Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:propionic acid
go back to main search page
Accession:CHEBI:30768 term browser browse the term
Definition:A short-chain saturated fatty acid comprising ethane attached to the carbon of a carboxy group.
Synonyms:related_synonym: CH3-CH2-COOH;   Formula=C3H6O2;   InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5);   InChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N;   PA;   Propanoic acid;   Propionsaeure;   SMILES=CCC(O)=O;   acide propanoique;   acide propionique;   carboxyethane;   ethanecarboxylic acid;   ethylformic acid;   metacetonic acid;   methylacetic acid;   propioic acid;   propoic acid;   pseudoacetic acid
 alt_id: CHEBI:26304;   CHEBI:45227;   CHEBI:8476
 xref: Beilstein:506071 "Beilstein";   CAS:79-09-4 "ChemIDplus";   CAS:79-09-4 "KEGG COMPOUND";   CAS:79-09-4 "NIST Chemistry WebBook";   DrugBank:DB03766;   Gmelin:1821 "Gmelin";   KEGG:C00163;   KEGG:D02310;   LIPID_MAPS_instance:LMFA01010003 "LIPID MAPS"
 xref_mesh: MESH:C029658
 xref: PDBeChem:PPI;   PMID:15868474 "Europe PMC";   PMID:1628870 "Europe PMC";   PMID:16763906 "Europe PMC";   PPDB:1341
 cyclic_relationship: is_conjugate_acid_of CHEBI:17272


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19657
    role 19601
      application 19225
        pharmaceutical 19089
          drug 19089
            antifungal drug 5101
              propionic acid 3642
                (2R,4S)-2-[(1R)-1-carboxy-2-hydroxy-2-methylpropyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid 0
                (2S)-2-(4-\{[(1R,2S)-2-hydroxycyclopentyl]methyl\}phenyl)propanoic acid 0
                (2S)-2-[(2R,4S,5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-\{[(R)-hydroxy(phosphonooxy)phosphoryl]oxy\}ethyl)-4-methyl-1,3-thiazolidin-2-yl]-2-hydroxypropanoic acid 0
                (2S)-2-[3-(aminomethyl)phenyl]-3-[(S)-\{(1R)-1-[(2,1,3-benzothiadiazol-4-ylsulfonyl)amino]-2-methylpropyl\}(hydroxy)phosphoryl]propanoic acid 0
                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{(3R)-1-[(1Z)-ethanimidoyl]pyrrolidin-3-yl\}oxy)phenyl]propanoic acid 0
                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{1-[(1E)-ethanimidoyl]piperidin-4-yl\}oxy)phenyl]propanoic acid 0
                (R)-3-(5-benzyloxyindol-3-yl)lactic acid 0
                (R)-indole-3-lactic acid 0
                (S)-2-amino-3-(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)propionic acid 0
                (S)-2-chloropropanoic acid 0
                (S)-3-fluorolactic acid 0
                (S)-methylmalonaldehydic acid 0
                1-palmitoyl-2-propionyl-sn-glycero-3-phosphocholine 0
                2,2'-iminodipropanoic acid + 0
                2,2-bis(4-hydroxyphenyl)propanoic acid 0
                2,3-dihydroxy-2-methylpropanoic acid 0
                2-(4-cyclohexyl-1-naphthyl)propanoic acid + 0
                2-amino-3-phosphonopropanoic acid 0
                2-aminoisobutyric acid + 0
                2-arylpropionic acid + 193
                2-hydroxy-3-oxopropanoic acid 0
                2-hydroxypropanoic acid + 2790
                2-methyl-2-(4-\{[(\{4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl\}carbonyl)amino]methyl\}phenoxy)propanoic acid 0
                2-methyl-3-oxopropanoic acid + 0
                3,4,5-trimethoxydihydrocinnamic acid 0
                3-(1H-indol-3-yl)propanoic acid 2
                3-(2,3-dihydroxyphenyl)propanoic acid 0
                3-(2-hydroxyphenyl)propanoic acid 0
                3-(3,4-dimethoxyphenyl)propanoic acid 0
                3-(3-hydroxyphenyl)propanoic acid + 0
                3-(3-sulfooxyphenyl)propanoic acid 0
                3-(methylthio)propionic acid + 0
                3-(trimethylsilyl)propionic acid 0
                3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoic acid 0
                3-[(5E)-5-\{[5-(4-chlorophenyl)furan-2-yl]methylidene\}-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]propanoic acid 0
                3-[2-(trifluoromethyl)phenyl]propanoic acid + 0
                3-\{(2Z)-2-\{[3-(2-carboxyethyl)-5-\{(Z)-[(3E,4S)-3-ethylidene-4-methyl-5-oxopyrrolidin-2-ylidene]methyl\}-4-methyl-1H-pyrrol-2-yl]methylene\}-4-methyl-5-[(Z)-(3-methyl-5-oxo-4-vinyl-1,5-dihydro-2H-pyrrol-2-ylidene)methyl]-2H-pyrrol-3-yl\}propanoic acid 0
                3-amino-3-(4-hydroxyphenyl)propanoic acid 0
                3-aminoalanine + 0
                3-guanidinopropanoic acid 1
                3-hydroxyisobutyric acid + 0
                3-hydroxyphenyl propanoate 0
                3-hydroxypropionic acid + 1
                3-mercapto-2-mercaptomethylpropanoic acid 0
                3-nitropropanoic acid 41
                3-oxopropanoic acid + 0
                3-phenylpropionic acid + 6
                3-sulfopropanoic acid 0
                Isopropyl propionate 0
                L-mimosine 19
                N(3)-oxalyl-L-2,3-diaminopropionic acid 0
                N-(2-hydroxyethyl)iminodiacetic acid 0
