Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:hexadecanoate
go back to main search page
Accession:CHEBI:7896 term browser browse the term
Definition:A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3.
Synonyms:related_synonym: (16:0);   1-hexyldecanoate;   1-pentadecanecarboxylate;   CH3-[CH2]14-COO(-);   Formula=C16H31O2;   Hexadecanoic acid, ion(1-);   InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1;   InChIKey=IPCSVZSSVZVIGE-UHFFFAOYSA-M;   SMILES=CCCCCCCCCCCCCCCC([O-])=O;   n-hexadecanoate;   n-hexadecoate;   palmitate;   pentadecanecarboxylate
 alt_id: CHEBI:231736
 xref: Beilstein:3589907;   CAS:143-20-4;   Gmelin:344266;   HMDB:HMDB0000220;   MetaCyc:PALMITATE;   Reaxys:3589907
 cyclic_relationship: is_conjugate_base_of CHEBI:15756


show annotations for term's descendants           Sort by:
 
palmitoyl-CoA term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Acox1 acyl-CoA oxidase 1 increases metabolic processing
multiple interactions
ISO ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A
[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide; benz(a)anthracene promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]; Dehydroepiandrosterone promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]; Tetrachlorodibenzodioxin promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]
CTD PMID:10497882 NCBI chr10:101,406,197...101,431,242
Ensembl chr10:101,406,197...101,431,232
JBrowse link
G Ces1d carboxylesterase 1D increases hydrolysis EXP CES1 protein results in increased hydrolysis of Palmitoyl Coenzyme A CTD PMID:8611161 NCBI chr19:13,873,490...13,912,035 JBrowse link
G Cpt1a carnitine palmitoyltransferase 1A multiple interactions EXP valproyl-coenzyme A inhibits the reaction [CPT1A protein results in increased metabolism of Palmitoyl Coenzyme A] CTD PMID:19854160 NCBI chr 1:200,564,634...200,627,059
Ensembl chr 1:200,565,613...200,627,055
JBrowse link
G Dgat1 diacylglycerol O-acyltransferase 1 multiple interactions ISO DGAT1 protein results in increased metabolism of [Palmitoyl Coenzyme A co-treated with Vitamin A] CTD PMID:16214399 NCBI chr 7:108,223,860...108,235,413
Ensembl chr 7:108,218,524...108,234,299
JBrowse link
G Gsta1 glutathione S-transferase alpha 1 multiple interactions ISO Palmitoyl Coenzyme A binds to and results in decreased activity of GSTA1 protein CTD PMID:10542059 NCBI chr 9:23,703,476...23,720,121
Ensembl chr 9:23,703,477...23,720,121
JBrowse link
G Hnf4a hepatocyte nuclear factor 4, alpha decreases expression ISO Palmitoyl Coenzyme A results in decreased expression of HNF4A mRNA; Palmitoyl Coenzyme A results in decreased expression of HNF4A protein CTD PMID:17992261 NCBI chr 3:152,186,787...152,248,320
Ensembl chr 3:152,186,787...152,248,320
JBrowse link
G Ppara peroxisome proliferator activated receptor alpha multiple interactions ISO Palmitoyl Coenzyme A binds to and results in increased activity of PPARA protein
Acetylglucosamine inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Atorvastatin promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Atropine inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Budesonide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Enalapril inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Fenofibrate promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; gamma-Aminobutyric Acid inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; gedunin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]; Pravastatin promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Pyrazinamide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Saccharin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; salicylamide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Tolazoline inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Tolmetin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]
CTD PMID:11139385 PMID:18812576 NCBI chr 7:116,832,405...116,900,878
Ensembl chr 7:116,832,756...116,895,346
JBrowse link
G Pparg peroxisome proliferator-activated receptor gamma multiple interactions ISO Palmitoyl Coenzyme A binds to and results in increased activity of PPARG protein CTD PMID:11139385 NCBI chr 4:148,423,102...148,548,471
Ensembl chr 4:148,423,194...148,548,468
JBrowse link
G Shbg sex hormone binding globulin decreases expression ISO Palmitoyl Coenzyme A results in decreased expression of SHBG mRNA; Palmitoyl Coenzyme A results in decreased expression of SHBG protein CTD PMID:17992261 NCBI chr10:54,332,939...54,350,409
Ensembl chr10:54,332,941...54,351,057
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19821
    role 19769
      biological role 19769
        biochemical role 19389
          metabolite 19364
            eukaryotic metabolite 19052
              fungal metabolite 17444
                Saccharomyces cerevisiae metabolite 16509
                  hexadecanoate 9
                    (2S)-2-hydroxyphytanate 0
                    (2S)-2-hydroxyphytanic acid 0
                    1,1',2-trioleoyl-2'-palmitoyl-cardiolipin(2-) 0
                    1-palmitoyl-2-acylglycerol 0
                    1-palmitoyl-sn-glycero-2,3-cyclic-phosphate(1-) 0
                    16-hydroxyhexadecanoate 0
                    2-hydroxyhexadecanoate + 0
                    2-oxohexadecanoate 0
                    2-oxophytanate 0
                    3,16-dihydroxyhexadecanoate 0
                    3-hydroxypalmitate 0
                    C-terminal amide O-palmitoyl-L-threonine residue 0
                    N-aryl-1,2-dipalmitoyl-sn-glycero-3-phosphoethanolamine(1-) + 0
                    N-hexadecanoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1-) 0
                    N-hexadecanoyl-sphinga-4E,14Z-dienine 0
                    N-palmitoyl-L-phenylalanine(1-) 0
                    O-hexadecanoyl-L-serine residue 0
                    O-hexadecanoyl-L-threonine residue 0
                    palmitoyl-CoA + 9
                    phytanate + 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19821
    subatomic particle 19819
      composite particle 19819
        hadron 19819
          baryon 19819
            nucleon 19819
              atomic nucleus 19819
                atom 19819
                  main group element atom 19716
                    p-block element atom 19716
                      carbon group element atom 19640
                        carbon atom 19630
                          organic molecular entity 19630
                            organic ion 9147
                              organic anion 3056
                                carboxylic acid anion 2396
                                  monocarboxylic acid anion 1500
                                    fatty acid anion 103
                                      saturated fatty acid anion 102
                                        fatty acid anion 16:0 9
                                          hexadecanoate 9
                                            (2S)-2-hydroxyphytanate 0
                                            (2S)-2-hydroxyphytanic acid 0
                                            1,1',2-trioleoyl-2'-palmitoyl-cardiolipin(2-) 0
                                            1-palmitoyl-2-acylglycerol 0
                                            1-palmitoyl-sn-glycero-2,3-cyclic-phosphate(1-) 0
                                            16-hydroxyhexadecanoate 0
                                            2-hydroxyhexadecanoate + 0
                                            2-oxohexadecanoate 0
                                            2-oxophytanate 0
                                            3,16-dihydroxyhexadecanoate 0
                                            3-hydroxypalmitate 0
                                            C-terminal amide O-palmitoyl-L-threonine residue 0
                                            N-aryl-1,2-dipalmitoyl-sn-glycero-3-phosphoethanolamine(1-) + 0
                                            N-hexadecanoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1-) 0
                                            N-hexadecanoyl-sphinga-4E,14Z-dienine 0
                                            N-palmitoyl-L-phenylalanine(1-) 0
                                            O-hexadecanoyl-L-serine residue 0
                                            O-hexadecanoyl-L-threonine residue 0
                                            palmitoyl-CoA + 9
                                            phytanate + 0
paths to the root