Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   


The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at The data is made available under the Creative Commons License (CC BY 3.0, For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

go back to main search page
Accession:CHEBI:141319 term browser browse the term
Definition:A member of the class of dithiocarbamic acids that is dithiocarbamic acid in which a hydrogen attached to the amino group has been replaced by a methyl group. It is used (most widely as the corresponding sodium salt, metam-sodium) as an agricultural pesticide, mainly as a broad spectrum soil fumigant for the control of weeds, nematodes, soil-borne insects and fungi.
Synonyms:exact_synonym: methylcarbamodithioic acid
 related_synonym: Dithiokohlensaeure-methylamid;   Formula=C2H5NS2;   InChI=1S/C2H5NS2/c1-3-2(4)5/h1H3,(H2,3,4,5);   InChIKey=HYVVJDQGXFXBRZ-UHFFFAOYSA-N;   Methyl-dithiocarbamidsaeure;   N-methyldithiocarbamic acid;   SMILES=CNC(=S)S;   methan;   methyl-dithiocarbamic acid;   methyldithiocarbamate;   methyldithiocarbaminic acid
 xref: CAS:144-54-7
 xref_mesh: MESH:C008435
 xref: Pesticides:metam;   Reaxys:1739002
 cyclic_relationship: is_conjugate_acid_of CHEBI:141326

show annotations for term's descendants           Sort by:
metam term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Als2 alsin Rho guanine nucleotide exchange factor ALS2 multiple interactions ISO methyldithiocarbamate affects the reaction [Lipopolysaccharides results in increased expression of ALS2 mRNA] CTD PMID:19339665 NCBI chr 9:65,961,361...66,034,396
Ensembl chr 9:65,961,346...66,033,871
JBrowse link
G Cat catalase multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of CAT mRNA] CTD PMID:19339665 NCBI chr 3:93,379,872...93,412,058
Ensembl chr 3:93,379,874...93,412,058
JBrowse link
G Ccl11 C-C motif chemokine ligand 11 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL11 protein] CTD PMID:24056979 NCBI chr10:69,434,965...69,439,566
Ensembl chr10:69,434,941...69,439,575
JBrowse link
G Ccl2 C-C motif chemokine ligand 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL2 protein] CTD PMID:24056979 NCBI chr10:69,412,065...69,413,863
Ensembl chr10:69,412,017...69,413,870
JBrowse link
G Ccl3 C-C motif chemokine ligand 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of CCL3 protein] CTD PMID:19339665 PMID:24056979 NCBI chr10:70,869,516...70,871,066
Ensembl chr10:70,869,513...70,871,066
JBrowse link
G Ccl4 C-C motif chemokine ligand 4 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL4 protein] CTD PMID:24056979 NCBI chr10:70,870,926...70,886,357
Ensembl chr10:70,884,531...70,886,355
JBrowse link
G Ccl5 C-C motif chemokine ligand 5 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL5 protein] CTD PMID:24056979 NCBI chr10:70,739,764...70,744,303
Ensembl chr10:70,739,800...70,744,315
JBrowse link
G Cd40 CD40 molecule multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of CD40 mRNA] CTD PMID:24056979 NCBI chr 3:161,519,789...161,534,943
Ensembl chr 3:161,519,743...161,534,704
JBrowse link
G Cd55 CD55 molecule (Cromer blood group) multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of CD55 mRNA] CTD PMID:24056979 NCBI chr13:47,125,156...47,153,557
Ensembl chr13:47,126,741...47,154,292
JBrowse link
G Cfb complement factor B multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of CFB mRNA] CTD PMID:24056979 NCBI chr20:4,536,206...4,542,073
Ensembl chr20:4,536,203...4,561,066
Ensembl chr20:4,536,203...4,561,066
JBrowse link
G Clec7a C-type lectin domain containing 7A multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of CLEC7A mRNA] CTD PMID:24056979 NCBI chr 4:163,216,152...163,227,367
Ensembl chr 4:163,216,163...163,227,334
JBrowse link
G Crtam cytotoxic and regulatory T cell molecule multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of CRTAM mRNA] CTD PMID:24056979 NCBI chr 8:45,152,584...45,216,082
Ensembl chr 8:45,153,308...45,215,974
JBrowse link
