Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:propionic acid
go back to main search page
Accession:CHEBI:30768 term browser browse the term
Definition:A short-chain saturated fatty acid comprising ethane attached to the carbon of a carboxy group.
Synonyms:related_synonym: CH3-CH2-COOH;   Formula=C3H6O2;   InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5);   InChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N;   PA;   Propanoic acid;   Propionsaeure;   SMILES=CCC(O)=O;   acide propanoique;   acide propionique;   carboxyethane;   ethanecarboxylic acid;   ethylformic acid;   metacetonic acid;   methylacetic acid;   propioic acid;   propoic acid;   pseudoacetic acid
 alt_id: CHEBI:26304;   CHEBI:45227;   CHEBI:8476
 xref: Beilstein:506071 "Beilstein";   CAS:79-09-4 "ChemIDplus";   CAS:79-09-4 "KEGG COMPOUND";   CAS:79-09-4 "NIST Chemistry WebBook";   DrugBank:DB03766;   Gmelin:1821 "Gmelin";   KEGG:C00163;   KEGG:D02310;   LIPID_MAPS_instance:LMFA01010003 "LIPID MAPS"
 xref_mesh: MESH:C029658
 xref: PDBeChem:PPI;   PMID:15868474 "Europe PMC";   PMID:1628870 "Europe PMC";   PMID:16763906 "Europe PMC";   PPDB:1341
 cyclic_relationship: is_conjugate_acid_of CHEBI:17272


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      application 0
        pharmaceutical 0
          drug 0
            antifungal drug 0
              propionic acid 0
                (2R,4S)-2-[(1R)-1-carboxy-2-hydroxy-2-methylpropyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid 0
                (2S)-2-(4-\{[(1R,2S)-2-hydroxycyclopentyl]methyl\}phenyl)propanoic acid 0
                (2S)-2-[(2R,4S,5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-\{[(R)-hydroxy(phosphonooxy)phosphoryl]oxy\}ethyl)-4-methyl-1,3-thiazolidin-2-yl]-2-hydroxypropanoic acid 0
                (2S)-2-[3-(aminomethyl)phenyl]-3-[(S)-\{(1R)-1-[(2,1,3-benzothiadiazol-4-ylsulfonyl)amino]-2-methylpropyl\}(hydroxy)phosphoryl]propanoic acid 0
                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{(3R)-1-[(1Z)-ethanimidoyl]pyrrolidin-3-yl\}oxy)phenyl]propanoic acid 0
                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{1-[(1E)-ethanimidoyl]piperidin-4-yl\}oxy)phenyl]propanoic acid 0
                (R)-3-(5-benzyloxyindol-3-yl)lactic acid 0
                (R)-indole-3-lactic acid 0
                (S)-2-amino-3-(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)propionic acid 0
                (S)-2-chloropropanoic acid 0
                (S)-3-fluorolactic acid 0
                (S)-methylmalonaldehydic acid 0
                1-palmitoyl-2-propionyl-sn-glycero-3-phosphocholine 0
                2,2'-iminodipropanoic acid + 0
                2,2-bis(4-hydroxyphenyl)propanoic acid 0
                2,3-dihydroxy-2-methylpropanoic acid 0
                2-(4-cyclohexyl-1-naphthyl)propanoic acid + 0
                2-aminoisobutyric acid + 0
                2-arylpropionic acid + 0
                2-hydroxy-3-oxopropanoic acid 0
                2-hydroxypropanoic acid + 0
                2-methyl-2-(4-\{[(\{4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl\}carbonyl)amino]methyl\}phenoxy)propanoic acid 0
                2-methyl-3-oxopropanoic acid + 0
                3,4,5-trimethoxydihydrocinnamic acid 0
                3-(1H-indol-3-yl)propanoic acid 0
                3-(2,3-dihydroxyphenyl)propanoic acid 0
                3-(2-hydroxyphenyl)propanoic acid 0
                3-(3,4-dimethoxyphenyl)propanoic acid 0
                3-(3-hydroxyphenyl)propanoic acid + 0
                3-(3-sulfooxyphenyl)propanoic acid 0
                3-(methylthio)propionic acid + 0
                3-(trimethylsilyl)propionic acid 0
                3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoic acid 0
                3-[(5E)-5-\{[5-(4-chlorophenyl)furan-2-yl]methylidene\}-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]propanoic acid 0
                3-[2-(trifluoromethyl)phenyl]propanoic acid + 0
                3-\{(2Z)-2-\{[3-(2-carboxyethyl)-5-\{(Z)-[(3E,4S)-3-ethylidene-4-methyl-5-oxopyrrolidin-2-ylidene]methyl\}-4-methyl-1H-pyrrol-2-yl]methylene\}-4-methyl-5-[(Z)-(3-methyl-5-oxo-4-vinyl-1,5-dihydro-2H-pyrrol-2-ylidene)methyl]-2H-pyrrol-3-yl\}propanoic acid 0
                3-amino-3-(4-hydroxyphenyl)propanoic acid 0
                3-aminoalanine + 0
                3-guanidinopropanoic acid 0
                3-hydroxyisobutyric acid + 0
                3-hydroxyphenyl propanoate 0
                3-hydroxypropionic acid + 0
                3-mercapto-2-mercaptomethylpropanoic acid 0
                3-nitropropanoic acid 0
