Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:fast blue B
go back to main search page
Accession:CHEBI:87629 term browser browse the term
Definition:The aromatic diazonium ion formed from diazotisation of 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diamine.
Synonyms:exact_synonym: 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-bis(diazonium)
 related_synonym: C.I. 37235;   C.I.Azoic Diazo Component 48;   Formula=C14H12N4O2;   InChI=1S/C14H12N4O2/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2/h3-8H,1-2H3/q+2;   InChIKey=QMMMCTXNYMSXLI-UHFFFAOYSA-N;   SMILES=COc1cc(ccc1[N+]#N)-c1ccc([N+]#N)c(OC)c1
 xref: CAS:20282-70-6;   PMID:25978643;   PMID:26102595;   Reaxys:1499067

GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      application 0
        dye 0
          histological dye 0
            fast blue B 0
              fast blue salt B 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      p-block molecular entity 0
                        carbon group molecular entity 0
                          organic molecular entity 0
                            organic ion 0
                              organic cation 0
                                diazonium ion 0
                                  aromatic diazonium ion 0
                                    fast blue B 0
                                      fast blue salt B 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.