G Csf2 colony stimulating factor 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of CSF2 mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of CSF2 protein] CTD PMID:19339665 PMID:24056979 NCBI chr10:39,602,089...39,604,070
Ensembl chr10:39,602,089...39,604,070
JBrowse link
G Ctsb cathepsin B multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of CTSB mRNA] CTD PMID:19339665 NCBI chr15:46,316,741...46,337,613
Ensembl chr15:46,316,741...46,337,612
JBrowse link
G Cxcl9 C-X-C motif chemokine ligand 9 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of CXCL9 protein]; methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CXCL9 protein] CTD PMID:16321413 PMID:24056979 NCBI chr14:17,228,832...17,233,743
Ensembl chr14:17,228,856...17,234,712
JBrowse link
G Ddx58 DEXD/H-box helicase 58 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of DDX58 mRNA] CTD PMID:24056979 NCBI chr 5:56,486,584...56,536,898
Ensembl chr 5:56,500,734...56,536,772
JBrowse link
G Dhx58 DEXH-box helicase 58 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of DHX58 mRNA] CTD PMID:24056979 NCBI chr10:88,599,722...88,611,562
Ensembl chr10:88,599,680...88,611,105
JBrowse link
G Eif2ak2 eukaryotic translation initiation factor 2-alpha kinase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of EIF2AK2 mRNA] CTD PMID:24056979 NCBI chr 6:1,428,845...1,466,193
Ensembl chr 6:1,428,834...1,466,201
JBrowse link
G Ereg epiregulin multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of EREG mRNA] CTD PMID:24056979 NCBI chr14:18,577,620...18,591,395
Ensembl chr14:18,576,355...18,591,394
JBrowse link
G Fcgr1a Fc fragment of IgG receptor Ia multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of FCGR1 mRNA] CTD PMID:24056979 NCBI chr 2:198,430,536...198,439,453
Ensembl chr 2:198,430,530...198,458,041
JBrowse link
G Gab1 GRB2-associated binding protein 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of GAB1 mRNA] CTD PMID:19339665 NCBI chr19:30,794,290...30,903,819
Ensembl chr19:30,794,571...30,902,008
JBrowse link
G Gclm glutamate cysteine ligase, modifier subunit multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of GCLM mRNA] CTD PMID:19339665 NCBI chr 2:225,827,504...225,847,876
Ensembl chr 2:225,827,504...225,847,874
JBrowse link
G Gpx3 glutathione peroxidase 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of GPX3 mRNA] CTD PMID:19339665 NCBI chr10:40,247,436...40,255,423
Ensembl chr10:40,247,436...40,255,422
JBrowse link
G Hif1a hypoxia inducible factor 1 subunit alpha multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of HIF1A mRNA] CTD PMID:19339665 NCBI chr 6:96,810,868...96,856,303
Ensembl chr 6:96,810,907...96,856,052
JBrowse link
G Idh1 isocitrate dehydrogenase (NADP(+)) 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IDH1 mRNA] CTD PMID:19339665 NCBI chr 9:71,882,108...71,911,645
Ensembl chr 9:71,882,105...71,900,044
JBrowse link
G Ifih1 interferon induced with helicase C domain 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFIH1 mRNA] CTD PMID:24056979 NCBI chr 3:48,557,696...48,604,097
Ensembl chr 3:48,557,696...48,604,097
JBrowse link
G Ifit2 interferon-induced protein with tetratricopeptide repeats 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFIT2 mRNA] CTD PMID:24056979 NCBI chr 1:252,894,663...252,900,727
Ensembl chr 1:252,894,663...252,900,726
JBrowse link
G Ifit3 interferon-induced protein with tetratricopeptide repeats 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFIT3 mRNA] CTD PMID:24056979 NCBI chr 1:252,906,234...252,911,377
Ensembl chr 1:252,906,234...252,911,382
JBrowse link
G Ifnb1 interferon beta 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IFNB1 mRNA] CTD PMID:24056979 NCBI chr 5:106,865,192...106,865,746
Ensembl chr 5:106,865,192...106,865,746
JBrowse link
G Ifng interferon gamma multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IFNG mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IFNG protein] CTD PMID:15933225 PMID:19339665 NCBI chr 7:61,337,383...61,341,419
