Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:alprenolol
go back to main search page
Accession:CHEBI:51211 term browser browse the term
Definition:A secondary alcohol that is propan-2-ol substituted by a 2-allylphenoxy group at position 1 and an isopropylamino group at position 3. It is a beta-adrenergic antagonist used as a antihypertensive, anti-arrhythmia and a sympatholytic agent.
Synonyms:exact_synonym: 1-[2-(propen-2-ylphenoxy)]-3-(isopropylamino)propan-2-ol
 related_synonym: 1-(2-Allylphenoxy)-3-isopropylamino-2-propanol;   1-(o-Allylphenoxy)-3-(isopropylamino)-2-propanol;   Alfeprol;   Formula=C15H23NO2;   InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3;   InChIKey=PAZJSJFMUHDSTF-UHFFFAOYSA-N;   SMILES=CC(C)NCC(O)COc1ccccc1CC=C;   alprenololum
 xref: Beilstein:1913441;   CAS:13655-52-2;   DrugBank:DB00866;   Drug_Central:137;   HMDB:HMDB0015004;   KEGG:D07156;   LINCS:LSM-1238
 xref_mesh: MESH:D000526
 xref: PMID:19203609;   PMID:19882938;   PMID:21958537;   PMID:22841109;   Patent:NL6605692;   Patent:NL6612958;   Reaxys:1913441;   Wikipedia:Alprenolol


show annotations for term's descendants           Sort by:
 
alprenolol term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Adrb1 adrenoceptor beta 1 multiple interactions
increases phosphorylation
increases activity
ISO [Alprenolol binds to and results in decreased activity of ADRB1 protein] which results in decreased abundance of Cyclic AMP; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Alprenolol binds to and results in decreased activity of ADRB1 protein; Alprenolol inhibits the reaction [[CGP 12177 binds to ADRB1 protein] which results in increased abundance of Cyclic AMP]; Alprenolol inhibits the reaction [cyanopindolol binds to ADRB1 protein]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]; Alprenolol promotes the reaction [ADRB1 protein binds to ARRB1 protein]; Alprenolol promotes the reaction [ADRB1 protein binds to ARRB2 protein]; Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of and results in increased uptake of EGFR protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; CGP 20712A affects the reaction [Alprenolol results in increased activity of ADRB1 protein]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein promotes the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased uptake of EGFR protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]
[Alprenolol results in increased phosphorylation of ADRB1 protein] which results in increased phosphorylation of EGFR protein; Alprenolol results in increased phosphorylation of ADRB1 protein
CTD PMID:12761341 PMID:14730417 PMID:15060759 PMID:18787115 NCBI chr 1:255,772,217...255,773,617
Ensembl chr 1:255,771,597...255,807,259
JBrowse link
G Adrb2 adrenoceptor beta 2 multiple interactions ISO [Alprenolol binds to ADRB2 protein] which results in increased abundance of Cyclic AMP; [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK1 protein; [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK3 protein; [Alprenolol co-treated with ADRB2 protein] results in increased expression of GNAS protein; Alprenolol inhibits the reaction [cyanopindolol binds to ADRB2 protein]
Alprenolol inhibits the reaction [ADRB2 results in decreased susceptibility to Histamine]; Alprenolol inhibits the reaction [ADRB2 results in increased expression of GRK2 protein]
CTD PMID:10455254 PMID:12198331 PMID:14730417 PMID:17925438 NCBI chr18:55,642,459...55,644,501
Ensembl chr18:55,502,903...55,644,512
JBrowse link
G Adrb3 adrenoceptor beta 3 multiple interactions ISO [Alprenolol binds to and results in increased activity of ADRB3 protein] which results in increased abundance of Cyclic AMP; Alprenolol binds to and results in increased activity of ADRB3 protein; Alprenolol inhibits the reaction [cyanopindolol binds to ADRB3 protein] CTD PMID:14730417 NCBI chr16:64,839,820...64,844,552
Ensembl chr16:64,841,788...64,844,552
JBrowse link
G Arrb1 arrestin, beta 1 multiple interactions ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125A mRNA; [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125B-1 mRNA; [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR150 mRNA; [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR214 mRNA; Alprenolol promotes the reaction [ADRB1 protein binds to ARRB1 protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]] CTD PMID:18787115 PMID:24334028 NCBI chr 1:153,837,964...153,912,111
Ensembl chr 1:153,838,078...153,904,061
JBrowse link
G Arrb2 arrestin, beta 2 multiple interactions ISO Alprenolol promotes the reaction [ADRB1 protein binds to ARRB2 protein]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]] CTD PMID:18787115 NCBI chr10:55,146,887...55,154,854
Ensembl chr10:55,146,818...55,154,850
JBrowse link
G Egfr epidermal growth factor receptor multiple interactions
increases phosphorylation
ISO AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]; Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of and results in increased uptake of EGFR protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein promotes the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased uptake of EGFR protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]
[Alprenolol results in increased phosphorylation of ADRB1 protein] which results in increased phosphorylation of EGFR protein
CTD PMID:18787115 NCBI chr14:91,176,931...91,349,722
