Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:37782 term browser browse the term
Synonyms:related_synonym: Formula=C5H9O5R;   SMILES=[C@@H]1([C@@H]([C@H]([C@@H](O)CO1)O)O)O*;   alpha-L-arabinopyranosides

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19789
    chemical entity 19788
      atom 19787
        nonmetal atom 19660
          oxygen atom 19338
            oxygen molecular entity 19338
              organooxygen compound 18769
                carbohydrates and carbohydrate derivatives 12154
                  carbohydrate derivative 11779
                    glycosyl compound 10814
                      glycoside 9160
                        pentoside 573
                          arabinoside 571
                            alpha-L-arabinoside 0
                              alpha-L-arabinopyranoside 0
                                (+)-taxifolin 3-O-alpha-L-arabinopyranoside 0
                                25-O-methoxycimigenol 3-O-alpha-L-arabinopyranoside 0
                                3beta-[(alpha-L-arabinopyranosyl)oxy]-20beta-hydroxyursan-28-oic acid delta-lactone 0
                                4-methylumbelliferyl alpha-L-arabinoside 0
                                4-nitrophenyl alpha-L-arabinoside 0
                                capilliposide B 0
                                cimicifoetiside + 0
                                hederagenin 3-O-arabinoside 0
                                hermannioside B 0
                                kaempferol 3-O-alpha-L-arabinopyranosyl-7-O-alpha-L-rhamnopyranoside 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19789
    subatomic particle 19787
      composite particle 19787
        hadron 19787
          baryon 19787
            nucleon 19787
              atomic nucleus 19787
                atom 19787
                  main group element atom 19672
                    p-block element atom 19672
                      carbon group element atom 19569
                        carbon atom 19558
                          organic molecular entity 19558
                            heteroorganic entity 19152
                              organochalcogen compound 18851
                                organooxygen compound 18769
                                  carbohydrates and carbohydrate derivatives 12154
                                    carbohydrate 12154
                                      carbohydrate derivative 11779
                                        glycosyl compound 10814
                                          glycoside 9160
                                            pentoside 573
                                              arabinoside 571
                                                alpha-L-arabinoside 0
                                                  alpha-L-arabinopyranoside 0
                                                    (+)-taxifolin 3-O-alpha-L-arabinopyranoside 0
                                                    25-O-methoxycimigenol 3-O-alpha-L-arabinopyranoside 0
                                                    3beta-[(alpha-L-arabinopyranosyl)oxy]-20beta-hydroxyursan-28-oic acid delta-lactone 0
                                                    4-methylumbelliferyl alpha-L-arabinoside 0
                                                    4-nitrophenyl alpha-L-arabinoside 0
                                                    capilliposide B 0
                                                    cimicifoetiside + 0
                                                    hederagenin 3-O-arabinoside 0
                                                    hermannioside B 0
                                                    kaempferol 3-O-alpha-L-arabinopyranosyl-7-O-alpha-L-rhamnopyranoside 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.