Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:2-\{2-[(2,5-dimethylphenoxy)methyl]phenyl\}-2-methoxy-N-methylacetamide
go back to main search page
Accession:CHEBI:83208 term browser browse the term
Definition:A monocarboxylic acid amide obtained by formal condensation of the carboxy group of {2-[(2,5-dimethylphenoxy)methyl]phenyl}(methoxy)acetic acid with the amino group of methylamine.
Synonyms:related_synonym: Formula=C19H23NO3;   InChI=1S/C19H23NO3/c1-13-9-10-14(2)17(11-13)23-12-15-7-5-6-8-16(15)18(22-4)19(21)20-3/h5-11,18H,12H2,1-4H3,(H,20,21);   InChIKey=PDPWCKVFIFAQIQ-UHFFFAOYSA-N;   SMILES=CNC(=O)C(OC)c1ccccc1COc1cc(C)ccc1C
 xref: PPDB:2628


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                carboxamide 0
                  monocarboxylic acid amide 0
                    2-\{2-[(2,5-dimethylphenoxy)methyl]phenyl\}-2-methoxy-N-methylacetamide 0
                      (R)-mandestrobin + 0
                      (S)-mandestrobin + 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        carboacyl group 0
                                          univalent carboacyl group 0
                                            carbamoyl group 0
                                              carboxamide 0
                                                monocarboxylic acid amide 0
                                                  2-\{2-[(2,5-dimethylphenoxy)methyl]phenyl\}-2-methoxy-N-methylacetamide 0
                                                    (R)-mandestrobin + 0
                                                    (S)-mandestrobin + 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.