Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:fast blue B
go back to main search page
Accession:CHEBI:87629 term browser browse the term
Definition:The aromatic diazonium ion formed from diazotisation of 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diamine.
Synonyms:exact_synonym: 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-bis(diazonium)
 related_synonym: C.I. 37235;   C.I.Azoic Diazo Component 48;   Formula=C14H12N4O2;   InChI=1S/C14H12N4O2/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2/h3-8H,1-2H3/q+2;   InChIKey=QMMMCTXNYMSXLI-UHFFFAOYSA-N;   SMILES=COc1cc(ccc1[N+]#N)-c1ccc([N+]#N)c(OC)c1
 xref: CAS:20282-70-6;   PMID:25978643;   PMID:26102595;   Reaxys:1499067


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 21309
    role 21296
      application 20756
        dye 1282
          histological dye 145
            fast blue B 0
              fast blue salt B 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 21309
    subatomic particle 21305
      composite particle 21305
        hadron 21305
          baryon 21305
            nucleon 21305
              atomic nucleus 21305
                atom 21305
                  main group element atom 21181
                    p-block element atom 21181
                      p-block molecular entity 21180
                        carbon group molecular entity 20978
                          organic molecular entity 20869
                            organic ion 8470
                              organic cation 7245
                                diazonium ion 0
                                  aromatic diazonium ion 0
                                    fast blue B 0
                                      fast blue salt B 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.