Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:valeric acid
go back to main search page
Accession:CHEBI:17418 term browser browse the term
Definition:A straight-chain saturated fatty acid containing five carbon atoms.
Synonyms:related_synonym: 1-butanecarboxylic acid;   CH3-[CH2]3-COOH;   Formula=C5H10O2;   InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7);   InChIKey=NQPDZGIKBAWPEJ-UHFFFAOYSA-N;   Pentanoate;   Pentanoic acid;   SMILES=CCCCC(O)=O;   Valerate;   Valerianic acid;   Valeriansaeure;   Valeric acid normal;   n-BuCOOH;   n-Pentanoate;   n-pentanoic acid;   n-valeric acid;   pentoic acid;   propylacetic acid
 alt_id: CHEBI:113448;   CHEBI:27263;   CHEBI:27264;   CHEBI:43606;   CHEBI:44803;   CHEBI:7980
 xref: Beilstein:969454 "Beilstein";   CAS:109-52-4 "ChemIDplus";   CAS:109-52-4 "KEGG COMPOUND";   CAS:109-52-4 "NIST Chemistry WebBook";   DrugBank:DB02406;   Gmelin:26714 "Gmelin";   HMDB:HMDB0000892;   KEGG:C00803;   KNApSAcK:C00001208;   LIPID_MAPS_instance:LMFA01010005 "LIPID MAPS"
 xref_mesh: MESH:C038780
 xref: PDBeChem:LEA;   PDBeChem:PEI;   PMID:20507156 "Europe PMC";   PPDB:3130;   Reaxys:969454 "Reaxys";   Wikipedia:Valeric_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:31011


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19596
    role 19539
      biological role 19537
        biochemical role 19055
          metabolite 19020
            eukaryotic metabolite 18684
              plant metabolite 16960
                valeric acid 14344
                  (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid 0
                  (2R,3S)-2-hydroxy-3-methylpentanoic acid 0
                  (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid 0
                  (4R)-4-hydroxypentanoic acid + 0
                  (S)-4-amino-5-oxopentanoic acid 0
                  1-octadecanoyl-2-pentanoyl-sn-glycero-3-phosphocholine 0
                  1-palmitoyl-2-valeroyl-sn-glycero-3-phosphocholine 0
                  2,3,4-trihydroxypentanoic acid 0
                  2,5-dioxopentanoic acid 0
                  2-amino-4-oxopentanoic acid + 0
                  2-aminopentanoic acid + 0
                  2-hydroxy-4-methylvalerate + 0
                  2-hydroxy-4-methylvaleric acid + 1
                  2-hydroxypentanoic acid + 0
                  2-methyl-3-ketovaleric acid 0
                  2-phenylethyl pentanoate 0
                  3-hydroxy-3-methyl-2-oxopentanoic acid + 0
                  3-hydroxypentanoic acid + 0
                  3-methyl-2-oxovaleric acid + 1
                  4,5-dioxopentanoic acid 0
                  4-hydroxy-2-oxopentanoic acid + 0
                  4-methyl-2-oxopentanoic acid 3
                  4-methyl-3-oxopentanoic acid 0
                  5-(2,3-dimethoxy-4-methylphenyl)pentanoic acid 0
                  5-[(1-phenylcyclohexyl)amino]pentanoic acid 0
                  5-[(4-nitrobenzyl)(phosphonomethyl)amino]valeric acid 0
                  5-\{3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy\}pentanoic acid 0
                  5-amino-2-oxopentanoic acid 0
                  5-aminopentanoic acid + 0
                  5-guanidino-2-oxopentanoic acid 0
                  5-guanidino-3-methyl-2-oxopentanoic acid 0
                  5-hydroxypentanoic acid + 0
                  5-phenylpentanoic acid 0
                  O-valeroylcarnitine + 0
                  acetylpyruvic acid + 0
                  ethyl (4R)-4-[((2R,5S)-2-(4-fluorobenzyl)-6-methyl-5-\{[(5-methylisoxazol-3-yl)carbonyl]amino\}-4-oxoheptanoyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pentanoate 0
                  gemfibrozil 87
                  mevaldic acid 0
                  mevalonic acid + 109
                  oxopentanoic acid + 26
                  p-N,N-bis(2-chloroethyl)aminophenylvaleric acid 0
                  pentanamide + 0
                  pentanoyl-CoA + 0
                  perfluoropentanoic acid 0
                  valeryl group 0
                  valproic acid + 14321
Path 2
Term Annotations click to browse term
  CHEBI ontology 19596
    subatomic particle 19592
      composite particle 19592
        hadron 19592
          baryon 19592
            nucleon 19592
              atomic nucleus 19592
                atom 19592
                  main group element atom 19471
                    p-block element atom 19471
                      carbon group element atom 19345
                        carbon atom 19337
                          organic molecular entity 19337
                            organic group 18299
                              organic divalent group 18289
