Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:35071 term browser browse the term
Definition:A macrolide that has formula C18H26O5.
Synonyms:related_synonym: Formula=C18H26O5;   InChI=1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14-/m0/s1;   InChIKey=DWTTZBARDOXEAM-JSGCOSHPSA-N;   SMILES=C[C@H]1CCC[C@@H](O)CCCCCc2cc(O)cc(O)c2C(=O)O1;   Taleranol
 xref: CAS:42422-68-4 "KEGG COMPOUND";   KEGG:C14753;   KEGG:D05992
 xref_mesh: MESH:C028226

GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          oxygen atom 0
            oxygen molecular entity 0
              organooxygen compound 0
                polyketide 0
                  macrolide 0
                    beta-Zearalanol 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic ester 0
                                        lactone 0
                                          macrocyclic lactone 0
                                            macrolide 0
                                              beta-Zearalanol 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.