Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:butyric acid
go back to main search page
Accession:CHEBI:30772 term browser browse the term
Definition:A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group.
Synonyms:related_synonym: 1-butanoic acid;   1-butyric acid;   1-propanecarboxylic acid;   4:0;   Butanoate;   Butanoic acid;   Buttersaeure;   C4:0;   CH3-[CH2]2-COOH;   Formula=C4H8O2;   InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6);   InChIKey=FERIUCNNQQJTOY-UHFFFAOYSA-N;   SMILES=CCCC(O)=O;   acide butanoique;   acide butyrique;   butanic acid;   butoic acid;   ethylacetic acid;   n-butanoic acid;   n-butyric acid;   propanecarboxylic acid;   propylformic acid
 alt_id: CHEBI:113450;   CHEBI:22948;   CHEBI:3234;   CHEBI:41208
 xref: Beilstein:906770 "Beilstein";   CAS:107-92-6 "ChemIDplus";   CAS:107-92-6 "KEGG COMPOUND";   CAS:107-92-6 "NIST Chemistry WebBook";   DrugBank:DB03568;   Gmelin:26242 "Gmelin";   HMDB:HMDB0000039;   KEGG:C00246;   KNApSAcK:C00001180;   LIPID_MAPS_instance:LMFA01010004 "LIPID MAPS"
 xref_mesh: MESH:D020148
 xref: MetaCyc:BUTYRIC_ACID;   PDBeChem:BUA;   PMID:10736622 "Europe PMC";   PMID:10956204 "ChEMBL";   PMID:11201044 "Europe PMC";   PMID:11208715 "Europe PMC";   PMID:11238216 "Europe PMC";   PMID:11305323 "Europe PMC";   PMID:12068484 "Europe PMC";   PMID:13678314 "Europe PMC";   PMID:14962641 "Europe PMC";   PMID:1542095 "ChEMBL";   PMID:15809727 "Europe PMC";   PMID:15810631 "Europe PMC";   PMID:15938880 "Europe PMC";   PMID:19318247 "Europe PMC";   PMID:19366864 "Europe PMC";   PMID:19703412 "Europe PMC";   PMID:21699495 "Europe PMC";   PMID:22038864 "Europe PMC";   PMID:22194341 "Europe PMC";   PMID:22322557 "Europe PMC";   PMID:22339023 "Europe PMC";   PMID:22466881 "Europe PMC";   Reaxys:906770 "Reaxys";   Wikipedia:Butyric_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:17968


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      biological role 0
        biochemical role 0
          metabolite 0
            prokaryotic metabolite 0
              bacterial metabolite 0
                Mycoplasma genitalium metabolite 0
                  butyric acid 0
                    (2S)-2-[(\{4-[2-(2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]phenyl\}carbonyl)amino]-4-(2H-tetrazol-5-yl)butanoic acid 0
                    (2S)-3-methyl-2-((2R,3S)-3-[(methylsulfonyl)amino]-1-\{[2-(pyrrolidin-1-ylmethyl)-1,3-oxazol-4-yl]carbonyl\}pyrrolidin-2-yl)butanoic acid 0
                    (2S,3R)-2-[(3S,6R)-3-amino-6-hydroxy-2-oxopiperidinyl]-3-hydroxybutanoic acid 0
                    (R)-2-hydroxy-4-(hydroxymethylphosphinyl)butyric acid 0
                    (R)-3,4-dihydroxy-2-oxobutanoic acid 0
                    (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid 0
                    (R)-3-hydroxy-2-oxo-4-phosphonooxybutanoic acid 0
                    (S)-2,4-dihydroxy-3-oxobutanoic acid 0
                    (S)-2-acetyl-2-hydroxybutanoic acid 0
                    (S)-3,4-dihydroxy-2-oxobutanoic acid 0
                    1,2-dibutyryl-sn-glycero-3-phospho-(1'D-myo-inositol) 0
                    1,2-dibutyryl-sn-glycero-3-phospho-(1'D-myo-inositol-5'-phosphate) 0
                    1-butyryl-2-oleoyl-sn-glycerol 0
                    1-palmitoyl-2-butanoyl-sn-glycero-3-phosphocholine 0
                    2,2,4-trihydroxybutanoic acid 0
                    2,3-dihydroxy-3-methylbutanoic acid + 0
                    2,4-diaminobutyric acid + 0
                    2-(hydroxymethyl)-4-oxobutanoic acid 0
                    2-acetyllactic acid + 0
                    2-amino-2-hydroxybutanoic acid 0
                    2-amino-2-methylbutanoic acid 0
                    2-amino-3-oxobutanoic acid + 0
                    2-hydroxybutyric acid + 0
                    2-methylacetoacetic acid + 0
                    2-oxobutanoic acid 0
                    2-phenylbutyric acid 0
                    3,4-dihydroxybutyric acid 0
                    3-(indol-3-yl)-2-oxobutyric acid + 0
                    3-aminobutanoic acid + 0
                    3-hydroxy-2-methylbutanoic acid + 0
                    3-hydroxybutyric acid + 0
                    3-hydroxyisovaleric acid + 0
                    3-methyl-2-oxobutanoic acid 0
                    4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid 0
                    4-(2-amino-5-hydroxyphenyl)-2,4-dioxobutanoic acid 0
                    4-(2-aminophenyl)-2,4-dioxobutanoic acid 0
                    4-(2-thienyl)butyric acid 0
                    4-(5-ethyl-2-thienyl)-4-oxobutyric acid 0
