Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:N(2)-[(2E)-3-methylhex-2-enoyl]-L-glutamine
go back to main search page
Accession:CHEBI:145321 term browser browse the term
Definition:An N(2)-acyl-L-glutamine resulting from the formal condensation of the alpha-amino group of L-glutamine with the carboxy group of (2E)-3-methylhex-2-enoic acid.
Synonyms:related_synonym: Formula=C12H20N2O4;   InChI=1S/C12H20N2O4/c1-3-4-8(2)7-11(16)14-9(12(17)18)5-6-10(13)15/h7,9H,3-6H2,1-2H3,(H2,13,15)(H,14,16)(H,17,18)/b8-7+/t9-/m0/s1;   InChIKey=AUBGCRXOZPJJJG-FLOXNTQESA-N;   N(alpha)-[(2E)-3-methylhex-2-enoyl]-L-glutamine;   SMILES=CCC/C(=C/C(N[C@H](C(O)=O)CCC(N)=O)=O)/C
 xref: MetaCyc:CPD-21074;   PMID:12468539 "SUBMITTER";   PMID:17193210 "SUBMITTER"
 cyclic_relationship: is_conjugate_acid_of CHEBI:143557


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19745
    chemical entity 19743
      atom 19741
        nonmetal atom 19613
          nitrogen atom 18400
            nitrogen molecular entity 18400
              organonitrogen compound 18192
                carboxamide 16809
                  primary carboxamide 3788
                    N(2)-[(2E)-3-methylhex-2-enoyl]-L-glutamine 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19745
    subatomic particle 19741
      composite particle 19741
        hadron 19741
          baryon 19741
            nucleon 19741
              atomic nucleus 19741
                atom 19741
                  main group element atom 19625
                    p-block element atom 19625
                      carbon group element atom 19519
                        carbon atom 19513
                          organic molecular entity 19513
                            organic group 18424
                              organic divalent group 18416
                                organodiyl group 18416
                                  carbonyl group 18304
                                    carbonyl compound 18304
                                      carboxylic acid 17970
                                        amino acid 12446
                                          alpha-amino acid 7652
                                            L-alpha-amino acid 7318
                                              glutamine family amino acid 5349
                                                L-glutamic acid 5250
                                                  L-glutamic acid derivative 3712
                                                    L-glutamine derivative 0
                                                      N(2)-acyl-L-glutamine 0
                                                        N(2)-[(2E)-3-methylhex-2-enoyl]-L-glutamine 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.