ONTOLOGY REPORT - ANNOTATIONS |
|
Term: | lipoic acid |
|
Accession: | CHEBI:16494
|
browse the term
|
Definition: | A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
Synonyms: | exact_synonym: | 5-(1,2-dithiolan-3-yl)pentanoic acid |
| related_synonym: | 1,2-dithiolane-3-pentanoic acid; 1,2-dithiolane-3-valeric acid; 5-(1,2-dithiolan-3-yl)valeric acid; 5-(dithiolan-3-yl)valeric acid; 5-[3-(1,2-dithiolanyl)]pentanoic acid; 6,8-thioctic acid; 6,8-thiotic acid; 6-thioctic acid; 6-thiotic acid; Acetate-replacing factor; Biletan; Formula=C8H14O2S2; InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10); InChIKey=AGBQKNBQESQNJD-UHFFFAOYSA-N; SMILES=OC(=O)CCCCC1CCSS1; Thioctansaeure; Thioctic acid; Thioctsaeure; Thioktsaeure; alpha-Liponsaeure; alpha-lipoic acid; liponic acid |
| alt_id: | CHEBI:146958; CHEBI:25058; CHEBI:6492 |
| xref: | Beilstein:122410 "Beilstein"; Beilstein:81853 "Beilstein"; CAS:62-46-4 "ChemIDplus"; CAS:62-46-4 "KEGG COMPOUND"; CAS:62-46-4 "NIST Chemistry WebBook"; DrugBank:DB00166; Drug_Central:4732 "DrugCentral"; ECMDB:ECMDB01451; Gmelin:720915 "Gmelin"; KEGG:C00725; KEGG:D00086 |
| xref_mesh: | MESH:D008063 |
| xref: | PMID:7519986 "Europe PMC"; PMID:7548757 "Europe PMC"; Reaxys:81853 "Reaxys"; Wikipedia:Lipoic_acid; YMDB:YMDB00334 |
| cyclic_relationship: | is_conjugate_acid_of CHEBI:30313 |
|
|
|
G |
Abcb1a |
ATP binding cassette subfamily B member 1A |
|
4 |
22,339,829 |
22,517,642 |
RGD:6480464 |
G |
Acadl |
acyl-CoA dehydrogenase, long chain |
|
9 |
73,833,368 |
73,871,857 |
RGD:6480464 |
G |
Ace |
angiotensin I converting enzyme |
|
10 |
94,170,766 |
94,213,831 |
RGD:6480464 |
G |
Ache |
acetylcholinesterase |
|
12 |
22,472,358 |
22,477,052 |
RGD:6480464 |
G |
Acox1 |
acyl-CoA oxidase 1 |
|
10 |
104,724,534 |
104,748,003 |
RGD:6480464 |
G |
Acta2 |
actin alpha 2, smooth muscle |
|
1 |
252,537,614 |
252,550,394 |
RGD:6480464 |
G |
Adipoq |
adiponectin, C1Q and collagen domain containing |
|
11 |
81,330,845 |
81,344,488 |
RGD:6480464 |
G |
Agt |
angiotensinogen |
|
19 |
57,321,594 |
57,333,460 |
RGD:6480464 |
G |
Agtr1a |
angiotensin II receptor, type 1a |
|
17 |
35,907,102 |
35,958,136 |
RGD:6480464 |
G |
Akt1 |
AKT serine/threonine kinase 1 |
|
6 |
137,218,398 |
137,239,970 |
RGD:6480464 |
G |
Alad |
aminolevulinate dehydratase |
|
5 |
78,368,867 |
78,379,206 |
RGD:6480464 |
G |
Alb |
albumin |
|
14 |
19,176,275 |
19,191,793 |
RGD:6480464 |
G |
Apln |
apelin |
|
X |
134,856,719 |
134,866,210 |
RGD:6480464 |
G |
Atf4 |
activating transcription factor 4 |
|
7 |
121,480,723 |
121,482,781 |
RGD:6480464 |
G |
Atf6 |
activating transcription factor 6 |
|
13 |
89,053,457 |
89,242,531 |
RGD:6480464 |
G |
Atp1b1 |
ATPase Na+/K+ transporting subunit beta 1 |
|
13 |
82,737,161 |
82,757,681 |
RGD:6480464 |
G |
Atp2a2 |
ATPase sarcoplasmic/endoplasmic reticulum Ca2+ transporting 2 |
|
12 |
39,553,903 |
39,603,326 |
RGD:6480464 |
G |
Bax |
BCL2 associated X, apoptosis regulator |
|
1 |
101,451,801 |
101,457,207 |
RGD:6480464 |
G |
Bbc3 |
Bcl-2 binding component 3 |
|
1 |
78,261,491 |
78,267,802 |
RGD:6480464 |
G |
Bche |
butyrylcholinesterase |
|
2 |
171,104,476 |
171,196,186 |
RGD:6480464 |
G |
Bcl2 |
BCL2, apoptosis regulator |
|
13 |
26,605,426 |
26,769,374 |
RGD:6480464 |
G |
Bcl2l1 |
Bcl2-like 1 |
|
3 |
148,259,594 |
148,314,191 |
RGD:6480464 |
G |
Brca2 |
BRCA2, DNA repair associated |
|
12 |
503,660 |
544,754 |
RGD:6480464 |
G |
C1qa |
complement C1q A chain |
|
5 |
155,261,254 |
155,264,101 |
RGD:6480464 |
G |
C4b |
complement C4B (Chido blood group) |
|
20 |
4,302,344 |
4,316,752 |
RGD:6480464 |
G |
Calb2 |
calbindin 2 |
|
19 |
41,482,743 |
41,509,617 |
RGD:6480464 |
G |
Calm1 |
calmodulin 1 |
|
6 |
124,217,241 |
124,225,292 |
RGD:6480464 |
G |
Casp3 |
caspase 3 |
|
16 |
48,845,011 |
48,863,249 |
RGD:6480464 |
G |
Casp8 |
caspase 8 |
|
9 |
65,614,142 |
65,662,624 |
RGD:6480464 |
G |
Casp9 |
caspase 9 |
|
5 |
160,356,211 |
160,373,774 |
RGD:6480464 |
G |
Cat |
catalase |
|
3 |
93,379,872 |
93,412,058 |
RGD:6480464 |
G |
Ccl2 |
C-C motif chemokine ligand 2 |
|
10 |
69,412,065 |
69,413,863 |
RGD:6480464 |
G |
