Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:63179 term browser browse the term
Definition:A monocarboxylic acid amide obtained by formal condensation between N-butyl-L-alaninamide and (2Z)-2-(2-furyl)-2-(methoxyimino)acetic acid.
Synonyms:related_synonym: Formula=C14H21N3O4;   InChI=1S/C14H21N3O4/c1-4-5-8-15-13(18)10(2)16-14(19)12(17-20-3)11-7-6-9-21-11/h6-7,9-10H,4-5,8H2,1-3H3,(H,15,18)(H,16,19)/b17-12-/t10-/m0/s1;   InChIKey=LCTALFIVWVFDFO-JCROAMGPSA-N;   SMILES=CCCCNC(=O)[C@H](C)NC(=O)C(=N/OC)\\c1ccco1
 xref: PMID:21425867 "Europe PMC"

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                oxime O-ether 0
                  N-butyl-N(2)-[(2Z)-2-(2-furyl)-2-(methoxyimino)acetyl]-L-alaninamide 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          fatty acid 0
                                            saturated fatty acid 0
                                              propionic acid 0
                                                alanine 0
                                                  L-alanine 0
                                                    L-alanine derivative 0
                                                      N-butyl-N(2)-[(2Z)-2-(2-furyl)-2-(methoxyimino)acetyl]-L-alaninamide 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.