Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:BAPTA
go back to main search page
Accession:CHEBI:60888 term browser browse the term
Definition:A polyamino carboxylic acid in which bis(carboxymethyl)nitrilo groups are bonded to C-2 and C-2' of 1,1'-[ethane-1,2-diylbis(oxy)]dibenzene.
Synonyms:exact_synonym: 2,2',2'',2'''-[ethane-1,2-diylbis(oxy-2,1-phenylenenitrilo)]tetraacetic acid
 related_synonym: 1,2-Bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid;   1,2-Bis(o-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid;   Bapeta;   Formula=C22H24N2O10;   InChI=1S/C22H24N2O10/c25-19(26)11-23(12-20(27)28)15-5-1-3-7-17(15)33-9-10-34-18-8-4-2-6-16(18)24(13-21(29)30)14-22(31)32/h1-8H,9-14H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32);   InChIKey=FTEDXVNDVHYDQW-UHFFFAOYSA-N;   SMILES=OC(=O)CN(CC(O)=O)c1ccccc1OCCOc1ccccc1N(CC(O)=O)CC(O)=O
 xref: CAS:85233-19-8
 xref_mesh: MESH:C025603
 xref: Reaxys:5192406



show annotations for term's descendants           Sort by:
 
BAPTA term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Abca1 ATP binding cassette subfamily A member 1 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Capsaicin results in increased expression of ABCA1 protein] CTD PMID:21908651 NCBI chr 5:67,678,267...67,801,162
Ensembl chr 5:67,681,297...67,801,170
JBrowse link
G Agt angiotensinogen multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [AGT protein modified form results in increased abundance of Superoxides] CTD PMID:12606818 NCBI chr19:52,529,139...52,549,618
Ensembl chr19:52,529,185...52,540,977
JBrowse link
G Akt1 AKT serine/threonine kinase 1 multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in decreased phosphorylation of AKT1 protein] CTD PMID:25433145 NCBI chr 6:131,713,716...131,735,319
Ensembl chr 6:131,713,720...131,733,921
JBrowse link
G Atf6 activating transcription factor 6 increases expression
multiple interactions
ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of ATF6 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of ATF6 protein]
CTD PMID:28181380 NCBI chr13:82,927,579...83,106,381
Ensembl chr13:82,930,034...83,107,177
JBrowse link
G Atf6b activating transcription factor 6 beta multiple interactions
increases expression
ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of ATF6B protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of ATF6B protein
CTD PMID:28181380 NCBI chr20:4,090,921...4,098,920
Ensembl chr20:4,090,921...4,098,894
JBrowse link
G Bid BH3 interacting domain death agonist multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Diclofenac results in increased activity of BID protein] CTD PMID:18191430 NCBI chr 4:154,113,198...154,136,353
Ensembl chr 4:154,113,198...154,134,720
JBrowse link
G Cacna1e calcium voltage-gated channel subunit alpha1 E multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid affects the reaction [Methacholine Chloride affects the reaction [CACNA1E protein results in increased transport of Barium]] CTD PMID:12663092 NCBI chr13:66,574,659...67,063,443
Ensembl chr13:66,581,920...66,894,450
JBrowse link
G Capn1 calpain 1 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CAPN1 protein] CTD PMID:28181380 NCBI chr 1:203,275,912...203,300,848
Ensembl chr 1:203,277,344...203,300,177
JBrowse link
G Capn2 calpain 2 multiple interactions
increases expression
ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CAPN2 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of CAPN2 protein
CTD PMID:28181380 NCBI chr13:94,150,244...94,200,969
Ensembl chr13:94,150,240...94,200,969
JBrowse link
G Casp12 caspase 12 multiple interactions
increases expression
ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CASP12 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of CASP12 protein
CTD PMID:28181380 NCBI chr 8:2,642,296...2,669,549
Ensembl chr 8:2,642,434...2,674,037
JBrowse link
G Casp3 caspase 3 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased activity of CASP3 protein]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Pilocarpine results in increased activity of CASP3 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased cleavage of CASP3 protein]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [GW 7845 results in increased activity of CASP3 protein]; [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid co-treated with Egtazic Acid] inhibits the reaction [Cadmium results in increased cleavage of CASP3 protein]
CTD PMID:19927300 PMID:20810541 PMID:28181380 PMID:29111403 NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648
JBrowse link
G Casp4 caspase 4 increases expression
multiple interactions
ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of CASP4 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CASP4 protein]
CTD PMID:28181380 NCBI chr 8:2,599,017...2,635,097
Ensembl chr 8:2,598,876...2,635,092
JBrowse link
G Casp8 caspase 8 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased cleavage of CASP8 protein]; [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid co-treated with Egtazic Acid] inhibits the reaction [Cadmium results in increased cleavage of CASP8 protein] CTD PMID:29111403 NCBI chr 9:60,263,863...60,312,542