Ccnd1 |
cyclin D1 |
|
1 |
218,090,750 |
218,100,447 |
RGD:6480464 |
G |
Cd36 |
CD36 molecule |
|
4 |
14,150,309 |
14,191,498 |
RGD:6480464 |
G |
Cd86 |
CD86 molecule |
|
11 |
67,060,305 |
67,117,990 |
RGD:6480464 |
G |
Cd8a |
CD8a molecule |
|
4 |
99,217,640 |
99,243,352 |
RGD:6480464 |
G |
Cdx4 |
caudal type homeo box 4 |
|
X |
74,165,172 |
74,173,758 |
RGD:6480464 |
G |
Chat |
choline O-acetyltransferase |
|
16 |
8,576,858 |
8,686,131 |
RGD:6480464 |
G |
Cntf |
ciliary neurotrophic factor |
|
1 |
229,599,009 |
229,601,032 |
RGD:6480464 |
G |
Col1a1 |
collagen type I alpha 1 chain |
|
10 |
82,745,801 |
82,762,790 |
RGD:6480464 |
G |
Cpt1a |
carnitine palmitoyltransferase 1A |
|
1 |
218,568,157 |
218,629,679 |
RGD:6480464 |
G |
Crp |
C-reactive protein |
|
13 |
91,080,448 |
91,081,358 |
RGD:6480464 |
G |
Cryaa |
crystallin, alpha A |
|
20 |
10,438,444 |
10,442,189 |
RGD:6480464 |
G |
Ctsd |
cathepsin D |
|
1 |
215,541,570 |
215,553,446 |
RGD:6480464 |
G |
Ctss |
cathepsin S |
|
2 |
197,655,780 |
197,679,768 |
RGD:6480464 |
G |
Cybb |
cytochrome b-245 beta chain |
|
X |
14,578,330 |
14,610,049 |
RGD:6480464 |
G |
Cycs |
cytochrome c, somatic |
|
4 |
80,331,226 |
80,333,326 |
RGD:6480464 |
G |
Cyp1a1 |
cytochrome P450, family 1, subfamily a, polypeptide 1 |
|
8 |
62,472,087 |
62,478,122 |
RGD:6480464 |
G |
Cyp1a2 |
cytochrome P450, family 1, subfamily a, polypeptide 2 |
|
8 |
62,451,360 |
62,458,244 |
RGD:6480464 |
G |
Cyp2c6v1 |
cytochrome P450, family 2, subfamily C, polypeptide 6, variant 1 |
|
1 |
147,713,879 |
147,814,410 |
RGD:6480464 |
G |
Cyp2c79 |
cytochrome P450, family 2, subfamily c, polypeptide 79 |
|
1 |
147,236,480 |
147,307,988 |
RGD:6480464 |
G |
Cyp2d4 |
cytochrome P450, family 2, subfamily d, polypeptide 4 |
|
7 |
123,599,264 |
123,608,436 |
RGD:6480464 |
G |
Dab1 |
DAB adaptor protein 1 |
|
5 |
123,154,360 |
124,279,170 |
RGD:6480464 |
G |
Ddit3 |
DNA-damage inducible transcript 3 |
|
7 |
70,578,564 |
70,585,074 |
RGD:6480464 |
G |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
|
1 |
164,113,459 |
164,143,818 |
RGD:6480464 |
G |
Dio1 |
iodothyronine deiodinase 1 |
|
5 |
126,894,837 |
126,911,532 |
RGD:6480464 |
G |
Dld |
dihydrolipoamide dehydrogenase |
|
6 |
50,597,677 |
50,618,694 |
RGD:6480464 |
G |
Drd2 |
dopamine receptor D2 |
|
8 |
53,678,777 |
53,743,643 |
RGD:6480464 |
G |
Eif2a |
eukaryotic translation initiation factor 2A |
|
2 |
148,722,343 |
148,755,781 |
RGD:6480464 |
G |
Eif2s1 |
eukaryotic translation initiation factor 2 subunit alpha |
|
6 |
102,048,372 |
102,073,041 |
RGD:6480464 |
G |
Fas |
Fas cell surface death receptor |
|
1 |
252,589,785 |
252,624,790 |
RGD:6480464 |
G |
Flt1 |
FMS-related tyrosine kinase 1 |
|
12 |
9,033,993 |
9,205,886 |
RGD:6480464 |
G |
Fos |
Fos proto-oncogene, AP-1 transcription factor subunit |
|
6 |
109,300,433 |
109,303,299 |
RGD:6480464 |
G |
Foxo3 |
forkhead box O3 |
|
20 |
46,428,078 |
46,519,156 |
RGD:6480464 |
G |
Fras1 |
Fraser extracellular matrix complex subunit 1 |
|
14 |
14,438,392 |
14,853,016 |
RGD:6480464 |
G |
Fshb |
follicle stimulating hormone subunit beta |
|
3 |
98,088,321 |
98,092,131 |
RGD:6480464 |
G |
Gad1 |
glutamate decarboxylase 1 |
|
3 |
56,861,440 |
56,902,139 |
RGD:6480464 |
G |
Gclc |
glutamate-cysteine ligase, catalytic subunit |
|
8 |
85,059,051 |
85,097,471 |
RGD:6480464 |
G |
Gclm |
glutamate cysteine ligase, modifier subunit |
|
2 |
225,827,504 |
225,847,876 |
RGD:6480464 |
G |
Gfap |
glial fibrillary acidic protein |
|
10 |
90,990,762 |
90,999,435 |
RGD:6480464 |
G |
Ggt1 |
gamma-glutamyltransferase 1 |
|
20 |
14,019,723 |
14,045,781 |
RGD:6480464 |
G |
Gja1 |
gap junction protein, alpha 1 |
|
20 |
37,876,650 |
37,889,097 |
RGD:6480464 |
G |
Gnrhr |
gonadotropin releasing hormone receptor |
|
14 |
23,480,462 |
23,498,450 |
RGD:6480464 |
G |
Gpt |
glutamic--pyruvic transaminase |
|
7 |
117,759,083 |
117,761,932 |
RGD:6480464 |
G |
Gpx1 |
glutathione peroxidase 1 |
|
8 |
117,117,430 |
117,118,528 |
RGD:6480464 |
G |
Gpx2 |
glutathione peroxidase 2 |
|
6 |
99,839,960 |
99,843,245 |
RGD:6480464 |
G |
Gpx3 |
glutathione peroxidase 3 |
|
10 |
