Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:oxotremorine M
go back to main search page
Accession:CHEBI:38322 term browser browse the term
Definition:A quaternary ammonium ion that has formula C11H19N2O.
Synonyms:exact_synonym: N,N,N-trimethyl-4-(2-oxopyrrolidin-1-yl)but-2-yn-1-aminium
 related_synonym: Formula=C11H19N2O;   InChI=1S/C11H19N2O/c1-13(2,3)10-5-4-8-12-9-6-7-11(12)14/h6-10H2,1-3H3/q+1;   InChIKey=CANZROMYQDHYHR-UHFFFAOYSA-N;   SMILES=C[N+](C)(C)CC#CCN1CCCC1=O
 xref: Beilstein:1532398;   CAS:63939-65-1
 xref_mesh: MESH:C042743


show annotations for term's descendants           Sort by:
 
oxotremorine M term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Bcar1 BCAR1 scaffold protein, Cas family member multiple interactions
increases phosphorylation
ISO [oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of BCAR1 protein]; Atropine inhibits the reaction [[oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of BCAR1 protein]]; wortmannin inhibits the reaction [oxotremorine M results in increased phosphorylation of BCAR1 protein] CTD PMID:10537051 NCBI chr19:43,932,543...43,967,452
Ensembl chr19:43,932,554...43,955,783
JBrowse link
G Chrm1 cholinergic receptor, muscarinic 1 multiple interactions
affects binding
ISO brucine promotes the reaction [oxotremorine M binds to CHRM1 protein]
CHRM1 protein binds to oxotremorine M
CTD PMID:9224827 NCBI chr 1:224,869,087...224,885,101
Ensembl chr 1:224,882,439...224,884,205
JBrowse link
G Chrm2 cholinergic receptor, muscarinic 2 affects binding
multiple interactions
ISO CHRM2 protein binds to oxotremorine M
eburnamonine promotes the reaction [oxotremorine M binds to CHRM2 protein]
CTD PMID:9224827 NCBI chr 4:64,089,028...64,091,090
Ensembl chr 4:64,088,900...64,091,090
JBrowse link
G Chrm3 cholinergic receptor, muscarinic 3 multiple interactions
affects binding
ISO brucine promotes the reaction [oxotremorine M binds to CHRM3 protein]
CHRM3 protein binds to oxotremorine M
CTD PMID:9224827 NCBI chr17:63,990,599...64,463,222
Ensembl chr17:63,990,599...63,994,169
JBrowse link
G Chrm4 cholinergic receptor, muscarinic 4 affects binding
multiple interactions
ISO CHRM4 protein binds to oxotremorine M
brucine promotes the reaction [oxotremorine M binds to CHRM4 protein]
CTD PMID:9224827 NCBI chr 3:80,833,272...80,841,165
Ensembl chr 3:80,833,272...80,841,006
JBrowse link
G Fos Fos proto-oncogene, AP-1 transcription factor subunit multiple interactions
increases expression
ISO 4-diphenylacetoxy-1,1-dimethylpiperidinium inhibits the reaction [oxotremorine M results in increased expression of FOS mRNA] CTD PMID:11128034 NCBI chr 6:109,300,433...109,303,299
Ensembl chr 6:109,300,433...109,303,299
JBrowse link
G Ptk2 protein tyrosine kinase 2 multiple interactions
increases phosphorylation
ISO [oxophenylarsine co-treated with oxotremorine M] results in increased phosphorylation of PTK2 protein; [Tetradecanoylphorbol Acetate co-treated with oxotremorine M] results in increased phosphorylation of PTK2 protein; [wortmannin co-treated with Tetradecanoylphorbol Acetate] inhibits the reaction [oxotremorine M results in increased phosphorylation of PTK2 protein]; Atropine inhibits the reaction [oxotremorine M inhibits the reaction [[wortmannin co-treated with lysophosphatidic acid] results in increased phosphorylation of PTK2 protein]]; Atropine inhibits the reaction [oxotremorine M inhibits the reaction [[wortmannin co-treated with oxophenylarsine] results in increased phosphorylation of PTK2 protein]]; Atropine inhibits the reaction [oxotremorine M promotes the reaction [[Tetradecanoylphorbol Acetate co-treated with wortmannin] results in increased phosphorylation of PTK2 protein]]; oxotremorine M inhibits the reaction [[wortmannin co-treated with lysophosphatidic acid] results in increased phosphorylation of PTK2 protein]; oxotremorine M inhibits the reaction [[wortmannin co-treated with oxophenylarsine] results in increased phosphorylation of PTK2 protein]; oxotremorine M promotes the reaction [[Tetradecanoylphorbol Acetate co-treated with wortmannin] results in increased phosphorylation of PTK2 protein] CTD PMID:10537051 NCBI chr 7:114,436,419...114,611,317
Ensembl chr 7:114,437,361...114,590,119
JBrowse link
G Pxn paxillin multiple interactions
increases phosphorylation
ISO [oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of PXN protein]; Atropine inhibits the reaction [[oxotremorine M co-treated with wortmannin] inhibits the reaction [oxophenylarsine results in increased phosphorylation of PXN protein]]; wortmannin inhibits the reaction [oxotremorine M results in increased phosphorylation of PXN protein] CTD PMID:10537051 NCBI chr12:46,797,953...46,845,107
Ensembl chr12:46,797,954...46,845,080
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19771
    chemical entity 19771
      molecular entity 19770
        ion 15945
          organic ion 8455
            organic cation 7309
              quaternary ammonium ion 5098
                oxotremorine M 8
Path 2
Term Annotations click to browse term
  CHEBI ontology 19771
    subatomic particle 19770
      composite particle 19770
        hadron 19770
          baryon 19770
            nucleon 19770
              atomic nucleus 19770
                atom 19770
                  main group element atom 19658
                    main group molecular entity 19658
                      s-block molecular entity 19423
                        hydrogen molecular entity 19416
                          hydrides 18755
                            inorganic hydride 17460
                              pnictogen hydride 17435
                                nitrogen hydride 17281
                                  ammonium 8216
                                    ammonium ion derivative 8212
                                      quaternary ammonium ion 5098
                                        oxotremorine M 8
paths to the root