Ensembl chr 9:60,264,075...60,312,542
JBrowse link
G Creb1 cAMP responsive element binding protein 1 decreases phosphorylation ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in decreased phosphorylation of CREB1 protein CTD PMID:21443188 NCBI chr 9:65,903,511...65,972,562
Ensembl chr 9:65,903,547...65,970,816
JBrowse link
G Crebbp CREB binding protein multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [CREBBP protein binds to NFE2L2 protein]] CTD PMID:21443188 NCBI chr10:11,335,551...11,461,888
Ensembl chr10:11,335,953...11,461,888
JBrowse link
G Cycs cytochrome c, somatic multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [GW 7845 affects the localization of CYCS protein] CTD PMID:20810541 NCBI chr 4:79,651,894...79,653,994
Ensembl chr 4:79,651,378...79,654,054
JBrowse link
G Ddit3 DNA-damage inducible transcript 3 increases expression
multiple interactions
ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of DDIT3 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased expression of DDIT3 protein]; [Egtazic Acid co-treated with 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid] inhibits the reaction [Cadmium results in increased expression of DDIT3 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of DDIT3 protein]
CTD PMID:28181380 PMID:29111403 NCBI chr 7:63,115,645...63,121,203
Ensembl chr 7:63,116,380...63,121,201
JBrowse link
G Eif2ak3 eukaryotic translation initiation factor 2 alpha kinase 3 multiple interactions
increases expression
ISO [fisetin co-treated with 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid] results in decreased expression of EIF2AK3 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of EIF2AK3 protein
CTD PMID:28181380 NCBI chr 4:102,805,495...102,866,914
Ensembl chr 4:102,805,510...102,866,911
JBrowse link
G Fos Fos proto-oncogene, AP-1 transcription factor subunit multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Ionomycin results in increased expression of FOS mRNA]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [PDGFB protein results in increased expression of FOS mRNA]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Tetradecanoylphorbol Acetate results in increased expression of FOS mRNA] CTD PMID:9650640 NCBI chr 6:105,121,170...105,124,036
Ensembl chr 6:105,121,170...105,124,036
JBrowse link
G Gsk3b glycogen synthase kinase 3 beta multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in decreased phosphorylation of GSK3B protein] CTD PMID:25433145 NCBI chr11:62,498,997...62,648,665
Ensembl chr11:62,504,316...62,648,646
JBrowse link
G Hmox1 heme oxygenase 1 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [NFE2L2 protein binds to HMOX1 promoter]]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone results in increased expression of HMOX1 mRNA] CTD PMID:21443188 NCBI chr19:13,466,287...13,474,082
Ensembl chr19:13,467,244...13,474,079
JBrowse link
G Hsp90aa1 heat shock protein 90 alpha family class A member 1 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Humic Substances results in increased expression of HSP90AA1 protein] CTD PMID:23836447 NCBI chr 6:129,702,376...129,707,907
Ensembl chr 6:129,702,383...129,707,268
JBrowse link
G Hsp90ab1 heat shock protein 90 alpha family class B member 1 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Humic Substances results in increased expression of HSP90AB1 protein] CTD PMID:23836447 NCBI chr 9:15,432,986...15,438,358
Ensembl chr 9:15,433,691...15,438,488
JBrowse link
G Hspa5 heat shock protein family A (Hsp70) member 5 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of HSPA5 protein] CTD PMID:28181380 NCBI chr 3:18,055,507...18,059,969
Ensembl chr 3:18,055,405...18,059,891
JBrowse link
G Il1a interleukin 1 alpha multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [tributyltin results in increased expression of IL1A protein] CTD PMID:9221826 NCBI chr 3:116,526,601...116,537,055
Ensembl chr 3:116,526,604...116,536,822
JBrowse link
G Il4 interleukin 4 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Toluene 2,4-Diisocyanate results in increased secretion of IL4 protein] CTD PMID:20371970 NCBI chr10:37,771,203...37,776,750
Ensembl chr10:37,771,203...37,776,750
JBrowse link
G Lrp1 LDL receptor related protein 1 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Capsaicin results in decreased expression of LRP1 protein] CTD PMID:21908651 NCBI chr 7:63,380,325...63,461,029
Ensembl chr 7:63,380,356...63,460,910
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Tetrachlorodibenzodioxin results in increased expression of MAPK3 mRNA] CTD PMID:28836330 NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
JBrowse link
G Mapk8 mitogen-activated protein kinase 8 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Pilocarpine results in increased activity of MAPK8 protein] CTD PMID:19927300 NCBI chr16:8,638,897...8,721,960
Ensembl chr16:8,638,924...8,721,981
