Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:17-hydroxyjolkinolide B
go back to main search page
Accession:CHEBI:69828 term browser browse the term
Definition:A diterpene lactone that has formula C20H26O5.
Synonyms:related_synonym: (4aR,6aS,7aR,10aR,11aR,11bR,11cR)-8-(Hydroxymethyl)-4,4,11c-trimethyl-1,2,3,4,4a,5,6,11a,11b,11c-decahydrobisoxireno[3,4:1,10a]phenanthro[3,2-b]furan-9(7aH)-one;   Formula=C20H26O5;   InChI=1S/C20H26O5/c1-17(2)6-4-7-18(3)11(17)5-8-19-13(18)15-20(24-15)12(14(19)23-19)10(9-21)16(22)25-20/h11,13-15,21H,4-9H2,1-3H3/t11-,13+,14-,15-,18-,19+,20-/m1/s1;   InChIKey=ORPHDWFMIUUKJM-MCDHERAVSA-N;   SMILES=[H][C@]12O[C@]11CC[C@]3([H])C(C)(C)CCC[C@@]3(C)[C@]1([H])[C@@]1([H])O[C@]11OC(=O)C(CO)=C21
 xref_mesh: MESH:C057916
 xref: PMID:21534540


show annotations for term's descendants           Sort by:
 
17-hydroxyjolkinolide B term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Hmox1 heme oxygenase 1 multiple interactions ISO 17-hydroxyjolkinolide B promotes the reaction [Lipopolysaccharides results in increased expression of HMOX1 mRNA]; 17-hydroxyjolkinolide B promotes the reaction [Lipopolysaccharides results in increased expression of HMOX1 protein]; SB 203580 inhibits the reaction [17-hydroxyjolkinolide B promotes the reaction [Lipopolysaccharides results in increased expression of HMOX1 protein]] CTD PMID:22080918 NCBI chr19:14,508,634...14,515,455
Ensembl chr19:14,508,616...14,515,456
JBrowse link
G Il6 interleukin 6 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of IL6 mRNA] CTD PMID:22080918 NCBI chr 4:3,043,231...3,047,807
Ensembl chr 4:3,043,231...3,047,807
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK1 protein] CTD PMID:22080918 NCBI chr11:88,203,863...88,273,301
Ensembl chr11:88,211,599...88,273,254
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK3 protein] CTD PMID:22080918 NCBI chr 1:198,192,773...198,198,975
Ensembl chr 1:198,192,773...198,198,975
JBrowse link
G Nfkbia NFKB inhibitor alpha multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased degradation of NFKBIA protein] CTD PMID:22080918 NCBI chr 6:76,267,227...76,270,457
Ensembl chr 6:76,267,228...76,270,457
JBrowse link
G Nos2 nitric oxide synthase 2 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of NOS2 mRNA]; 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of NOS2 protein] CTD PMID:22080918 NCBI chr10:66,188,290...66,221,621
Ensembl chr10:66,189,786...66,313,190
JBrowse link
G Ptgs2 prostaglandin-endoperoxide synthase 2 multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of PTGS2 mRNA]; 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of PTGS2 protein] CTD PMID:22080918 NCBI chr13:67,351,230...67,356,920
Ensembl chr13:67,351,087...67,359,335
JBrowse link
G Rela RELA proto-oncogene, NF-kB subunit multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased localization of and results in increased activity of RELA protein] CTD PMID:22080918 NCBI chr 1:220,992,770...221,003,249
Ensembl chr 1:220,992,770...221,003,249
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO 17-hydroxyjolkinolide B inhibits the reaction [Lipopolysaccharides results in increased expression of TNF mRNA] CTD PMID:22080918 NCBI chr20:5,189,382...5,192,000
Ensembl chr20:5,189,390...5,192,000
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19785
    role 19732
      biological role 19732
        biochemical role 19281
          metabolite 19262
            17-hydroxyjolkinolide B 9
Path 2
Term Annotations click to browse term
  CHEBI ontology 19785
    subatomic particle 19782
      composite particle 19782
        hadron 19782
          baryon 19782
            nucleon 19782
              atomic nucleus 19782
                atom 19782
                  main group element atom 19670
                    p-block element atom 19670
                      carbon group element atom 19572
                        carbon atom 19561
                          organic molecular entity 19561
                            organic group 18493
                              organic divalent group 18486
                                organodiyl group 18486
                                  carbonyl group 18389
                                    carbonyl compound 18389
                                      carboxylic ester 14073
                                        lactone 5978
                                          terpene lactone 1770
                                            diterpene lactone 226
                                              17-hydroxyjolkinolide B 9
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.