Send us a Message

Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

Ontology Browser

Parent Terms Term With Siblings Child Terms
aminoxyls +     
benzoate ester +     
piperidines +     
(+)-gallocatechin +  
(+)-methyl sydowate 
(-)-gallocatechin +  
(3S,4R)-1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-4-phenyl-4-piperidinecarboxylic acid 
(3S,4R)-3-Benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-4-carboxylic acid 
(3Z)-hex-3-en-1-yl benzoate 
(5-Benzoyloxy-4,6-dihydroxy-3-methoxycyclohexen-1-yl)methyl benzoate 
1'-Hydroxychavicol acetate 
1,2,2,6,6-Pentamethyl-4-piperidinyl acrylate 
1,2-Benzenediol, 4-[[4-(4-fluorophenyl)-3-piperidinyl]methoxy]-, (3S-trans)- 
1,3-benzodioxole-5-carboxylic acid [2-[[[(3-fluorophenyl)-oxomethyl]hydrazinylidene]methyl]phenyl] ester 
1-(1-oxo-2-thiophen-2-ylethyl)-4-piperidinecarboxylic acid ethyl ester 
1-(2,6-difluorobenzyl)piperidine hydrochloride 
1-(2H-1,3-Benzodioxol-5-yl)-2-[2,6-dimethoxy-4-(prop-2-en-1-yl)phenoxy]propyl benzoate 
1-(3,4-dihydroxybenzoyl)-beta-D-glucopyranose +  
1-(3-phenylpropanoyl)-4-piperidinecarboxylic acid 
1-(4,6-dimethyl-2-pyrimidinyl)-4-piperidinecarboxylic acid 
1-(4-azido-2-nitrophenyl)amino-3-(1-oxyl-2,2,5,5-pyrrolidin-3-ylcarbonylamino)propan-2-yl diphosphate 
1-(4-carbamoyl-2-nitrophenyl)-4-piperidinecarboxylic acid methyl ester 
1-(4-chlorophenyl)-2-[4-(4-fluorobenzyl)piperidin-1-yl]ethanol +   
1-(4-ethylphenyl)-2-methyl-3-(piperidin-1-yl)propan-1-one +  
1-(5-isoquinolinylmethyl)-4-[(3-methoxyphenyl)methyl]-4-piperidinecarboxylic acid ethyl ester 
1-(tert-butylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-yl benzoate +   
1-[(4-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfonyl-4-piperidinecarboxylic acid ethyl ester 
1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-4-piperidinecarboxylic acid ethyl ester 
1-[(6-hydroxy-2-methyl-5-thiazolo[3,2-b][1,2,4]triazolyl)-(3,4,5-trimethoxyphenyl)methyl]-4-piperidinecarboxylic acid methyl ester 
1-[1-(2-benzylphenoxy)propan-2-yl]piperidine +  
1-[2-[(4-chlorophenyl)thio]-1-oxopropyl]-4-piperidinecarboxylic acid ethyl ester 
1-[2-[(4-methyl-2-oxo-1-benzopyran-7-yl)oxy]-1-oxoethyl]-4-phenyl-4-piperidinecarboxylic acid 
1-[2-[3-(N-ethylanilino)propylamino]-3,4-dioxo-1-cyclobutenyl]-4-piperidinecarboxylic acid ethyl ester 
1-[2-hydroxy-3-[4-(2-methylbutan-2-yl)phenoxy]propyl]-4-piperidinecarboxylic acid ethyl ester 
1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine +   
1-Piperidine carboxylic acid 
1-Tert-Butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate 
10-dehydroxymelleolide D 
10H-phenothiazine +   
11-(15-butyl-13-ethyl-tetrahydro-12-oxo-2H-pyran-13-yl) propyl-2-methylbenzoate 
13-hydroxymelleolide K 
15-acetoxyorbiculin G 
16-DOXYL-stearic acid +  
16-DOXYL-stearic acid methyl ester 
17beta-estradiol 3-benzoate  
1beta-hydroxymaprounic acid 3-p-hydroxybenzoate 
2,2-diphenyl-4-piperidinomethyl-1,3-dioxolane methiodide 
2,3,4-trihydroxybenzoic acid 
2,4,6-Trimethoxyphenyl acetate 
2,4-dichlorobenzoic acid 1,2,4-triazol-1-ylmethyl ester 
2,4-difluorobenzoic acid [2-(cyclopropylamino)-2-oxoethyl] ester 
2,6-difluorobenzoic acid 2,3-dihydro-1,4-benzodioxin-3-ylmethyl ester 
2,6-diphenyl-3-propyl-4-piperidinone oxime 
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid thiophen-2-ylmethyl ester 
2-(2-furanylmethylamino)benzoic acid [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] ester 
2-(2-furanylmethylamino)benzoic acid [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] ester 
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoic acid 
2-(butylamino)benzoic acid [2-oxo-2-(4-sulfamoylanilino)ethyl] ester 
2-(piperidin-1-yl)ethanol +  
2-(thiophen-2-ylsulfonylamino)benzoic acid [2-(cyclohexylamino)-2-oxoethyl] ester 
2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxyindan-1-one +  
2-[(2-\{[2-(\{2,4-dinitro-5-[2,2,6,6-tetramethyl-1-(ylooxy)piperidin-4-ylamino]phenyl\}amino)ethyl]amino\}-2-oxoethoxy)acetamido]ethyl 1,2-dipalmitoylglycero-3-phosphate 