JBrowse link
G Mmp9 matrix metallopeptidase 9 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Acrolein results in increased expression of MMP9 protein] CTD PMID:19371603 NCBI chr 3:153,684,158...153,692,118
Ensembl chr 3:153,683,858...153,692,120
JBrowse link
G Nefl neurofilament light chain multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in decreased expression of NEFL mRNA] CTD PMID:31969611 NCBI chr15:42,301,920...42,305,793
Ensembl chr15:42,301,916...42,305,793
JBrowse link
G Nfe2l2 NFE2 like bZIP transcription factor 2 affects localization
multiple interactions
ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid affects the localization of NFE2L2 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [CREBBP protein binds to NFE2L2 protein]]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [NFE2L2 protein binds to HMOX1 promoter]]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone results in increased activity of NFE2L2 protein]
CTD PMID:21443188 NCBI chr 3:60,594,239...60,621,785
Ensembl chr 3:60,594,242...60,621,737
JBrowse link
G Nos3 nitric oxide synthase 3 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Humic Substances results in increased expression of and results in increased phosphorylation of NOS3 protein] CTD PMID:23836447 NCBI chr 4:10,793,834...10,814,170
Ensembl chr 4:10,793,834...10,814,166
JBrowse link
G Parp1 poly (ADP-ribose) polymerase 1 multiple interactions ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2,3,5-(triglutathion-S-yl)hydroquinone results in increased activity of PARP1 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased cleavage of PARP1 protein]; [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid co-treated with Egtazic Acid] inhibits the reaction [Cadmium results in increased cleavage of PARP1 protein]
CTD PMID:24752504 PMID:29111403 NCBI chr13:92,307,593...92,339,406
Ensembl chr13:92,307,586...92,339,404
JBrowse link
G Pdgfb platelet derived growth factor subunit B multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [PDGFB protein results in increased expression of FOS mRNA] CTD PMID:9650640 NCBI chr 7:111,539,444...111,557,984
Ensembl chr 7:111,540,345...111,557,984
JBrowse link
G Prkaca protein kinase cAMP-activated catalytic subunit alpha multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [diphenylditelluride results in decreased expression of PRKACA protein] CTD PMID:21863293 NCBI chr19:24,155,081...24,178,430
Ensembl chr19:24,155,090...24,178,430
JBrowse link
G Rps6kb1 ribosomal protein S6 kinase B1 multiple interactions
decreases phosphorylation
ISO oxophenylarsine inhibits the reaction [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in decreased phosphorylation of RPS6KB1 protein] CTD PMID:16183647 NCBI chr10:71,323,777...71,367,908
Ensembl chr10:71,323,777...71,367,908
JBrowse link
G Sct secretin multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Ursodeoxycholic Acid analog results in increased activity of SCT] CTD PMID:22194894 NCBI chr 1:196,382,941...196,383,635
Ensembl chr 1:196,382,856...196,383,658
JBrowse link
G Snca synuclein alpha multiple interactions EXP 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in increased expression of and results in increased phosphorylation of SNCA protein] CTD PMID:25433145 NCBI chr 4:89,696,420...89,797,240
Ensembl chr 4:89,696,420...89,796,262
JBrowse link
G Xiap X-linked inhibitor of apoptosis decreases degradation ISO 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in decreased degradation of XIAP protein CTD PMID:16223472 NCBI chr  X:120,890,537...120,938,413
Ensembl chr  X:120,897,907...120,934,700
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19800
    role 19751
      chemical role 19320
        ligand 5825
          chelator 5811
            BAPTA 40
              5,5'-dibromo-BAPTA 0
              5,5'-dimethyl-BAPTA 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19800
    subatomic particle 19799
      composite particle 19799
        hadron 19799
          baryon 19799
            nucleon 19799
              atomic nucleus 19799
                atom 19799
                  main group element atom 19698
                    p-block element atom 19698
                      carbon group element atom 19619
                        carbon atom 19609
                          organic molecular entity 19609
                            organic group 18718
                              organic divalent group 18702
                                organodiyl group 18702
                                  carbonyl group 18651
                                    carbonyl compound 18651
                                      carboxylic acid 18346
                                        amino acid 14872
                                          polyamino carboxylic acid 93
                                            BAPTA 40
                                              5,5'-dibromo-BAPTA 0
                                              5,5'-dimethyl-BAPTA 0
paths to the root