                3-oxopropanoic acid + 0
                3-phenylpropionic acid + 0
                3-sulfopropanoic acid 0
                Isopropyl propionate 0
                L-mimosine 0
                N(3)-oxalyl-L-2,3-diaminopropionic acid 0
                N-(2-hydroxyethyl)iminodiacetic acid 0
                N-carbamoyl-beta-alanine 0
                N-propanoyl-L-methionine 0
                O-propanoylcarnitine + 0
                alanine + 0
                benoxaprofen 0
                beta-alanopine + 0
                bezafibrate 0
                clobetasol propionate 0
                dihydroferulic acid + 0
                dihydrourocanic acid 0
                egonolpropanoate 0
                flunoxaprofen 0
                flurbiprofen + 0
                glyceric acid + 0
                ibuprofen + 0
                indoprofen 0
                ketoprofen 0
                loxoprofen + 0
                mercaptopropanoic acid + 0
                meta-hydroxyphenylhydracrylic acid 0
                miroprofen 0
                oxaprozin 0
                phloretic acid 0
                propanoate ester + 0
                propanoyl phosphate 0
                propanoyl-AMP 0
                propanoyl-AMP(1-) 0
                propanoyl-CoAs + 0
                propionamide + 0
                propionyl group + 0
                propionyl-CoA + 0
                propionylglycine 0
                pyruvic acid + 0
                tropic acid + 0
                tyrosine + 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          fatty acid 0
                                            saturated fatty acid 0
                                              propionic acid 0
                                                (2R,4S)-2-[(1R)-1-carboxy-2-hydroxy-2-methylpropyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid 0
                                                (2S)-2-(4-\{[(1R,2S)-2-hydroxycyclopentyl]methyl\}phenyl)propanoic acid 0
                                                (2S)-2-[(2R,4S,5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-\{[(R)-hydroxy(phosphonooxy)phosphoryl]oxy\}ethyl)-4-methyl-1,3-thiazolidin-2-yl]-2-hydroxypropanoic acid 0
                                                (2S)-2-[3-(aminomethyl)phenyl]-3-[(S)-\{(1R)-1-[(2,1,3-benzothiadiazol-4-ylsulfonyl)amino]-2-methylpropyl\}(hydroxy)phosphoryl]propanoic acid 0
                                                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{(3R)-1-[(1Z)-ethanimidoyl]pyrrolidin-3-yl\}oxy)phenyl]propanoic acid 0
                                                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{1-[(1E)-ethanimidoyl]piperidin-4-yl\}oxy)phenyl]propanoic acid 0
                                                (R)-3-(5-benzyloxyindol-3-yl)lactic acid 0
                                                (R)-indole-3-lactic acid 0
                                                (S)-2-amino-3-(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)propionic acid 0
                                                (S)-2-chloropropanoic acid 0
                                                (S)-3-fluorolactic acid 0
                                                (S)-methylmalonaldehydic acid 0
                                                1-palmitoyl-2-propionyl-sn-glycero-3-phosphocholine 0
                                                2,2'-iminodipropanoic acid + 0
                                                2,2-bis(4-hydroxyphenyl)propanoic acid 0
                                                2,3-dihydroxy-2-methylpropanoic acid 0
                                                2-(4-cyclohexyl-1-naphthyl)propanoic acid + 0
                                                2-aminoisobutyric acid + 0
                                                2-arylpropionic acid + 0
                                                2-hydroxy-3-oxopropanoic acid 0
                                                2-hydroxypropanoic acid + 0
                                                2-methyl-2-(4-\{[(\{4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl\}carbonyl)amino]methyl\}phenoxy)propanoic acid 0
                                                2-methyl-3-oxopropanoic acid + 0
                                                3,4,5-trimethoxydihydrocinnamic acid 0
                                                3-(1H-indol-3-yl)propanoic acid 0
                                                3-(2,3-dihydroxyphenyl)propanoic acid 0
                                                3-(2-hydroxyphenyl)propanoic acid 0
