Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:trichostatic acid
go back to main search page
Accession:CHEBI:39157 term browser browse the term
Definition:A 7-oxo monocarboxylic acid that has formula C17H21NO3.
Synonyms:exact_synonym: (2E,4E)-7-[4-(dimethylamino)phenyl]-4,6-dimethyl-7-oxohepta-2,4-dienoic acid
 related_synonym: (+-)-7-(4-(dimethylamino)phenyl)-4,6-dimethyl-7-oxo-2,4-heptadienoic acid;   Formula=C17H21NO3;   InChI=1S/C17H21NO3/c1-12(5-10-16(19)20)11-13(2)17(21)14-6-8-15(9-7-14)18(3)4/h5-11,13H,1-4H3,(H,19,20)/b10-5+,12-11+;   InChIKey=VKEITMNFEJHFCX-WKWSCTOISA-N;   SMILES=CC(C(=O)c1ccc(cc1)N(C)C)\\C=C(C)\\C=C\\C(O)=O
 xref: Beilstein:2386556 "Beilstein";   CAS:114127-17-2 "ChemIDplus"

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      chemical role 0
        donor 0
          Bronsted acid 0
            oxoacid 0
              carbon oxoacid 0
                carboxylic acid 0
                  monocarboxylic acid 0
                    alpha,beta-unsaturated monocarboxylic acid 0
                      trichostatic acid 0
                        (R)-trichostatic acid + 0
                        (S)-trichostatic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          oxo monocarboxylic acid 0
                                            7-oxo monocarboxylic acid 0
                                              trichostatic acid 0
                                                (R)-trichostatic acid + 0
                                                (S)-trichostatic acid 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.