                    4-(hydroxymethylphosphinyl)-2-oxobutyric acid 0
                    4-(methylamino)butyric acid 0
                    4-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid 0
                    4-[4-(2,5-dioxopyrrolidin-1-yl)phenylamino]-4-hydroxybutyric acid 0
                    4-[4-(3,5-dioxohexyl)phenylcarbamoyl]butyric acid 0
                    4-guanidinobutanoic acid 0
                    4-hydroxybutyric acid + 0
                    4-methylthio-2-oxobutanoic acid + 0
                    4-oxo-4-(2-thienyl)butyric acid 0
                    4-oxo-4-phenylbutyric acid 0
                    4-phenylbutyric acid 0
                    D-2,4-diaminobutyric acid 0
                    L-2,4-diaminobutyric acid + 0
                    L-2-amino-4-(hydroxymethylphosphinoyl)butanoic acid 0
                    N-(butanoyl)ethanolamine 0
                    N-butanoylserotonin 0
                    N-butyryl-1-palmitoyl-2-linoleoyl-sn-glycero-3-phosphoethanolamine 0
                    O-butanoylcarnitine + 0
                    S-butyryl-4'-phosphopantetheine 0
                    acetoacetic acid + 0
                    alpha-amino-gamma-cyanobutanoic acid 0
                    alpha-aminobutyric acid + 0
                    butyrate ester + 0
                    butyryl group 0
                    butyryl-CoA + 0
                    butyrylglycine 0
                    dibutyrin + 0
                    dimethylbutyric acid + 0
                    discadenine 0
                    gamma-amino-beta-hydroxybutyric acid + 0
                    gamma-amino-gamma-cyanobutanoic acid + 0
                    gamma-aminobutyric acid + 0
                    heptafluorobutyric anhydride 0
                    hexyl butyrate 0
                    hydroxybutyric acid + 0
                    indole-3-butyric acid + 0
                    methionine + 0
                    methylbutyric acid + 0
                    monobutyrin 0
                    perfluorobutyric acid 0
                    tributyrin 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          fatty acid 0
                                            short-chain fatty acid 0
                                              fatty acid 4:0 0
                                                butyric acid 0
                                                  (2S)-2-[(\{4-[2-(2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]phenyl\}carbonyl)amino]-4-(2H-tetrazol-5-yl)butanoic acid 0
                                                  (2S)-3-methyl-2-((2R,3S)-3-[(methylsulfonyl)amino]-1-\{[2-(pyrrolidin-1-ylmethyl)-1,3-oxazol-4-yl]carbonyl\}pyrrolidin-2-yl)butanoic acid 0
                                                  (2S,3R)-2-[(3S,6R)-3-amino-6-hydroxy-2-oxopiperidinyl]-3-hydroxybutanoic acid 0
                                                  (R)-2-hydroxy-4-(hydroxymethylphosphinyl)butyric acid 0
                                                  (R)-3,4-dihydroxy-2-oxobutanoic acid 0
                                                  (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid 0
                                                  (R)-3-hydroxy-2-oxo-4-phosphonooxybutanoic acid 0
                                                  (S)-2,4-dihydroxy-3-oxobutanoic acid 0
                                                  (S)-2-acetyl-2-hydroxybutanoic acid 0
                                                  (S)-3,4-dihydroxy-2-oxobutanoic acid 0
                                                  1,2-dibutyryl-sn-glycero-3-phospho-(1'D-myo-inositol) 0
                                                  1,2-dibutyryl-sn-glycero-3-phospho-(1'D-myo-inositol-5'-phosphate) 0
                                                  1-butyryl-2-oleoyl-sn-glycerol 0
                                                  1-palmitoyl-2-butanoyl-sn-glycero-3-phosphocholine 0
                                                  2,2,4-trihydroxybutanoic acid 0
                                                  2,3-dihydroxy-3-methylbutanoic acid + 0
                                                  2,4-diaminobutyric acid + 0
                                                  2-(hydroxymethyl)-4-oxobutanoic acid 0
                                                  2-acetyllactic acid + 0
                                                  2-amino-2-hydroxybutanoic acid 0
                                                  2-amino-2-methylbutanoic acid 0
                                                  2-amino-3-oxobutanoic acid + 0
                                                  2-hydroxybutyric acid + 0