2-[(4-acetyloxy-3-ethoxyphenyl)methylidene]-7-methyl-3-oxo-5-(2-phenylethenyl)-5H-thiazolo[3,2-a]pyrimidine-6-carboxylic acid ethyl ester 
2-[(4-acetyloxyphenyl)methylidene]-7-methyl-3-oxo-5-(2-phenylethenyl)-5H-thiazolo[3,2-a]pyrimidine-6-carboxylic acid ethyl ester 
2-[(benzoylamino)methyl]-3,4,6-trichlorophenyl 4-nitrobenzoate 
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid (4-chlorophenyl) ester 
2-[3-(trifluoromethyl)anilino]benzoic acid 2-(2-hydroxyethoxy)ethyl ester 
2-[3-[(4-ethoxycarbonylphenyl)hydrazinylidene]-6-oxo-1-cyclohexa-1,4-dienyl]acetic acid 
2-[4-(difluoromethylthio)anilino]benzoic acid [2-(cyclopropylamino)-2-oxoethyl] ester 
2-[4-(difluoromethylthio)anilino]benzoic acid [2-(dimethylamino)-2-oxoethyl] ester 
2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide +   
2-[5-[(5-amino-1-tetrazolyl)iminomethyl]-2-furanyl]-5-bromobenzoic acid methyl ester 
2-[[(1,3-benzodioxol-5-ylamino)-oxomethyl]amino]benzoic acid methyl ester 
2-[[(4-methyl-1-piperidinyl)-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
2-[[(4-methyl-1-pyrazolyl)-oxomethyl]amino]benzoic acid methyl ester 
2-[[2-(6-oxo-1-cyclohexa-2,4-dienylidene)-3H-1,3,4-oxadiazol-5-yl]thio]acetic acid (2,6-dimethylphenyl) ester 
2-[[2-(6-oxo-1-cyclohexa-2,4-dienylidene)-3H-1,3,4-oxadiazol-5-yl]thio]acetic acid (4-phenylmethoxyphenyl) ester 
2-[[2-[(2-hydroxyphenyl)-oxomethoxy]-1-oxoethyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylic acid methyl ester 
2-[[3-(methylthio)-1,2,4-thiadiazol-5-yl]thio]acetic acid (4-acetamidophenyl) ester 
2-[[[(1-ethyl-3,5-dimethyl-4-pyrazolyl)methylamino]-oxomethyl]amino]benzoic acid methyl ester 
2-[[[(5-chloro-2-pyridinyl)amino]-oxomethyl]amino]benzoic acid methyl ester 
2-[[[2-(2-methoxyphenyl)ethylamino]-oxomethyl]amino]benzoic acid methyl ester 
2-acetylamino-3-hydroxyl-4-methyl-benzoic acid methyl ester 
2-amino-4-chlorobenzoic acid [2-oxo-2-(3,3,5-trimethyl-7-azabicyclo[3.2.1]octan-7-yl)ethyl] ester 
2-aminosulfonyl-benzoic acid methyl ester 
2-benzoylbenzene-1,4-diyl bis(4-bromo-3-nitrobenzoate) 
2-chloro-5-[5-[(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]-2-furanyl]benzoic acid ethyl ester 
2-ethoxy-3-pyridinecarboxylic acid (4-methoxycarbonylphenyl)methyl ester 
2-furancarboxylic acid [3-[[[1,3-benzodioxol-5-yl(oxo)methyl]hydrazinylidene]methyl]phenyl] ester 
2-furancarboxylic acid [3-[[[4-anilino-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] ester 
2-furancarboxylic acid [4-[(2,4-dioxo-5-thiazolidinylidene)methyl]-2-methoxyphenyl] ester 
2-furancarboxylic acid [4-[(3-methyl-4-oxo-2-sulfanylidene-5-thiazolidinylidene)methyl]phenyl] ester 
2-furancarboxylic acid [4-[[[(2-methylpropan-2-yl)oxy-oxomethyl]hydrazinylidene]methyl]phenyl] ester 
2-furancarboxylic acid [4-[[[oxo(2-pyridinyl)methyl]hydrazinylidene]methyl]phenyl] ester 
2-Hexenyl benzoate 
2-hydroxy-2-phenylacetic acid (1,2,2,6-tetramethyl-4-piperidinyl) ester 
2-hydroxy-2-phenylacetic acid (1,2,6,6-tetramethyl-3-piperidinyl) ester 
2-hydroxy-3-methylbenzoic acid (3-cyano-4-imino-2-oxopentyl) ester 
2-hydroxy-4-methylbenzoic acid [2-(2-chloroanilino)-2-oxoethyl] ester 
2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid [2-[1-(3-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] ester 
2-hydroxybenzoic acid (3,3,5-trimethylcyclohexyl) ester  
2-hydroxybenzoic acid [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] ester 
2-hydroxybenzoic acid [2-[[(1-methyl-2-pyrrolyl)-oxomethyl]amino]-2-oxoethyl] ester 
2-methyl butyl propyl phthalate 
2-Methyl-2-propanyl (4-hydroxy-3-piperidinyl)carbamate 
2-Methylphenyl 2-methylpropanoate 
2-Methylpropyl 2-aminobenzoate 
2-naphthol +   
2-O-caffeoyl maslinic acid 
2-Phenylethyl 2-aminobenzoate 
2-piperidinobenzoic acid 
2-piperidinophenyl 4-(acetylamino)-3-chlorobenzenesulfonate 
2-Propenyl 2-aminobenzoate 
2-thiophenecarboxylic acid (4-acetamidophenyl) ester 
2-thiophenecarboxylic acid [2-ethoxy-4-[(3-methyl-5-oxo-1-phenyl-4-pyrazolylidene)methyl]phenyl] ester 
2-thiophenecarboxylic acid [3-[[1-(3-chloro-4-fluorophenyl)-3,5-dioxo-4-pyrazolidinylidene]methyl]phenyl] ester 
