  
phenyl 5-phosphono-alpha-D-ribofuranoside 
puerarin +   
puerarin xyloside 
S-methyl-5-thio-alpha-D-ribose 1-phosphate 
Semduramicin sodium 
sinapoyl-isovitexin 2''-O-arabinoside 
vitexin +   
vitexin 2''-O-alpha-L-rhamnoside 
vitexin 2''-O-beta-D-glucoside 
vitexin 2''-O-beta-L-rhamnoside 

Exact Synonyms: (1S)-1-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)-1,4-anhydro-5-O-phosphono-D-ribitol
Related Synonyms: Formula=C18H23N6O8P ;   InChI=1S/C18H23N6O8P/c19-18-23-16-12(17(27)24-18)22-10(6-21-16)5-20-9-3-1-8(2-4-9)15-14(26)13(25)11(32-15)7-31-33(28,29)30/h1-4,11,13-15,20,25-26H,5-7H2,(H2,28,29,30)(H4,19,21,23,24,27)/t11-,13-,14-,15+/m1/s1 ;   InChIKey=VNLUYZYZRAWLHI-NGFQHRJXSA-N ;   SMILES=Nc1nc2NCC(CNc3ccc(cc3)[C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)=Nc2c(=O)[nH]1
Xrefs: MetaCyc:CPD-10766 ;   PMID:10426953
Cyclic Relationships: is_conjugate_acid_of CHEBI:72951

paths to the root