Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:acrylic acid
go back to main search page
Accession:CHEBI:18308 term browser browse the term
Definition:A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group.
Synonyms:related_synonym: 2-Propenoic acid;   Acrylate;   Formula=C3H4O2;   InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5);   InChIKey=NIXOWILDQLNWCW-UHFFFAOYSA-N;   Propenoate;   Propenoic acid;   SMILES=OC(=O)C=C;   Vinylformic acid;   acroleic acid;   ethylenecarboxylic acid;   prop-2-enoic acid
 alt_id: CHEBI:19766;   CHEBI:19768;   CHEBI:35853;   CHEBI:40714;   CHEBI:8487
 xref: Beilstein:635743;   CAS:79-10-7;   DrugBank:DB02579;   Gmelin:1817;   HMDB:HMDB0031647;   KEGG:C00511;   LIPID_MAPS_instance:LMFA01030193
 xref_mesh: MESH:C036658
 xref: MetaCyc:MY148411;   MetaCyc:MY149879;   PDBeChem:AKR;   PMID:24650085;   PMID:24673501;   Reaxys:635743;   Wikipedia:Acrylic_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:37080


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 21270
    role 21254
      biological role 21252
        biochemical role 20300
          metabolite 20239
            acrylic acid 3678
              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
              (2Z)-2,3-dihydroxyacrylic acid 0
              (E)-3-(indol-2-yl)acrylic acid 0
              (E)-3-(indol-3-yl)acrylic acid 0
              (Z)-3-aminoacrylic acid 0
              (Z)-3-aminoperacrylic acid 0
              1-Octen-3-one 0
              1-Penten-3-one 1
              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
              2-chloroacrylic acid 0
              2-ethylacrylic acid 0
              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
              2-hydroxyacrylic acid 0
              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
              3-Methyl-3-buten-2-one 0
              3-Octen-2-one 0
              3-[(1-carboxyvinyl)oxy]benzoic acid 0
              3-chloroacrylic acid + 0
              3-nitroacrylic acid 0
              4-Hexen-3-one 0
              4-Methyl-3-penten-2-one, 9CI 0
              6-Methyl-3,5-heptadien-2-one 0
              O-acryloyl-L-carnitine 0
              O-propenoylcarnitine + 0
              acrylamide 3620
              acryloyl group 0
              acryloyl-CoA 2
              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
              butyl acrylate 0
              caffeic acid quinone 0
              enol-phenylpyruvic acid 0
              methacrylic acid + 85
              phosphoenolpyruvic acid 0
              ureidoacrylic acid 0
              ureidoperacrylic acid 0
              valanimycin 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 21270
    subatomic particle 21266
      composite particle 21266
        hadron 21266
          baryon 21266
            nucleon 21266
              atomic nucleus 21266
                atom 21266
                  main group element atom 21135
                    p-block element atom 21135
                      carbon group element atom 20906
                        carbon atom 20796
                          organic molecular entity 20796
                            organic group 19191
                              organic divalent group 19181
                                organodiyl group 19181
                                  carbonyl group 19156
                                    carbonyl compound 19156
                                      carboxylic acid 18839
                                        monocarboxylic acid 18012
                                          alpha,beta-unsaturated monocarboxylic acid 11415
                                            acrylic acid 3678
                                              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
                                              (2Z)-2,3-dihydroxyacrylic acid 0
                                              (E)-3-(indol-2-yl)acrylic acid 0
                                              (E)-3-(indol-3-yl)acrylic acid 0
                                              (Z)-3-aminoacrylic acid 0
                                              (Z)-3-aminoperacrylic acid 0
                                              1-Octen-3-one 0
                                              1-Penten-3-one 1
                                              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
                                              2-chloroacrylic acid 0
                                              2-ethylacrylic acid 0
                                              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
                                              2-hydroxyacrylic acid 0
                                              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
                                              3-Methyl-3-buten-2-one 0
                                              3-Octen-2-one 0
                                              3-[(1-carboxyvinyl)oxy]benzoic acid 0
                                              3-chloroacrylic acid + 0
                                              3-nitroacrylic acid 0
                                              4-Hexen-3-one 0
                                              4-Methyl-3-penten-2-one, 9CI 0
                                              6-Methyl-3,5-heptadien-2-one 0
                                              O-acryloyl-L-carnitine 0
                                              O-propenoylcarnitine + 0
                                              acrylamide 3620
                                              acryloyl group 0
                                              acryloyl-CoA 2
                                              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
                                              butyl acrylate 0
                                              caffeic acid quinone 0
                                              enol-phenylpyruvic acid 0
                                              methacrylic acid + 85
                                              phosphoenolpyruvic acid 0
                                              ureidoacrylic acid 0
                                              ureidoperacrylic acid 0
                                              valanimycin 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.