Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:acrylic acid
go back to main search page
Accession:CHEBI:18308 term browser browse the term
Definition:A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group.
Synonyms:related_synonym: 2-Propenoic acid;   Acrylate;   Formula=C3H4O2;   InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5);   InChIKey=NIXOWILDQLNWCW-UHFFFAOYSA-N;   Propenoate;   Propenoic acid;   SMILES=OC(=O)C=C;   Vinylformic acid;   acroleic acid;   ethylenecarboxylic acid;   prop-2-enoic acid
 alt_id: CHEBI:19766;   CHEBI:19768;   CHEBI:35853;   CHEBI:40714;   CHEBI:8487
 xref: Beilstein:635743;   CAS:79-10-7;   DrugBank:DB02579;   Gmelin:1817;   HMDB:HMDB0031647;   KEGG:C00511;   LIPID_MAPS_instance:LMFA01030193
 xref_mesh: MESH:C036658
 xref: MetaCyc:MY148411;   MetaCyc:MY149879;   PDBeChem:AKR;   PMID:24650085;   PMID:24673501;   Reaxys:635743;   Wikipedia:Acrylic_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:37080

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19789
    role 19735
      biological role 19734
        biochemical role 19227
          metabolite 19202
            acrylic acid 3844
              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
              (2Z)-2,3-dihydroxyacrylic acid 0
              (E)-3-(indol-2-yl)acrylic acid 0
              (E)-3-(indol-3-yl)acrylic acid 0
              (Z)-3-aminoacrylic acid 0
              (Z)-3-aminoperacrylic acid 0
              1-Octen-3-one 0
              1-Penten-3-one 1
              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
              2-chloroacrylic acid 0
              2-ethylacrylic acid 0
              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
              2-hydroxyacrylic acid 0
              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
              3-Methyl-3-buten-2-one 0
              3-Octen-2-one 0
              3-[(1-carboxyvinyl)oxy]benzoic acid 0
              3-chloroacrylic acid + 0
              3-nitroacrylic acid 0
              4-Hexen-3-one 0
              4-Methyl-3-penten-2-one, 9CI 0
              6-Methyl-3,5-heptadien-2-one 0
              O-acryloyl-L-carnitine 0
              O-propenoylcarnitine + 0
              acrylamide 3792
              acryloyl group 0
              acryloyl-CoA 2
              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
              butyl acrylate 0
              caffeic acid quinone 0
              enol-phenylpyruvic acid 0
              methacrylic acid + 78
              phosphoenolpyruvic acid 0
              ureidoacrylic acid 0
              ureidoperacrylic acid 0
              valanimycin 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19789
    subatomic particle 19787
      composite particle 19787
        hadron 19787
          baryon 19787
            nucleon 19787
              atomic nucleus 19787
                atom 19787
                  main group element atom 19672
                    p-block element atom 19672
                      carbon group element atom 19569
                        carbon atom 19558
                          organic molecular entity 19558
                            organic group 18473
                              organic divalent group 18467
                                organodiyl group 18467
                                  carbonyl group 18366
                                    carbonyl compound 18366
                                      carboxylic acid 18038
                                        monocarboxylic acid 17290
                                          alpha,beta-unsaturated monocarboxylic acid 11376
                                            acrylic acid 3844
                                              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
                                              (2Z)-2,3-dihydroxyacrylic acid 0
                                              (E)-3-(indol-2-yl)acrylic acid 0
                                              (E)-3-(indol-3-yl)acrylic acid 0
                                              (Z)-3-aminoacrylic acid 0
                                              (Z)-3-aminoperacrylic acid 0
                                              1-Octen-3-one 0
                                              1-Penten-3-one 1
                                              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
                                              2-chloroacrylic acid 0
                                              2-ethylacrylic acid 0
                                              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
                                              2-hydroxyacrylic acid 0
                                              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
                                              3-Methyl-3-buten-2-one 0
                                              3-Octen-2-one 0
                                              3-[(1-carboxyvinyl)oxy]benzoic acid 0
                                              3-chloroacrylic acid + 0
                                              3-nitroacrylic acid 0
                                              4-Hexen-3-one 0
                                              4-Methyl-3-penten-2-one, 9CI 0
                                              6-Methyl-3,5-heptadien-2-one 0
                                              O-acryloyl-L-carnitine 0
                                              O-propenoylcarnitine + 0
                                              acrylamide 3792
                                              acryloyl group 0
                                              acryloyl-CoA 2
                                              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
                                              butyl acrylate 0
                                              caffeic acid quinone 0
                                              enol-phenylpyruvic acid 0
                                              methacrylic acid + 78
                                              phosphoenolpyruvic acid 0
                                              ureidoacrylic acid 0
                                              ureidoperacrylic acid 0
                                              valanimycin 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.