40,247,436 |
40,255,423 |
RGD:6480464 |
G |
Gpx5 |
glutathione peroxidase 5 |
|
17 |
45,508,657 |
45,518,686 |
RGD:6480464 |
G |
Grin2a |
glutamate ionotropic receptor NMDA type subunit 2A |
|
10 |
5,707,806 |
6,123,568 |
RGD:6480464 |
G |
Gsk3b |
glycogen synthase kinase 3 beta |
|
11 |
65,060,884 |
65,208,842 |
RGD:6480464 |
G |
Gsr |
glutathione-disulfide reductase |
|
16 |
62,197,617 |
62,239,987 |
RGD:6480464 |
G |
Gstm1 |
glutathione S-transferase mu 1 |
|
2 |
210,803,869 |
210,809,461 |
RGD:6480464 |
G |
Gstm7 |
glutathione S-transferase, mu 7 |
|
2 |
210,720,719 |
210,726,179 |
RGD:6480464 |
G |
Gstp1 |
glutathione S-transferase pi 1 |
|
1 |
219,291,679 |
219,294,147 |
RGD:6480464 |
G |
Gusb |
glucuronidase, beta |
|
12 |
30,202,066 |
30,215,583 |
RGD:6480464 |
G |
Havcr1 |
hepatitis A virus cellular receptor 1 |
|
10 |
31,813,819 |
31,860,934 |
RGD:6480464 |
G |
Hmox1 |
heme oxygenase 1 |
|
19 |
14,508,634 |
14,515,455 |
RGD:6480464 |
G |
Hs1bp3 |
HCLS1 binding protein 3 |
|
6 |
33,517,711 |
33,548,015 |
RGD:6480464 |
G |
Hspa1a |
heat shock protein family A (Hsp70) member 1A |
|
20 |
4,875,834 |
4,881,751 |
RGD:6480464 |
G |
Hspa5 |
heat shock protein family A (Hsp70) member 5 |
|
3 |
13,838,304 |
13,842,763 |
RGD:6480464 |
G |
Igfbp3 |
insulin-like growth factor binding protein 3 |
|
14 |
87,457,647 |
87,465,374 |
RGD:6480464 |
G |
Il10 |
interleukin 10 |
|
13 |
47,738,933 |
47,743,392 |
RGD:6480464 |
G |
Il1a |
interleukin 1 alpha |
|
3 |
121,824,712 |
121,836,122 |
RGD:6480464 |
G |
Il1b |
interleukin 1 beta |
|
3 |
121,876,256 |
121,882,637 |
RGD:6480464 |
G |
Il2 |
interleukin 2 |
|
2 |
123,847,150 |
123,851,854 |
RGD:6480464 |
G |
Il22ra2 |
interleukin 22 receptor subunit alpha 2 |
|
1 |
15,084,136 |
15,107,423 |
RGD:6480464 |
G |
Il4 |
interleukin 4 |
|
10 |
38,963,979 |
38,969,531 |
RGD:6480464 |
G |
Il6 |
interleukin 6 |
|
4 |
3,043,231 |
3,047,807 |
RGD:6480464 |
G |
Ins2 |
insulin 2 |
|
1 |
215,856,967 |
215,858,034 |
RGD:6480464 |
G |
Irf1 |
interferon regulatory factor 1 |
|
10 |
39,109,530 |
39,116,532 |
RGD:6480464 |
G |
Jun |
Jun proto-oncogene, AP-1 transcription factor subunit |
|
5 |
114,011,184 |
114,014,277 |
RGD:6480464 |
G |
Keap1 |
Kelch-like ECH-associated protein 1 |
|
8 |
22,250,518 |
22,259,868 |
RGD:6480464 |
G |
Ldhc |
lactate dehydrogenase C |
|
1 |
102,914,875 |
102,931,843 |
RGD:6480464 |
G |
Lep |
leptin |
|
4 |
56,337,695 |
56,351,818 |
RGD:6480464 |
G |
Lhb |
luteinizing hormone subunit beta |
|
1 |
101,409,992 |
101,413,725 |
RGD:6480464 |
G |
Lipe |
lipase E, hormone sensitive type |
|
1 |
82,248,031 |
82,266,727 |
RGD:6480464 |
G |
LOC108348233 |
protocadherin beta-6-like |
|
18 |
30,512,507 |
30,518,524 |
RGD:6480464 |
G |
Mapk1 |
mitogen activated protein kinase 1 |
|
11 |
88,203,863 |
88,273,301 |
RGD:6480464 |
G |
Mapk14 |
mitogen activated protein kinase 14 |
|
20 |
5,933,290 |
5,995,137 |
RGD:6480464 |
G |
Mapk3 |
mitogen activated protein kinase 3 |
|
1 |
198,192,773 |
198,198,975 |
RGD:6480464 |
G |
Mapk8 |
mitogen-activated protein kinase 8 |
|
16 |
9,620,854 |
9,709,342 |
RGD:6480464 |
G |
Mir21 |
microRNA 21 |
|
10 |
73,902,210 |
73,902,301 |
RGD:6480464 |
G |
Mir210 |
microRNA 210 |
|
1 |
214,208,355 |
214,208,464 |
RGD:6480464 |
G |
Mmp12 |
matrix metallopeptidase 12 |
|
8 |
5,594,717 |
5,616,494 |
RGD:6480464 |
G |
Mmp13 |
matrix metallopeptidase 13 |
|
8 |
5,522,739 |
5,533,018 |
RGD:6480464 |
G |
Mmp2 |
matrix metallopeptidase 2 |
|
19 |
15,542,771 |
15,570,589 |
RGD:6480464 |
G |
Mmp3 |
matrix metallopeptidase 3 |
|
8 |
5,676,608 |
5,698,579 |
RGD:6480464 |
G |
Msr1 |
macrophage scavenger receptor 1 |
|
16 |
56,817,714 |
56,900,025 |
RGD:6480464 |
G |
Mt1 |
metallothionein 1 |
|
19 |
11,301,991 |
11,303,007 |
RGD:6480464 |
G |
Mvd |
mevalonate diphosphate decarboxylase |
|
19 |
55,258,910 |
55,268,933 |
RGD:6480464 |
G |
Myc |
MYC proto-oncogene, bHLH transcription factor |
|
7 |
102,586,313 |
102,591,240 |
RGD:6480464 |
G |
Ncf1 |
neutrophil cytosolic factor 1 |
|
12 |
25,497,104 |
25,506,300 |
RGD:6480464 |
G |
Nfe2l2 |
nuclear factor, erythroid 2-like 2 |
|
3 |
62,497,568 |
