Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:folic acid
go back to main search page
Accession:CHEBI:27470 term browser browse the term
Definition:An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
Synonyms:related_synonym: Folate;   Folsaeure;   Formula=C19H19N7O6;   InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1;   InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N;   N-(4-{[(2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid;   N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid;   N-pteroyl-L-glutamic acid;   PGA;   PteGlu;   Pteroylglutamic acid;   SMILES=Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1;   pteroyl-L-glutamic acid;   pteroyl-L-monoglutamic acid;   vitamin Bc;   vitamin M
 alt_id: CHEBI:24075;   CHEBI:42610;   CHEBI:5140;   CHEBI:569217
 xref: Beilstein:100781 "Beilstein";   CAS:59-30-3 "ChemIDplus";   CAS:59-30-3 "KEGG COMPOUND";   CAS:59-30-3 "NIST Chemistry WebBook";   DrugBank:DB00158;   Drug_Central:1231 "DrugCentral";   KEGG:C00504;   KEGG:D00070;   KNApSAcK:C00001539;   LINCS:LSM-5355
 xref_mesh: MESH:D005492
 xref: MetaCyc:CPD-12826;   PDBeChem:FOL;   PMID:11261364 "Europe PMC";   PMID:11451208 "Europe PMC";   PMID:14387833 "Europe PMC";   PMID:15754725 "Europe PMC";   PMID:17784727 "Europe PMC";   PMID:18788725 "ChEMBL";   PMID:19355913 "Europe PMC";   PMID:24650098 "Europe PMC";   PMID:9040515 "Europe PMC";   Reaxys:100781 "Reaxys";   Wikipedia:Folic_Acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:62501


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19716
    role 19663
      biological role 19661
        physiological role 19653
          food component 19653
            nutrient 19649
              folic acid 3679
                4-aminofolic acid 0
                vitamin B complex 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19716
    subatomic particle 19712
      composite particle 19712
        hadron 19712
          baryon 19712
            nucleon 19712
              atomic nucleus 19712
                atom 19712
                  main group element atom 19598
                    p-block element atom 19598
                      carbon group element atom 19486
                        carbon atom 19480
                          organic molecular entity 19480
                            organic group 18407
                              organic divalent group 18397
                                organodiyl group 18397
                                  carbonyl group 18285
                                    carbonyl compound 18285
                                      carboxylic acid 17940
                                        amino acid 12442
                                          alpha-amino acid 7648
                                            L-alpha-amino acid 7312
                                              glutamine family amino acid 5349
                                                L-glutamic acid 5251
                                                  L-glutamic acid derivative 3714
                                                    folic acids 3710
                                                      folic acid 3679
                                                        4-aminofolic acid 0
                                                        vitamin B complex 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.