Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:Corynoxine B
go back to main search page
Accession:CHEBI:70070 term browser browse the term
Definition:An indolizine that has formula C22H28N2O4.
Synonyms:related_synonym: Formula=C22H28N2O4;   InChI=1S/C22H28N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h5-8,13-15,19H,4,9-12H2,1-3H3,(H,23,26)/b16-13+/t14-,15+,19+,22-/m1/s1;   InChIKey=DAXYUDFNWXHGBE-XYEDMTIPSA-N;   SMILES=[H][C@@]1(C[C@]2([H])N(CC[C@]22C(=O)Nc3ccccc23)C[C@H]1CC)C(=C/OC)\\C(=O)OC;   methyl(E)-2-[(3R,6'S,7'S,8'aS)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate
 xref_mesh: MESH:C000600670
 xref: PMID:21070010



show annotations for term's descendants           Sort by:
Corynoxine B term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Bcl2 BCL2, apoptosis regulator multiple interactions ISO corynoxine B inhibits the reaction [manganese chloride promotes the reaction [BCL2 protein binds to BECN1 protein]] CTD PMID:30578841 NCBI chr13:22,689,783...22,853,920
Ensembl chr13:22,684,989...22,853,743
Ensembl chr13:22,684,989...22,853,743
JBrowse link
G Becn1 beclin 1 multiple interactions ISO corynoxine B affects the reaction [manganese chloride affects the reaction [HMGB1 protein binds to BECN1 protein]]; corynoxine B inhibits the reaction [manganese chloride promotes the reaction [BCL2 protein binds to BECN1 protein]] CTD PMID:30578841 NCBI chr10:86,231,387...86,246,742
Ensembl chr10:86,231,388...86,246,742
JBrowse link
G Eif4ebp1 eukaryotic translation initiation factor 4E binding protein 1 multiple interactions
decreases phosphorylation
ISO corynoxine B promotes the reaction [manganese chloride results in decreased phosphorylation of EIF4EBP1 protein]
corynoxine B results in decreased phosphorylation of EIF4EBP1 protein
CTD PMID:30578841 NCBI chr16:64,792,595...64,805,984
Ensembl chr16:64,790,226...64,805,984
JBrowse link
G Hmgb1 high mobility group box 1 multiple interactions ISO corynoxine B affects the reaction [manganese chloride affects the reaction [HMGB1 protein binds to BECN1 protein]]; corynoxine B inhibits the reaction [manganese chloride promotes the reaction [HMGB1 protein binds to SNCA protein]] CTD PMID:30578841 NCBI chr12:5,973,062...5,978,565
Ensembl chr12:5,901,586...5,978,565
JBrowse link
G Mtor mechanistic target of rapamycin kinase multiple interactions
decreases phosphorylation
ISO corynoxine B promotes the reaction [manganese chloride results in decreased phosphorylation of MTOR protein]
corynoxine B results in decreased phosphorylation of MTOR protein
CTD PMID:30578841 NCBI chr 5:158,884,856...158,994,311
Ensembl chr 5:158,884,804...158,994,311
JBrowse link
G Rps6kb1 ribosomal protein S6 kinase B1 multiple interactions
decreases phosphorylation
ISO corynoxine B promotes the reaction [manganese chloride results in decreased phosphorylation of RPS6KB1 protein]
corynoxine B results in decreased phosphorylation of RPS6KB1 protein
CTD PMID:30578841 NCBI chr10:71,323,777...71,367,908
Ensembl chr10:71,323,777...71,367,908
JBrowse link
G Snca synuclein alpha multiple interactions ISO corynoxine B inhibits the reaction [manganese chloride promotes the reaction [HMGB1 protein binds to SNCA protein]] CTD PMID:30578841 NCBI chr 4:89,696,420...89,797,240
Ensembl chr 4:89,696,420...89,796,262
JBrowse link
G Sqstm1 sequestosome 1 multiple interactions ISO corynoxine B affects the reaction [manganese chloride affects the expression of SQSTM1 protein] CTD PMID:30578841 NCBI chr10:34,525,517...34,536,685
Ensembl chr10:34,525,519...34,536,673
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19818
    role 19790
      biological role 19788
        biochemical role 19501
          metabolite 19486
            Corynoxine B 8
Path 2
Term Annotations click to browse term
  CHEBI ontology 19818
    subatomic particle 19816
      composite particle 19816
        hadron 19816
          baryon 19816
            nucleon 19816
              atomic nucleus 19816
                atom 19816
                  main group element atom 19761
                    p-block element atom 19761
                      p-block molecular entity 19761
                        carbon group molecular entity 19703
                          organic molecular entity 19698
                            organic molecule 19656
                              organic cyclic compound 19461
                                organic heterocyclic compound 18817
                                  organic heteropolycyclic compound 18297
                                    organic heterobicyclic compound 17247
                                      indolizines 75
                                        Corynoxine B 8
paths to the root