62,525,146 |
RGD:6480464 |
G |
Nfkb1 |
nuclear factor kappa B subunit 1 |
|
2 |
240,773,520 |
240,890,053 |
RGD:6480464 |
G |
Ngfr |
nerve growth factor receptor |
|
10 |
83,389,828 |
83,408,061 |
RGD:6480464 |
G |
Nos2 |
nitric oxide synthase 2 |
|
10 |
66,188,290 |
66,221,621 |
RGD:6480464 |
G |
Nos3 |
nitric oxide synthase 3 |
|
4 |
7,321,908 |
7,342,404 |
RGD:6480464 |
G |
Nox1 |
NADPH oxidase 1 |
|
X |
104,909,328 |
104,932,508 |
RGD:6480464 |
G |
Nox4 |
NADPH oxidase 4 |
|
1 |
150,796,359 |
150,976,186 |
RGD:6480464 |
G |
Nqo1 |
NAD(P)H quinone dehydrogenase 1 |
|
19 |
38,422,210 |
38,437,103 |
RGD:6480464 |
G |
Otx2 |
orthodenticle homeobox 2 |
|
15 |
25,500,037 |
25,511,619 |
RGD:6480464 |
G |
Pah |
phenylalanine hydroxylase |
|
7 |
28,066,639 |
28,129,772 |
RGD:6480464 |
G |
Pcna |
proliferating cell nuclear antigen |
|
3 |
124,880,698 |
124,884,570 |
RGD:6480464 |
G |
Plaat3 |
phospholipase A and acyltransferase 3 |
|
1 |
222,844,238 |
222,877,180 |
RGD:6480464 |
G |
Plin1 |
perilipin 1 |
|
1 |
141,458,907 |
141,470,927 |
RGD:6480464 |
G |
Por |
cytochrome p450 oxidoreductase |
|
12 |
23,998,411 |
24,017,063 |
RGD:6480464 |
G |
Ppara |
peroxisome proliferator activated receptor alpha |
|
7 |
126,618,872 |
126,687,282 |
RGD:6480464 |
G |
Pparg |
peroxisome proliferator-activated receptor gamma |
|
4 |
147,274,055 |
147,399,383 |
RGD:6480464 |
G |
Ppargc1a |
PPARG coactivator 1 alpha |
|
14 |
63,095,291 |
63,190,688 |
RGD:6480464 |
G |
Ppargc1b |
PPARG coactivator 1 beta |
|
18 |
56,626,725 |
56,650,524 |
RGD:6480464 |
G |
Ptgs2 |
prostaglandin-endoperoxide synthase 2 |
|
13 |
67,351,230 |
67,356,920 |
RGD:6480464 |
G |
Rela |
RELA proto-oncogene, NF-kB subunit |
|
1 |
220,992,770 |
221,003,249 |
RGD:6480464 |
G |
Reln |
reelin |
|
4 |
9,347,533 |
9,774,257 |
RGD:6480464 |
G |
S100b |
S100 calcium binding protein B |
|
20 |
13,130,633 |
13,142,856 |
RGD:6480464 |
G |
Sema5a |
semaphorin 5A |
|
2 |
85,377,318 |
85,808,970 |
RGD:6480464 |
G |
Serpinh1 |
serpin family H member 1 |
|
1 |
164,301,010 |
164,308,306 |
RGD:6480464 |
G |
Sirt1 |
sirtuin 1 |
|
20 |
26,831,971 |
26,851,587 |
RGD:6480464 |
G |
Sirt3 |
sirtuin 3 |
|
1 |
213,613,502 |
213,636,061 |
RGD:6480464 |
G |
Slc12a2 |
solute carrier family 12 member 2 |
|
18 |
52,917,124 |
52,985,281 |
RGD:6480464 |
G |
Slc38a2 |
solute carrier family 38, member 2 |
|
7 |
138,088,654 |
138,100,869 |
RGD:6480464 |
G |
Slc5a6 |
solute carrier family 5 member 6 |
|
6 |
26,685,823 |
26,697,110 |
RGD:6480464 |
G |
Snca |
synuclein alpha |
|
4 |
90,782,412 |
90,883,236 |
RGD:6480464 |
G |
Sod1 |
superoxide dismutase 1 |
|
11 |
30,363,282 |
30,368,858 |
RGD:6480464 |
G |
Sod2 |
superoxide dismutase 2 |
|
1 |
47,914,757 |
47,921,587 |
RGD:6480464 |
G |
Sp1 |
Sp1 transcription factor |
|
7 |
144,014,173 |
144,044,635 |
RGD:6480464 |
G |
Srebf1 |
sterol regulatory element binding transcription factor 1 |
|
10 |
46,570,996 |
46,593,021 |
RGD:6480464 |
G |
Star |
steroidogenic acute regulatory protein |
|
16 |
71,036,204 |
71,040,847 |
RGD:6480464 |
G |
Stat1 |
signal transducer and activator of transcription 1 |
|
9 |
54,287,540 |
54,327,958 |
RGD:6480464 |
G |
Stat3 |
signal transducer and activator of transcription 3 |
|
10 |
88,790,401 |
88,842,263 |
RGD:6480464 |
G |
Sumo1 |
small ubiquitin-like modifier 1 |
|
9 |
66,453,428 |
66,483,614 |
RGD:6480464 |
G |
Tgfb1 |
transforming growth factor, beta 1 |
|
1 |
82,480,875 |
82,497,196 |
RGD:6480464 |
G |
Tgfb1i1 |
transforming growth factor beta 1 induced transcript 1 |
|
1 |
199,664,039 |
199,670,970 |
RGD:6480464 |
G |
Tgfb2 |
transforming growth factor, beta 2 |
|
13 |
105,039,639 |
105,142,010 |
RGD:6480464 |
G |
Thra |
thyroid hormone receptor alpha |
|
10 |
86,657,285 |
86,684,935 |
RGD:6480464 |
G |
Tnf |
tumor necrosis factor |
|
20 |
5,189,382 |
5,192,000 |
RGD:6480464 |
G |
Tnfrsf26 |
tumor necrosis factor receptor superfamily, member 26 |
|
1 |
216,808,642 |
216,829,361 |
RGD:6480464 |
G |
Tnfsf10 |
TNF superfamily member 10 |
|
2 |
113,008,008 |
113,026,899 |
RGD:6480464 |
G |
Tnni3 |
troponin I3, cardiac type |
|
1 |
72,882,806 |
