Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:acrylic acid
go back to main search page
Accession:CHEBI:18308 term browser browse the term
Definition:A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group.
Synonyms:related_synonym: 2-Propenoic acid;   Acrylate;   Formula=C3H4O2;   InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5);   InChIKey=NIXOWILDQLNWCW-UHFFFAOYSA-N;   Propenoate;   Propenoic acid;   SMILES=OC(=O)C=C;   Vinylformic acid;   acroleic acid;   ethylenecarboxylic acid;   prop-2-enoic acid
 alt_id: CHEBI:19766;   CHEBI:19768;   CHEBI:35853;   CHEBI:40714;   CHEBI:8487
 xref: Beilstein:635743;   CAS:79-10-7;   DrugBank:DB02579;   Gmelin:1817;   HMDB:HMDB0031647;   KEGG:C00511;   LIPID_MAPS_instance:LMFA01030193
 xref_mesh: MESH:C036658
 xref: MetaCyc:MY148411;   MetaCyc:MY149879;   PDBeChem:AKR;   PMID:24650085;   PMID:24673501;   Reaxys:635743;   Wikipedia:Acrylic_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:37080


show annotations for term's descendants       view all columns           Sort by:
 
acrylamide term browser
Symbol Object Name JBrowse Chr Start Stop Reference
G CALCB calcitonin-related polypeptide beta JBrowse link 2 44,043,135 44,048,651 RGD:6480464
G IL6 interleukin 6 JBrowse link 9 91,506,421 91,510,830 RGD:6480464
G LOC110258578 interleukin-1 beta-like RGD:6480464
G TAC1 tachykinin precursor 1 JBrowse link 9 77,197,403 77,206,529 RGD:6480464
G TNF tumor necrosis factor JBrowse link 7 23,699,635 23,702,393 RGD:6480464
G VIP vasoactive intestinal peptide JBrowse link 1 13,611,786 13,620,250 RGD:6480464

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 847
    role 824
      biological role 824
        biochemical role 697
          metabolite 681
            acrylic acid 6
              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
              (2Z)-2,3-dihydroxyacrylic acid 0
              (E)-3-(indol-2-yl)acrylic acid 0
              (E)-3-(indol-3-yl)acrylic acid 0
              (Z)-3-aminoacrylic acid 0
              (Z)-3-aminoperacrylic acid 0
              1-Octen-3-one 0
              1-Penten-3-one 0
              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
              2-chloroacrylic acid 0
              2-ethylacrylic acid 0
              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
              2-hydroxyacrylic acid 0
              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
              3-Methyl-3-buten-2-one 0
              3-Octen-2-one 0
              3-[(1-carboxyvinyl)oxy]benzoic acid 0
              3-chloroacrylic acid + 0
              3-nitroacrylic acid 0
              4-Hexen-3-one 0
              4-Methyl-3-penten-2-one, 9CI 0
              6-Methyl-3,5-heptadien-2-one 0
              O-acryloyl-L-carnitine 0
              O-propenoylcarnitine + 0
              acrylamide 6
              acryloyl group 0
              acryloyl-CoA 0
              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
              butyl acrylate 0
              caffeic acid quinone 0
              enol-phenylpyruvic acid 0
              methacrylic acid + 0
              phosphoenolpyruvic acid 0
              ureidoacrylic acid 0
              ureidoperacrylic acid 0
              valanimycin 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 847
    subatomic particle 831
      composite particle 831
        hadron 831
          baryon 831
            nucleon 831
              atomic nucleus 831
                atom 831
                  main group element atom 819
                    p-block element atom 816
                      carbon group element atom 787
                        carbon atom 783
                          organic molecular entity 783
                            organic group 361
                              organic divalent group 359
                                organodiyl group 359
                                  carbonyl group 358
                                    carbonyl compound 358
                                      carboxylic acid 242
                                        monocarboxylic acid 131
                                          alpha,beta-unsaturated monocarboxylic acid 15
                                            acrylic acid 6
                                              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
                                              (2Z)-2,3-dihydroxyacrylic acid 0
                                              (E)-3-(indol-2-yl)acrylic acid 0
                                              (E)-3-(indol-3-yl)acrylic acid 0
                                              (Z)-3-aminoacrylic acid 0
                                              (Z)-3-aminoperacrylic acid 0
                                              1-Octen-3-one 0
                                              1-Penten-3-one 0
                                              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
                                              2-chloroacrylic acid 0
                                              2-ethylacrylic acid 0
                                              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
                                              2-hydroxyacrylic acid 0
                                              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
                                              3-Methyl-3-buten-2-one 0
                                              3-Octen-2-one 0
                                              3-[(1-carboxyvinyl)oxy]benzoic acid 0
                                              3-chloroacrylic acid + 0
                                              3-nitroacrylic acid 0
                                              4-Hexen-3-one 0
                                              4-Methyl-3-penten-2-one, 9CI 0
                                              6-Methyl-3,5-heptadien-2-one 0
                                              O-acryloyl-L-carnitine 0
                                              O-propenoylcarnitine + 0
                                              acrylamide 6
                                              acryloyl group 0
                                              acryloyl-CoA 0
                                              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
                                              butyl acrylate 0
                                              caffeic acid quinone 0
                                              enol-phenylpyruvic acid 0
                                              methacrylic acid + 0
                                              phosphoenolpyruvic acid 0
                                              ureidoacrylic acid 0
                                              ureidoperacrylic acid 0
                                              valanimycin 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.