Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:epibatidine
go back to main search page
Accession:CHEBI:4803 term browser browse the term
Definition:An alkaloid that has formula C11H13ClN2.
Synonyms:related_synonym: (1R,2R,4S)-2-(6-chloropyridin-3-yl)-7-azabicyclo[2.2.1]heptane;   CMI-488;   Formula=C11H13ClN2;   InChI=1S/C11H13ClN2/c12-11-4-1-7(6-13-11)9-5-8-2-3-10(9)14-8/h1,4,6,8-10,14H,2-3,5H2/t8?,9-,10+/m1/s1;   InChIKey=NLPRAJRHRHZCQQ-XVBQNVSMSA-N;   SMILES=C12C[C@@]([C@@H](N1)CC2)(C=3C=NC(=CC3)Cl)[H]
 alt_id: CHEBI:47399
 xref: CAS:140111-52-0;   DrugBank:DB07720;   KEGG:C11690;   KNApSAcK:C00028244
 xref_mesh: MESH:C082748
 xref: PDBeChem:EPJ;   PMID:16193063;   PMID:20337496;   PMID:21909087;   PMID:8112391;   Wikipedia:Epibatidine


show annotations for term's descendants           Sort by:
 
epibatidine term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Chrna1 cholinergic receptor nicotinic alpha 1 subunit multiple interactions EXP epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]; LYNX1 protein promotes the reaction [epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]]; LYPD1 protein promotes the reaction [epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]] CTD PMID:19619141 NCBI chr 3:60,445,657...60,460,724
Ensembl chr 3:60,445,666...60,460,724
JBrowse link
G Chrna2 cholinergic receptor nicotinic alpha 2 subunit multiple interactions
affects binding
EXP
ISO
epibatidine binds to and results in increased activity of [CHRNA2 protein binds to CHRNB2 protein]; sazetidine-A analog inhibits the reaction [epibatidine binds to and results in increased activity of [CHRNA2 protein binds to CHRNB2 protein]]
[CHRNB4 protein binds to CHRNA2 protein] which binds to epibatidine
CTD PMID:9454827 PMID:21905669 NCBI chr15:42,808,897...42,825,179
Ensembl chr15:42,808,897...42,825,179
JBrowse link
G Chrna3 cholinergic receptor nicotinic alpha 3 subunit affects binding
multiple interactions
ISO
EXP
[CHRNB4 protein binds to CHRNA3 protein] which binds to epibatidine
epibatidine analog binds to and results in increased activity of [CHRNA3 protein binds to CHRNB4 protein]
[CHRNA3 protein binds to CHRNB4 protein] which binds to epibatidine; epibatidine binds to [CHRNA3 protein binds to CHRNB4 protein]
Tretinoin promotes the reaction [epibatidine binds to CHRNA3 protein]
2-(1'-methyl-2'-pyrrolidinyl)-7-hydroxy-1,4-benzodioxane inhibits the reaction [epibatidine binds to [CHRNA3 protein binds to CHRNB4 protein]]; epibatidine binds to and results in increased activity of [CHRNA3 protein binds to CHRNB4 protein]
CTD PMID:9454827 PMID:9687574 PMID:15615518 PMID:17203487 PMID:21942635 PMID:22060139 NCBI chr 8:59,594,007...59,607,122
Ensembl chr 8:59,592,403...59,607,275
JBrowse link
G Chrna4 cholinergic receptor nicotinic alpha 4 subunit multiple interactions
affects binding
ISO
EXP
Acetylcholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Acetylthiocholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Alcuronium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Carbachol inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Choline inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; cytisine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; decamethonium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Dihydro-beta-Erythroidine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Dimethylphenylpiperazinium Iodide inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; epibatidine binds to and results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]; epibatidine results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]; Hexamethonium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Lobeline inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; methyllycaconitine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Nicotine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Pancuronium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Physostigmine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; subecholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Succinylcholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Tubocurarine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Vecuronium Bromide inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]
