Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:AM6545
go back to main search page
Accession:CHEBI:231613 term browser browse the term
Definition:AM6545 is a CB1 antagonist
Synonyms:related_synonym: 5-[4-(4-Cyanobut-1-yn-1-yl)phenyl]-1-(2,4-dichlorophenyl)-N-(1,1-dioxo-1lambda~6~,4-thiazinan-4-yl)-4-methyl-1H-pyrazole-3-carboxamide;   AM 6545;   Formula=C26H23Cl2N5O3S;   InChI=1S/C26H23Cl2N5O3S/c1-18-24(26(34)31-32-13-15-37(35,36)16-14-32)30-33(23-11-10-21(27)17-22(23)28)25(18)20-8-6-19(7-9-20)5-3-2-4-12-29/h6-11,17H,2,4,13-16H2,1H3,(H,31,34);   InChIKey=XBHQLFVDGLPBCK-UHFFFAOYSA-N;   SMILES=CC1=C(N(N=C1C(=O)NN2CCS(=O)(=O)CC2)C3=C(C=C(C=C3)Cl)Cl)C4=CC=C(C=C4)C#CCCC#N
 xref: CAS:1245626-05-4
 xref_mesh: MESH:C551825



show annotations for term's descendants           Sort by:
AM6545 term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Agtr1a angiotensin II receptor, type 1a multiple interactions ISO [Perindopril co-treated with AM6545] inhibits the reaction [Streptozocin results in increased expression of AGTR1A protein]; AM6545 inhibits the reaction [Streptozocin results in increased expression of AGTR1A mRNA]; AM6545 inhibits the reaction [Streptozocin results in increased expression of AGTR1A protein] CTD PMID:30184259 NCBI chr17:34,173,446...34,226,892
Ensembl chr17:34,174,429...34,226,946
JBrowse link
G Alb albumin multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in increased expression of ALB protein] CTD PMID:30184259 NCBI chr14:17,607,397...17,622,814
Ensembl chr14:17,607,381...17,622,836
JBrowse link
G Arg1 arginase 1 multiple interactions ISO AM6545 inhibits the reaction [(3R)-((2,3-dihydro-5-methyl-3-((4-morpholinyl)methyl)pyrrolo-(1,2,3-de)-1,4-benzoxazin-6-yl)(1-naphthalenyl))methanone affects the expression of ARG1 mRNA]; AM6545 inhibits the reaction [Streptozocin results in decreased expression of ARG1 mRNA]; Perindopril inhibits the reaction [AM6545 inhibits the reaction [Streptozocin results in decreased expression of ARG1 mRNA]] CTD PMID:30184259 NCBI chr 1:20,475,878...20,488,422
Ensembl chr 1:20,475,968...20,488,422
JBrowse link
G Ccl2 C-C motif chemokine ligand 2 multiple interactions ISO [AM6545 co-treated with Perindopril] inhibits the reaction [Streptozocin results in increased expression of CCL2 mRNA]; [AM6545 co-treated with Perindopril] inhibits the reaction [Streptozocin results in increased expression of CCL2 protein] CTD PMID:30184259 NCBI chr10:67,005,424...67,007,222
Ensembl chr10:67,005,424...67,007,226
JBrowse link
G Ccl3 C-C motif chemokine ligand 3 multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in increased expression of CCL3 mRNA]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in increased expression of CCL3 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in increased expression of CCL3 mRNA]] CTD PMID:30184259 NCBI chr10:68,451,388...68,452,938
Ensembl chr10:68,451,388...68,452,938
JBrowse link
G Ccr2 C-C motif chemokine receptor 2 multiple interactions ISO [AM6545 co-treated with Perindopril] inhibits the reaction [Streptozocin results in increased expression of CCR2 mRNA]; AM6545 inhibits the reaction [Streptozocin results in increased expression of CCR2 mRNA] CTD PMID:30184259 NCBI chr 8:123,734,465...123,742,483
Ensembl chr 8:123,734,430...123,742,100
JBrowse link
G Cd163 CD163 molecule multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in decreased expression of CD163 mRNA]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in decreased expression of CD163 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in decreased expression of CD163 mRNA]] CTD PMID:30184259 NCBI chr 4:157,085,080...157,118,470
Ensembl chr 4:157,085,093...157,117,878
JBrowse link
G Cd68 Cd68 molecule multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in increased expression of CD68 mRNA]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in increased expression of CD68 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in increased expression of CD68 mRNA]] CTD PMID:30184259 NCBI chr10:54,381,814...54,383,693
Ensembl chr10:54,381,815...54,383,697
JBrowse link
G Fn1 fibronectin 1 multiple interactions ISO [AM6545 co-treated with Perindopril] inhibits the reaction [Streptozocin results in increased expression of FN1 mRNA]; AM6545 inhibits the reaction [Streptozocin results in increased expression of FN1 mRNA]; AM6545 inhibits the reaction [Streptozocin results in increased expression of FN1 protein] CTD PMID:30184259 NCBI chr 9:73,196,044...73,264,695