2-thiophenecarboxylic acid [4-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]phenyl] ester 
2alpha-hydroxymaprounic acid 2,3-bis-p-hydroxybenzoate 
3'-Hydroxy Repaglinide(Mixture of Diastereomers) 
3,3-dimethyl-5-oxo-5-(2-piperidinoanilino)pentanoic acid 
3,3-Dimethylpiperidine hydrochloride 
3,4,5-Trimethoxyphenyl acetate 
3,4-bis(methoxycarbonyl)benzoic acid 
3,4-diethoxybenzoic acid [2-[(5-methyl-3-isoxazolyl)amino]-2-oxoethyl] ester 
3,4-dimethylbenzoic acid (6-methyl-3-pyridinyl) ester 
3,5-Bis(1,1-dimethylethyl)-4-hydroxy-benzoic acid ethyl ester 
3,5-dichlorobenzoic acid (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) ester 
3,5-dimethyl-4-oxo-6-thieno[2,3-d]pyrimidinecarboxylic acid (4-methylphenyl) ester 
3,5-dimethylbenzoic acid (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) ester 
3-(2-furanyl)-2-propenoic acid (3-formylphenyl) ester 
3-(2-methylpiperidin-1-yl)propyl 3,4-dichlorobenzoate +  
3-(diethylsulfamoyl)benzoic acid [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] ester 
3-(dimethylamino)propyl benzoate 
3-(methanesulfonamido)benzoic acid methyl ester 
3-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoic acid [2-(1H-indol-3-yl)-2-oxoethyl] ester 
3-[(3,4-difluorophenyl)sulfonylamino]benzoic acid [2-[[(2-methylpropylamino)-oxomethyl]amino]-2-oxoethyl] ester 
3-[(4-ethoxycarbonyl-4-phenyl-1-piperidinyl)methyl]benzoic acid 
3-[(4-methylphenyl)sulfamoyl]benzoic acid [2-(2-furanylmethylamino)-2-oxoethyl] ester 
3-[2-(2,6-dichlorophenyl)-6-quinolyl]-1-hydroxy-1-methoxypropan-2-yl 2,6-dichlorobenzoate 
3-[5-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]-2-furanyl]benzoic acid methyl ester 
3-[[oxo-[3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methoxy]methyl]benzoic acid ethyl ester 
3-amino-4-chlorobenzoic acid [2-oxo-2-(1-pyrrolidinyl)ethyl] ester 
3-Aminomethylbenzoic acid methyl ester hydrochloride 
3-cyclohexyl-1-[2-(methyl\{[(3R)-1-methylpiperidin-3-yl]methyl\}amino)-2-oxoethyl]-2-phenyl-1H-indole-6-carboxylic acid 
3-Hexenyl salicylic acid 
3-hydroxybenzoic acid [2-(1H-indol-3-yl)-2-oxoethyl] ester 
3-hydroxybenzyl benzoate 
3-Iodopropanoic acid 
3-Methylbutyl benzoate 
3-methylthiofentanyl +  
3-Piperidinobenzoic acid 
3-pyridinecarboxylic acid [4-[heptoxy(oxo)methyl]phenyl] ester 
4,4-dimethyloxazolidine-N-oxyl +  
4-(1-piperidinyl)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid ethyl ester 
4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid [2-(cyclopropylamino)-2-oxoethyl] ester 
4-(2-benzamidoethylamino)-1-piperidinecarboxylic acid ethyl ester 
4-(4-buta-2,3-dienyloxy-benzyloxy)-benzoic acid methyl ester 
4-(4-methoxycarbonylphenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylic acid dimethyl ester 
4-(5-formyl-2-furanyl)benzoic acid propyl ester 
4-(\{4-[(2,3,3-Trichloroacryloyl)oxy]phenyl\}sulfonyl)phenyl 2,3,3-trichloroacrylate 
4-(benzenesulfonyl)-1-[(4-chlorophenyl)methyl]-4-piperidinecarboxylic acid ethyl ester 
4-(carbamoylamino)benzoic acid [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] ester 
4-(diethylsulfamoyl)benzoic acid 1,3-benzodioxol-5-yl ester 
4-(diethylsulfamoyl)benzoic acid [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] ester 
4-(dimethylamino)benzoic acid (3,5-dimethyl-4-isoxazolyl)methyl ester 
4-(dimethylamino)benzoic acid (phenylmethyl) ester 
4-(dimethylamino)benzoic acid [2-(cycloheptylamino)-2-oxoethyl] ester 
4-(dimethylsulfamoyl)benzoic acid [2-(2-furanylmethylamino)-2-oxoethyl] ester 
4-(tert-butyl)phenyl 3,5-dimethylisoxazole-4-carboxylate 
4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]benzoic acid methyl ester 
4-[(2-methoxyphenyl)-methylsulfamoyl]benzoic acid [2-[(5-methyl-3-isoxazolyl)amino]-2-oxoethyl] ester 
4-[2-(4-methoxycarbonylphenyl)iminohydrazinyl]benzoic acid methyl ester 
4-[2-(cyclohexylamino)-2-oxo-1-[(1-oxo-2-thiophen-2-ylethyl)-(phenylmethyl)amino]ethyl]benzoic acid methyl ester 
4-[3-(2-furanyl)-4-(3-nitrophenyl)-6-oxo-2,4-dihydropyrrolo[3,4-c]pyrazol-5-yl]benzoic acid ethyl ester 