epibatidine binds to CHRNA4 protein
2-(1'-methyl-2'-pyrrolidinyl)-7-hydroxy-1,4-benzodioxane inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; epibatidine binds to [CHRNA4 protein co-treated with CHRNB2 protein]; epibatidine binds to and results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]; sazetidine-A analog inhibits the reaction [epibatidine binds to and results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]]
Tretinoin promotes the reaction [epibatidine binds to CHRNA4 protein]
[CHRNB4 protein binds to CHRNA4 protein] which binds to epibatidine; epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]
CTD PMID:9454827 PMID:10728888 PMID:11124396 PMID:14645658 PMID:15615518 PMID:17203487 PMID:21905669 PMID:21942635 PMID:22060139 NCBI chr 3:176,533,182...176,547,965
Ensembl chr 3:176,527,516...176,548,208
JBrowse link
G Chrna7 cholinergic receptor nicotinic alpha 7 subunit multiple interactions
affects activity
affects binding
ISO
EXP
1-(5-chloro-2,4-dimethoxyphenyl)-3-(5-methylisoxazol-3-yl)urea promotes the reaction [epibatidine affects the activity of CHRNA7 protein]; Bungarotoxins inhibits the reaction [epibatidine binds to CHRNA7 protein]; Carbachol inhibits the reaction [epibatidine binds to CHRNA7 protein]; methyllycaconitine inhibits the reaction [epibatidine binds to CHRNA7 protein]; PNU-282987 inhibits the reaction [epibatidine binds to CHRNA7 protein]; SAD-128 analog inhibits the reaction [epibatidine binds to CHRNA7 protein]
epibatidine inhibits the reaction [iodo-alpha-bungarotoxin binds to CHRNA7 protein]
CTD PMID:19448648 PMID:21703337 PMID:29248576 NCBI chr 1:123,897,341...124,039,263
Ensembl chr 1:123,899,657...124,039,196
JBrowse link
G Chrnb2 cholinergic receptor nicotinic beta 2 subunit multiple interactions
affects binding
ISO
EXP
Acetylcholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Acetylthiocholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Alcuronium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Carbachol inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Choline inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; cytisine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; decamethonium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Dihydro-beta-Erythroidine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Dimethylphenylpiperazinium Iodide inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; epibatidine binds to and results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]; epibatidine results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]; Hexamethonium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Lobeline inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; methyllycaconitine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Nicotine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Pancuronium inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Physostigmine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; subecholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Succinylcholine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Tubocurarine inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; Vecuronium Bromide inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]
2-(1'-methyl-2'-pyrrolidinyl)-7-hydroxy-1,4-benzodioxane inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]]; epibatidine binds to [CHRNA4 protein co-treated with CHRNB2 protein]; epibatidine binds to [NACHRA2 protein co-treated with CHRNB2 protein]; epibatidine binds to [NACHRALPHA1 protein co-treated with CHRNB2 protein]; epibatidine binds to [NACHRALPHA2 protein co-treated with CHRNB2 protein]; epibatidine binds to [NACHRALPHA3 protein co-treated with CHRNB2 protein]; epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]; epibatidine binds to and results in increased activity of [CHRNA2 protein binds to CHRNB2 protein]; epibatidine binds to and results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]; epibatidine results in increased activity of [NACHRA1 protein co-treated with CHRNB2 protein]; LYNX1 protein promotes the reaction [epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]]; LYPD1 protein promotes the reaction [epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]]; sazetidine-A analog inhibits the reaction [epibatidine binds to and results in increased activity of [CHRNA2 protein binds to CHRNB2 protein]]; sazetidine-A analog inhibits the reaction [epibatidine binds to and results in increased activity of [CHRNA4 protein binds to CHRNB2 protein]]
