Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:asiatic acid
go back to main search page
Accession:CHEBI:2873 term browser browse the term
Definition:A pentacyclic triterpenoid that is ursane substituted by a carboxy group at position 28 and hydroxy groups at positions 2, 3 and 23 (the 2alpha,3beta stereoisomer). It is isolated from Symplocos lancifolia and Vateria indica and exhibits anti-angiogenic activity.
Synonyms:exact_synonym: (2alpha,3beta)-2,3,23-trihydroxyurs-12-en-28-oic acid
 related_synonym: Formula=C30H48O5;   InChI=1S/C30H48O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,17-18,20-24,31-33H,8-16H2,1-6H3,(H,34,35)/t17-,18+,20-,21-,22-,23+,24+,26+,27+,28-,29-,30+/m1/s1;   InChIKey=JXSVIVRDWWRQRT-UYDOISQJSA-N;   SMILES=[H][C@@]12CC[C@]3(C)[C@]([H])(CC=C4[C@]5([H])[C@@H](C)[C@H](C)CC[C@@]5(CC[C@@]34C)C(O)=O)[C@@]1(C)C[C@@H](O)[C@H](O)[C@@]2(C)CO
 alt_id: CHEBI:68382
 xref: CAS:464-92-6;   KEGG:C08617;   KNApSAcK:C00003739
 xref_mesh: MESH:C017032
 xref: PDBeChem:0AS;   PMID:21265555;   PMID:21288041;   PMID:21561086;   PMID:23102509;   Patent:JP2012092110;   Patent:TW200938215;   Reaxys:2712715



show annotations for term's descendants           Sort by:
 
asiatic acid term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Bax BCL2 associated X, apoptosis regulator multiple interactions EXP
ISO
asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in decreased expression of BAX protein]
[Carnosine co-treated with asiatic acid] inhibits the reaction [Glucose results in increased expression of BAX mRNA]; asiatic acid inhibits the reaction [Glucose results in increased expression of BAX mRNA]
CTD PMID:29108773 PMID:30802477 NCBI chr 1:95,940,001...95,945,407
Ensembl chr 1:95,938,808...95,945,368
JBrowse link
G Bcl2 BCL2, apoptosis regulator multiple interactions EXP
ISO
asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in increased expression of BCL2 protein]
asiatic acid inhibits the reaction [Glucose results in decreased expression of BCL2 mRNA]; asiatic acid promotes the reaction [Carnosine inhibits the reaction [Glucose results in decreased expression of BCL2 mRNA]]; Carnosine promotes the reaction [asiatic acid inhibits the reaction [Glucose results in decreased expression of BCL2 mRNA]]
CTD PMID:29108773 PMID:30802477 NCBI chr13:22,689,783...22,853,920 JBrowse link
G Casp3 caspase 3 multiple interactions EXP
ISO
asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in decreased expression of CASP3 protein]
[Carnosine co-treated with asiatic acid] inhibits the reaction [Glucose results in increased activity of CASP3 protein]; asiatic acid inhibits the reaction [Glucose results in increased activity of CASP3 protein]
CTD PMID:29108773 PMID:30802477 NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648
JBrowse link
G Casp9 caspase 9 multiple interactions EXP asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in decreased expression of CASP9 protein] CTD PMID:29108773 NCBI chr 5:154,108,872...154,126,628
Ensembl chr 5:154,109,046...154,126,626
JBrowse link
G Ccnd1 cyclin D1 multiple interactions EXP asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in increased expression of CCND1 protein] CTD PMID:29108773 NCBI chr 1:200,089,002...200,098,524
Ensembl chr 1:200,089,002...200,098,602
JBrowse link
G Cyp2e1 cytochrome P450, family 2, subfamily e, polypeptide 1 multiple interactions EXP asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in increased activity of CYP2E1 protein] CTD PMID:29108773 NCBI chr 1:195,840,330...195,850,728
Ensembl chr 1:195,840,058...195,864,023
JBrowse link
G Il1b interleukin 1 beta multiple interactions ISO asiatic acid inhibits the reaction [Streptozocin results in increased expression of IL1B protein]; asiatic acid promotes the reaction [Carnosine inhibits the reaction [Streptozocin results in increased expression of IL1B protein]]
[Carnosine co-treated with asiatic acid] inhibits the reaction [Glucose results in increased secretion of IL1B protein]; asiatic acid inhibits the reaction [Glucose results in increased secretion of IL1B protein]
CTD PMID:30802477 NCBI chr 3:116,577,005...116,583,386
Ensembl chr 3:116,577,010...116,583,415
JBrowse link
G Il6 interleukin 6 multiple interactions ISO asiatic acid inhibits the reaction [Streptozocin results in increased expression of IL6 protein]; asiatic acid promotes the reaction [Carnosine inhibits the reaction [Streptozocin results in increased expression of IL6 protein]]; Carnosine promotes the reaction [asiatic acid inhibits the reaction [Streptozocin results in increased expression of IL6 protein]]
[Carnosine co-treated with asiatic acid] inhibits the reaction [Glucose results in increased secretion of IL6 protein]; asiatic acid inhibits the reaction [Glucose results in increased secretion of IL6 protein]
CTD PMID:30802477 NCBI chr 4:5,214,602...5,219,178
Ensembl chr 4:5,213,394...5,219,178
JBrowse link
G Mapk8 mitogen-activated protein kinase 8 multiple interactions ISO [Carnosine co-treated with asiatic acid] inhibits the reaction [Streptozocin results in increased phosphorylation of MAPK8 protein]; asiatic acid inhibits the reaction [Streptozocin results in increased phosphorylation of MAPK8 protein] CTD PMID:30802477 NCBI chr16:8,638,897...8,721,960
