Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:brimonidine
go back to main search page
Accession:CHEBI:3175 term browser browse the term
Definition:A secondary amine that has formula C11H10BrN5.
Synonyms:exact_synonym: 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine
 related_synonym: 5-Bromo-6-(2-imidazolin-2-ylamino)quinoxaline;   Bromoxidine;   Formula=C11H10BrN5;   InChI=1S/C11H10BrN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17);   InChIKey=XYLJNLCSTIOKRM-UHFFFAOYSA-N;   SMILES=Brc1c(NC2=NCCN2)ccc2nccnc12;   brimonidina;   brimonidinum
 xref: Beilstein:751629;   CAS:59803-98-4;   DrugBank:DB00484;   Drug_Central:395;   KEGG:C07886;   KEGG:D07540;   LINCS:LSM-3526
 xref_mesh: MESH:C015620
 xref: Patent:DE2309160;   Patent:US3890319;   Wikipedia:Brimonidine



show annotations for term's descendants           Sort by:
 
brimonidine tartrate term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Adra2a adrenoceptor alpha 2A multiple interactions ISO
EXP
Brimonidine Tartrate inhibits the reaction [Norepinephrine binds to and results in increased activity of ADRA2A protein]; Brimonidine Tartrate promotes the reaction [Phenylephrine binds to and results in increased activity of ADRA2A protein]; Phenylephrine promotes the reaction [Brimonidine Tartrate binds to and results in increased activity of ADRA2A protein]; Prazosin inhibits the reaction [Phenylephrine promotes the reaction [Brimonidine Tartrate binds to and results in increased activity of ADRA2A protein]]; Yohimbine inhibits the reaction [Brimonidine Tartrate promotes the reaction [Phenylephrine binds to and results in increased activity of ADRA2A protein]] CTD PMID:8397342 PMID:10742289 PMID:12208771 PMID:12598592 NCBI chr 1:253,061,480...253,064,280
Ensembl chr 1:253,060,218...253,064,365
JBrowse link
G Agt angiotensinogen multiple interactions EXP 1-(6-((3-methoxyestra-1,3,5(10)-trien-17-yl)amino)hexyl)-1H-pyrrole-2,5-dione inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased abundance of Superoxides]]; 1-(6-((3-methoxyestra-1,3,5(10)-trien-17-yl)amino)hexyl)-1H-pyrrole-2,5-dione inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; 4-amino-5-(4-methylphenyl)-7-(tert-butyl)pyrazolo(3,4-d)pyrimidine inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased abundance of Superoxides]]; 4-amino-5-(4-methylphenyl)-7-(tert-butyl)pyrazolo(3,4-d)pyrimidine inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; bisindolylmaleimide I inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased abundance of Superoxides]]; bisindolylmaleimide I inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; Brimonidine Tartrate promotes the reaction [AGT protein results in increased abundance of Superoxides]; Brimonidine Tartrate promotes the reaction [AGT protein results in increased activity of RHOA protein]; diphenyleneiodonium inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased abundance of Superoxides]]; diphenyleneiodonium inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; tempol inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased abundance of Superoxides]]; tempol inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]] CTD PMID:18250367 NCBI chr19:52,529,139...52,549,618
Ensembl chr19:52,529,185...52,540,977
JBrowse link
G Cftr CF transmembrane conductance regulator multiple interactions ISO Brimonidine Tartrate inhibits the reaction [CFTR protein affects the transport of Chlorides] CTD PMID:12598592 NCBI chr 4:46,561,269...46,728,759
Ensembl chr 4:46,560,885...46,728,756
JBrowse link
G Creb1 cAMP responsive element binding protein 1 increases phosphorylation EXP Brimonidine Tartrate results in increased phosphorylation of CREB1 protein CTD PMID:17680988 NCBI chr 9:65,903,511...65,972,562
Ensembl chr 9:65,903,547...65,970,816
JBrowse link
G Prkca protein kinase C, alpha affects localization
multiple interactions
EXP Brimonidine Tartrate affects the localization of PRKCA protein
Nitric Oxide deficiency promotes the reaction [Brimonidine Tartrate affects the localization of PRKCA protein]
CTD PMID:12388232 NCBI chr10:92,889,390...93,288,013
Ensembl chr10:92,894,012...93,288,012
JBrowse link
G Prkcd protein kinase C, delta affects localization
multiple interactions
EXP Brimonidine Tartrate affects the localization of PRKCD protein
Nitric Oxide deficiency inhibits the reaction [Brimonidine Tartrate affects the localization of PRKCD protein]
CTD PMID:12388232 NCBI chr16:5,769,226...5,807,214
Ensembl chr16:5,769,215...5,799,352
JBrowse link
G Rhoa ras homolog family member A multiple interactions EXP 1-(6-((3-methoxyestra-1,3,5(10)-trien-17-yl)amino)hexyl)-1H-pyrrole-2,5-dione inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; 4-amino-5-(4-methylphenyl)-7-(tert-butyl)pyrazolo(3,4-d)pyrimidine inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; bisindolylmaleimide I inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; Brimonidine Tartrate promotes the reaction [AGT protein results in increased activity of RHOA protein]; diphenyleneiodonium inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]]; tempol inhibits the reaction [Brimonidine Tartrate promotes the reaction [AGT protein results in increased expression of RHOA protein]] CTD PMID:18250367 NCBI chr 8:108,991,926...109,025,746
Ensembl chr 8:108,991,954...109,025,746
JBrowse link
G Slc22a2 solute carrier family 22 member 2 multiple interactions ISO Brimonidine Tartrate inhibits the reaction [SLC22A2 protein results in increased uptake of 4-(4-dimethylaminostyryl)-1-methylpyridinium] CTD PMID:21599003 NCBI chr 1:48,121,061...48,163,268
Ensembl chr 1:48,121,061...48,163,268
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19808
    role 19757
      application 19467
        pharmaceutical 19315
          drug 19315
            cardiovascular drug 7676
              antihypertensive agent 1847
                brimonidine 8
                  brimonidine tartrate 8
Path 2
Term Annotations click to browse term
  CHEBI ontology 19808
    subatomic particle 19807
      composite particle 19807
        hadron 19807
          baryon 19807
            nucleon 19807
              atomic nucleus 19807
                atom 19807
                  main group element atom 19704
                    p-block element atom 19704
                      carbon group element atom 19626
                        carbon atom 19616
                          organic molecular entity 19616
                            organic molecule 19556
                              organic cyclic compound 19347
                                organic heterocyclic compound 18580
                                  organic heteropolycyclic compound 18057
                                    organic heterobicyclic compound 16867
                                      mancude organic heterobicyclic parent 5408
                                        naphthyridine 797
                                          quinoxaline 385
                                            quinoxaline derivative 385
                                              brimonidine 8
                                                brimonidine tartrate 8
paths to the root