Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:(2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate
go back to main search page
Accession:CHEBI:140652 term browser browse the term
Synonyms:related_synonym: Formula=C12H9N2O2;   InChI=1S/C12H10N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,14H,6H2,(H,15,16)/p-1/t11-/m0/s1;   InChIKey=UBSZGFBFCQBSCZ-NSHDSACASA-M;   L-tryptophan isonitrile;   SMILES=C1(=CNC2=C1C=CC=C2)C[C@@H](C(=O)[O-])[N+]#[C-]
 xref: MetaCyc:CPD-20766;   PMID:16206308;   PMID:16217820;   PMID:24180436;   PMID:28212039


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          carbon atom 0
            organic molecular entity 0
              (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        amino acid 0
                                          alpha-amino acid 0
                                            L-alpha-amino acid 0
                                              erythrose 4-phosphate/phosphoenolpyruvate family amino acid 0
                                                L-tryptophan 0
                                                  (2S)-3-(1H-indol-3-yl)-2-isocyanopropanoate 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.