Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:folic acid
go back to main search page
Accession:CHEBI:27470 term browser browse the term
Definition:An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
Synonyms:related_synonym: Folate;   Folsaeure;   Formula=C19H19N7O6;   InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1;   InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N;   N-(4-{[(2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid;   N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid;   N-pteroyl-L-glutamic acid;   PGA;   PteGlu;   Pteroylglutamic acid;   SMILES=Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1;   pteroyl-L-glutamic acid;   pteroyl-L-monoglutamic acid;   vitamin Bc;   vitamin M
 alt_id: CHEBI:24075;   CHEBI:42610;   CHEBI:5140;   CHEBI:569217
 xref: Beilstein:100781 "Beilstein";   CAS:59-30-3 "ChemIDplus";   CAS:59-30-3 "KEGG COMPOUND";   CAS:59-30-3 "NIST Chemistry WebBook";   DrugBank:DB00158;   Drug_Central:1231 "DrugCentral";   KEGG:C00504;   KEGG:D00070;   KNApSAcK:C00001539;   LINCS:LSM-5355
 xref_mesh: MESH:D005492
 xref: MetaCyc:CPD-12826;   PDBeChem:FOL;   PMID:11261364 "Europe PMC";   PMID:11451208 "Europe PMC";   PMID:14387833 "Europe PMC";   PMID:15754725 "Europe PMC";   PMID:17784727 "Europe PMC";   PMID:18788725 "ChEMBL";   PMID:19355913 "Europe PMC";   PMID:24650098 "Europe PMC";   PMID:9040515 "Europe PMC";   Reaxys:100781 "Reaxys";   Wikipedia:Folic_Acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:62501


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19654
    role 19598
      biological role 19596
        physiological role 19588
          food component 19588
            nutrient 19584
              folic acid 3670
                4-aminofolic acid 0
                vitamin B complex 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19654
    subatomic particle 19650
      composite particle 19650
        hadron 19650
          baryon 19650
            nucleon 19650
              atomic nucleus 19650
                atom 19650
                  main group element atom 19531
                    p-block element atom 19531
                      carbon group element atom 19413
                        carbon atom 19405
                          organic molecular entity 19405
                            organic group 18331
                              organic divalent group 18321
                                organodiyl group 18321
                                  carbonyl group 18209
                                    carbonyl compound 18209
                                      carboxylic acid 17908
                                        amino acid 12306
                                          alpha-amino acid 7423
                                            L-alpha-amino acid 7080
                                              glutamine family amino acid 5340
                                                L-glutamic acid 5242
                                                  L-glutamic acid derivative 3705
                                                    folic acids 3701
                                                      folic acid 3670
                                                        4-aminofolic acid 0
                                                        vitamin B complex 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.