72,886,490 |
RGD:6480464 |
G |
Tp53 |
tumor protein p53 |
|
10 |
56,186,299 |
56,198,449 |
RGD:6480464 |
G |
Trib3 |
tribbles pseudokinase 3 |
|
3 |
147,814,056 |
147,819,650 |
RGD:6480464 |
G |
Txn1 |
thioredoxin 1 |
|
5 |
75,049,735 |
75,057,731 |
RGD:6480464 |
G |
Txnrd1 |
thioredoxin reductase 1 |
|
7 |
26,946,124 |
26,984,400 |
RGD:6480464 |
G |
Ucp2 |
uncoupling protein 2 |
|
1 |
165,506,375 |
165,512,744 |
RGD:6480464 |
G |
Vegfa |
vascular endothelial growth factor A |
|
9 |
17,340,341 |
17,355,681 |
RGD:6480464 |
|
G |
Abcb1a |
ATP binding cassette subfamily B member 1A |
|
4 |
22,339,829 |
22,517,642 |
RGD:6480464 |
G |
Acadl |
acyl-CoA dehydrogenase, long chain |
|
9 |
73,833,368 |
73,871,857 |
RGD:6480464 |
G |
Ace |
angiotensin I converting enzyme |
|
10 |
94,170,766 |
94,213,831 |
RGD:6480464 |
G |
Ache |
acetylcholinesterase |
|
12 |
22,472,358 |
22,477,052 |
RGD:6480464 |
G |
Acox1 |
acyl-CoA oxidase 1 |
|
10 |
104,724,534 |
104,748,003 |
RGD:6480464 |
G |
Acta2 |
actin alpha 2, smooth muscle |
|
1 |
252,537,614 |
252,550,394 |
RGD:6480464 |
G |
Adipoq |
adiponectin, C1Q and collagen domain containing |
|
11 |
81,330,845 |
81,344,488 |
RGD:6480464 |
G |
Agt |
angiotensinogen |
|
19 |
57,321,594 |
57,333,460 |
RGD:6480464 |
G |
Agtr1a |
angiotensin II receptor, type 1a |
|
17 |
35,907,102 |
35,958,136 |
RGD:6480464 |
G |
Akt1 |
AKT serine/threonine kinase 1 |
|
6 |
137,218,398 |
137,239,970 |
RGD:6480464 |
G |
Alad |
aminolevulinate dehydratase |
|
5 |
78,368,867 |
78,379,206 |
RGD:6480464 |
G |
Alb |
albumin |
|
14 |
19,176,275 |
19,191,793 |
RGD:6480464 |
G |
Apln |
apelin |
|
X |
134,856,719 |
134,866,210 |
RGD:6480464 |
G |
Atf4 |
activating transcription factor 4 |
|
7 |
121,480,723 |
121,482,781 |
RGD:6480464 |
G |
Atf6 |
activating transcription factor 6 |
|
13 |
89,053,457 |
89,242,531 |
RGD:6480464 |
G |
Atp1b1 |
ATPase Na+/K+ transporting subunit beta 1 |
|
13 |
82,737,161 |
82,757,681 |
RGD:6480464 |
G |
Atp2a2 |
ATPase sarcoplasmic/endoplasmic reticulum Ca2+ transporting 2 |
|
12 |
39,553,903 |
39,603,326 |
RGD:6480464 |
G |
Bax |
BCL2 associated X, apoptosis regulator |
|
1 |
101,451,801 |
101,457,207 |
RGD:6480464 |
G |
Bbc3 |
Bcl-2 binding component 3 |
|
1 |
78,261,491 |
78,267,802 |
RGD:6480464 |
G |
Bche |
butyrylcholinesterase |
|
2 |
171,104,476 |
171,196,186 |
RGD:6480464 |
G |
Bcl2 |
BCL2, apoptosis regulator |
|
13 |
26,605,426 |
26,769,374 |
RGD:6480464 |
G |
Bcl2l1 |
Bcl2-like 1 |
|
3 |
148,259,594 |
148,314,191 |
RGD:6480464 |
G |
Brca2 |
BRCA2, DNA repair associated |
|
12 |
503,660 |
544,754 |
RGD:6480464 |
G |
C1qa |
complement C1q A chain |
|
5 |
155,261,254 |
155,264,101 |
RGD:6480464 |
G |
C4b |
complement C4B (Chido blood group) |
|
20 |
4,302,344 |
4,316,752 |
RGD:6480464 |
G |
Calb2 |
calbindin 2 |
|
19 |
41,482,743 |
41,509,617 |
RGD:6480464 |
G |
Calm1 |
calmodulin 1 |
|
6 |
124,217,241 |
124,225,292 |
RGD:6480464 |
G |
Casp3 |
caspase 3 |
|
16 |
48,845,011 |
48,863,249 |
RGD:6480464 |
G |
Casp8 |
caspase 8 |
|
9 |
65,614,142 |
65,662,624 |
RGD:6480464 |
G |
Casp9 |
caspase 9 |
|
5 |
160,356,211 |
160,373,774 |
RGD:6480464 |
G |
Cat |
catalase |
|
3 |
93,379,872 |
93,412,058 |
RGD:6480464 |
G |
Ccl2 |
C-C motif chemokine ligand 2 |
|
10 |
69,412,065 |
69,413,863 |
RGD:6480464 |
G |
Ccnd1 |
cyclin D1 |
|
1 |
218,090,750 |
218,100,447 |
RGD:6480464 |
G |
Cd36 |
CD36 molecule |
|
4 |
14,150,309 |
14,191,498 |
RGD:6480464 |
G |
Cd86 |
CD86 molecule |
|
11 |
67,060,305 |
67,117,990 |
RGD:6480464 |
G |
Cd8a |
CD8a molecule |
|
4 |
99,217,640 |
99,243,352 |
RGD:6480464 |
G |
Cdx4 |
caudal type homeo box 4 |
|
X |
74,165,172 |
74,173,758 |
RGD:6480464 |
G |
Chat |
choline O-acetyltransferase |
|
16 |
8,576,858 |
8,686,131 |
RGD:6480464 |
G |
Cntf |
ciliary neurotrophic factor |
|
1 |
229,599,009 |
229,601,032 |
RGD:6480464 |
G |
Col1a1 |
collagen type I alpha 1 chain |
|
10 |
82,745,801 |
82,762,790 |
RGD:6480464 |
G |
Cpt1a |
carnitine palmitoyltransferase 1A |
|
1 |
218,568,157 |
218,629,679 |
RGD:6480464 |
G |
Crp |
C-reactive protein |
|
13 |
91,080,448 |
91,081,358 |
RGD:6480464 |
G |
Cryaa |
