Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:metam
go back to main search page
Accession:CHEBI:141319 term browser browse the term
Definition:A member of the class of dithiocarbamic acids that is dithiocarbamic acid in which a hydrogen attached to the amino group has been replaced by a methyl group. It is used (most widely as the corresponding sodium salt, metam-sodium) as an agricultural pesticide, mainly as a broad spectrum soil fumigant for the control of weeds, nematodes, soil-borne insects and fungi.
Synonyms:exact_synonym: methylcarbamodithioic acid
 related_synonym: Dithiokohlensaeure-methylamid;   Formula=C2H5NS2;   InChI=1S/C2H5NS2/c1-3-2(4)5/h1H3,(H2,3,4,5);   InChIKey=HYVVJDQGXFXBRZ-UHFFFAOYSA-N;   Methyl-dithiocarbamidsaeure;   N-methyldithiocarbamic acid;   SMILES=CNC(=S)S;   methan;   methyl-dithiocarbamic acid;   methyldithiocarbamate;   methyldithiocarbaminic acid
 xref: CAS:144-54-7
 xref_mesh: MESH:C008435
 xref: Pesticides:metam;   Reaxys:1739002
 cyclic_relationship: is_conjugate_acid_of CHEBI:141326



show annotations for term's descendants           Sort by:
 
metam term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Als2 alsin Rho guanine nucleotide exchange factor ALS2 multiple interactions ISO methyldithiocarbamate affects the reaction [Lipopolysaccharides results in increased expression of ALS2 mRNA] CTD PMID:19339665 NCBI chr 9:60,613,182...60,686,394
Ensembl chr 9:60,613,167...60,670,737
JBrowse link
G Cat catalase multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of CAT mRNA] CTD PMID:19339665 NCBI chr 3:89,842,393...89,874,577
Ensembl chr 3:89,842,399...89,874,478
JBrowse link
G Ccl11 C-C motif chemokine ligand 11 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL11 protein] CTD PMID:24056979 NCBI chr10:67,028,328...67,032,929
Ensembl chr10:67,028,328...67,032,926
JBrowse link
G Ccl2 C-C motif chemokine ligand 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL2 protein] CTD PMID:24056979 NCBI chr10:67,005,424...67,007,222
Ensembl chr10:67,005,424...67,007,226
JBrowse link
G Ccl3 C-C motif chemokine ligand 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of CCL3 protein] CTD PMID:19339665 PMID:24056979 NCBI chr10:68,451,388...68,452,938
Ensembl chr10:68,451,388...68,452,938
JBrowse link
G Ccl4 C-C motif chemokine ligand 4 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL4 protein] CTD PMID:24056979 NCBI chr10:68,466,469...68,467,941
Ensembl chr10:68,452,052...68,468,231
JBrowse link
G Ccl5 C-C motif chemokine ligand 5 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CCL5 protein] CTD PMID:24056979 NCBI chr10:68,322,826...68,327,365
Ensembl chr10:68,322,829...68,327,377
JBrowse link
G Cd40 CD40 molecule multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of CD40 mRNA] CTD PMID:24056979 NCBI chr 3:153,790,372...153,805,279
Ensembl chr 3:153,790,449...153,805,534
JBrowse link
G Cd55 CD55 molecule (Cromer blood group) multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of CD55 mRNA] CTD PMID:24056979 NCBI chr13:41,857,242...41,885,966
Ensembl chr13:41,857,395...41,885,831
JBrowse link
G Cfb complement factor B multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of CFB mRNA] CTD PMID:24056979 NCBI chr20:3,970,643...3,976,510 JBrowse link
G Clec7a C-type lectin domain containing 7A multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of CLEC7A mRNA] CTD PMID:24056979 NCBI chr 4:162,902,731...162,913,931
Ensembl chr 4:162,902,732...162,913,897
JBrowse link
G Crtam cytotoxic and regulatory T cell molecule multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of CRTAM mRNA] CTD PMID:24056979 NCBI chr 8:41,340,117...41,377,343
Ensembl chr 8:41,340,837...41,377,343
JBrowse link
G Csf2 colony stimulating factor 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of CSF2 mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of CSF2 protein] CTD PMID:19339665 PMID:24056979 NCBI chr10:38,386,945...38,388,926
Ensembl chr10:38,386,945...38,389,199
JBrowse link