                                                  2-methylacetoacetic acid + 0
                                                  2-oxobutanoic acid 0
                                                  2-phenylbutyric acid 0
                                                  3,4-dihydroxybutyric acid 0
                                                  3-(indol-3-yl)-2-oxobutyric acid + 0
                                                  3-aminobutanoic acid + 0
                                                  3-hydroxy-2-methylbutanoic acid + 0
                                                  3-hydroxybutyric acid + 0
                                                  3-hydroxyisovaleric acid + 0
                                                  3-methyl-2-oxobutanoic acid 0
                                                  4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid 0
                                                  4-(2-amino-5-hydroxyphenyl)-2,4-dioxobutanoic acid 0
                                                  4-(2-aminophenyl)-2,4-dioxobutanoic acid 0
                                                  4-(2-thienyl)butyric acid 0
                                                  4-(5-ethyl-2-thienyl)-4-oxobutyric acid 0
                                                  4-(hydroxymethylphosphinyl)-2-oxobutyric acid 0
                                                  4-(methylamino)butyric acid 0
                                                  4-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid 0
                                                  4-[4-(2,5-dioxopyrrolidin-1-yl)phenylamino]-4-hydroxybutyric acid 0
                                                  4-[4-(3,5-dioxohexyl)phenylcarbamoyl]butyric acid 0
                                                  4-guanidinobutanoic acid 0
                                                  4-hydroxybutyric acid + 0
                                                  4-methylthio-2-oxobutanoic acid + 0
                                                  4-oxo-4-(2-thienyl)butyric acid 0
                                                  4-oxo-4-phenylbutyric acid 0
                                                  4-phenylbutyric acid 0
                                                  D-2,4-diaminobutyric acid 0
                                                  L-2,4-diaminobutyric acid + 0
                                                  L-2-amino-4-(hydroxymethylphosphinoyl)butanoic acid 0
                                                  N-(butanoyl)ethanolamine 0
                                                  N-butanoylserotonin 0
                                                  N-butyryl-1-palmitoyl-2-linoleoyl-sn-glycero-3-phosphoethanolamine 0
                                                  O-butanoylcarnitine + 0
                                                  S-butyryl-4'-phosphopantetheine 0
                                                  acetoacetic acid + 0
                                                  alpha-amino-gamma-cyanobutanoic acid 0
                                                  alpha-aminobutyric acid + 0
                                                  butyrate ester + 0
                                                  butyryl group 0
                                                  butyryl-CoA + 0
                                                  butyrylglycine 0
                                                  dibutyrin + 0
                                                  dimethylbutyric acid + 0
                                                  discadenine 0
                                                  gamma-amino-beta-hydroxybutyric acid + 0
                                                  gamma-amino-gamma-cyanobutanoic acid + 0
                                                  gamma-aminobutyric acid + 0
                                                  heptafluorobutyric anhydride 0
                                                  hexyl butyrate 0
                                                  hydroxybutyric acid + 0
                                                  indole-3-butyric acid + 0
                                                  methionine + 0
                                                  methylbutyric acid + 0
                                                  monobutyrin 0
                                                  perfluorobutyric acid 0
                                                  tributyrin 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.