Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:alprenolol
go back to main search page
Accession:CHEBI:51211 term browser browse the term
Definition:A secondary alcohol that is propan-2-ol substituted by a 2-allylphenoxy group at position 1 and an isopropylamino group at position 3. It is a beta-adrenergic antagonist used as a antihypertensive, anti-arrhythmia and a sympatholytic agent.
Synonyms:exact_synonym: 1-[2-(propen-2-ylphenoxy)]-3-(isopropylamino)propan-2-ol
 related_synonym: 1-(2-Allylphenoxy)-3-isopropylamino-2-propanol;   1-(o-Allylphenoxy)-3-(isopropylamino)-2-propanol;   Alfeprol;   Formula=C15H23NO2;   InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3;   InChIKey=PAZJSJFMUHDSTF-UHFFFAOYSA-N;   SMILES=CC(C)NCC(O)COc1ccccc1CC=C;   alprenololum
 xref: Beilstein:1913441;   CAS:13655-52-2;   DrugBank:DB00866;   Drug_Central:137;   HMDB:HMDB0015004;   KEGG:D07156;   LINCS:LSM-1238
 xref_mesh: MESH:D000526
 xref: PMID:19203609;   PMID:19882938;   PMID:21958537;   PMID:22841109;   Patent:NL6605692;   Patent:NL6612958;   Reaxys:1913441;   Wikipedia:Alprenolol


show annotations for term's descendants           Sort by:
 
alprenolol term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Adrb1 adrenoceptor beta 1 multiple interactions
increases phosphorylation
increases activity
ISO [Alprenolol binds to and results in decreased activity of ADRB1 protein] which results in decreased abundance of Cyclic AMP; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Alprenolol binds to and results in decreased activity of ADRB1 protein; Alprenolol inhibits the reaction [[CGP 12177 binds to ADRB1 protein] which results in increased abundance of Cyclic AMP]; Alprenolol inhibits the reaction [cyanopindolol binds to ADRB1 protein]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]; Alprenolol promotes the reaction [ADRB1 protein binds to ARRB1 protein]; Alprenolol promotes the reaction [ADRB1 protein binds to ARRB2 protein]; Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of and results in increased uptake of EGFR protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; CGP 20712A affects the reaction [Alprenolol results in increased activity of ADRB1 protein]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein promotes the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased uptake of EGFR protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]
[Alprenolol results in increased phosphorylation of ADRB1 protein] which results in increased phosphorylation of EGFR protein; Alprenolol results in increased phosphorylation of ADRB1 protein
CTD PMID:12761341, PMID:14730417, PMID:15060759, PMID:18787115 NCBI chr 1:277,537,585...277,538,985
Ensembl chr 1:277,537,585...277,538,985
JBrowse link
G Adrb2 adrenoceptor beta 2 multiple interactions ISO [Alprenolol binds to ADRB2 protein] which results in increased abundance of Cyclic AMP; [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK1 protein; [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK3 protein; [Alprenolol co-treated with ADRB2 protein] results in increased expression of GNAS protein; Alprenolol inhibits the reaction [cyanopindolol binds to ADRB2 protein]
Alprenolol inhibits the reaction [ADRB2 results in decreased susceptibility to Histamine]; Alprenolol inhibits the reaction [ADRB2 results in increased expression of GRK2 protein]
CTD PMID:10455254, PMID:12198331, PMID:14730417, PMID:17925438 NCBI chr18:57,513,792...57,515,834
Ensembl chr18:57,513,793...57,515,834
JBrowse link
G Adrb3 adrenoceptor beta 3 multiple interactions ISO [Alprenolol binds to and results in increased activity of ADRB3 protein] which results in increased abundance of Cyclic AMP; Alprenolol binds to and results in increased activity of ADRB3 protein; Alprenolol inhibits the reaction [cyanopindolol binds to ADRB3 protein] CTD PMID:14730417 NCBI chr16:69,003,541...69,006,632
Ensembl chr16:69,003,868...69,006,632
JBrowse link
G Arrb1 arrestin, beta 1 multiple interactions ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125A mRNA; [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125B-1 mRNA; [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR150 mRNA; [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR214 mRNA; Alprenolol promotes the reaction [ADRB1 protein binds to ARRB1 protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]] CTD PMID:18787115, PMID:24334028 NCBI chr 1:164,502,099...164,573,947
Ensembl chr 1:164,502,389...164,593,139
JBrowse link
G Arrb2 arrestin, beta 2 multiple interactions ISO Alprenolol promotes the reaction [ADRB1 protein binds to ARRB2 protein]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]] CTD PMID:18787115 NCBI chr10:57,040,252...57,048,045
Ensembl chr10:57,040,267...57,048,134
JBrowse link
G Egfr epidermal growth factor receptor multiple interactions
increases phosphorylation
ISO AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]; Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of and results in increased uptake of EGFR protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein promotes the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]; Propranolol inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased uptake of EGFR protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]]
[Alprenolol results in increased phosphorylation of ADRB1 protein] which results in increased phosphorylation of EGFR protein
CTD PMID:18787115 NCBI chr14:99,919,485...100,104,136
Ensembl chr14:99,919,485...100,098,796
JBrowse link
G Gnas GNAS complex locus multiple interactions ISO [Alprenolol co-treated with ADRB2 protein] results in increased expression of GNAS protein CTD PMID:10455254 NCBI chr 3:172,374,957...172,434,988