G Ctsb cathepsin B multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of CTSB mRNA] CTD PMID:19339665 NCBI chr15:37,389,636...37,410,508
Ensembl chr15:37,389,629...37,410,500
JBrowse link
G Cxcl9 C-X-C motif chemokine ligand 9 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of CXCL9 protein]; methyldithiocarbamate inhibits the reaction [Poly I-C results in increased secretion of CXCL9 protein] CTD PMID:16321413 PMID:24056979 NCBI chr14:15,722,868...15,727,779
Ensembl chr14:15,722,908...15,728,435
JBrowse link
G Ddx58 DEXD/H-box helicase 58 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of DDX58 mRNA] CTD PMID:24056979 NCBI chr 5:55,321,229...55,369,947
Ensembl chr 5:55,321,235...55,370,819
JBrowse link
G Dhx58 DEXH-box helicase 58 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of DHX58 mRNA] CTD PMID:24056979 NCBI chr10:85,620,352...85,631,776
Ensembl chr10:85,620,357...85,631,525
JBrowse link
G Eif2ak2 eukaryotic translation initiation factor 2-alpha kinase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of EIF2AK2 mRNA] CTD PMID:24056979 NCBI chr 6:16,189,000...16,224,972
Ensembl chr 6:16,188,979...16,224,971
JBrowse link
G Ereg epiregulin multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of EREG mRNA] CTD PMID:24056979 NCBI chr14:17,027,287...17,041,062
Ensembl chr14:17,027,287...17,041,062
JBrowse link
G Fcgr1a Fc gamma receptor Ia multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of FCGR1 mRNA] CTD PMID:24056979 NCBI chr 2:183,851,075...183,860,077
Ensembl chr 2:183,851,077...183,859,994
JBrowse link
G Gab1 GRB2-associated binding protein 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of GAB1 mRNA] CTD PMID:19339665 NCBI chr19:27,131,262...27,239,236
Ensembl chr19:27,131,262...27,239,236
JBrowse link
G Gclm glutamate cysteine ligase, modifier subunit multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of GCLM mRNA] CTD PMID:19339665 NCBI chr 2:210,347,482...210,367,537
Ensembl chr 2:210,347,482...210,367,535
JBrowse link
G Gpx3 glutathione peroxidase 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of GPX3 mRNA] CTD PMID:19339665 NCBI chr10:39,028,624...39,036,695
Ensembl chr10:39,028,570...39,037,035
JBrowse link
G Hif1a hypoxia inducible factor 1 subunit alpha multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of HIF1A mRNA] CTD PMID:19339665 NCBI chr 6:92,624,059...92,669,262
Ensembl chr 6:92,624,390...92,669,261
JBrowse link
G Idh1 isocitrate dehydrogenase (NADP(+)) 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IDH1 mRNA] CTD PMID:19339665 NCBI chr 9:66,534,146...66,563,703
Ensembl chr 9:66,534,146...66,563,708
JBrowse link
G Ifih1 interferon induced with helicase C domain 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFIH1 mRNA] CTD PMID:24056979 NCBI chr 3:47,228,980...47,275,403
Ensembl chr 3:47,227,364...47,275,456
JBrowse link
G Ifit1 interferon-induced protein with tetratricopeptide repeats 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFIT1 mRNA] CTD PMID:24056979 NCBI chr 1:232,152,038...232,154,103
Ensembl chr 1:232,127,170...232,154,435
JBrowse link
G Ifit2 interferon-induced protein with tetratricopeptide repeats 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFIT2 mRNA] CTD PMID:24056979 NCBI chr 1:232,102,570...232,108,638
Ensembl chr 1:232,102,570...232,108,635
JBrowse link
G Ifit3 interferon-induced protein with tetratricopeptide repeats 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFIT3 mRNA] CTD PMID:24056979 NCBI chr 1:232,114,166...232,119,311
Ensembl chr 1:232,114,166...232,119,307
JBrowse link
G Ifnb1 interferon beta 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IFNB1 mRNA] CTD PMID:24056979 NCBI chr 5:103,020,969...103,021,523
Ensembl chr 5:103,020,969...103,021,523
JBrowse link
G Ifng interferon gamma multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IFNG mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IFNG protein] CTD PMID:15933225 PMID:19339665 NCBI chr 7:53,903,339...53,907,375
Ensembl chr 7:53,903,337...53,907,375
JBrowse link
