Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:85917 term browser browse the term
Definition:An L-cysteine thioether in which the thiol hydrogen is replaced by a (1R,2S)-2-hydroxy-1-phosphonopropyl group
Synonyms:exact_synonym: S-[(1R,2S)-2-hydroxy-1-phosphonopropyl]-L-cysteine
 related_synonym: Formula=C6H14NO6PS;   InChI=1S/C6H14NO6PS/c1-3(8)6(14(11,12)13)15-2-4(7)5(9)10/h3-4,6,8H,2,7H2,1H3,(H,9,10)(H2,11,12,13)/t3-,4-,6+/m0/s1;   InChIKey=ACZNEKUZDVGTFM-RVJQKOHUSA-N;   SMILES=C[C@H](O)[C@@H](SC[C@H](N)C(O)=O)P(O)(O)=O
 xref: PMID:11244082 "Europe PMC";   Reaxys:8137249 "Reaxys"
 cyclic_relationship: is_conjugate_acid_of CHEBI:85580

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          phosphorus atom 0
            phosphorus molecular entity 0
              phosphorus oxoacids and derivatives 0
                phosphonic acids 0
                  (1R,2S)-1-(S-L-cysteinyl)-2-hydroxypropylphosphonate 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        amino acid 0
                                          alpha-amino acid 0
                                            L-alpha-amino acid 0
                                              serine family amino acid 0
                                                L-cysteine 0
                                                  L-cysteine derivative 0
                                                    S-substituted L-cysteine 0
                                                      L-cysteine thioether 0
                                                        (1R,2S)-1-(S-L-cysteinyl)-2-hydroxypropylphosphonate 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.