Ensembl chr 3:172,374,957...172,428,483
Ensembl chr 3:172,374,957...172,428,483
JBrowse link
G Grk2 G protein-coupled receptor kinase 2 multiple interactions ISO Alprenolol inhibits the reaction [ADRB2 results in increased expression of GRK2 protein] CTD PMID:12198331 NCBI chr 1:219,536,220...219,544,329
Ensembl chr 1:219,536,220...219,544,328
JBrowse link
G Hbegf heparin-binding EGF-like growth factor multiple interactions ISO HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein promotes the reaction [Alprenolol promotes the reaction [ADRB1 protein results in increased phosphorylation of EGFR protein]] CTD PMID:18787115 NCBI chr18:29,330,302...29,340,185
Ensembl chr18:29,329,764...29,340,403
JBrowse link
G Htr2a 5-hydroxytryptamine receptor 2A multiple interactions ISO [Alprenolol co-treated with Cocaine] affects the reaction [HTR2A protein results in increased susceptibility to 4-iodo-2,5-dimethoxyphenylisopropylamine] CTD PMID:8392199 NCBI chr15:56,666,152...56,732,469
Ensembl chr15:56,666,012...56,735,382
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions
increases phosphorylation
ISO [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK1 protein; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK1 protein]]
Alprenolol results in increased phosphorylation of MAPK1 protein
Erlotinib Hydrochloride inhibits the reaction [Alprenolol results in increased phosphorylation of MAPK1 protein]
CTD PMID:17925438, PMID:18787115 NCBI chr11:88,203,863...88,273,301
Ensembl chr11:88,211,599...88,273,254
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions
increases phosphorylation
ISO [Alprenolol binds to ADRB2 protein] which results in increased phosphorylation of MAPK3 protein; AG 1879 inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]; ARRB1 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; ARRB2 protein promotes the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; HBEGF protein inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]; RTKI cpd inhibits the reaction [Alprenolol promotes the reaction [[ADRB1 protein co-treated with EGFR protein] results in increased phosphorylation of MAPK3 protein]]
Erlotinib Hydrochloride inhibits the reaction [Alprenolol results in increased phosphorylation of MAPK3 protein]
CTD PMID:17925438, PMID:18787115 NCBI chr 1:198,192,773...198,198,975
Ensembl chr 1:198,192,773...198,198,975
JBrowse link
G Mir125a microRNA 125a multiple interactions
increases expression
ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125A mRNA
Alprenolol results in increased expression of MIR125A mRNA
CTD PMID:24334028 NCBI chr 1:59,704,827...59,704,911
Ensembl chr 1:59,704,827...59,704,911
JBrowse link
G Mir125b1 microRNA 125b-1 multiple interactions
increases expression
ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR125B-1 mRNA
Alprenolol results in increased expression of MIR125B-1 mRNA
CTD PMID:24334028 NCBI chr 8:45,798,260...45,798,346
Ensembl chr 8:45,798,260...45,798,346
JBrowse link
G Mir150 microRNA 150 multiple interactions
increases expression
ISO [Alprenolol co-treated with ARRB1 protein] results in increased expression of MIR150 mRNA
Alprenolol results in increased expression of MIR150 mRNA
CTD PMID:24334028 NCBI chr 1:101,115,974...101,116,058
Ensembl chr 1:101,115,974...101,116,058
JBrowse link
G Nppa natriuretic peptide A increases expression ISO Alprenolol results in increased expression of NPPA mRNA CTD PMID:12721106 NCBI chr 5:164,808,407...164,809,716
Ensembl chr 5:164,808,323...164,809,705
JBrowse link
G Odc1 ornithine decarboxylase 1 multiple interactions ISO Alprenolol inhibits the reaction [Clenbuterol results in increased activity of ODC1 protein] CTD PMID:10353628 NCBI chr 6:42,852,529...42,859,142
Ensembl chr 6:42,852,683...42,859,927
JBrowse link
G Ren renin multiple interactions
decreases expression
ISO Alprenolol inhibits the reaction [Hydralazine results in increased expression of REN protein]
Alprenolol results in decreased expression of REN protein
CTD PMID:923630 NCBI chr13:50,502,724...50,513,953
Ensembl chr13:50,502,724...50,514,151
JBrowse link
G Slc22a2 solute carrier family 22 member 2 multiple interactions ISO Alprenolol inhibits the reaction [SLC22A2 protein results in increased uptake of 4-(4-dimethylaminostyryl)-1-methylpyridinium] CTD PMID:21599003 NCBI chr 1:48,318,025...48,360,219
Ensembl chr 1:48,317,995...48,360,261
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19785
    role 19732
      application 19391
        pharmaceutical 19272
          drug 19272
            cardiovascular drug 7613
              antihypertensive agent 1676
                alprenolol 19
                  alprenolol hydrochloride 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19785
    subatomic particle 19782
      composite particle 19782
        hadron 19782
          baryon 19782
            nucleon 19782
              atomic nucleus 19782
                atom 19782
                  main group element atom 19670
                    main group molecular entity 19670
                      s-block molecular entity 19428
                        hydrogen molecular entity 19418
                          hydrides 18685
                            inorganic hydride 17409
                              pnictogen hydride 17381
                                nitrogen hydride 17223
                                  azane 16940
                                    ammonia 16939
                                      organic amino compound 16938
                                        secondary amino compound 6515
                                          alprenolol 19
                                            alprenolol hydrochloride 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.