G Il10 interleukin 10 multiple interactions ISO [Lipopolysaccharides co-treated with methyldithiocarbamate] results in increased expression of IL10 mRNA; [Lipopolysaccharides co-treated with methyldithiocarbamate] results in increased secretion of IL10 protein; [methyldithiocarbamate binds to Copper] promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein]; [Nadolol co-treated with Mifepristone] promotes the reaction [methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein]]; Buthionine Sulfoximine promotes the reaction [methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein]]; methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IL10 mRNA]; methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of IL10 protein]; methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased secretion of IL10 protein] CTD PMID:15933225 PMID:16321413 PMID:19339665 PMID:24056979 NCBI chr13:42,472,625...42,477,308
Ensembl chr13:42,472,839...42,477,313
JBrowse link
G Il12a interleukin 12A multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL12A mRNA] CTD PMID:15933225 NCBI chr 2:152,965,769...152,973,035
Ensembl chr 2:152,965,769...152,972,734
JBrowse link
G Il12b interleukin 12B multiple interactions ISO [Nadolol co-treated with Mifepristone] inhibits the reaction [methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL12B protein]]; Buthionine Sulfoximine inhibits the reaction [methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL12B protein]]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL12B mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL12B protein]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL12B protein] CTD PMID:15933225 PMID:16321413 PMID:19339665 PMID:24056979 NCBI chr10:28,888,832...28,903,796
Ensembl chr10:28,893,008...28,902,903
JBrowse link
G Il18 interleukin 18 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL18 mRNA] CTD PMID:15933225 NCBI chr 8:50,904,630...50,932,887
Ensembl chr 8:50,906,960...50,932,887
JBrowse link
G Il1a interleukin 1 alpha multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL1A mRNA] CTD PMID:15933225 NCBI chr 3:116,526,601...116,537,055
Ensembl chr 3:116,526,604...116,536,822
JBrowse link
G Il1b interleukin 1 beta multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IL1B mRNA]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL1B protein] CTD PMID:15933225 PMID:19339665 PMID:24056979 NCBI chr 3:116,577,005...116,583,386
Ensembl chr 3:116,577,010...116,583,415
JBrowse link
G Il6 interleukin 6 multiple interactions ISO Buthionine Sulfoximine inhibits the reaction [methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL6 protein]]; methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of IL6 protein] CTD PMID:19339665 NCBI chr 4:5,214,602...5,219,178
Ensembl chr 4:5,213,394...5,219,178
JBrowse link
G Irf3 interferon regulatory factor 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IRF3 mRNA] CTD PMID:24056979 NCBI chr 1:95,479,966...95,484,926
Ensembl chr 1:95,479,821...95,484,935
JBrowse link
G Irf4 interferon regulatory factor 4 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IRF4 mRNA] CTD PMID:24056979 NCBI chr17:33,721,800...33,742,570
Ensembl chr17:33,721,811...33,740,070
JBrowse link
G Irf5 interferon regulatory factor 5 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IRF5 mRNA] CTD PMID:24056979 NCBI chr 4:58,127,577...58,140,665
Ensembl chr 4:58,127,640...58,139,267
JBrowse link
G Irf7 interferon regulatory factor 7 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IRF7 mRNA] CTD PMID:24056979 NCBI chr 1:196,367,380...196,370,943
Ensembl chr 1:196,367,361...196,370,832
JBrowse link
G Irgm immunity-related GTPase M multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of IRGM1 mRNA] CTD PMID:24056979 NCBI chr10:33,233,513...33,241,594
Ensembl chr10:33,233,455...33,241,578
JBrowse link
G Isg15 ISG15 ubiquitin-like modifier multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of ISG15 mRNA] CTD PMID:24056979 NCBI chr 5:166,784,148...166,785,435
Ensembl chr 5:166,784,148...166,785,435
JBrowse link
