Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:fast blue B
go back to main search page
Accession:CHEBI:87629 term browser browse the term
Definition:The aromatic diazonium ion formed from diazotisation of 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diamine.
Synonyms:exact_synonym: 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-bis(diazonium)
 related_synonym: C.I. 37235;   C.I.Azoic Diazo Component 48;   Formula=C14H12N4O2;   InChI=1S/C14H12N4O2/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2/h3-8H,1-2H3/q+2;   InChIKey=QMMMCTXNYMSXLI-UHFFFAOYSA-N;   SMILES=COc1cc(ccc1[N+]#N)-c1ccc([N+]#N)c(OC)c1
 xref: CAS:20282-70-6;   PMID:25978643;   PMID:26102595;   Reaxys:1499067


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19779
    role 19727
      application 19373
        dye 1287
          histological dye 150
            fast blue B 0
              fast blue salt B 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19779
    subatomic particle 19777
      composite particle 19777
        hadron 19777
          baryon 19777
            nucleon 19777
              atomic nucleus 19777
                atom 19777
                  main group element atom 19664
                    p-block element atom 19664
                      p-block molecular entity 19664
                        carbon group molecular entity 19559
                          organic molecular entity 19548
                            organic ion 8314
                              organic cation 7128
                                diazonium ion 0
                                  aromatic diazonium ion 0
                                    fast blue B 0
                                      fast blue salt B 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.