Ensembl chr 9:73,196,044...73,264,678
JBrowse link
G Icam1 intercellular adhesion molecule 1 multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in increased expression of ICAM1 mRNA]; AM6545 inhibits the reaction [Streptozocin results in increased expression of ICAM1 protein]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in increased expression of ICAM1 mRNA]]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in increased expression of ICAM1 protein]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in increased expression of ICAM1 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in increased expression of ICAM1 protein]] CTD PMID:30184259 NCBI chr 8:19,553,063...19,565,438
Ensembl chr 8:19,553,645...19,565,438
JBrowse link
G Mrc1 mannose receptor, C type 1 multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in decreased expression of MRC1 mRNA]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in decreased expression of MRC1 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in decreased expression of MRC1 mRNA]] CTD PMID:30184259 NCBI chr17:77,249,187...77,330,857
Ensembl chr17:77,249,187...77,330,857
JBrowse link
G Nos2 nitric oxide synthase 2 multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in increased expression of NOS2 mRNA]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in increased expression of NOS2 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in increased expression of NOS2 mRNA]] CTD PMID:30184259 NCBI chr10:63,815,308...63,851,208
Ensembl chr10:63,815,308...63,851,210
JBrowse link
G Nphs1 NPHS1 adhesion molecule, nephrin multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS1 mRNA]; AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS1 protein]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in decreased expression of NPHS1 mRNA]]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in decreased expression of NPHS1 protein]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS1 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS1 protein]] CTD PMID:30184259 NCBI chr 1:85,720,812...85,749,079
Ensembl chr 1:85,720,812...85,749,078
JBrowse link
G Nphs2 NPHS2 stomatin family member, podocin multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS2 mRNA]; AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS2 protein]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in decreased expression of NPHS2 mRNA]]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in decreased expression of NPHS2 protein]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS2 mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in decreased expression of NPHS2 protein]] CTD PMID:30184259 NCBI chr13:68,448,720...68,461,312
Ensembl chr13:68,448,926...68,461,313
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO AM6545 inhibits the reaction [Streptozocin results in increased expression of TNF mRNA]; AM6545 inhibits the reaction [Streptozocin results in increased expression of TNF protein]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in increased expression of TNF mRNA]]; AM6545 promotes the reaction [Perindopril inhibits the reaction [Streptozocin results in increased expression of TNF protein]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in increased expression of TNF mRNA]]; Perindopril promotes the reaction [AM6545 inhibits the reaction [Streptozocin results in increased expression of TNF protein]] CTD PMID:30184259 NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19922
    chemical entity 19920
      atom 19892
        nonmetal atom 19849
          carbon atom 19802
            organic molecular entity 19775
              AM6545 15
Path 2
Term Annotations click to browse term
  CHEBI ontology 19922
    subatomic particle 19892
      composite particle 19892
        hadron 19920
          baryon 19892
            nucleon 19920
              atomic nucleus 19892
                atom 19892
                  main group element atom 19866
                    p-block element atom 19866
                      carbon group element atom 19805
                        carbon atom 19802
                          organic molecular entity 19775
                            AM6545 15
paths to the root