G Klrk1 killer cell lectin like receptor K1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of KLRK1 mRNA] CTD PMID:24056979 NCBI chr 4:163,079,887...163,092,434
Ensembl chr 4:163,081,927...163,092,459
JBrowse link
G Malt1 MALT1 paracaspase multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MALT1 mRNA] CTD PMID:24056979 NCBI chr18:58,942,282...58,996,318
Ensembl chr18:58,942,299...58,994,260
JBrowse link
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK1 protein] CTD PMID:15933225 NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616
JBrowse link
G Mapk14 mitogen activated protein kinase 14 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK14 protein] CTD PMID:15933225 NCBI chr20:6,749,646...6,810,590
Ensembl chr20:6,749,670...6,810,589
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK3 protein] CTD PMID:15933225 NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
JBrowse link
G Mapk8 mitogen-activated protein kinase 8 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased phosphorylation of MAPK8 protein] CTD PMID:15933225 NCBI chr16:8,638,897...8,721,960
Ensembl chr16:8,638,924...8,721,981
JBrowse link
G Masp1 MBL associated serine protease 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of MASP1 mRNA] CTD PMID:24056979 NCBI chr11:77,334,794...77,405,271
Ensembl chr11:77,334,859...77,402,974
JBrowse link
G Mbl2 mannose binding lectin 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MBL2 mRNA] CTD PMID:24056979 NCBI chr 1:228,016,439...228,024,736 JBrowse link
G Mif macrophage migration inhibitory factor multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MIF mRNA] CTD PMID:15933225 NCBI chr20:12,790,919...12,791,784
Ensembl chr20:12,790,902...12,799,504
JBrowse link
G Mnda myeloid cell nuclear differentiation antigen multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of IFI204 mRNA] CTD PMID:24056979 NCBI chr13:86,017,888...86,035,556
Ensembl chr13:86,017,892...86,034,201
JBrowse link
G Mtf1 metal-regulatory transcription factor 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MTF1 mRNA] CTD PMID:19339665 NCBI chr 5:137,062,319...137,107,136
Ensembl chr 5:137,062,376...137,107,136
JBrowse link
G Mx1 MX dynamin like GTPase 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MX1 mRNA] CTD PMID:24056979 NCBI chr11:36,799,659...36,825,209
Ensembl chr11:36,799,660...36,823,507
JBrowse link
G Mx2 MX dynamin like GTPase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MX2 mRNA] CTD PMID:24056979 NCBI chr11:36,905,698...36,936,308
Ensembl chr11:36,906,111...36,930,342
JBrowse link
G Myd88 MYD88, innate immune signal transduction adaptor multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of MYD88 mRNA] CTD PMID:24056979 NCBI chr 8:119,074,439...119,078,508
Ensembl chr 8:119,074,437...119,079,415
JBrowse link
G Myo1f myosin IF multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in decreased expression of MYO1F mRNA] CTD PMID:24056979 NCBI chr 7:14,363,340...14,413,911
Ensembl chr 7:14,363,350...14,413,911
JBrowse link
G Nfkb1 nuclear factor kappa B subunit 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of NFKB1 mRNA] CTD PMID:24056979 NCBI chr 2:224,016,214...224,132,135
Ensembl chr 2:224,016,214...224,110,404
JBrowse link
G Nod1 nucleotide-binding oligomerization domain containing 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of NOD1 mRNA] CTD PMID:24056979 NCBI chr 4:84,060,871...84,111,668
Ensembl chr 4:84,060,880...84,111,404
JBrowse link
G Ppp1r15b protein phosphatase 1, regulatory subunit 15B multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of PPP1R15B mRNA] CTD PMID:19339665 NCBI chr13:44,577,840...44,585,737
Ensembl chr13:44,577,932...44,585,737
JBrowse link
G Prdx1 peroxiredoxin 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of PRDX1 mRNA] CTD PMID:19339665 NCBI chr 5:130,147,276...130,162,850
Ensembl chr 5:130,147,204...130,162,856
JBrowse link
G Prnp prion protein multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of PRNP mRNA] CTD PMID:19339665 NCBI chr 3:119,186,073...119,201,513
Ensembl chr 3:119,177,485...119,203,937