crystallin, alpha A |
|
20 |
10,438,444 |
10,442,189 |
RGD:6480464 |
G |
Ctsd |
cathepsin D |
|
1 |
215,541,570 |
215,553,446 |
RGD:6480464 |
G |
Ctss |
cathepsin S |
|
2 |
197,655,780 |
197,679,768 |
RGD:6480464 |
G |
Cybb |
cytochrome b-245 beta chain |
|
X |
14,578,330 |
14,610,049 |
RGD:6480464 |
G |
Cycs |
cytochrome c, somatic |
|
4 |
80,331,226 |
80,333,326 |
RGD:6480464 |
G |
Cyp1a1 |
cytochrome P450, family 1, subfamily a, polypeptide 1 |
|
8 |
62,472,087 |
62,478,122 |
RGD:6480464 |
G |
Cyp1a2 |
cytochrome P450, family 1, subfamily a, polypeptide 2 |
|
8 |
62,451,360 |
62,458,244 |
RGD:6480464 |
G |
Cyp2c6v1 |
cytochrome P450, family 2, subfamily C, polypeptide 6, variant 1 |
|
1 |
147,713,879 |
147,814,410 |
RGD:6480464 |
G |
Cyp2c79 |
cytochrome P450, family 2, subfamily c, polypeptide 79 |
|
1 |
147,236,480 |
147,307,988 |
RGD:6480464 |
G |
Cyp2d4 |
cytochrome P450, family 2, subfamily d, polypeptide 4 |
|
7 |
123,599,264 |
123,608,436 |
RGD:6480464 |
G |
Dab1 |
DAB adaptor protein 1 |
|
5 |
123,154,360 |
124,279,170 |
RGD:6480464 |
G |
Ddit3 |
DNA-damage inducible transcript 3 |
|
7 |
70,578,564 |
70,585,074 |
RGD:6480464 |
G |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
|
1 |
164,113,459 |
164,143,818 |
RGD:6480464 |
G |
Dio1 |
iodothyronine deiodinase 1 |
|
5 |
126,894,837 |
126,911,532 |
RGD:6480464 |
G |
Dld |
dihydrolipoamide dehydrogenase |
|
6 |
50,597,677 |
50,618,694 |
RGD:6480464 |
G |
Drd2 |
dopamine receptor D2 |
|
8 |
53,678,777 |
53,743,643 |
RGD:6480464 |
G |
Eif2a |
eukaryotic translation initiation factor 2A |
|
2 |
148,722,343 |
148,755,781 |
RGD:6480464 |
G |
Eif2s1 |
eukaryotic translation initiation factor 2 subunit alpha |
|
6 |
102,048,372 |
102,073,041 |
RGD:6480464 |
G |
Fas |
Fas cell surface death receptor |
|
1 |
252,589,785 |
252,624,790 |
RGD:6480464 |
G |
Flt1 |
FMS-related tyrosine kinase 1 |
|
12 |
9,033,993 |
9,205,886 |
RGD:6480464 |
G |
Fos |
Fos proto-oncogene, AP-1 transcription factor subunit |
|
6 |
109,300,433 |
109,303,299 |
RGD:6480464 |
G |
Foxo3 |
forkhead box O3 |
|
20 |
46,428,078 |
46,519,156 |
RGD:6480464 |
G |
Fras1 |
Fraser extracellular matrix complex subunit 1 |
|
14 |
14,438,392 |
14,853,016 |
RGD:6480464 |
G |
Fshb |
follicle stimulating hormone subunit beta |
|
3 |
98,088,321 |
98,092,131 |
RGD:6480464 |
G |
Gad1 |
glutamate decarboxylase 1 |
|
3 |
56,861,440 |
56,902,139 |
RGD:6480464 |
G |
Gclc |
glutamate-cysteine ligase, catalytic subunit |
|
8 |
85,059,051 |
85,097,471 |
RGD:6480464 |
G |
Gclm |
glutamate cysteine ligase, modifier subunit |
|
2 |
225,827,504 |
225,847,876 |
RGD:6480464 |
G |
Gfap |
glial fibrillary acidic protein |
|
10 |
90,990,762 |
90,999,435 |
RGD:6480464 |
G |
Ggt1 |
gamma-glutamyltransferase 1 |
|
20 |
14,019,723 |
14,045,781 |
RGD:6480464 |
G |
Gja1 |
gap junction protein, alpha 1 |
|
20 |
37,876,650 |
37,889,097 |
RGD:6480464 |
G |
Gnrhr |
gonadotropin releasing hormone receptor |
|
14 |
23,480,462 |
23,498,450 |
RGD:6480464 |
G |
Gpt |
glutamic--pyruvic transaminase |
|
7 |
117,759,083 |
117,761,932 |
RGD:6480464 |
G |
Gpx1 |
glutathione peroxidase 1 |
|
8 |
117,117,430 |
117,118,528 |
RGD:6480464 |
G |
Gpx2 |
glutathione peroxidase 2 |
|
6 |
99,839,960 |
99,843,245 |
RGD:6480464 |
G |
Gpx3 |
glutathione peroxidase 3 |
|
10 |
40,247,436 |
40,255,423 |
RGD:6480464 |
G |
Gpx5 |
glutathione peroxidase 5 |
|
17 |
45,508,657 |
45,518,686 |
RGD:6480464 |
G |
Grin2a |
glutamate ionotropic receptor NMDA type subunit 2A |
|
10 |
5,707,806 |
6,123,568 |
RGD:6480464 |
G |
Gsk3b |
glycogen synthase kinase 3 beta |
|
11 |
65,060,884 |
65,208,842 |
RGD:6480464 |
G |
Gsr |
glutathione-disulfide reductase |
|
16 |
62,197,617 |
62,239,987 |
RGD:6480464 |
G |
Gstm1 |
glutathione S-transferase mu 1 |
|
2 |
210,803,869 |
210,809,461 |
RGD:6480464 |
G |
Gstm7 |
glutathione S-transferase, mu 7 |
|
2 |
210,720,719 |
210,726,179 |
RGD:6480464 |
G |
Gstp1 |
glutathione S-transferase pi 1 |
|
1 |
219,291,679 |
219,294,147 |
RGD:6480464 |
G |
Gusb |
glucuronidase, beta |
|
12 |
30,202,066 |
30,215,583 |
RGD:6480464 |
G |
Havcr1 |
hepatitis A virus cellular receptor 1 |