Ensembl chr14:91,177,067...91,344,382
JBrowse link
G Gnas GNAS complex locus multiple interactions ISO [Alprenolol co-treated with ADRB2 protein] results in increased expression of GNAS protein CTD PMID:10455254 NCBI chr 3:163,071,003...163,136,350
Ensembl chr 3:163,071,417...163,127,262
Ensembl chr 3:163,071,417...163,127,262
JBrowse link
G Grk2 G protein-coupled receptor kinase 2 multiple interactions ISO Alprenolol inhibits the reaction [ADRB2 results in increased expression of GRK2 protein] CTD PMID:12198331 NCBI chr 1:201,581,480...201,601,580
Ensembl chr 1:201,581,480...201,601,582
JBrowse link
G Hbegf heparin-binding EGF-like growth factor multiple interactions ISO HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein promotes the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]] CTD PMID:18787115 NCBI chr18:28,106,284...28,116,167
Ensembl chr18:28,105,760...28,116,441
JBrowse link
G Htr2a 5-hydroxytryptamine receptor 2A multiple interactions ISO [Alprenolol co-treated with Cocaine] affects the reaction [HTR2A protein results in increased susceptibility to 4-iodo-2,5-dimethoxyphenylisopropylamine] CTD PMID:8392199 NCBI chr15:49,950,035...50,022,188
Ensembl chr15:49,950,804...50,020,928
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions
increases phosphorylation
ISO [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK1 protein; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]
Alprenolol results in increased phosphorylation of MAPK1 protein
Erlotinib Hydrochloride inhibits the reaction [Alprenolol results in increased phosphorylation of MAPK1 protein]
CTD PMID:17925438 PMID:18787115 NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions
increases phosphorylation
ISO [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK3 protein; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]
Erlotinib Hydrochloride inhibits the reaction [Alprenolol results in increased phosphorylation of MAPK3 protein]
CTD PMID:17925438 PMID:18787115 NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
JBrowse link
G Mir125a microRNA 125a multiple interactions
increases expression
ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125A mRNA
Alprenolol results in increased expression of MIR125A mRNA
CTD PMID:24334028 NCBI chr 1:58,677,626...58,677,710
Ensembl chr 1:58,677,626...58,677,710
JBrowse link
G Mir125b1 microRNA 125b-1 multiple interactions
increases expression
ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125B-1 mRNA
Alprenolol results in increased expression of MIR125B-1 mRNA
CTD PMID:24334028 NCBI chr 8:41,952,966...41,953,052
Ensembl chr 8:41,952,966...41,953,052
JBrowse link
G Mir150 microRNA 150 multiple interactions
increases expression
ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR150 mRNA
Alprenolol results in increased expression of MIR150 mRNA
CTD PMID:24334028 NCBI chr 1:95,605,024...95,605,108
Ensembl chr 1:95,605,024...95,605,108
JBrowse link
G Nppa natriuretic peptide A increases expression ISO Alprenolol results in increased expression of NPPA mRNA CTD PMID:12721106 NCBI chr 5:158,429,042...158,430,351
Ensembl chr 5:158,429,042...158,430,351
JBrowse link
G Odc1 ornithine decarboxylase 1 multiple interactions ISO Alprenolol inhibits the reaction [Clenbuterol results in increased activity of ODC1 protein] CTD PMID:10353628 NCBI chr 6:40,329,831...40,336,444
Ensembl chr 6:40,329,964...40,336,440
JBrowse link
G Ren renin multiple interactions
decreases expression
ISO Alprenolol inhibits the reaction [Hydralazine results in increased expression of REN protein]
Alprenolol results in decreased expression of REN protein
CTD PMID:923630 NCBI chr13:44,796,260...44,807,491
Ensembl chr13:44,796,091...44,807,489
JBrowse link
G Slc22a2 solute carrier family 22 member 2 multiple interactions ISO Alprenolol inhibits the reaction [SLC22A2 protein results in increased uptake of 4-(4-dimethylaminostyryl)-1-methylpyridinium] CTD PMID:21599003 NCBI chr 1:48,121,061...48,163,268
Ensembl chr 1:48,121,061...48,163,268
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19821
    role 19769
      application 19481
        pharmaceutical 19329
          drug 19329
            cardiovascular drug 7683
              antihypertensive agent 1848
                alprenolol 19
                  alprenolol hydrochloride 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19821
    subatomic particle 19819
      composite particle 19819
        hadron 19819
          baryon 19819
            nucleon 19819
              atomic nucleus 19819
                atom 19819
                  main group element atom 19716
                    main group molecular entity 19716
                      s-block molecular entity 19502
                        hydrogen molecular entity 19498
                          hydrides 18852
                            inorganic hydride 17691
                              pnictogen hydride 17672
                                nitrogen hydride 17545
                                  azane 17279
                                    ammonia 17278
                                      organic amino compound 17278
                                        secondary amino compound 6583
                                          alprenolol 19
                                            alprenolol hydrochloride 0
paths to the root