Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:17-hydroxyjolkinolide B
go back to main search page
Accession:CHEBI:69828 term browser browse the term
Definition:A diterpene lactone that has formula C20H26O5.
Synonyms:related_synonym: (4aR,6aS,7aR,10aR,11aR,11bR,11cR)-8-(Hydroxymethyl)-4,4,11c-trimethyl-1,2,3,4,4a,5,6,11a,11b,11c-decahydrobisoxireno[3,4:1,10a]phenanthro[3,2-b]furan-9(7aH)-one;   Formula=C20H26O5;   InChI=1S/C20H26O5/c1-17(2)6-4-7-18(3)11(17)5-8-19-13(18)15-20(24-15)12(14(19)23-19)10(9-21)16(22)25-20/h11,13-15,21H,4-9H2,1-3H3/t11-,13+,14-,15-,18-,19+,20-/m1/s1;   InChIKey=ORPHDWFMIUUKJM-MCDHERAVSA-N;   SMILES=[H][C@]12O[C@]11CC[C@]3([H])C(C)(C)CCC[C@@]3(C)[C@]1([H])[C@@]1([H])O[C@]11OC(=O)C(CO)=C21
 xref_mesh: MESH:C057916
 xref: PMID:21534540


show annotations for term's descendants           Sort by:
 
17-hydroxyjolkinolide B term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Hmox1 heme oxygenase 1 multiple interactions ISO 17-hydroxyjolkinolide B promotes the reaction [Lipopolysaccharides results in increased expression of HMOX1 mRNA]; 17-hydroxyjolkinolide B promotes the reaction [Lipopolysaccharides results in increased expression of HMOX1 protein]; SB 203580 inhibits the reaction [17-hydroxyjolkinolide B promotes the reaction [Lipopolysaccharides results in increased expression of HMOX1 protein]] CTD PMID:22080918 NCBI chr19:13,466,287...13,474,082
Ensembl chr19:13,467,244...13,474,079
JBrowse link
G Il6 interleukin 6 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of IL6 mRNA] CTD PMID:22080918 NCBI chr 4:5,214,602...5,219,178
Ensembl chr 4:5,213,394...5,219,178
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK1 protein] CTD PMID:22080918 NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK3 protein] CTD PMID:22080918 NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
JBrowse link
G Nfkbia NFKB inhibitor alpha multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased degradation of NFKBIA protein] CTD PMID:22080918 NCBI chr 6:72,858,713...72,861,941
Ensembl chr 6:72,858,712...72,861,941
JBrowse link
G Nos2 nitric oxide synthase 2 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of NOS2 mRNA]; 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of NOS2 protein] CTD PMID:22080918 NCBI chr10:63,815,308...63,851,208
Ensembl chr10:63,815,308...63,851,210
JBrowse link
G Ptgs2 prostaglandin-endoperoxide synthase 2 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of PTGS2 mRNA]; 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of PTGS2 protein] CTD PMID:22080918 NCBI chr13:62,164,080...62,169,770
Ensembl chr13:62,163,932...62,172,188
JBrowse link
G Rela RELA proto-oncogene, NF-kB subunit multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased localization of and results in increased activity of RELA protein] CTD PMID:22080918 NCBI chr 1:202,925,001...202,935,484
Ensembl chr 1:202,924,945...202,935,484
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of TNF mRNA] CTD PMID:22080918 NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19812
    role 19761
      biological role 19761
        biochemical role 19381
          metabolite 19356
            17-hydroxyjolkinolide B 9
Path 2
Term Annotations click to browse term
  CHEBI ontology 19812
    subatomic particle 19811
      composite particle 19811
        hadron 19811
          baryon 19811
            nucleon 19811
              atomic nucleus 19811
                atom 19811
                  main group element atom 19708
                    p-block element atom 19708
                      carbon group element atom 19630
                        carbon atom 19620
                          organic molecular entity 19620
                            organic group 18728
                              organic divalent group 18719
                                organodiyl group 18719
                                  carbonyl group 18667
                                    carbonyl compound 18667
                                      carboxylic ester 15889
                                        lactone 11245
                                          terpene lactone 1786
                                            diterpene lactone 230
                                              17-hydroxyjolkinolide B 9
paths to the root