Ensembl chr 7:61,337,381...61,341,419
JBrowse link
G Il10 interleukin 10 multiple interactions ISO [Lipopolysaccharides co-treated with methyldithiocarbamate] results in increased expression of IL10 mRNA; [Lipopolysaccharides co-treated with methyldithiocarbamate] results in increased secretion of IL10 protein; [methyldithiocarbamate binds to Copper] promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein]; [Nadolol co-treated with Mifepristone] promotes the reaction [methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein]]; Buthionine Sulfoximine promotes the reaction [methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein]]; methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IL10 mRNA]; methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IL10 protein]; methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein] CTD PMID:15933225 PMID:16321413 PMID:19339665 PMID:24056979 NCBI chr13:47,738,933...47,743,392
Ensembl chr13:47,739,526...47,743,392
JBrowse link
G Il12a interleukin 12A multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL12A mRNA] CTD PMID:15933225 NCBI chr 2:165,076,945...165,083,996
Ensembl chr 2:165,076,607...165,084,318
JBrowse link
G Il12b interleukin 12B multiple interactions ISO [Nadolol co-treated with Mifepristone] inhibits the reaction [methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL12B protein]]; Buthionine Sulfoximine inhibits the reaction [methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL12B protein]]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL12B mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL12B protein]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL12B protein] CTD PMID:15933225 PMID:16321413 PMID:19339665 PMID:24056979 NCBI chr10:30,034,447...30,048,774
Ensembl chr10:30,038,709...30,048,085
JBrowse link
G Il18 interleukin 18 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL18 mRNA] CTD PMID:15933225 NCBI chr 8:55,009,666...55,016,286
Ensembl chr 8:54,993,859...55,016,299
JBrowse link
G Il1a interleukin 1 alpha multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL1A mRNA] CTD PMID:15933225 NCBI chr 3:121,824,712...121,836,122
Ensembl chr 3:121,825,412...121,836,086
JBrowse link
G Il1b interleukin 1 beta multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL1B mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL1B protein] CTD PMID:15933225 PMID:19339665 PMID:24056979 NCBI chr 3:121,876,256...121,882,637
Ensembl chr 3:121,876,263...121,882,726
JBrowse link
G Il6 interleukin 6 multiple interactions ISO Buthionine Sulfoximine inhibits the reaction [methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL6 protein]]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL6 protein] CTD PMID:19339665 NCBI chr 4:3,043,231...3,047,807
Ensembl chr 4:3,043,231...3,047,807
JBrowse link
G Irf3 interferon regulatory factor 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IRF3 mRNA] CTD PMID:24056979 NCBI chr 1:100,992,244...100,997,202
Ensembl chr 1:100,992,405...100,997,198
JBrowse link
G Irf4 interferon regulatory factor 4 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IRF4 mRNA] CTD PMID:24056979 NCBI chr17:34,886,746...34,905,191
Ensembl chr17:34,886,739...34,905,117
JBrowse link
G Irf5 interferon regulatory factor 5 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IRF5 mRNA] CTD PMID:24056979 NCBI chr 4:56,804,477...56,816,271
Ensembl chr 4:56,805,132...56,820,543
JBrowse link
G Irf7 interferon regulatory factor 7 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IRF7 mRNA] CTD PMID:24056979 NCBI chr 1:214,249,388...214,252,909
Ensembl chr 1:214,248,837...214,252,456
JBrowse link
G Irgm immunity-related GTPase M multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IRGM1 mRNA] CTD PMID:24056979 NCBI chr10:34,213,885...34,221,968
Ensembl chr10:34,213,936...34,221,928
JBrowse link
