Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:6-formamidopenicillanic acid
go back to main search page
Accession:CHEBI:59004 term browser browse the term
Definition:A penicillanic acid having a (6R)-formamido substituent.
Synonyms:related_synonym: (2S,5R,6R)-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;   6-formamido-2,2-dimethylpenam-3alpha-carboxylic acid;   6beta-formylaminopenicillanic acid;   Formula=C9H12N2O4S;   InChI=1S/C9H12N2O4S/c1-9(2)5(8(14)15)11-6(13)4(10-3-12)7(11)16-9/h3-5,7H,1-2H3,(H,10,12)(H,14,15)/t4-,5+,7-/m1/s1;   InChIKey=MDQGTDMBVJCTBN-JCGDXUMPSA-N;   SMILES=[H]C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@]12[H]
 xref: Beilstein:1218301;   CAS:64527-04-4;   PMID:41925;   PMID:6166603;   Reaxys:1218301
 cyclic_relationship: is_conjugate_acid_of CHEBI:59005

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      biological role 0
        aetiopathogenetic role 0
          allergen 0
            6-aminopenicillanic acid 0
              6-formamidopenicillanic acid 0
                6-formamidopenicilloyl group 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        carboacyl group 0
                                          univalent carboacyl group 0
                                            carbamoyl group 0
                                              carboxamide 0
                                                lactam 0
                                                  beta-lactam 0
                                                    beta-lactam antibiotic 0
                                                      penams 0
                                                        penicillanic acids 0
                                                          penicillanic acid 0
                                                            6-aminopenicillanic acid 0
                                                              6-formamidopenicillanic acid 0
                                                                6-formamidopenicilloyl group 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.