Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:hexadecanoate
go back to main search page
Accession:CHEBI:7896 term browser browse the term
Definition:A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3.
Synonyms:related_synonym: (16:0);   1-hexyldecanoate;   1-pentadecanecarboxylate;   CH3-[CH2]14-COO(-);   Formula=C16H31O2;   Hexadecanoic acid, ion(1-);   InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1;   InChIKey=IPCSVZSSVZVIGE-UHFFFAOYSA-M;   SMILES=CCCCCCCCCCCCCCCC([O-])=O;   n-hexadecanoate;   n-hexadecoate;   palmitate;   pentadecanecarboxylate
 alt_id: CHEBI:231736
 xref: Beilstein:3589907;   CAS:143-20-4;   Gmelin:344266;   HMDB:HMDB0000220;   MetaCyc:PALMITATE;   Reaxys:3589907
 cyclic_relationship: is_conjugate_base_of CHEBI:15756



show annotations for term's descendants           Sort by:
palmitoyl-CoA term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G ACOX1 acyl-CoA oxidase 1 increases metabolic processing
multiple interactions
ISO ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A
[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide; benz(a)anthracene promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]; Dehydroepiandrosterone promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]; Tetrachlorodibenzodioxin promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]
CTD PMID:10497882 NCBI chr17:75,941,507...75,979,166
Ensembl chr17:75,941,507...75,979,177
JBrowse link
G CES1 carboxylesterase 1 increases hydrolysis ISO CES1 protein results in increased hydrolysis of Palmitoyl Coenzyme A CTD PMID:8611161 NCBI chr16:55,802,851...55,833,096
Ensembl chr16:55,802,851...55,833,337
JBrowse link
G CPT1A carnitine palmitoyltransferase 1A multiple interactions ISO valproyl-coenzyme A inhibits the reaction [CPT1A protein results in increased metabolism of Palmitoyl Coenzyme A] CTD PMID:19854160 NCBI chr11:68,754,620...68,844,277
Ensembl chr11:68,754,620...68,844,410
JBrowse link
G DGAT1 diacylglycerol O-acyltransferase 1 multiple interactions EXP DGAT1 protein results in increased metabolism of [Palmitoyl Coenzyme A co-treated with Vitamin A] CTD PMID:16214399 NCBI chr 8:144,314,584...144,326,852
Ensembl chr 8:144,314,584...144,326,910
JBrowse link
G GSTA1 glutathione S-transferase alpha 1 multiple interactions EXP Palmitoyl Coenzyme A binds to and results in decreased activity of GSTA1 protein CTD PMID:10542059 NCBI chr 6:52,791,371...52,803,816
Ensembl chr 6:52,791,371...52,803,860
JBrowse link
G HNF4A hepatocyte nuclear factor 4 alpha decreases expression EXP Palmitoyl Coenzyme A results in decreased expression of HNF4A mRNA; Palmitoyl Coenzyme A results in decreased expression of HNF4A protein CTD PMID:17992261 NCBI chr20:44,355,699...44,434,596
Ensembl chr20:44,355,699...44,432,845
JBrowse link
G PPARA peroxisome proliferator activated receptor alpha multiple interactions EXP
ISO
Palmitoyl Coenzyme A binds to and results in increased activity of PPARA protein
Acetylglucosamine inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Atorvastatin promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Atropine inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Budesonide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Enalapril inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Fenofibrate promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; gamma-Aminobutyric Acid inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; gedunin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]; Pravastatin promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Pyrazinamide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Saccharin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; salicylamide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Tolazoline inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Tolmetin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]
CTD PMID:11139385 PMID:18812576 NCBI chr22:46,150,526...46,243,756
Ensembl chr22:46,150,521...46,243,755
JBrowse link
G PPARG peroxisome proliferator activated receptor gamma multiple interactions EXP Palmitoyl Coenzyme A binds to and results in increased activity of PPARG protein CTD PMID:11139385 NCBI chr 3:12,287,368...12,434,344
Ensembl chr 3:12,287,368...12,434,356
JBrowse link