4-[3-methyl-5-(4-methylphenyl)-6-oxo-2,4-dihydropyrrolo[3,4-c]pyrazol-4-yl]benzoic acid methyl ester 
4-[4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]-1-piperidinyl]-3-nitrobenzoic acid methyl ester 
4-[5-(2-phenylethyl)-2-sulfanylidene-1,3,5-triazinan-1-yl]benzoic acid ethyl ester 
4-[5-[[(2-hydroxy-2-phenylethyl)amino]methyl]-2-furanyl]benzoic acid methyl ester 
4-[5-[[[(5-bromo-3-pyridinyl)-oxomethyl]hydrazinylidene]methyl]-2-furanyl]benzoic acid ethyl ester 
4-[5-[[[2-(2-methyl-1,3-dioxan-2-yl)-1-oxoethyl]hydrazinylidene]methyl]-2-furanyl]benzoic acid methyl ester 
4-[5-[[[ethylamino(sulfanylidene)methyl]hydrazinylidene]methyl]-2-furanyl]benzoic acid butyl ester 
4-[5-[oxo-(3-pyridinylamino)methyl]-2-furanyl]benzoic acid ethyl ester 
4-[6-(diaminomethylideneamino)-1-oxohexoxy]benzoic acid ethyl ester  
4-[[(2,3-dihydro-1H-inden-1-ylamino)-sulfanylidenemethyl]amino]benzoic acid methyl ester 
4-[[(3,4-dimethoxyanilino)-oxomethyl]amino]benzoic acid butyl ester 
4-[[(4-hydroxy-1-piperidinyl)-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[(4-methoxyanilino)-oxomethyl]amino]benzoic acid methyl ester 
4-[[(4-oxo-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)thio]methyl]benzoic acid methyl ester 
4-[[(cyclohexylamino)-oxomethyl]amino]benzoic acid methyl ester 
4-[[1-azepanyl(oxo)methyl]amino]benzoic acid ethyl ester 
4-[[2-(3-ethylanilino)-3,4-dioxo-1-cyclobutenyl]amino]-1-piperidinecarboxylic acid ethyl ester 
4-[[3-(4-chlorophenyl)-5-isoxazolyl]methyl]-1-[(2-methylpropan-2-yl)oxy-oxomethyl]-4-piperidinecarboxylic acid 
4-[[4-[[[(2-methoxyethylamino)-sulfanylidenemethyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid methyl ester 
4-[[4-cyclohexyl-3-(2-hydroxyethyl)-1-piperazinyl]methyl]benzoic acid methyl ester 
4-[[6-methyl-2-(6-oxo-1-cyclohexa-2,4-dienylidene)-1H-pyrimidin-4-yl]amino]benzoic acid methyl ester 
4-[[[(2-methoxy-1-oxoethyl)hydrazo]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[(2-methoxyphenyl)methylamino]-oxomethyl]amino]benzoic acid ethyl ester 
4-[[[2-(1-azepanyl)ethyl-(2-furanylmethyl)amino]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[2-(3-methylphenyl)ethylamino]-sulfanylidenemethyl]amino]benzoic acid methyl ester 
4-[[[2-(4-fluorophenyl)ethylamino]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[2-(4-methoxyphenyl)-3-thiazolidinyl]-sulfanylidenemethyl]amino]benzoic acid ethyl ester 
4-[[[[2-(3-pyridinyl)-1-piperidinyl]amino]-sulfanylidenemethyl]amino]benzoic acid methyl ester 
4-[[[[8-[(1-tert-butyl-5-tetrazolyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-oxomethyl]amino]benzoic acid ethyl ester 
4-[[diethylamino(oxo)methyl]amino]benzoic acid ethyl ester 
4-\{[tricycle(,3)non-8-yl] methoxy carbonyl benzene-1,3-dicarboxylic acid\} (2,4,5,6,7, 8, 9 heptaoxa, 3-ethoxy, 5,6,7,9-tetramethyl unidecane) 
4-acetamidobenzenesulfonic acid [2-(1-piperidinyl)phenyl] ester 
4-amino-TEMPO +   
4-aminobenzoic acid 3-(dibutylamino)propyl ester 
4-chloro-3-(1-piperidinylsulfonyl)benzoic acid [2-(4-amino-1,3-dimethyl-2,6-dioxo-5-pyrimidinyl)-2-oxoethyl] ester 
4-chloro-3-(1-pyrrolidinylsulfonyl)benzoic acid [2-(butylamino)-2-oxoethyl] ester 
4-chlorobenzoic acid (5-methyl-2-pyridin-4-yl-4-thiazolyl) ester 
4-chlorophenyl methyl\{trans-4-[4-(piperidin-1-ylmethyl)phenyl]cyclohexyl\}carbamate 
4-cyanobenzoic acid [4-oxo-6-[(2-pyrimidinylthio)methyl]-3-pyranyl] ester 
4-cyanobenzoic acid [6-[[(4-methyl-2-pyrimidinyl)thio]methyl]-4-oxo-3-pyranyl] ester 
4-Ethoxy ethylbenzoate 
4-ethylbenzoic acid [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] ester 
4-fluorobenzoic acid 4-[(5-phenyl-1,3,4-oxadiazol-2-yl)thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-furanyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-fluorobenzoic acid 4-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]thio]but-2-ynyl ester 
4-Hydroxy-2,3,6-trimethylphenyl acetate 
4-hydroxy-TEMPO +   
4-hydroxy-TEMPO benzoate 
A member of the class of piperidines that is TEMPO carrying a benzoyloxy group at position 4.