|
10 |
31,813,819 |
31,860,934 |
RGD:6480464 |
G |
Hmox1 |
heme oxygenase 1 |
|
19 |
14,508,634 |
14,515,455 |
RGD:6480464 |
G |
Hs1bp3 |
HCLS1 binding protein 3 |
|
6 |
33,517,711 |
33,548,015 |
RGD:6480464 |
G |
Hspa1a |
heat shock protein family A (Hsp70) member 1A |
|
20 |
4,875,834 |
4,881,751 |
RGD:6480464 |
G |
Hspa5 |
heat shock protein family A (Hsp70) member 5 |
|
3 |
13,838,304 |
13,842,763 |
RGD:6480464 |
G |
Igfbp3 |
insulin-like growth factor binding protein 3 |
|
14 |
87,457,647 |
87,465,374 |
RGD:6480464 |
G |
Il10 |
interleukin 10 |
|
13 |
47,738,933 |
47,743,392 |
RGD:6480464 |
G |
Il1a |
interleukin 1 alpha |
|
3 |
121,824,712 |
121,836,122 |
RGD:6480464 |
G |
Il1b |
interleukin 1 beta |
|
3 |
121,876,256 |
121,882,637 |
RGD:6480464 |
G |
Il2 |
interleukin 2 |
|
2 |
123,847,150 |
123,851,854 |
RGD:6480464 |
G |
Il22ra2 |
interleukin 22 receptor subunit alpha 2 |
|
1 |
15,084,136 |
15,107,423 |
RGD:6480464 |
G |
Il4 |
interleukin 4 |
|
10 |
38,963,979 |
38,969,531 |
RGD:6480464 |
G |
Il6 |
interleukin 6 |
|
4 |
3,043,231 |
3,047,807 |
RGD:6480464 |
G |
Ins2 |
insulin 2 |
|
1 |
215,856,967 |
215,858,034 |
RGD:6480464 |
G |
Irf1 |
interferon regulatory factor 1 |
|
10 |
39,109,530 |
39,116,532 |
RGD:6480464 |
G |
Jun |
Jun proto-oncogene, AP-1 transcription factor subunit |
|
5 |
114,011,184 |
114,014,277 |
RGD:6480464 |
G |
Keap1 |
Kelch-like ECH-associated protein 1 |
|
8 |
22,250,518 |
22,259,868 |
RGD:6480464 |
G |
Ldhc |
lactate dehydrogenase C |
|
1 |
102,914,875 |
102,931,843 |
RGD:6480464 |
G |
Lep |
leptin |
|
4 |
56,337,695 |
56,351,818 |
RGD:6480464 |
G |
Lhb |
luteinizing hormone subunit beta |
|
1 |
101,409,992 |
101,413,725 |
RGD:6480464 |
G |
Lipe |
lipase E, hormone sensitive type |
|
1 |
82,248,031 |
82,266,727 |
RGD:6480464 |
G |
LOC108348233 |
protocadherin beta-6-like |
|
18 |
30,512,507 |
30,518,524 |
RGD:6480464 |
G |
Mapk1 |
mitogen activated protein kinase 1 |
|
11 |
88,203,863 |
88,273,301 |
RGD:6480464 |
G |
Mapk14 |
mitogen activated protein kinase 14 |
|
20 |
5,933,290 |
5,995,137 |
RGD:6480464 |
G |
Mapk3 |
mitogen activated protein kinase 3 |
|
1 |
198,192,773 |
198,198,975 |
RGD:6480464 |
G |
Mapk8 |
mitogen-activated protein kinase 8 |
|
16 |
9,620,854 |
9,709,342 |
RGD:6480464 |
G |
Mir21 |
microRNA 21 |
|
10 |
73,902,210 |
73,902,301 |
RGD:6480464 |
G |
Mir210 |
microRNA 210 |
|
1 |
214,208,355 |
214,208,464 |
RGD:6480464 |
G |
Mmp12 |
matrix metallopeptidase 12 |
|
8 |
5,594,717 |
5,616,494 |
RGD:6480464 |
G |
Mmp13 |
matrix metallopeptidase 13 |
|
8 |
5,522,739 |
5,533,018 |
RGD:6480464 |
G |
Mmp2 |
matrix metallopeptidase 2 |
|
19 |
15,542,771 |
15,570,589 |
RGD:6480464 |
G |
Mmp3 |
matrix metallopeptidase 3 |
|
8 |
5,676,608 |
5,698,579 |
RGD:6480464 |
G |
Msr1 |
macrophage scavenger receptor 1 |
|
16 |
56,817,714 |
56,900,025 |
RGD:6480464 |
G |
Mt1 |
metallothionein 1 |
|
19 |
11,301,991 |
11,303,007 |
RGD:6480464 |
G |
Mvd |
mevalonate diphosphate decarboxylase |
|
19 |
55,258,910 |
55,268,933 |
RGD:6480464 |
G |
Myc |
MYC proto-oncogene, bHLH transcription factor |
|
7 |
102,586,313 |
102,591,240 |
RGD:6480464 |
G |
Ncf1 |
neutrophil cytosolic factor 1 |
|
12 |
25,497,104 |
25,506,300 |
RGD:6480464 |
G |
Nfe2l2 |
nuclear factor, erythroid 2-like 2 |
|
3 |
62,497,568 |
62,525,146 |
RGD:6480464 |
G |
Nfkb1 |
nuclear factor kappa B subunit 1 |
|
2 |
240,773,520 |
240,890,053 |
RGD:6480464 |
G |
Ngfr |
nerve growth factor receptor |
|
10 |
83,389,828 |
83,408,061 |
RGD:6480464 |
G |
Nos2 |
nitric oxide synthase 2 |
|
10 |
66,188,290 |
66,221,621 |
RGD:6480464 |
G |
Nos3 |
nitric oxide synthase 3 |
|
4 |
7,321,908 |
7,342,404 |
RGD:6480464 |
G |
Nox1 |
NADPH oxidase 1 |
|
X |
104,909,328 |
104,932,508 |
RGD:6480464 |
G |
Nox4 |
NADPH oxidase 4 |
|
1 |
150,796,359 |
150,976,186 |
RGD:6480464 |
G |
Nqo1 |
NAD(P)H quinone dehydrogenase 1 |
|
19 |
38,422,210 |
38,437,103 |
RGD:6480464 |
G |
Otx2 |
orthodenticle homeobox 2 |
|
15 |
25,500,037 |
25,511,619 |
RGD:6480464 |
G |
Pah |
phenylalanine hydroxylase |
|
7 |
28,066,639 |
28,129,772 |
RGD:6480464 |
G |
Pcna |
