Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:hexadecanoate
go back to main search page
Accession:CHEBI:7896 term browser browse the term
Definition:A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3.
Synonyms:related_synonym: (16:0);   1-hexyldecanoate;   1-pentadecanecarboxylate;   CH3-[CH2]14-COO(-);   Formula=C16H31O2;   Hexadecanoic acid, ion(1-);   InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1;   InChIKey=IPCSVZSSVZVIGE-UHFFFAOYSA-M;   SMILES=CCCCCCCCCCCCCCCC([O-])=O;   n-hexadecanoate;   n-hexadecoate;   palmitate;   pentadecanecarboxylate
 alt_id: CHEBI:231736
 xref: Beilstein:3589907;   CAS:143-20-4;   Gmelin:344266;   HMDB:HMDB0000220;   MetaCyc:PALMITATE;   Reaxys:3589907
 cyclic_relationship: is_conjugate_base_of CHEBI:15756


show annotations for term's descendants           Sort by:
 
palmitoyl-CoA term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Acox1 acyl-CoA oxidase 1 increases metabolic processing
multiple interactions
ISO ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A
[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide; benz(a)anthracene promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]; Dehydroepiandrosterone promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]; Tetrachlorodibenzodioxin promotes the reaction [[ACOX1 protein results in increased metabolism of Palmitoyl Coenzyme A] which results in increased chemical synthesis of Hydrogen Peroxide]
CTD PMID:10497882 NCBI chr10:104,724,534...104,748,003
Ensembl chr10:104,722,958...104,748,050
JBrowse link
G Ces1d carboxylesterase 1D increases hydrolysis EXP CES1 protein results in increased hydrolysis of Palmitoyl Coenzyme A CTD PMID:8611161 NCBI chr19:15,195,514...15,239,827
Ensembl chr19:15,033,108...15,239,821
JBrowse link
G Cpt1a carnitine palmitoyltransferase 1A multiple interactions EXP valproyl-coenzyme A inhibits the reaction [CPT1A protein results in increased metabolism of Palmitoyl Coenzyme A] CTD PMID:19854160 NCBI chr 1:218,568,157...218,629,679
Ensembl chr 1:218,569,510...218,629,678
JBrowse link
G Dgat1 diacylglycerol O-acyltransferase 1 multiple interactions ISO DGAT1 protein results in increased metabolism of [Palmitoyl Coenzyme A co-treated with Vitamin A] CTD PMID:16214399 NCBI chr 7:117,566,363...117,576,735
Ensembl chr 7:117,566,368...117,576,737
JBrowse link
G Gsta1 glutathione S-transferase alpha 1 multiple interactions ISO Palmitoyl Coenzyme A binds to and results in decreased activity of GSTA1 protein CTD PMID:10542059 NCBI chr 9:27,366,404...27,381,004
Ensembl chr 9:27,368,272...27,452,902
JBrowse link
G Hnf4a hepatocyte nuclear factor 4, alpha decreases expression ISO Palmitoyl Coenzyme A results in decreased expression of HNF4A mRNA; Palmitoyl Coenzyme A results in decreased expression of HNF4A protein CTD PMID:17992261 NCBI chr 3:159,902,441...159,965,003
Ensembl chr 3:159,902,441...159,965,003
JBrowse link
G Ppara peroxisome proliferator activated receptor alpha multiple interactions ISO Palmitoyl Coenzyme A binds to and results in increased activity of PPARA protein
Acetylglucosamine inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Atorvastatin promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Atropine inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Budesonide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Enalapril inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Fenofibrate promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; gamma-Aminobutyric Acid inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; gedunin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]; Pravastatin promotes the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Pyrazinamide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Saccharin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; salicylamide inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Tolazoline inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]; Tolmetin inhibits the reaction [Glucose inhibits the reaction [Palmitoyl Coenzyme A analog binds to PPARA protein]]
CTD PMID:11139385, PMID:18812576 NCBI chr 7:126,618,872...126,687,282
Ensembl chr 7:126,619,196...126,681,752
JBrowse link
G Pparg peroxisome proliferator-activated receptor gamma multiple interactions ISO Palmitoyl Coenzyme A binds to and results in increased activity of PPARG protein CTD PMID:11139385 NCBI chr 4:147,274,055...147,399,383
Ensembl chr 4:147,274,107...147,399,380
JBrowse link
G Shbg sex hormone binding globulin decreases expression ISO Palmitoyl Coenzyme A results in decreased expression of SHBG mRNA; Palmitoyl Coenzyme A results in decreased expression of SHBG protein CTD PMID:17992261 NCBI chr10:56,219,861...56,237,354
Ensembl chr10:56,219,858...56,223,245
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19816
    role 19764
      biological role 19764
        biochemical role 19313
          metabolite 19294
            eukaryotic metabolite 18943
              fungal metabolite 17421
                Saccharomyces cerevisiae metabolite 16485
                  hexadecanoate 9
                    (2S)-2-hydroxyphytanate 0
                    (2S)-2-hydroxyphytanic acid 0
                    1-palmitoyl-2-acylglycerol 0
                    1-palmitoyl-sn-glycero-2,3-cyclic-phosphate(1-) 0
                    16-hydroxyhexadecanoate 0
                    2-hydroxyhexadecanoate + 0
                    2-oxophytanate 0
                    3,16-dihydroxyhexadecanoate 0
                    3-hydroxypalmitate 0
                    C-terminal amide O-palmitoyl-L-threonine residue 0
                    N-aryl-1,2-dipalmitoyl-sn-glycero-3-phosphoethanolamine(1-) + 0
                    N-hexadecanoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1-) 0
                    N-hexadecanoyl-sphinga-4E,14Z-dienine 0
                    N-palmitoyl-L-phenylalanine(1-) 0
                    O-hexadecanoyl-L-threonine residue 0
                    palmitoyl-CoA + 9
                    phytanate + 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19816
    subatomic particle 19814
      composite particle 19814
        hadron 19814
          baryon 19814
            nucleon 19814
              atomic nucleus 19814
                atom 19814
                  main group element atom 19702
                    p-block element atom 19702
                      carbon group element atom 19608
                        carbon atom 19597
                          organic molecular entity 19597
                            organic ion 8327
                              organic anion 3018
                                carboxylic acid anion 2388
                                  monocarboxylic acid anion 1489
                                    fatty acid anion 100
                                      saturated fatty acid anion 99
                                        fatty acid anion 16:0 9
                                          hexadecanoate 9
                                            (2S)-2-hydroxyphytanate 0
                                            (2S)-2-hydroxyphytanic acid 0
                                            1-palmitoyl-2-acylglycerol 0
                                            1-palmitoyl-sn-glycero-2,3-cyclic-phosphate(1-) 0
                                            16-hydroxyhexadecanoate 0
                                            2-hydroxyhexadecanoate + 0
                                            2-oxophytanate 0
                                            3,16-dihydroxyhexadecanoate 0
                                            3-hydroxypalmitate 0
                                            C-terminal amide O-palmitoyl-L-threonine residue 0
                                            N-aryl-1,2-dipalmitoyl-sn-glycero-3-phosphoethanolamine(1-) + 0
                                            N-hexadecanoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1-) 0
                                            N-hexadecanoyl-sphinga-4E,14Z-dienine 0
                                            N-palmitoyl-L-phenylalanine(1-) 0
                                            O-hexadecanoyl-L-threonine residue 0
                                            palmitoyl-CoA + 9
                                            phytanate + 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.