4-hydroxybenzoate ester +   
4-methyl-3-(4-morpholinylsulfonyl)benzoic acid [3-(1H-benzimidazol-2-yl)-3-cyano-2-oxopropyl] ester 
4-methylbenzoic acid [2-(1H-indol-3-yl)-2-oxoethyl] ester 
4-methylbenzoic acid [6-[[[5-[[cyclopropyl(oxo)methyl]amino]-1,3,4-thiadiazol-2-yl]thio]methyl]-4-oxo-3-pyranyl] ester 
4-Methylphenyl 3-methylbutanoate 
4-Methylphenyl dodecanoate 
4-Methylphenyl octanoate 
4-Piperidinobenzoic acid 
4-Tritylphenyl 5-hexynoate 
4R,5R,6S-Trihydroxy-2-hydroxymethyl-2-cyclohexen-1-one 6-(2-hydroxy-6-methylbenzoate) 
5-(4-acetyloxy-3-methoxyphenyl)-2,7-dimethyl-3-oxo-5H-thiazolo[3,2-a]pyrimidine-6-carboxylic acid ethyl ester 
5-(4-morpholinylsulfonyl)-2-(1-piperidinyl)benzoic acid [2-[[(3-methylbutylamino)-oxomethyl]amino]-2-oxoethyl] ester 
5-(diethylsulfamoyl)-2-hydroxybenzoic acid [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] ester 
5-[(carbamimidoylthio)methyl]-2-(3-methylbutoxy)benzoic acid methyl ester 
5-DOXYL-stearic acid +  
5-DOXYL-stearic acid methyl ester 
5-O-[(3R)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate 
6'-chloromelleolide F 
6-O-p-bromobenzoyl sphaeropsidin A 
7-Epizucchini factor A 
9-acetoxy-8,10-dehydrothymol 3-O-tiglate 
9-acetoxy-8,10-epoxythymol 3-O-tiglate 
[(2S)-1-(1H-indol-3-yl)-5-methyl-3-oxohexan-2-yl] 2-aminobenzoate 
[2,8-bis(trifluoromethyl)quinolin-4-yl]-(2-piperidyl)methanol +   
[8]-Paradyl acetate 
A-72363 A-1 
A-72363 A-2 
A-72363 C 
acetic acid [2-(4-acetamido-6-phenyl-1,3,5-triazin-2-yl)phenyl] ester 
acetic acid [2-[2-acetyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl] ester 
acetic acid [3-[3-(dimethylamino)-1-oxopropyl]-5-benzofuranyl] ester 
acetic acid [4-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-2-methoxyphenyl] ester 
acetic acid [4-[(1-oxo-2-phenylethyl)amino]phenyl] ester 
acetic acid [4-[oxo-(2-phenylethylamino)methyl]phenyl] ester 
AF-DX 384 
albibrissinoside A 
albiflorin +   
allopurinol +   
Allyl benzoate 
amburoside A 
amidopiperidine +   
aminopiperidine +   
Ampelomin G 
Amyl salicylate 
ananolignan K 
Anthocidin A 
Anthocidin B 
Anthocidin C 
Anthocidin D 
anthrone +  
Arcuflavin B 
ardisiphenol A 
ardisiphenol B 
ardisiphenol C 
Armillaric acid 
Armillyl everninate 
Armillyl orsellinate 
Asarumin B 
Asperidine B 
aspirin-based probe AP 
avilamycin A 
avilamycin A precursor 
baccatin III +   
baicalein +   
bellidin +   
Benwamycin C 
benzastatin C 
benzoic acid (2-oxo-2-thiophen-2-ylethyl) ester 
benzoic acid 2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl ester  
benzoic acid [2-(2-furanylmethylamino)-2-oxoethyl] ester 
benzoic acid [2-methyl-2-(propylamino)propyl] ester 
benzoic acid [4-(6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)-2-methoxyphenyl] ester 
benzoic acid [5-amino-1-(4-methoxyphenyl)sulfonyl-3-pyrazolyl] ester 
benzoic acid [[1-(4-nitrophenyl)-4-piperidinylidene]amino] ester 
Benzoyl meso-tartaric acid 
Benzoylmalic acid 
benzyl 2,5-dihydroxybenzoate 
Benzyl 4-piperidinylcarbamate 
benzyl benzoate  
Benzyl parahydroxybenzoate  
Benzyl salicylate  
bevonium methyl sulfate 
Bicyclomycin benzoate 
biperiden +   
biperiden hydrochloride 
bipiperidines +  
Bis(3,5,5-trimethylhexyl) phthalate 
Bopindolol malonate 
brasilicardin A 
BU-4601 A 
BU-4601 B 
BU-4601 C 
butamben +   
butan-2-yl 2-(2-hydroxyethyl)piperidine-1-carboxylate 
Butyl 2-ethylhexyl phthalate 
butyl anthranilate 
butyl benzoate 
