Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:acrylic acid
go back to main search page
Accession:CHEBI:18308 term browser browse the term
Definition:A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group.
Synonyms:related_synonym: 2-Propenoic acid;   Acrylate;   Formula=C3H4O2;   InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5);   InChIKey=NIXOWILDQLNWCW-UHFFFAOYSA-N;   Propenoate;   Propenoic acid;   SMILES=OC(=O)C=C;   Vinylformic acid;   acroleic acid;   ethylenecarboxylic acid;   prop-2-enoic acid
 alt_id: CHEBI:19766;   CHEBI:19768;   CHEBI:35853;   CHEBI:40714;   CHEBI:8487
 xref: Beilstein:635743 "Beilstein";   CAS:79-10-7 "ChemIDplus";   CAS:79-10-7 "KEGG COMPOUND";   CAS:79-10-7 "NIST Chemistry WebBook";   DrugBank:DB02579;   Gmelin:1817 "Gmelin";   HMDB:HMDB0031647;   KEGG:C00511;   LIPID_MAPS_instance:LMFA01030193 "LIPID MAPS"
 xref_mesh: MESH:C036658
 xref: MetaCyc:MY148411;   MetaCyc:MY149879;   PDBeChem:AKR;   PMID:24650085 "Europe PMC";   PMID:24673501 "Europe PMC";   Reaxys:635743 "Reaxys";   Wikipedia:Acrylic_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:37080

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19669
    role 19613
      biological role 19611
        biochemical role 19138
          metabolite 19106
            acrylic acid 3815
              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
              (2Z)-2,3-dihydroxyacrylic acid 0
              (E)-3-(indol-2-yl)acrylic acid 0
              (E)-3-(indol-3-yl)acrylic acid 0
              (Z)-3-aminoacrylic acid 0
              (Z)-3-aminoperacrylic acid 0
              1-Octen-3-one 0
              1-Penten-3-one 1
              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
              2-chloroacrylic acid 0
              2-ethylacrylic acid 0
              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
              2-hydroxyacrylic acid 0
              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
              3-Methyl-3-buten-2-one 0
              3-Octen-2-one 0
              3-[(1-carboxyvinyl)oxy]benzoic acid 0
              3-chloroacrylic acid + 0
              3-nitroacrylic acid 0
              4-Hexen-3-one 0
              4-Methyl-3-penten-2-one, 9CI 0
              6-Methyl-3,5-heptadien-2-one 0
              O-acryloyl-L-carnitine 0
              O-propenoylcarnitine + 0
              acrylamide 3780
              acryloyl group 0
              acryloyl-CoA 2
              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
              butyl acrylate 0
              caffeic acid quinone 0
              enol-phenylpyruvic acid 0
              methacrylic acid + 57
              phosphoenolpyruvic acid 0
              ureidoacrylic acid 0
              ureidoperacrylic acid 0
              valanimycin 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19669
    subatomic particle 19665
      composite particle 19665
        hadron 19665
          baryon 19665
            nucleon 19665
              atomic nucleus 19665
                atom 19665
                  main group element atom 19545
                    p-block element atom 19545
                      carbon group element atom 19428
                        carbon atom 19420
                          organic molecular entity 19420
                            organic group 18343
                              organic divalent group 18334
                                organodiyl group 18334
                                  carbonyl group 18222
                                    carbonyl compound 18222
                                      carboxylic acid 17923
                                        monocarboxylic acid 17256
                                          alpha,beta-unsaturated monocarboxylic acid 11261
                                            acrylic acid 3815
                                              (2E)-3-[(2S,3aR,7aS)-4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3,3a,7a-tetrahydro-1-benzofuran-2-yl]prop-2-enoic acid 0
                                              (2Z)-2,3-dihydroxyacrylic acid 0
                                              (E)-3-(indol-2-yl)acrylic acid 0
                                              (E)-3-(indol-3-yl)acrylic acid 0
                                              (Z)-3-aminoacrylic acid 0
                                              (Z)-3-aminoperacrylic acid 0
                                              1-Octen-3-one 0
                                              1-Penten-3-one 1
                                              2-(4-chlorophenyl)-3,3-dichloropropenoic acid 0
                                              2-chloroacrylic acid 0
                                              2-ethylacrylic acid 0
                                              2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 0
                                              2-hydroxyacrylic acid 0
                                              3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid 0
                                              3-Methyl-3-buten-2-one 0
                                              3-Octen-2-one 0
                                              3-[(1-carboxyvinyl)oxy]benzoic acid 0
                                              3-chloroacrylic acid + 0
                                              3-nitroacrylic acid 0
                                              4-Hexen-3-one 0
                                              4-Methyl-3-penten-2-one, 9CI 0
                                              6-Methyl-3,5-heptadien-2-one 0
                                              O-acryloyl-L-carnitine 0
                                              O-propenoylcarnitine + 0
                                              acrylamide 3780
                                              acryloyl group 0
                                              acryloyl-CoA 2
                                              alpha-(4-methoxyphenyl)-6-methyl-2-pyridineacrylic acid 0
                                              butyl acrylate 0
                                              caffeic acid quinone 0
                                              enol-phenylpyruvic acid 0
                                              methacrylic acid + 57
                                              phosphoenolpyruvic acid 0
                                              ureidoacrylic acid 0
                                              ureidoperacrylic acid 0
                                              valanimycin 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.