G SHBG sex hormone binding globulin decreases expression EXP Palmitoyl Coenzyme A results in decreased expression of SHBG mRNA; Palmitoyl Coenzyme A results in decreased expression of SHBG protein CTD PMID:17992261 NCBI chr17:7,614,064...7,633,372
Ensembl chr17:7,613,946...7,633,382
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 26041
    role 25957
      biological role 25936
        biochemical role 25170
          metabolite 25100
            eukaryotic metabolite 24521
              fungal metabolite 20902
                Saccharomyces cerevisiae metabolite 19480
                  hexadecanoate 9
                    (2S)-2-hydroxyphytanate 0
                    (2S)-2-hydroxyphytanic acid 0
                    1,1',2-trioleoyl-2'-palmitoyl-cardiolipin(2-) 0
                    1-palmitoyl-2-acylglycerol 0
                    1-palmitoyl-sn-glycero-2,3-cyclic-phosphate(1-) 0
                    16-hydroxyhexadecanoate 0
                    2-hydroxyhexadecanoate + 0
                    2-oxohexadecanoate 0
                    2-oxophytanate 0
                    3,16-dihydroxyhexadecanoate 0
                    3-hydroxypalmitate 0
                    C-terminal amide O-palmitoyl-L-threonine residue 0
                    N-aryl-1,2-dipalmitoyl-sn-glycero-3-phosphoethanolamine(1-) + 0
                    N-hexadecanoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1-) 0
                    N-hexadecanoyl-sphinga-4E,14Z-dienine 0
                    N-palmitoyl-3-ketodihydrosphingosine 0
                    N-palmitoyl-L-phenylalanine(1-) 0
                    O-hexadecanoyl-L-serine residue 0
                    O-hexadecanoyl-L-threonine residue 0
                    palmitoyl-CoA + 9
                    phytanate + 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 26041
    subatomic particle 26016
      composite particle 26016
        hadron 26016
          baryon 26016
            nucleon 26016
              atomic nucleus 26016
                atom 26016
                  main group element atom 25841
                    p-block element atom 25841
                      carbon group element atom 25441
                        carbon atom 25399
                          organic molecular entity 25399
                            organic ion 10241
                              organic anion 3769
                                carboxylic acid anion 2558
                                  monocarboxylic acid anion 1661
                                    fatty acid anion 126
                                      saturated fatty acid anion 126
                                        fatty acid anion 16:0 9
                                          hexadecanoate 9
                                            (2S)-2-hydroxyphytanate 0
                                            (2S)-2-hydroxyphytanic acid 0
                                            1,1',2-trioleoyl-2'-palmitoyl-cardiolipin(2-) 0
                                            1-palmitoyl-2-acylglycerol 0
                                            1-palmitoyl-sn-glycero-2,3-cyclic-phosphate(1-) 0
                                            16-hydroxyhexadecanoate 0
                                            2-hydroxyhexadecanoate + 0
                                            2-oxohexadecanoate 0
                                            2-oxophytanate 0
                                            3,16-dihydroxyhexadecanoate 0
                                            3-hydroxypalmitate 0
                                            C-terminal amide O-palmitoyl-L-threonine residue 0
                                            N-aryl-1,2-dipalmitoyl-sn-glycero-3-phosphoethanolamine(1-) + 0
                                            N-hexadecanoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1-) 0
                                            N-hexadecanoyl-sphinga-4E,14Z-dienine 0
                                            N-palmitoyl-3-ketodihydrosphingosine 0
                                            N-palmitoyl-L-phenylalanine(1-) 0
                                            O-hexadecanoyl-L-serine residue 0
                                            O-hexadecanoyl-L-threonine residue 0
                                            palmitoyl-CoA + 9
                                            phytanate + 0
paths to the root