                                                3-(3,4-dimethoxyphenyl)propanoic acid 0
                                                3-(3-hydroxyphenyl)propanoic acid + 0
                                                3-(3-sulfooxyphenyl)propanoic acid 0
                                                3-(methylthio)propionic acid + 0
                                                3-(trimethylsilyl)propionic acid 0
                                                3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoic acid 0
                                                3-[(5E)-5-\{[5-(4-chlorophenyl)furan-2-yl]methylidene\}-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]propanoic acid 0
                                                3-[2-(trifluoromethyl)phenyl]propanoic acid + 0
                                                3-\{(2Z)-2-\{[3-(2-carboxyethyl)-5-\{(Z)-[(3E,4S)-3-ethylidene-4-methyl-5-oxopyrrolidin-2-ylidene]methyl\}-4-methyl-1H-pyrrol-2-yl]methylene\}-4-methyl-5-[(Z)-(3-methyl-5-oxo-4-vinyl-1,5-dihydro-2H-pyrrol-2-ylidene)methyl]-2H-pyrrol-3-yl\}propanoic acid 0
                                                3-amino-3-(4-hydroxyphenyl)propanoic acid 0
                                                3-aminoalanine + 0
                                                3-guanidinopropanoic acid 0
                                                3-hydroxyisobutyric acid + 0
                                                3-hydroxyphenyl propanoate 0
                                                3-hydroxypropionic acid + 0
                                                3-mercapto-2-mercaptomethylpropanoic acid 0
                                                3-nitropropanoic acid 0
                                                3-oxopropanoic acid + 0
                                                3-phenylpropionic acid + 0
                                                3-sulfopropanoic acid 0
                                                Isopropyl propionate 0
                                                L-mimosine 0
                                                N(3)-oxalyl-L-2,3-diaminopropionic acid 0
                                                N-(2-hydroxyethyl)iminodiacetic acid 0
                                                N-carbamoyl-beta-alanine 0
                                                N-propanoyl-L-methionine 0
                                                O-propanoylcarnitine + 0
                                                alanine + 0
                                                benoxaprofen 0
                                                beta-alanopine + 0
                                                bezafibrate 0
                                                clobetasol propionate 0
                                                dihydroferulic acid + 0
                                                dihydrourocanic acid 0
                                                egonolpropanoate 0
                                                flunoxaprofen 0
                                                flurbiprofen + 0
                                                glyceric acid + 0
                                                ibuprofen + 0
                                                indoprofen 0
                                                ketoprofen 0
                                                loxoprofen + 0
                                                mercaptopropanoic acid + 0
                                                meta-hydroxyphenylhydracrylic acid 0
                                                miroprofen 0
                                                oxaprozin 0
                                                phloretic acid 0
                                                propanoate ester + 0
                                                propanoyl phosphate 0
                                                propanoyl-AMP 0
                                                propanoyl-AMP(1-) 0
                                                propanoyl-CoAs + 0
                                                propionamide + 0
                                                propionyl group + 0
                                                propionyl-CoA + 0
                                                propionylglycine 0
                                                pyruvic acid + 0
                                                tropic acid + 0
                                                tyrosine + 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.