Butyl phthalyl butylglycolate 
Butyl salicylate 
caffeoylglycolic acid methyl ester 
calabricoside A 
calabricoside B 
Calystegin A3 
Calystegin B2 
Camporidine A 
Camporidine B 
cangorinine E-1 
Chamiside A 
Chavicol acetate 
chloroprocaine +  
Chloropupukeanone A 
cholesta-5,7-dien-3beta-ol benzoate 
Cinnamyl anthranilate  
Cinnamyl benzoate 
cis-3-Hexenyl 2-aminobenzoate 
cis-3-Hexenyl salicylate 
Clebopride malate 
Cochphthester A 
Cochphthester D 
Cochphthester E 
Cochphthester F 
Cochphthester G 
comazaphilone A 
comazaphilone B 
comazaphilone C 
comazaphilone D 
comazaphilone E 
comazaphilone F 
coniferyl benzoate 
Coniferyl diangelate 
crassicauline A 
crassifogenin C 
cratoxylumxanthone D 
cudranian 1 
cudranian 2 
curcumin +   
Curtachalasin C 
Curtachalasin D 
Curtachalasin E 
curtisian A 
curtisian B 
curtisian C 
curtisian D 
cyathusal A 
cyathusal B 
cyathusal C 
cyclohexanecarboxylic acid [2-oxo-2-[4-(1-piperidinyl)anilino]ethyl] ester 
Cyclohexyl 2-aminobenzoate 
cycrimine +  
cylindol A 
cyproheptadine +   
cytonic acid A 
cytonic acid B 
D-glucosyl salicylate +  
daedalin A 
dehydrodiconiferyl dibenzoate 
dendrocandin C 
dendrocandin D 
dendrocandin E 
desmethyl loperamide 
Di(2,6-dimethyl-4-heptyl) phthalate 
Di(2-nonyl) phthalate 
di-tert-butyl nitroxide 
Dibenzoyl Thiamine 
digallic acid  
Dimethyl 4,4'-ethyne-1,2-diyldibenzoate 
dimethyl sulfoxide +   
Dinoseb acetate 
diphemanil methylsulfate 
diphenylamine +   
diphenylpyraline +   
DL-Propylene glycol dibenzoate 
dyclonine +   
ecgonine benzoate  
Echinacea extract 
emarginatine B 
emarginatine F 
encainide +  
eriodictyol 7-O-beta-D-glucopyranoside 
erylatissin A 
erylatissin B 
erylatissin C 
ethyl 1-(3-nitro-2-thienyl)piperidine-4-carboxylate 
Ethyl 2-aminobenzoate 
Ethyl 3-(1,3-thiazol-2-yl)benzoate 
ethyl 3-amino-4-(methylamino)benzoate 
ethyl 4-\{2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy\}benzoate 
ethyl 4-\{3-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]propoxy\}benzoate 
ethyl 4-\{4-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]butoxy\}benzoate 
Ethyl 4-ethoxy-2-hydroxy-3,6-dimethylbenzoate 
ethyl 4-hydroxybenzoate sulfate 
ethyl 4-tert-butylbenzoate 
ethyl 5-ethoxy-2-formyl-3-hydroxy-4-methylbenzoate 
ethyl benzoate 
Ethyl N-methylanthranilate 
ethyl piperidinoacetylaminobenzoate 
Ethyl-N-ethylanthranilic acid 
Ethylhexyl salicylate 
eugenol +   
Euphorbia diterpenoid 1 
Euphorbia diterpenoid 3 
Euphorbiaproliferin B, (rel)- 
Euphorbiaproliferin D 
Euphorbiaproliferin E 
Euphorbiaproliferin F 
Euphorbiaproliferin H 
euphornin L 
Euphorprolitherin B 
Euphorprolitherin C 
fentanyl +   
ferrostatin-1 +   
flavaspidic acid PB 
G a G b G 
G b G AcO 
G b S 
gabexate methanesulfonate  
gallate ester +   
Ganbajunin A 
geranyl benzoate 
ginsenoside Rb1  
globosumone A 
globosumone B 
globosumone C 
glochierioside A 
glochierioside B 
Glycerol 1-hydroxy-2,5-dimethyl benzoate 
Glycerol tribenzoate 
GR 113808  
Guaiacol acetate 
Guaicyl acetate 
Guaicyl phenylacetate 
H b G AcO 
Heptyl p-hydroxybenzoate 
heteroarylpiperidine +   
hexadecyl benzoate 
hexan-2-yl benzoate 
hexan-3-yl benzoate 
Hexyl benzoate 
Hexyl salicylic acid 
hokbusine A 
Hydroxyphenylethanol diacetate 
hydroxypiperidine +   
hydroxysafflor yellow A  
hypoglaunine C 
hyponine D 
ibuprofen +   
Ifenprodil tartrate 
iminopiperidine +  
Ingenol 3,20-dibenzoate  
integracin A 