CTD PMID:10728888 PMID:11124396 PMID:14645658 PMID:15615518 PMID:16291090 PMID:16981889 PMID:19619141 PMID:21905669 PMID:21942635 PMID:22060139 NCBI chr 2:189,088,570...189,096,785
Ensembl chr 2:189,088,570...189,096,785
JBrowse link
G Chrnb4 cholinergic receptor nicotinic beta 4 subunit affects binding
multiple interactions
ISO
EXP
[CHRNB4 protein binds to CHRNA2 protein] which binds to epibatidine; [CHRNB4 protein binds to CHRNA3 protein] which binds to epibatidine; [CHRNB4 protein binds to CHRNA4 protein] which binds to epibatidine
epibatidine analog binds to and results in increased activity of [CHRNA3 protein binds to CHRNB4 protein]; epibatidine binds to [NACHRALPHA1 protein co-treated with CHRNB4 protein]; epibatidine binds to [NACHRALPHA2 protein co-treated with CHRNB4 protein]; epibatidine binds to [NACHRALPHA3 protein co-treated with CHRNB4 protein]
[CHRNA3 protein binds to CHRNB4 protein] which binds to epibatidine; epibatidine binds to [CHRNA3 protein binds to CHRNB4 protein]
2-(1'-methyl-2'-pyrrolidinyl)-7-hydroxy-1,4-benzodioxane inhibits the reaction [epibatidine binds to [CHRNA3 protein binds to CHRNB4 protein]]; epibatidine binds to and results in increased activity of [CHRNA3 protein binds to CHRNB4 protein]
CTD PMID:9454827 PMID:9687574 PMID:10728888 PMID:15615518 PMID:21942635 PMID:22060139 NCBI chr 8:59,610,489...59,629,073
Ensembl chr 8:59,609,693...59,629,133
JBrowse link
G Chrnd cholinergic receptor nicotinic delta subunit multiple interactions EXP epibatidine binds to [NACHRALPHA3 protein co-treated with CHRND protein] CTD PMID:10728888 NCBI chr 9:94,286,550...94,294,968
Ensembl chr 9:94,286,550...94,294,968
JBrowse link
G Chrng cholinergic receptor nicotinic gamma subunit multiple interactions EXP epibatidine binds to [NACHRALPHA3 protein co-treated with CHRNG protein] CTD PMID:10728888 NCBI chr 9:94,302,218...94,308,591 JBrowse link
G Lynx1 Ly6/neurotoxin 1 multiple interactions EXP LYNX1 protein promotes the reaction [epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]] CTD PMID:19619141 NCBI chr 7:115,982,877...115,988,121
Ensembl chr 7:115,982,876...115,988,090
JBrowse link
G Lypd1 Ly6/Plaur domain containing 1 multiple interactions EXP LYPD1 protein promotes the reaction [epibatidine binds to and results in increased activity of [CHRNA1 protein binds to CHRNB2 protein]] CTD PMID:19619141 NCBI chr13:42,219,884...42,263,024
Ensembl chr13:42,219,887...42,263,024
JBrowse link
G Th tyrosine hydroxylase multiple interactions
increases expression
EXP 1,2-bis(2-aminophenoxy)ethane N,N,N',N'-tetraacetic acid acetoxymethyl ester inhibits the reaction [epibatidine results in increased expression of TH mRNA]; 2',5'-dideoxyadenosine inhibits the reaction [epibatidine results in increased expression of TH mRNA] CTD PMID:15588622 NCBI chr 1:216,073,034...216,080,287
Ensembl chr 1:216,073,031...216,080,287
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19853
    role 19804
      biological role 19804
        biochemical role 19339
          metabolite 19319
            alkaloid 5366
              epibatidine 12
Path 2
Term Annotations click to browse term
  CHEBI ontology 19853
    subatomic particle 19851
      composite particle 19851
        hadron 19851
          baryon 19851
            nucleon 19851
              atomic nucleus 19851
                atom 19851
                  main group element atom 19744
                    main group molecular entity 19744
                      p-block molecular entity 19744
                        carbon group molecular entity 19650
                          organic molecular entity 19639
                            heteroorganic entity 19229
                              organonitrogen compound 18395
                                alkaloid 5366
                                  epibatidine 12
paths to the root