Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:oxotremorine M
go back to main search page
Accession:CHEBI:38322 term browser browse the term
Definition:A quaternary ammonium ion that has formula C11H19N2O.
Synonyms:exact_synonym: N,N,N-trimethyl-4-(2-oxopyrrolidin-1-yl)but-2-yn-1-aminium
 related_synonym: Formula=C11H19N2O;   InChI=1S/C11H19N2O/c1-13(2,3)10-5-4-8-12-9-6-7-11(12)14/h6-10H2,1-3H3/q+1;   InChIKey=CANZROMYQDHYHR-UHFFFAOYSA-N;   SMILES=C[N+](C)(C)CC#CCN1CCCC1=O
 xref: Beilstein:1532398;   CAS:63939-65-1
 xref_mesh: MESH:C042743


show annotations for term's descendants           Sort by:
 
oxotremorine M term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Bcar1 breast cancer anti-estrogen resistance 1 multiple interactions
increases phosphorylation
ISO [oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of BCAR1 protein]; Atropine inhibits the reaction [[oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of BCAR1 protein]]; wortmannin inhibits the reaction [oxotremorine M results in increased phosphorylation of BCAR1 protein] CTD PMID:10537051 NCBI chr 8:111,710,474...111,743,849
Ensembl chr 8:111,710,474...111,743,809
JBrowse link
G Chrm1 cholinergic receptor, muscarinic 1, CNS multiple interactions
affects binding
ISO brucine promotes the reaction [oxotremorine M binds to CHRM1 protein]
CHRM1 protein binds to oxotremorine M
CTD PMID:9224827 NCBI chr19:8,664,005...8,683,606
Ensembl chr19:8,663,789...8,683,587
JBrowse link
G Chrm2 cholinergic receptor, muscarinic 2, cardiac affects binding
multiple interactions
ISO CHRM2 protein binds to oxotremorine M
eburnamonine promotes the reaction [oxotremorine M binds to CHRM2 protein]
CTD PMID:9224827 NCBI chr 6:36,387,991...36,528,638
Ensembl chr 6:36,388,084...36,528,414
JBrowse link
G Chrm3 cholinergic receptor, muscarinic 3, cardiac multiple interactions
affects binding
ISO brucine promotes the reaction [oxotremorine M binds to CHRM3 protein]
CHRM3 protein binds to oxotremorine M
CTD PMID:9224827 NCBI chr13:9,875,486...10,361,062
Ensembl chr13:9,875,486...10,360,847
JBrowse link
G Chrm4 cholinergic receptor, muscarinic 4 affects binding
multiple interactions
ISO CHRM4 protein binds to oxotremorine M
brucine promotes the reaction [oxotremorine M binds to CHRM4 protein]
CTD PMID:9224827 NCBI chr 2:91,922,189...91,929,835
Ensembl chr 2:91,927,249...91,928,688
JBrowse link
G Fos FBJ osteosarcoma oncogene multiple interactions
increases expression
ISO 4-diphenylacetoxy-1,1-dimethylpiperidinium inhibits the reaction [oxotremorine M results in increased expression of FOS mRNA] CTD PMID:11128034 NCBI chr12:85,473,890...85,477,274
Ensembl chr12:85,473,890...85,477,273
JBrowse link
G Ptk2 PTK2 protein tyrosine kinase 2 multiple interactions
increases phosphorylation
ISO [oxophenylarsine co-treated with oxotremorine M] results in increased phosphorylation of PTK2 protein; [Tetradecanoylphorbol Acetate co-treated with oxotremorine M] results in increased phosphorylation of PTK2 protein; [wortmannin co-treated with Tetradecanoylphorbol Acetate] inhibits the reaction [oxotremorine M results in increased phosphorylation of PTK2 protein]; Atropine inhibits the reaction [oxotremorine M inhibits the reaction [[wortmannin co-treated with lysophosphatidic acid] results in increased phosphorylation of PTK2 protein]]; Atropine inhibits the reaction [oxotremorine M inhibits the reaction [[wortmannin co-treated with oxophenylarsine] results in increased phosphorylation of PTK2 protein]]; Atropine inhibits the reaction [oxotremorine M promotes the reaction [[Tetradecanoylphorbol Acetate co-treated with wortmannin] results in increased phosphorylation of PTK2 protein]]; oxotremorine M inhibits the reaction [[wortmannin co-treated with lysophosphatidic acid] results in increased phosphorylation of PTK2 protein]; oxotremorine M inhibits the reaction [[wortmannin co-treated with oxophenylarsine] results in increased phosphorylation of PTK2 protein]; oxotremorine M promotes the reaction [[Tetradecanoylphorbol Acetate co-treated with wortmannin] results in increased phosphorylation of PTK2 protein] CTD PMID:10537051 NCBI chr15:73,205,102...73,423,820
Ensembl chr15:73,205,102...73,423,280
JBrowse link
G Pxn paxillin multiple interactions
increases phosphorylation
ISO [oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of PXN protein]; Atropine inhibits the reaction [[oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of PXN protein]]; wortmannin inhibits the reaction [oxotremorine M results in increased phosphorylation of PXN protein] CTD PMID:10537051 NCBI chr 5:115,491,970...115,555,987
Ensembl chr 5:115,506,676...115,555,987
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 21720
    chemical entity 21718
      molecular entity 21705
        ion 16630
          organic ion 8621
            organic cation 7440
              quaternary ammonium ion 5241
                oxotremorine M 8
Path 2
Term Annotations click to browse term
  CHEBI ontology 21720
    subatomic particle 21706
      composite particle 21706
        hadron 21706
          baryon 21706
            nucleon 21706
              atomic nucleus 21706
                atom 21706
                  main group element atom 21621
                    main group molecular entity 21621
                      s-block molecular entity 21158
                        hydrogen molecular entity 21094
                          hydrides 20358
                            inorganic hydride 18054
                              pnictogen hydride 18016
                                nitrogen hydride 17835
                                  ammonium 8093
                                    ammonium ion derivative 8089
                                      quaternary ammonium ion 5241
                                        oxotremorine M 8
paths to the root