Ensembl chr16:8,638,924...8,721,981
JBrowse link
G Nqo1 NAD(P)H quinone dehydrogenase 1 multiple interactions EXP asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in decreased activity of NQO1 protein] CTD PMID:29108773 NCBI chr19:35,295,633...35,310,528
Ensembl chr19:35,295,573...35,310,557
JBrowse link
G Pcna proliferating cell nuclear antigen multiple interactions EXP asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in increased expression of PCNA protein] CTD PMID:29108773 NCBI chr 3:119,499,039...119,502,911
Ensembl chr 3:119,498,810...119,502,995
JBrowse link
G Por cytochrome p450 oxidoreductase multiple interactions EXP asiatic acid inhibits the reaction [1,2-Dimethylhydrazine results in increased activity of POR protein] CTD PMID:29108773 NCBI chr12:20,951,058...20,999,198
Ensembl chr12:20,951,058...20,999,245
JBrowse link
G Ppargc1a PPARG coactivator 1 alpha multiple interactions ISO [Glutamic Acid co-treated with asiatic acid] results in increased expression of PPARGC1A protein CTD PMID:22447225 NCBI chr14:58,860,752...59,516,525
Ensembl chr14:58,861,144...59,512,656
JBrowse link
G Ptgs2 prostaglandin-endoperoxide synthase 2 multiple interactions ISO asiatic acid inhibits the reaction [Streptozocin results in increased activity of PTGS2 protein]; asiatic acid promotes the reaction [Carnosine inhibits the reaction [Streptozocin results in increased activity of PTGS2 protein]]; Carnosine promotes the reaction [asiatic acid inhibits the reaction [Streptozocin results in increased activity of PTGS2 protein]] CTD PMID:30802477 NCBI chr13:62,164,080...62,169,770
Ensembl chr13:62,163,932...62,172,188
JBrowse link
G Rela RELA proto-oncogene, NF-kB subunit multiple interactions ISO asiatic acid inhibits the reaction [Streptozocin results in increased expression of RELA protein]; Carnosine promotes the reaction [asiatic acid inhibits the reaction [Streptozocin results in increased expression of RELA protein]] CTD PMID:30802477 NCBI chr 1:202,925,001...202,935,484
Ensembl chr 1:202,924,945...202,935,484
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO asiatic acid inhibits the reaction [Glucose results in increased secretion of TNF protein]; asiatic acid promotes the reaction [Carnosine inhibits the reaction [Glucose results in increased secretion of TNF protein]]; Carnosine promotes the reaction [asiatic acid inhibits the reaction [Glucose results in increased secretion of TNF protein]]
asiatic acid inhibits the reaction [Streptozocin results in increased expression of TNF protein]; asiatic acid promotes the reaction [Carnosine inhibits the reaction [Streptozocin results in increased expression of TNF protein]]; Carnosine promotes the reaction [asiatic acid inhibits the reaction [Streptozocin results in increased expression of TNF protein]]
CTD PMID:30802477 NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629
JBrowse link
G Vdac1 voltage-dependent anion channel 1 multiple interactions ISO asiatic acid inhibits the reaction [Hydrogen Peroxide results in increased expression of VDAC1 mRNA]; asiatic acid inhibits the reaction [Rotenone results in increased expression of VDAC1 mRNA]; asiatic acid inhibits the reaction [Rotenone results in increased expression of VDAC1 protein] CTD PMID:18802751 NCBI chr10:36,532,306...36,559,642
Ensembl chr10:36,532,244...36,559,640
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19823
    role 19773
      biological role 19773
        biochemical role 19390
          metabolite 19367
            asiatic acid 17
              11alpha-hydroxyasiatic acid 0
              19alpha-hydroxyasiatic acid + 0
              2alpha,3beta,23alpha-trihydroxyurs-12-en-28-oic acid 28-O-beta-D-glucopyranoside 0
              3-O-[beta-D-glucopyranosyl]-28-O-[alpha-L-rhamnopyranosyl-(1->2)-beta-D-glucopyranosyl]asiatic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19823
    subatomic particle 19821
      composite particle 19821
        hadron 19821
          baryon 19821
            nucleon 19821
              atomic nucleus 19821
                atom 19821
                  main group element atom 19720
                    p-block element atom 19720
                      carbon group element atom 19643
                        carbon atom 19633
                          organic molecular entity 19633
                            organic group 18739
                              organic divalent group 18730
                                organodiyl group 18730
                                  carbonyl group 18678
                                    carbonyl compound 18678
                                      carboxylic acid 18376
                                        monocarboxylic acid 17639
                                          asiatic acid 17
                                            11alpha-hydroxyasiatic acid 0
                                            19alpha-hydroxyasiatic acid + 0
                                            2alpha,3beta,23alpha-trihydroxyurs-12-en-28-oic acid 28-O-beta-D-glucopyranoside 0
                                            3-O-[beta-D-glucopyranosyl]-28-O-[alpha-L-rhamnopyranosyl-(1->2)-beta-D-glucopyranosyl]asiatic acid 0
paths to the root