Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:Aldosterone 18-glucuronide
go back to main search page
Accession:CHEBI:88734 term browser browse the term
Definition:A steroid glucosiduronic acid that has formula C27H36O11.
Synonyms:related_synonym: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(2S,14R,16R)-2-(2-hydroxyacetyl)-14-methyl-11-oxo-17-oxapentacyclo[14.2.1.0^{1,5}.0^{6,15}.0^{9,14}]nonadec-9-en-18-yl]oxy}oxane-2-carboxylic acid;   11beta,18-Epoxy-21-hydroxy-3,20-dioxopregn-4-en-18-yl-beta-D-glucopyranosiduronic acid;   11beta,18-Epoxy-21-hydroxy-3,20-dioxopregn-4-en-18-yl-beta-delta-glucopyranosiduronic acid;   Aldosterone-18-D-glucosiduronic acid;   Aldosterone-18-D-glucuronoside;   Aldosterone-18-delta-glucosiduronic acid;   Aldosterone-18-delta-glucuronoside;   Formula=C27H36O11;   InChI=1S/C27H36O11/c1-26-7-6-12(29)8-11(26)2-3-13-14-4-5-15(16(30)10-28)27(14)9-17(18(13)26)36-25(27)38-24-21(33)19(31)20(32)22(37-24)23(34)35/h8,13-15,17-22,24-25,28,31-33H,2-7,9-10H2,1H3,(H,34,35)/t13?,14?,15-,17-,18?,19+,20+,21-,22+,24+,25?,26+,27?/m1/s1;   InChIKey=OMRIQCUHVVBJKI-ACOLCOCVSA-N;   SMILES=O1[C@]2(C3C(C4C(C2)([C@H](CC4)C(=O)CO)C1O[C@@H]5O[C@@H]([C@@H](O)[C@H](O)[C@H]5O)C(O)=O)CCC=6[C@@]3(CCC(=O)C6)C)[H]
 xref: CAS:3604-86-2;   HMDB:HMDB0010345
 xref_mesh: MESH:C018447
 xref: MetaCyc:Beta-D-Glucuronides;   PMID:12850384


show annotations for term's descendants           Sort by:
 
Aldosterone 18-glucuronide term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Ugt2b7 UDP glucuronosyltransferase family 2 member B7 multiple interactions
increases chemical synthesis
ISO alclofenac inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Anti-Inflammatory Agents, Non-Steroidal inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; cicloprofen inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Diclofenac inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Diflunisal inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Fenoprofen inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Ibuprofen inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Indomethacin inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Ketoprofen inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Ketorolac inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Meclofenamic Acid inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Mefenamic Acid inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; Naproxen inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; pirprofen inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide]; tiaprofenic acid inhibits the reaction [UGT2B7 protein results in increased chemical synthesis of aldosterone 18-glucuronide] CTD PMID:19740398 NCBI chr14:22,597,103...22,619,968 JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19883
    chemical entity 19883
      atom 19881
        nonmetal atom 19760
          carbon atom 19668
            organic molecular entity 19668
              lipid 17239
                steroid 12832
                  steroid glucosiduronic acid 25
                    Aldosterone 18-glucuronide 1
Path 2
Term Annotations click to browse term
  CHEBI ontology 19883
    subatomic particle 19881
      composite particle 19881
        hadron 19881
          baryon 19881
            nucleon 19881
              atomic nucleus 19881
                atom 19881
                  main group element atom 19771
                    p-block element atom 19771
                      carbon group element atom 19679
                        carbon atom 19668
                          organic molecular entity 19668
                            heteroorganic entity 19257
                              organochalcogen compound 18964
                                organooxygen compound 18886
                                  carbohydrates and carbohydrate derivatives 12267
                                    carbohydrate 12267
                                      carbohydrate derivative 11894
                                        glycosyl compound 10944
                                          glycoside 9226
                                            glycosiduronic acid 141
                                              glucosiduronic acid 141
                                                steroid glucosiduronic acid 25
                                                  Aldosterone 18-glucuronide 1
paths to the root