Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:iodocyanopindolol
go back to main search page
Accession:CHEBI:73370 term browser browse the term
Definition:An indole that is 1H-indole substituted at positions 2, 3 and 7 by cyano, iodo and 3-(tert-butylamino)-2-hydroxypropoxy groups respectively.
Synonyms:exact_synonym: 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-iodo-1-indole-2-carbonitrile
 related_synonym: 4-(2-Hydroxy-3-(tert-butylamino)propoxy)-3-iodo-1H-indole-2-carbonitrile;   Formula=C16H20IN3O2;   InChI=1S/C16H20IN3O2/c1-16(2,3)19-8-10(21)9-22-13-6-4-5-11-14(13)15(17)12(7-18)20-11/h4-6,10,19-21H,8-9H2,1-3H3;   InChIKey=JBLUMBNIBNHRSO-UHFFFAOYSA-N;   SMILES=CC(C)(C)NCC(O)COc1cccc2[nH]c(C#N)c(I)c12
 xref: CAS:80180-26-3
 xref_mesh: MESH:D020120
 xref: PMID:20601048;   PMID:21734891;   PMID:23597562;   Reaxys:8716017;   Wikipedia:Iodocyanopindolol



show annotations for term's descendants           Sort by:
 
iodocyanopindolol term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Adrb1 adrenoceptor beta 1 multiple interactions
affects binding
ISO
EXP
Albuterol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; CGP 20712A inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Dobutamine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Epinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; ICI 89406 inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Isoproterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Norepinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; soterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Terbutaline inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]
Albuterol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Dobutamine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Epinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; ICI 118551 inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; ICI 89406 inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Isoproterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Norepinephrine inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; soterenol inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]; Terbutaline inhibits the reaction [Iodocyanopindolol binds to ADRB1 protein]
CTD PMID:8096834 PMID:9260993 PMID:10344530 NCBI chr 1:255,772,217...255,773,617
Ensembl chr 1:255,771,597...255,807,259
JBrowse link
G Adrb2 adrenoceptor beta 2 multiple interactions
affects binding
ISO
EXP
ICI 118551 inhibits the reaction [Iodocyanopindolol binds to ADRB2 protein] CTD PMID:9260993 PMID:10344530 NCBI chr18:55,642,459...55,644,501
Ensembl chr18:55,502,903...55,644,512
JBrowse link
G Htr1b 5-hydroxytryptamine receptor 1B affects binding
multiple interactions
EXP Iodocyanopindolol binds to HTR1B protein
sarpogrelate inhibits the reaction [Iodocyanopindolol binds to HTR1B protein]; sarpogrelate metabolite inhibits the reaction [Iodocyanopindolol binds to HTR1B protein]
CTD PMID:8937629 NCBI chr 8:82,513,572...82,534,892
Ensembl chr 8:82,517,360...82,534,549
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 20056
    chemical entity 20055
      group 19986
        pseudohalo group 3902
          cyano group 3902
            nitrile 3902
              iodocyanopindolol 3
Path 2
Term Annotations click to browse term
  CHEBI ontology 20056
    subatomic particle 20054
      composite particle 20054
        hadron 20054
          baryon 20054
            nucleon 20054
              atomic nucleus 20054
                atom 20054
                  main group element atom 19956
                    p-block element atom 19956
                      carbon group element atom 19882
                        carbon atom 19875
                          organic molecular entity 19875
                            organic molecule 19822
                              organic cyclic compound 19575
                                organic heterocyclic compound 18798
                                  organic heteropolycyclic compound 18272
                                    organic heterobicyclic compound 17159
                                      benzopyrrole 9612
                                        indoles 9279
                                          iodocyanopindolol 3
paths to the root