                N-carbamoyl-beta-alanine 0
                N-propanoyl-L-methionine 0
                O-propanoylcarnitine + 0
                alanine + 101
                benoxaprofen 12
                beta-alanopine + 0
                bezafibrate 218
                clobetasol propionate 0
                dihydroferulic acid + 0
                dihydrourocanic acid 0
                egonolpropanoate 0
                flunoxaprofen 0
                flurbiprofen + 109
                glyceric acid + 6
                ibuprofen + 290
                indoprofen 3
                ketoprofen 27
                loxoprofen + 3
                mercaptopropanoic acid + 13
                meta-hydroxyphenylhydracrylic acid 0
                miroprofen 0
                oxaprozin 3
                phloretic acid 1
                propanoate ester + 206
                propanoyl phosphate 0
                propanoyl-AMP 0
                propanoyl-AMP(1-) 0
                propanoyl-CoAs + 0
                propionamide + 1
                propionyl group + 0
                propionyl-CoA + 9
                propionylglycine 0
                pyruvic acid + 47
                tropic acid + 190
                tyrosine + 374
Path 2
Term Annotations click to browse term
  CHEBI ontology 19657
    subatomic particle 19653
      composite particle 19653
        hadron 19653
          baryon 19653
            nucleon 19653
              atomic nucleus 19653
                atom 19653
                  main group element atom 19534
                    p-block element atom 19534
                      carbon group element atom 19417
                        carbon atom 19409
                          organic molecular entity 19409
                            organic group 18338
                              organic divalent group 18329
                                organodiyl group 18329
                                  carbonyl group 18218
                                    carbonyl compound 18218
                                      carboxylic acid 17918
                                        monocarboxylic acid 17254
                                          fatty acid 15818
                                            saturated fatty acid 15785
                                              propionic acid 3642
                                                (2R,4S)-2-[(1R)-1-carboxy-2-hydroxy-2-methylpropyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid 0
                                                (2S)-2-(4-\{[(1R,2S)-2-hydroxycyclopentyl]methyl\}phenyl)propanoic acid 0
                                                (2S)-2-[(2R,4S,5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-\{[(R)-hydroxy(phosphonooxy)phosphoryl]oxy\}ethyl)-4-methyl-1,3-thiazolidin-2-yl]-2-hydroxypropanoic acid 0
                                                (2S)-2-[3-(aminomethyl)phenyl]-3-[(S)-\{(1R)-1-[(2,1,3-benzothiadiazol-4-ylsulfonyl)amino]-2-methylpropyl\}(hydroxy)phosphoryl]propanoic acid 0
                                                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{(3R)-1-[(1Z)-ethanimidoyl]pyrrolidin-3-yl\}oxy)phenyl]propanoic acid 0
                                                (2S)-3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-(\{1-[(1E)-ethanimidoyl]piperidin-4-yl\}oxy)phenyl]propanoic acid 0
                                                (R)-3-(5-benzyloxyindol-3-yl)lactic acid 0
                                                (R)-indole-3-lactic acid 0
                                                (S)-2-amino-3-(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)propionic acid 0
                                                (S)-2-chloropropanoic acid 0
                                                (S)-3-fluorolactic acid 0
                                                (S)-methylmalonaldehydic acid 0
                                                1-palmitoyl-2-propionyl-sn-glycero-3-phosphocholine 0
                                                2,2'-iminodipropanoic acid + 0
                                                2,2-bis(4-hydroxyphenyl)propanoic acid 0
                                                2,3-dihydroxy-2-methylpropanoic acid 0
                                                2-(4-cyclohexyl-1-naphthyl)propanoic acid + 0
                                                2-amino-3-phosphonopropanoic acid 0
                                                2-aminoisobutyric acid + 0
                                                2-arylpropionic acid + 193
                                                2-hydroxy-3-oxopropanoic acid 0
                                                2-hydroxypropanoic acid + 2790
                                                2-methyl-2-(4-\{[(\{4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl\}carbonyl)amino]methyl\}phenoxy)propanoic acid 0
                                                2-methyl-3-oxopropanoic acid + 0