integracin B 
integracin C 
interiotherin A 
Ioxynil octanoate 
Isoamyl salicylate 
isobutyl benzoate 
Isobutyl salicylate 
Isoeugenol phenylacetate 
isonymphaeol B 
isoorientin +   
Isopropyl benzoate 
isopropyl salicylate +   
kaempferol 7-O-beta-D-glucopyranoside 
Kansuinine B 
kweichowenol B 
lignin cw compound-116 
lignin cw compound-138 
lignin cw compound-195 
lignin cw compound-202 
lignin cw compound-214 
lignin cw compound-218 
lignin cw compound-251 
lignin cw compound-254 
lignin cw compound-255 
lignin cw compound-280 
lignin cw compound-294 
lignin cw compound-3010 
lignin cw compound-3035 
lignin cw compound-3037 
lignin cw compound-3039 
lignin cw compound-3041 
lignin cw compound-99 
Livostin (TN) 
locoracemoside B 
luteolin +   
lycoperine A 
madhucoside A 
madhucoside B 
matteucinol +  
Medinoterb acetate 
melatonin +   
Melledonal A 
Melledonal B 
Melleolide B 
Melleolide C 
Melleolide D 
Melleolide E 
melleolide F 
Melleolide G 
Melleolide H 
Melleolide I 
Melleolide K 
Melleolide L 
Melleolide M 
Melleolide Q 
menthyl salicylate 
Meprylcaine hydrochloride 
Methyl 2,5-dihydroxybenzoate 
Methyl 2,6-dihydroxybenzoate 
Methyl 2-(10-heptadecenyl)-6-hydroxybenzoate 
Methyl 2-(trifluoromethoxy)benzoate 
Methyl 2-[(methylsulfonyl)amino]benzoate 
methyl 2-\{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl\}benzoate 
methyl 2-\{[5-(\{3-chloro-4-[(5S)-1,1-dioxido-3-oxo-1,2-thiazolidin-5-yl]-N-(phenylsulfonyl)-L-phenylalanyl\}amino)pentyl]oxy\}-6-hydroxybenzoate 
Methyl 2-cyanobenzoate 
methyl 3,4-dihydroxy-5-(3'-methyl-2'-butenyl)benzoate 
Methyl 3-amino-4-methylbenzoate 
Methyl 3-aminobenzoate 
Methyl 3-cyanobenzoate 
methyl 3-hydroxybenzoate 
Methyl 4-(3-hydroxy-3-methylbut-1-ynyl)benzoate 
Methyl 4-(4,6-dihydroxy-5-methoxy-2,5-dimethyl-3-oxocyclohexen-1-yl)oxy-2-hydroxy-3,6-dimethylbenzoate 
methyl 4-\{[(\{[(2R,5S)-5-\{[(2S)-2-(aminomethyl)pyrrolidin-1-yl]carbonyl\}pyrrolidin-2-yl]methyl\}amino)carbonyl]amino\}benzoate 
methyl 4-acetoxy-3-methoxybenzoate 
methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate 
Methyl 4-amino-3-iodobenzoate 
Methyl 5-chloro-2-hydroxybenzoate 
Methyl 8-(2-(benzoyloxy)-ethyl)-hexahydro-4-((E)-pent-2-enyl)-2H-chromene-6-carboxylate 
methyl anthranilate 
methyl benzoate 
methyl brevifolincarboxylate 
methyl N-methylanthranilate 
Methyl neopentyl phthalic acid 
methyl p-anisate 
Methyl paroxetine 
methyl phenyl(piperidin-2-yl)acetate +   
methyl salicylate  
Methyl seco-fomannoxinate 
methyl syringate 
methyl vanillate +   
methyl-4-hydroxybenzoate O-sulfate 
metixene +   
metronidazole benzoate 
metsulfuron methyl  
Mono-carboxy isononyl phthalate 
Mono-carboxy isooctyl phthalate  
N,N-dimethylethanolamine +   
N-acetyl-L-cysteine +   
N-acylpiperidine +   
N-carbamimidoylpiperidine +  
N-cyclohexylpiperidine +  
N-ethylpiperidine +  
N-oxyethylpiperidine +   
Nabscebetain A 
Nabscebetain B 
nafamostat methanesulfonate 
Nigrospoxydon C 
nitric oxide  
Nocarasin B 
Nojirimycin B 
nymphaeol A 
nymphaeol B 
nymphaeol C 
O-benzoylecgonine 5-carboxypentyl ester 
o-orsellinate depside 
o-Tolyl acetate 
octyl benzoate 
oleuropein +   
onosmin B 
orbiculin A 
orbiculin E 
orbiculin F 
orbiculin G +  
oriciacridone C 
oriciacridone F 
orobol +  
ovothiol A 
ovothiol B 
ovothiol C 
oxybuprocaine +   
oxyphenisatine acetate  
p-Tolyl isobutyrate 
p-Tolyl phenylacetate 
Padimate A 
Padimate O  
