Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:iodocyanopindolol
go back to main search page
Accession:CHEBI:73370 term browser browse the term
Definition:An indole that is 1H-indole substituted at positions 2, 3 and 7 by cyano, iodo and 3-(tert-butylamino)-2-hydroxypropoxy groups respectively.
Synonyms:exact_synonym: 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-iodo-1-indole-2-carbonitrile
 related_synonym: 4-(2-Hydroxy-3-(tert-butylamino)propoxy)-3-iodo-1H-indole-2-carbonitrile;   Formula=C16H20IN3O2;   InChI=1S/C16H20IN3O2/c1-16(2,3)19-8-10(21)9-22-13-6-4-5-11-14(13)15(17)12(7-18)20-11/h4-6,10,19-21H,8-9H2,1-3H3;   InChIKey=JBLUMBNIBNHRSO-UHFFFAOYSA-N;   SMILES=CC(C)(C)NCC(O)COc1cccc2[nH]c(C#N)c(I)c12
 xref: CAS:80180-26-3
 xref_mesh: MESH:D020120
 xref: PMID:20601048;   PMID:21734891;   PMID:23597562;   Reaxys:8716017;   Wikipedia:Iodocyanopindolol


show annotations for term's descendants           Sort by:
 
iodocyanopindolol term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Adrb1 adrenoceptor beta 1 multiple interactions
affects binding
ISO
EXP
Albuterol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; CGP 20712A inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Dobutamine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Epinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; ICI 89406 inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Isoproterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Norepinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; soterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Terbutaline inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]
Albuterol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Dobutamine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Epinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; ICI 118551 inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; ICI 89406 inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Isoproterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Norepinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; soterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Terbutaline inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]
CTD PMID:8096834 PMID:9260993 PMID:10344530 NCBI chr 1:277,537,585...277,538,985
Ensembl chr 1:277,537,585...277,538,985
JBrowse link
G Adrb2 adrenoceptor beta 2 multiple interactions
affects binding
ISO
EXP
ICI 118551 inhibits the reaction [Iodocyanopindolol binds to ADRB2 protein] CTD PMID:9260993 PMID:10344530 NCBI chr18:57,513,792...57,515,834
Ensembl chr18:57,513,793...57,515,834
JBrowse link
G Htr1b 5-hydroxytryptamine receptor 1B affects binding
multiple interactions
EXP Iodocyanopindolol binds to HTR1B protein
sarpogrelate inhibits the reaction [Iodocyanopindolol binds to HTR1B protein]; sarpogrelate metabolite inhibits the reaction [Iodocyanopindolol binds to HTR1B protein]
CTD PMID:8937629 NCBI chr 8:89,113,984...89,130,830
Ensembl chr 8:89,129,453...89,130,991
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19771
    chemical entity 19771
      group 19689
        pseudohalo group 2943
          cyano group 2943
            nitrile 2943
              iodocyanopindolol 3
Path 2
Term Annotations click to browse term
  CHEBI ontology 19771
    subatomic particle 19770
      composite particle 19770
        hadron 19770
          baryon 19770
            nucleon 19770
              atomic nucleus 19770
                atom 19770
                  main group element atom 19658
                    p-block element atom 19658
                      carbon group element atom 19574
                        carbon atom 19564
                          organic molecular entity 19564
                            organic molecule 19497
                              organic cyclic compound 19321
                                organic heterocyclic compound 18512
                                  organic heteropolycyclic compound 17977
                                    organic heterobicyclic compound 16784
                                      benzopyrrole 9547
                                        indoles 9215
                                          iodocyanopindolol 3
paths to the root