                                organodiyl group 18289
                                  carbonyl group 18176
                                    carbonyl compound 18176
                                      carboxylic acid 17840
                                        monocarboxylic acid 17169
                                          fatty acid 15574
                                            saturated fatty acid 15539
                                              straight-chain saturated fatty acid 15177
                                                valeric acid 14344
                                                  (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid 0
                                                  (2R,3S)-2-hydroxy-3-methylpentanoic acid 0
                                                  (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid 0
                                                  (4R)-4-hydroxypentanoic acid + 0
                                                  (S)-4-amino-5-oxopentanoic acid 0
                                                  1-octadecanoyl-2-pentanoyl-sn-glycero-3-phosphocholine 0
                                                  1-palmitoyl-2-valeroyl-sn-glycero-3-phosphocholine 0
                                                  2,3,4-trihydroxypentanoic acid 0
                                                  2,5-dioxopentanoic acid 0
                                                  2-amino-4-oxopentanoic acid + 0
                                                  2-aminopentanoic acid + 0
                                                  2-hydroxy-4-methylvalerate + 0
                                                  2-hydroxy-4-methylvaleric acid + 1
                                                  2-hydroxypentanoic acid + 0
                                                  2-methyl-3-ketovaleric acid 0
                                                  2-phenylethyl pentanoate 0
                                                  3-hydroxy-3-methyl-2-oxopentanoic acid + 0
                                                  3-hydroxypentanoic acid + 0
                                                  3-methyl-2-oxovaleric acid + 1
                                                  4,5-dioxopentanoic acid 0
                                                  4-hydroxy-2-oxopentanoic acid + 0
                                                  4-methyl-2-oxopentanoic acid 3
                                                  4-methyl-3-oxopentanoic acid 0
                                                  5-(2,3-dimethoxy-4-methylphenyl)pentanoic acid 0
                                                  5-[(1-phenylcyclohexyl)amino]pentanoic acid 0
                                                  5-[(4-nitrobenzyl)(phosphonomethyl)amino]valeric acid 0
                                                  5-\{3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenoxy\}pentanoic acid 0
                                                  5-amino-2-oxopentanoic acid 0
                                                  5-aminopentanoic acid + 0
                                                  5-guanidino-2-oxopentanoic acid 0
                                                  5-guanidino-3-methyl-2-oxopentanoic acid 0
                                                  5-hydroxypentanoic acid + 0
                                                  5-phenylpentanoic acid 0
                                                  O-valeroylcarnitine + 0
                                                  acetylpyruvic acid + 0
                                                  ethyl (4R)-4-[((2R,5S)-2-(4-fluorobenzyl)-6-methyl-5-\{[(5-methylisoxazol-3-yl)carbonyl]amino\}-4-oxoheptanoyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pentanoate 0
                                                  gemfibrozil 87
                                                  mevaldic acid 0
                                                  mevalonic acid + 109
                                                  oxopentanoic acid + 26
                                                  p-N,N-bis(2-chloroethyl)aminophenylvaleric acid 0
                                                  pentanamide + 0
                                                  pentanoyl-CoA + 0
                                                  perfluoropentanoic acid 0
                                                  valeryl group 0
                                                  valproic acid + 14321
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.