G Isg15 ISG15 ubiquitin-like modifier multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of ISG15 mRNA] CTD PMID:24056979 NCBI chr 5:173,624,862...173,629,124
Ensembl chr 5:173,624,310...173,626,248
JBrowse link
G Klrk1 killer cell lectin like receptor K1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of KLRK1 mRNA] CTD PMID:24056979 NCBI chr 4:163,392,652...163,403,735
Ensembl chr 4:163,393,217...163,403,653
JBrowse link
G Malt1 MALT1 paracaspase multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MALT1 mRNA] CTD PMID:24056979 NCBI chr18:61,108,712...61,162,446
Ensembl chr18:61,109,069...61,162,445
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK1 protein] CTD PMID:15933225 NCBI chr11:88,203,863...88,273,301
Ensembl chr11:88,211,599...88,273,254
JBrowse link
G Mapk14 mitogen activated protein kinase 14 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK14 protein] CTD PMID:15933225 NCBI chr20:5,933,290...5,995,137
Ensembl chr20:5,933,303...5,995,137
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK3 protein] CTD PMID:15933225 NCBI chr 1:198,192,773...198,198,975
Ensembl chr 1:198,192,773...198,198,975
JBrowse link
G Mapk8 mitogen-activated protein kinase 8 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK8 protein] CTD PMID:15933225 NCBI chr16:9,620,854...9,709,342
Ensembl chr16:9,625,177...9,709,347
JBrowse link
G Masp1 MBL associated serine protease 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of MASP1 mRNA] CTD PMID:24056979 NCBI chr11:80,736,424...80,806,278
Ensembl chr11:80,736,576...80,803,382
JBrowse link
G Mbl2 mannose binding lectin 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MBL2 mRNA] CTD PMID:24056979 NCBI chr 1:248,435,069...248,442,669
Ensembl chr 1:248,723,397...248,729,962
JBrowse link
G Mif macrophage migration inhibitory factor multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MIF mRNA] CTD PMID:15933225 NCBI chr20:13,715,219...13,732,980
Ensembl chr20:13,732,198...13,732,859
JBrowse link
G Mnda myeloid cell nuclear differentiation antigen multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFI204 mRNA] CTD PMID:24056979 NCBI chr13:92,073,664...92,091,335
Ensembl chr13:92,073,668...92,089,980
JBrowse link
G Mtf1 metal-regulatory transcription factor 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MTF1 mRNA] CTD PMID:19339665 NCBI chr 5:142,797,340...142,843,896
Ensembl chr 5:142,797,366...142,842,122
JBrowse link
G Mx2 MX dynamin like GTPase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MX1 mRNA] CTD PMID:24056979 NCBI chr11:38,035,306...38,066,185
Ensembl chr11:38,035,450...38,059,950
JBrowse link
G Myd88 MYD88, innate immune signal transduction adaptor multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MYD88 mRNA] CTD PMID:24056979 NCBI chr 8:128,022,512...128,027,462
Ensembl chr 8:128,022,473...128,026,841
JBrowse link
G Myo1f myosin IF multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of MYO1F mRNA] CTD PMID:24056979 NCBI chr 7:18,440,742...18,491,448
Ensembl chr 7:18,440,742...18,491,448
JBrowse link
G Nfkb1 nuclear factor kappa B subunit 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of NFKB1 mRNA] CTD PMID:24056979 NCBI chr 2:240,773,520...240,890,053
Ensembl chr 2:240,773,456...240,866,689
JBrowse link
G Nod1 nucleotide-binding oligomerization domain containing 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of NOD1 mRNA] CTD PMID:24056979 NCBI chr 4:85,123,965...85,175,206
Ensembl chr 4:85,123,960...85,174,951
JBrowse link
G Ppp1r15b protein phosphatase 1, regulatory subunit 15B multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of PPP1R15B mRNA] CTD PMID:19339665 NCBI chr13:49,933,155...49,940,961
Ensembl chr13:49,933,155...49,940,961
JBrowse link
G Prdx1 peroxiredoxin 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of PRDX1 mRNA] CTD PMID:19339665 NCBI chr 5:135,536,413...135,551,986
Ensembl chr 5:135,536,413...135,551,990
JBrowse link
G Prnp prion protein multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of PRNP mRNA] CTD PMID:19339665 NCBI chr 3:124,515,917...124,531,320