proliferating cell nuclear antigen |
|
3 |
124,880,698 |
124,884,570 |
RGD:6480464 |
G |
Plaat3 |
phospholipase A and acyltransferase 3 |
|
1 |
222,844,238 |
222,877,180 |
RGD:6480464 |
G |
Plin1 |
perilipin 1 |
|
1 |
141,458,907 |
141,470,927 |
RGD:6480464 |
G |
Por |
cytochrome p450 oxidoreductase |
|
12 |
23,998,411 |
24,017,063 |
RGD:6480464 |
G |
Ppara |
peroxisome proliferator activated receptor alpha |
|
7 |
126,618,872 |
126,687,282 |
RGD:6480464 |
G |
Pparg |
peroxisome proliferator-activated receptor gamma |
|
4 |
147,274,055 |
147,399,383 |
RGD:6480464 |
G |
Ppargc1a |
PPARG coactivator 1 alpha |
|
14 |
63,095,291 |
63,190,688 |
RGD:6480464 |
G |
Ppargc1b |
PPARG coactivator 1 beta |
|
18 |
56,626,725 |
56,650,524 |
RGD:6480464 |
G |
Ptgs2 |
prostaglandin-endoperoxide synthase 2 |
|
13 |
67,351,230 |
67,356,920 |
RGD:6480464 |
G |
Rela |
RELA proto-oncogene, NF-kB subunit |
|
1 |
220,992,770 |
221,003,249 |
RGD:6480464 |
G |
Reln |
reelin |
|
4 |
9,347,533 |
9,774,257 |
RGD:6480464 |
G |
S100b |
S100 calcium binding protein B |
|
20 |
13,130,633 |
13,142,856 |
RGD:6480464 |
G |
Sema5a |
semaphorin 5A |
|
2 |
85,377,318 |
85,808,970 |
RGD:6480464 |
G |
Serpinh1 |
serpin family H member 1 |
|
1 |
164,301,010 |
164,308,306 |
RGD:6480464 |
G |
Sirt1 |
sirtuin 1 |
|
20 |
26,831,971 |
26,851,587 |
RGD:6480464 |
G |
Sirt3 |
sirtuin 3 |
|
1 |
213,613,502 |
213,636,061 |
RGD:6480464 |
G |
Slc12a2 |
solute carrier family 12 member 2 |
|
18 |
52,917,124 |
52,985,281 |
RGD:6480464 |
G |
Slc38a2 |
solute carrier family 38, member 2 |
|
7 |
138,088,654 |
138,100,869 |
RGD:6480464 |
G |
Slc5a6 |
solute carrier family 5 member 6 |
|
6 |
26,685,823 |
26,697,110 |
RGD:6480464 |
G |
Snca |
synuclein alpha |
|
4 |
90,782,412 |
90,883,236 |
RGD:6480464 |
G |
Sod1 |
superoxide dismutase 1 |
|
11 |
30,363,282 |
30,368,858 |
RGD:6480464 |
G |
Sod2 |
superoxide dismutase 2 |
|
1 |
47,914,757 |
47,921,587 |
RGD:6480464 |
G |
Sp1 |
Sp1 transcription factor |
|
7 |
144,014,173 |
144,044,635 |
RGD:6480464 |
G |
Srebf1 |
sterol regulatory element binding transcription factor 1 |
|
10 |
46,570,996 |
46,593,021 |
RGD:6480464 |
G |
Star |
steroidogenic acute regulatory protein |
|
16 |
71,036,204 |
71,040,847 |
RGD:6480464 |
G |
Stat1 |
signal transducer and activator of transcription 1 |
|
9 |
54,287,540 |
54,327,958 |
RGD:6480464 |
G |
Stat3 |
signal transducer and activator of transcription 3 |
|
10 |
88,790,401 |
88,842,263 |
RGD:6480464 |
G |
Sumo1 |
small ubiquitin-like modifier 1 |
|
9 |
66,453,428 |
66,483,614 |
RGD:6480464 |
G |
Tgfb1 |
transforming growth factor, beta 1 |
|
1 |
82,480,875 |
82,497,196 |
RGD:6480464 |
G |
Tgfb1i1 |
transforming growth factor beta 1 induced transcript 1 |
|
1 |
199,664,039 |
199,670,970 |
RGD:6480464 |
G |
Tgfb2 |
transforming growth factor, beta 2 |
|
13 |
105,039,639 |
105,142,010 |
RGD:6480464 |
G |
Thra |
thyroid hormone receptor alpha |
|
10 |
86,657,285 |
86,684,935 |
RGD:6480464 |
G |
Tnf |
tumor necrosis factor |
|
20 |
5,189,382 |
5,192,000 |
RGD:6480464 |
G |
Tnfrsf26 |
tumor necrosis factor receptor superfamily, member 26 |
|
1 |
216,808,642 |
216,829,361 |
RGD:6480464 |
G |
Tnfsf10 |
TNF superfamily member 10 |
|
2 |
113,008,008 |
113,026,899 |
RGD:6480464 |
G |
Tnni3 |
troponin I3, cardiac type |
|
1 |
72,882,806 |
72,886,490 |
RGD:6480464 |
G |
Tp53 |
tumor protein p53 |
|
10 |
56,186,299 |
56,198,449 |
RGD:6480464 |
G |
Trib3 |
tribbles pseudokinase 3 |
|
3 |
147,814,056 |
147,819,650 |
RGD:6480464 |
G |
Txn1 |
thioredoxin 1 |
|
5 |
75,049,735 |
75,057,731 |
RGD:6480464 |
G |
Txnrd1 |
thioredoxin reductase 1 |
|
7 |
26,946,124 |
26,984,400 |
RGD:6480464 |
G |
Ucp2 |
uncoupling protein 2 |
|
1 |
165,506,375 |
165,512,744 |
RGD:6480464 |
G |
Vegfa |
vascular endothelial growth factor A |
|
9 |
17,340,341 |
17,355,681 |
RGD:6480464 |
|
G |
Nfe2l2 |
nuclear factor, erythroid 2-like 2 |
|
3 |
62,497,568 |
62,525,146 |
RGD:6480464 |
G |
Txnrd1 |
thioredoxin reductase 1 |
|
7 |
26,946,124 |
26,984,400 |
RGD:6480464 |
G |
Txnrd2 |
thioredoxin reductase 2 |
|
11 |
86,667,994 |
86,716,063 |
RGD:6480464 |
Term paths to the root
|