Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:acrylic acid
go back to main search page
Accession:CHEBI:18308 term browser browse the term
Definition:A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group.
Synonyms:related_synonym: 2-Propenoic acid;   Acrylate;   Formula=C3H4O2;   InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5);   InChIKey=NIXOWILDQLNWCW-UHFFFAOYSA-N;   Propenoate;   Propenoic acid;   SMILES=OC(=O)C=C;   Vinylformic acid;   acroleic acid;   ethylenecarboxylic acid;   prop-2-enoic acid
 alt_id: CHEBI:19766;   CHEBI:19768;   CHEBI:35853;   CHEBI:40714;   CHEBI:8487
 xref: Beilstein:635743;   CAS:79-10-7;   DrugBank:DB02579;   Gmelin:1817;   HMDB:HMDB0031647;   KEGG:C00511;   LIPID_MAPS_instance:LMFA01030193
 xref_mesh: MESH:C036658
 xref: MetaCyc:MY148411;   MetaCyc:MY149879;   PDBeChem:AKR;   PMID:24650085;   PMID:24673501;   Reaxys:635743;   Wikipedia:Acrylic_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:37080


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 23949
    role 23837
      biological role 23800
        biochemical role 23132
          metabolite 23028
            acrylic acid 3645
              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
              (2Z)-2,3-dihydroxyacrylic acid 0
              (E)-3-(indol-2-yl)acrylic acid 0
              (E)-3-(indol-3-yl)acrylic acid 0
              (Z)-3-aminoacrylic acid 0
              (Z)-3-aminoperacrylic acid 0
              1-Octen-3-one 0
              1-Penten-3-one 1
              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
              2-chloroacrylic acid 0
              2-ethylacrylic acid 0
              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
              2-hydroxyacrylic acid 0
              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
              3-Methyl-3-buten-2-one 0
              3-Octen-2-one 0
              3-[(1-carboxyvinyl)oxy]benzoic acid 0
              3-chloroacrylic acid + 0
              3-nitroacrylic acid 0
              4-Hexen-3-one 0
              4-Methyl-3-penten-2-one, 9CI 0
              6-Methyl-3,5-heptadien-2-one 0
              O-acryloyl-L-carnitine 0
              O-propenoylcarnitine + 0
              acrylamide 3589
              acryloyl group 0
              acryloyl-CoA 2
              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
              butyl acrylate 0
              caffeic acid quinone 0
              enol-phenylpyruvic acid 0
              methacrylic acid + 84
              phosphoenolpyruvic acid 0
              ureidoacrylic acid 0
              ureidoperacrylic acid 0
              valanimycin 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 23949
    subatomic particle 23900
      composite particle 23900
        hadron 23900
          baryon 23900
            nucleon 23900
              atomic nucleus 23900
                atom 23900
                  main group element atom 23720
                    p-block element atom 23720
                      carbon group element atom 23436
                        carbon atom 23391
                          organic molecular entity 23391
                            organic group 22055
                              organic divalent group 22029
                                organodiyl group 22029
                                  carbonyl group 22004
                                    carbonyl compound 22004
                                      carboxylic acid 21056
                                        monocarboxylic acid 19836
                                          alpha,beta-unsaturated monocarboxylic acid 11679
                                            acrylic acid 3645
                                              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
                                              (2Z)-2,3-dihydroxyacrylic acid 0
                                              (E)-3-(indol-2-yl)acrylic acid 0
                                              (E)-3-(indol-3-yl)acrylic acid 0
                                              (Z)-3-aminoacrylic acid 0
                                              (Z)-3-aminoperacrylic acid 0
                                              1-Octen-3-one 0
                                              1-Penten-3-one 1
                                              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
                                              2-chloroacrylic acid 0
                                              2-ethylacrylic acid 0
                                              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
                                              2-hydroxyacrylic acid 0
                                              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
                                              3-Methyl-3-buten-2-one 0
                                              3-Octen-2-one 0
                                              3-[(1-carboxyvinyl)oxy]benzoic acid 0
                                              3-chloroacrylic acid + 0
                                              3-nitroacrylic acid 0
                                              4-Hexen-3-one 0
                                              4-Methyl-3-penten-2-one, 9CI 0
                                              6-Methyl-3,5-heptadien-2-one 0
                                              O-acryloyl-L-carnitine 0
                                              O-propenoylcarnitine + 0
                                              acrylamide 3589
                                              acryloyl group 0
                                              acryloyl-CoA 2
                                              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
                                              butyl acrylate 0
                                              caffeic acid quinone 0
                                              enol-phenylpyruvic acid 0
                                              methacrylic acid + 84
                                              phosphoenolpyruvic acid 0
                                              ureidoacrylic acid 0
                                              ureidoperacrylic acid 0
                                              valanimycin 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.