Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:oxotremorine M
go back to main search page
Accession:CHEBI:38322 term browser browse the term
Definition:A quaternary ammonium ion that has formula C11H19N2O.
Synonyms:exact_synonym: N,N,N-trimethyl-4-(2-oxopyrrolidin-1-yl)but-2-yn-1-aminium
 related_synonym: Formula=C11H19N2O;   InChI=1S/C11H19N2O/c1-13(2,3)10-5-4-8-12-9-6-7-11(12)14/h6-10H2,1-3H3/q+1;   InChIKey=CANZROMYQDHYHR-UHFFFAOYSA-N;   SMILES=C[N+](C)(C)CC#CCN1CCCC1=O
 xref: Beilstein:1532398;   CAS:63939-65-1
 xref_mesh: MESH:C042743


show annotations for term's descendants           Sort by:
 
oxotremorine M term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G BCAR1 BCAR1 scaffold protein, Cas family member multiple interactions
increases phosphorylation
EXP [oxotremorine M co-treated with Wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of BCAR1 protein]; Atropine inhibits the reaction [[oxotremorine M co-treated with Wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of BCAR1 protein]]; Wortmannin inhibits the reaction [oxotremorine M results in increased phosphorylation of BCAR1 protein] CTD PMID:10537051 NCBI chr16:75,228,181...75,268,007
Ensembl chr16:75,228,181...75,268,053
JBrowse link
G CHRM1 cholinergic receptor muscarinic 1 multiple interactions
affects binding
EXP brucine promotes the reaction [oxotremorine M binds to CHRM1 protein]
CHRM1 protein binds to oxotremorine M
CTD PMID:9224827 NCBI chr11:62,908,675...62,921,861
Ensembl chr11:62,908,679...62,921,807
JBrowse link
G CHRM2 cholinergic receptor muscarinic 2 affects binding
multiple interactions
EXP CHRM2 protein binds to oxotremorine M
eburnamonine promotes the reaction [oxotremorine M binds to CHRM2 protein]
CTD PMID:9224827 NCBI chr 7:136,868,652...137,020,213
Ensembl chr 7:136,868,652...137,020,255
JBrowse link
G CHRM3 cholinergic receptor muscarinic 3 multiple interactions
affects binding
EXP brucine promotes the reaction [oxotremorine M binds to CHRM3 protein]
CHRM3 protein binds to oxotremorine M
CTD PMID:9224827 NCBI chr 1:239,386,565...239,915,450
Ensembl chr 1:239,386,565...239,915,452
JBrowse link
G CHRM4 cholinergic receptor muscarinic 4 affects binding
multiple interactions
EXP CHRM4 protein binds to oxotremorine M
brucine promotes the reaction [oxotremorine M binds to CHRM4 protein]
CTD PMID:9224827 NCBI chr11:46,383,789...46,391,776
Ensembl chr11:46,383,789...46,391,776
JBrowse link
G FOS Fos proto-oncogene, AP-1 transcription factor subunit multiple interactions
increases expression
EXP 4-diphenylacetoxy-1,1-dimethylpiperidinium inhibits the reaction [oxotremorine M results in increased expression of FOS mRNA] CTD PMID:11128034 NCBI chr14:75,278,828...75,282,230
Ensembl chr14:75,278,826...75,282,230
JBrowse link
G PTK2 protein tyrosine kinase 2 multiple interactions
increases phosphorylation
EXP [oxophenylarsine co-treated with oxotremorine M] results in increased phosphorylation of PTK2 protein; [Tetradecanoylphorbol Acetate co-treated with oxotremorine M] results in increased phosphorylation of PTK2 protein; [wortmannin co-treated with Tetradecanoylphorbol Acetate] inhibits the reaction [oxotremorine M results in increased phosphorylation of PTK2 protein]; Atropine inhibits the reaction [oxotremorine M inhibits the reaction [[wortmannin co-treated with lysophosphatidic acid] results in increased phosphorylation of PTK2 protein]]; Atropine inhibits the reaction [oxotremorine M inhibits the reaction [[wortmannin co-treated with oxophenylarsine] results in increased phosphorylation of PTK2 protein]]; Atropine inhibits the reaction [oxotremorine M promotes the reaction [[Tetradecanoylphorbol Acetate co-treated with wortmannin] results in increased phosphorylation of PTK2 protein]]; oxotremorine M inhibits the reaction [[wortmannin co-treated with lysophosphatidic acid] results in increased phosphorylation of PTK2 protein]; oxotremorine M inhibits the reaction [[wortmannin co-treated with oxophenylarsine] results in increased phosphorylation of PTK2 protein]; oxotremorine M promotes the reaction [[Tetradecanoylphorbol Acetate co-treated with wortmannin] results in increased phosphorylation of PTK2 protein] CTD PMID:10537051 NCBI chr 8:140,657,900...141,002,079
Ensembl chr 8:140,657,900...141,002,216
JBrowse link
G PXN paxillin multiple interactions
increases phosphorylation
EXP [oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of PXN protein]; Atropine inhibits the reaction [[oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of PXN protein]]; wortmannin inhibits the reaction [oxotremorine M results in increased phosphorylation of PXN protein] CTD PMID:10537051 NCBI chr12:120,210,447...120,265,737
Ensembl chr12:120,210,439...120,265,771
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 24779
    chemical entity 24749
      molecular entity 24714
        ion 17256
          organic ion 8790
            organic cation 7525
              quaternary ammonium ion 5194
                oxotremorine M 8
Path 2
Term Annotations click to browse term
  CHEBI ontology 24779
    subatomic particle 24738
      composite particle 24738
        hadron 24738
          baryon 24738
            nucleon 24738
              atomic nucleus 24738
                atom 24738
                  main group element atom 24603
                    main group molecular entity 24603
                      s-block molecular entity 23910
                        hydrogen molecular entity 23749
                          hydrides 21960
                            inorganic hydride 19160
                              pnictogen hydride 19133
                                nitrogen hydride 18810
                                  ammonium 8048
                                    ammonium ion derivative 8044
                                      quaternary ammonium ion 5194
                                        oxotremorine M 8
paths to the root