Ensembl chr 3:124,515,978...124,531,316
JBrowse link
G Psmb5 proteasome 20S subunit beta 5 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of PSMB5 mRNA] CTD PMID:19339665 NCBI chr15:33,259,039...33,263,634
Ensembl chr15:33,259,043...33,263,659
JBrowse link
G Ripk2 receptor-interacting serine-threonine kinase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of RIPK2 mRNA] CTD PMID:24056979 NCBI chr 5:29,838,713...29,870,390
Ensembl chr 5:29,838,747...29,870,735
JBrowse link
G Sod2 superoxide dismutase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of SOD2 mRNA] CTD PMID:19339665 NCBI chr 1:47,914,757...47,921,587
Ensembl chr 1:47,914,759...47,921,587
JBrowse link
G Srxn1 sulfiredoxin 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of SRXN1 mRNA] CTD PMID:19339665 NCBI chr 3:147,608,850...147,614,410
Ensembl chr 3:147,609,095...147,632,801
JBrowse link
G Stat1 signal transducer and activator of transcription 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of STAT1 mRNA] CTD PMID:24056979 NCBI chr 9:54,287,540...54,327,958
Ensembl chr 9:54,287,541...54,484,533
JBrowse link
G Stat5a signal transducer and activator of transcription 5A multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of STAT5A mRNA] CTD PMID:24056979 NCBI chr10:88,764,732...88,789,060
Ensembl chr10:88,764,732...88,789,057
JBrowse link
G Tirap TIR domain containing adaptor protein multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of TIRAP mRNA] CTD PMID:24056979 NCBI chr 8:36,382,029...36,399,625
Ensembl chr 8:36,385,353...36,388,224
JBrowse link
G Tlr3 toll-like receptor 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of TLR3 mRNA] CTD PMID:24056979 NCBI chr16:50,016,466...50,031,011
Ensembl chr16:50,016,857...50,031,214
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of TNF protein] CTD PMID:19339665 NCBI chr20:5,189,382...5,192,000
Ensembl chr20:5,189,390...5,192,000
JBrowse link
G Tor1aip2 torsin 1A interacting protein 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of TOR1AIP2 mRNA] CTD PMID:24056979 NCBI chr13:73,704,088...73,735,339
Ensembl chr13:73,708,815...73,735,339
Ensembl chr13:73,708,815...73,735,339
JBrowse link
G Txnrd2 thioredoxin reductase 2 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of TXNRD2 mRNA] CTD PMID:19339665 NCBI chr11:86,667,994...86,716,063
Ensembl chr11:86,667,997...86,716,254
JBrowse link
G Uba1 ubiquitin-like modifier activating enzyme 1 multiple interactions ISO methyldithiocarbamate results in increased activity of and results in increased ubiquitination of UBA1 protein CTD PMID:25714994 NCBI chr  X:1,723,135...1,745,147
Ensembl chr  X:1,723,174...1,741,701
JBrowse link
G Xpa XPA, DNA damage recognition and repair factor multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of XPA mRNA] CTD PMID:19339665 NCBI chr 5:61,749,767...61,793,641
Ensembl chr 5:61,749,767...61,792,928
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19883
    role 19833
      application 19505
        pro-agent 8876
          propesticide 991
            proinsecticide 988
              metam 75
Path 2
Term Annotations click to browse term
  CHEBI ontology 19883
    subatomic particle 19881
      composite particle 19881
        hadron 19881
          baryon 19881
            nucleon 19881
              atomic nucleus 19881
                atom 19881
                  main group element atom 19771
                    p-block element atom 19771
                      carbon group element atom 19679
                        carbon atom 19668
                          organic molecular entity 19668
                            heteroorganic entity 19257
                              organochalcogen compound 18964
                                organosulfur compound 15254
                                  organosulfur pesticide 75
                                    organosulfur insecticide 75
                                      metam 75
paths to the root