paeoniflorin sulfonate 
Paeonilactone C 
para-methoxy-Butyryl fentanyl 
paroxetine +   
paxanthonin +  
Penicilactone B 
penicitrinol B 
Penipyrol B 
pennicitrinone C 
Pestalamine A 
phenethyl benzoate 
Phenethyl salicylate  
phenyl benzoate  
Phenyl butyrate 
phenyl salicylate  
Phenyl thiophene-2-carboxylate 
Phomone A 
phthalic acid di(2-propylpentyl)ester 
Piperenol A 
Piperenol B 
piperidine +   
piperidine alkaloid +   
piperidine antibiotic +   
piperidine N-oxide +  
piperidinecarboxamide +   
piperidinecarboxylate ester +   
piperidinemonocarboxylic acid +   
piperidinesulfonamide +  
piperidones +   
platensimycin A2 methyl ester 
platensimycin A3 methyl ester 
platensimycin A4 methyl ester 
platensimycin A5 methyl ester 
platensimycin B4 methyl ester 
platensimycin methyl ester 
potassium 2-(4-carboxylatophenyl)-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide 
potassium iodide  
potassium nitrosodisulfonate 
Prenyl benzoate 
proatranorin I 
proatranorin II 
proatranorin III 
proatranorin IV 
Proliferin A 
Proliferin B 
Proliferin C 
propofol +   
propyl 4-hydroxybenzoate sulfate 
propyl benzoate 
pterolinus F 
purpurquinone A 
purpurquinone B 
purpurquinone C 
PYR-41 +  
pyrrolidine dithiocarbamate  
quercetin +   
quercetin 3,4'-di-O-beta-D-glucoside 
quercetin 3-(6''-p-hydroxybenzoylgalactoside) 
rediocide C 
rediocide F 
rediocide G 
resorcinol monobenzoate 
ritalinic acid  
Ro 25-6981  
Roxane +   
Roxatidine acetate hydrochloride 
RS 39604  
S a S b S 
S b S AcO 
S-allylsulfenic acid 
scoparic acid A 
scutebarbatine C 
scutebarbatine D 
scutebarbatine E 
Siastatin B 
sigmoidin A 
sigmoidin B 
Sinapyl alcohol diacetate 
Streptazone A 
Streptoglyceride C 
Streptoglyceride D 
sugiol +  
sulfanylpiperidine +  
sulfometuron methyl 
surugapyrrole A 
surugapyrrole B 
taiwankadsurin B 
tanariflavanone C 
tanariflavanone D 
tasumatrol E 
tasumatrol F 
Tasumatrol I(rel) 
Tasumatrol J(rel) 
taurine +   
TEMPO +   
Tert-butyl 3-aminobenzoate 
tert-butyl 4-hydroxy-3-methoxybenzoate 
tert-butyl benzoate 
tert-butyl p-Toluate 
Tetracaine hydrochloride 
Tetracaine N-oxide 
Tetrahydrofuran fentanyl 
Thelephantin I 
Thellungianin G 
thioridazine +   
tirofiban +  
trans-resveratrol +   
Tri-2-ethylhexyl trimellitate  
tribenuron methyl 
Trichoderolide D 
Trichorin B 
tricin 7-O-beta-D-glucoside 
trigoheterin E, (rel)- 
triptofordin C 2 
tropanyl 3,5-dimethylbenzoate 
vaccihein A 
vandetanib +   
Vanillin a G b CA 
Vanillin isobutyrate 
vinyl benzoate 
wilfordinine C 
wilfornine A 
Xestoproxamine A, (rel)- 
Xestoproxamine B, (rel)- 
Xestoproxamine C, (rel)- 
xyloketal B 

Exact Synonyms: [4-(benzoyloxy)-2,2,6,6-tetramethylpiperidin-1-yl]oxidanyl
Related Synonyms: 2,2,6,6-Tetramethyl-4-(benzoyloxy)piperidine-1-oxyl ;   4-Benzoyloxy-2,2,6,6-tetramethylpiperidinyloxyl ;   4-Benzoyloxy-TEMPO ;   4-Hydroxy-2,2,6,6-tetramethylpiperidine 1-oxyl benzoate ;   4-benzoyloxy-2,2,6,6-tetramethylpiperidine 1-oxyl ;   4-hydroxy-TEMPO benzoate free radical ;   Formula=C16H22NO3 ;   InChI=1S/C16H22NO3/c1-15(2)10-13(11-16(3,4)17(15)19)20-14(18)12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3 ;   InChIKey=MJEDTBDGYVATPI-UHFFFAOYSA-N ;   SMILES=CC1(C)CC(CC(C)(C)N1[O])OC(=O)C1=CC=CC=C1
Xrefs: CAS:3225-26-1 ;   Chemspider:2123762 ;   PMID:16853976 ;   PMID:18611421 ;   PMID:22775798 ;   PMID:28890491 ;   PMID:33930266 ;   Reaxys:1431263

paths to the root