                                                3,4,5-trimethoxydihydrocinnamic acid 0
                                                3-(1H-indol-3-yl)propanoic acid 2
                                                3-(2,3-dihydroxyphenyl)propanoic acid 0
                                                3-(2-hydroxyphenyl)propanoic acid 0
                                                3-(3,4-dimethoxyphenyl)propanoic acid 0
                                                3-(3-hydroxyphenyl)propanoic acid + 0
                                                3-(3-sulfooxyphenyl)propanoic acid 0
                                                3-(methylthio)propionic acid + 0
                                                3-(trimethylsilyl)propionic acid 0
                                                3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoic acid 0
                                                3-[(5E)-5-\{[5-(4-chlorophenyl)furan-2-yl]methylidene\}-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]propanoic acid 0
                                                3-[2-(trifluoromethyl)phenyl]propanoic acid + 0
                                                3-\{(2Z)-2-\{[3-(2-carboxyethyl)-5-\{(Z)-[(3E,4S)-3-ethylidene-4-methyl-5-oxopyrrolidin-2-ylidene]methyl\}-4-methyl-1H-pyrrol-2-yl]methylene\}-4-methyl-5-[(Z)-(3-methyl-5-oxo-4-vinyl-1,5-dihydro-2H-pyrrol-2-ylidene)methyl]-2H-pyrrol-3-yl\}propanoic acid 0
                                                3-amino-3-(4-hydroxyphenyl)propanoic acid 0
                                                3-aminoalanine + 0
                                                3-guanidinopropanoic acid 1
                                                3-hydroxyisobutyric acid + 0
                                                3-hydroxyphenyl propanoate 0
                                                3-hydroxypropionic acid + 1
                                                3-mercapto-2-mercaptomethylpropanoic acid 0
                                                3-nitropropanoic acid 41
                                                3-oxopropanoic acid + 0
                                                3-phenylpropionic acid + 6
                                                3-sulfopropanoic acid 0
                                                Isopropyl propionate 0
                                                L-mimosine 19
                                                N(3)-oxalyl-L-2,3-diaminopropionic acid 0
                                                N-(2-hydroxyethyl)iminodiacetic acid 0
                                                N-carbamoyl-beta-alanine 0
                                                N-propanoyl-L-methionine 0
                                                O-propanoylcarnitine + 0
                                                alanine + 101
                                                benoxaprofen 12
                                                beta-alanopine + 0
                                                bezafibrate 218
                                                clobetasol propionate 0
                                                dihydroferulic acid + 0
                                                dihydrourocanic acid 0
                                                egonolpropanoate 0
                                                flunoxaprofen 0
                                                flurbiprofen + 109
                                                glyceric acid + 6
                                                ibuprofen + 290
                                                indoprofen 3
                                                ketoprofen 27
                                                loxoprofen + 3
                                                mercaptopropanoic acid + 13
                                                meta-hydroxyphenylhydracrylic acid 0
                                                miroprofen 0
                                                oxaprozin 3
                                                phloretic acid 1
                                                propanoate ester + 206
                                                propanoyl phosphate 0
                                                propanoyl-AMP 0
                                                propanoyl-AMP(1-) 0
                                                propanoyl-CoAs + 0
                                                propionamide + 1
                                                propionyl group + 0
                                                propionyl-CoA + 9
                                                propionylglycine 0
                                                pyruvic acid + 47
                                                tropic acid + 190
                                                tyrosine + 374
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.