JBrowse link
G Psmb5 proteasome 20S subunit beta 5 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of PSMB5 mRNA] CTD PMID:19339665 NCBI chr15:28,072,772...28,077,367
Ensembl chr15:28,072,781...28,077,440
JBrowse link
G Ripk2 receptor-interacting serine-threonine kinase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of RIPK2 mRNA] CTD PMID:24056979 NCBI chr 5:29,630,806...29,662,804
Ensembl chr 5:29,631,570...29,662,657
JBrowse link
G Sod2 superoxide dismutase 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of SOD2 mRNA] CTD PMID:19339665 NCBI chr 1:47,638,318...47,645,163
Ensembl chr 1:47,636,528...47,645,189
JBrowse link
G Srxn1 sulfiredoxin 1 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of SRXN1 mRNA] CTD PMID:19339665 NCBI chr 3:140,604,490...140,610,050
Ensembl chr 3:140,599,608...140,628,448
JBrowse link
G Stat1 signal transducer and activator of transcription 1 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of STAT1 mRNA] CTD PMID:24056979 NCBI chr 9:49,419,561...49,459,969 JBrowse link
G Stat5a signal transducer and activator of transcription 5A multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of STAT5A mRNA] CTD PMID:24056979 NCBI chr10:85,785,537...85,809,869
Ensembl chr10:85,785,537...85,809,866
JBrowse link
G Tirap TIR domain containing adaptor protein multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of TIRAP mRNA] CTD PMID:24056979 NCBI chr 8:33,531,724...33,548,508
Ensembl chr 8:33,531,725...33,547,432
JBrowse link
G Tlr3 toll-like receptor 3 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased expression of TLR3 mRNA] CTD PMID:24056979 NCBI chr16:46,821,980...46,837,900
Ensembl chr16:46,822,039...46,836,545
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides results in increased secretion of TNF protein] CTD PMID:19339665 NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629
JBrowse link
G Tor1aip2 torsin 1A interacting protein 2 multiple interactions ISO methyldithiocarbamate inhibits the reaction [Lipopolysaccharides affects the expression of TOR1AIP2 mRNA] CTD PMID:24056979 NCBI chr13:68,225,226...68,256,536
Ensembl chr13:68,230,009...68,256,536
Ensembl chr13:68,230,009...68,256,536
JBrowse link
G Txnrd2 thioredoxin reductase 2 multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of TXNRD2 mRNA] CTD PMID:19339665 NCBI chr11:82,519,996...82,568,156
Ensembl chr11:82,519,999...82,568,156
JBrowse link
G Uba1 ubiquitin-like modifier activating enzyme 1 multiple interactions ISO methyldithiocarbamate results in increased activity of and results in increased ubiquitination of UBA1 protein CTD PMID:25714994 NCBI chr  X:1,508,700...1,530,677
Ensembl chr  X:1,508,666...1,530,636
JBrowse link
G Xpa XPA, DNA damage recognition and repair factor multiple interactions ISO methyldithiocarbamate promotes the reaction [Lipopolysaccharides results in increased expression of XPA mRNA] CTD PMID:19339665 NCBI chr 5:60,431,673...60,476,438
Ensembl chr 5:60,431,673...60,475,726
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19800
    role 19751
      application 19498
        pro-agent 10115
          propesticide 1013
            proinsecticide 1010
              metam 77
Path 2
Term Annotations click to browse term
  CHEBI ontology 19800
    subatomic particle 19799
      composite particle 19799
        hadron 19799
          baryon 19799
            nucleon 19799
              atomic nucleus 19799
                atom 19799
                  main group element atom 19698
                    p-block element atom 19698
                      carbon group element atom 19619
                        carbon atom 19609
                          organic molecular entity 19609
                            heteroorganic entity 19278
                              organochalcogen compound 19052
                                organosulfur compound 15318
                                  organosulfur pesticide 636
                                    organosulfur insecticide 77
                                      metam 77
paths to the root